From 9a72a428da1a46010ccafa87d47f4bd80512eae6 Mon Sep 17 00:00:00 2001 From: Karen Wong Date: Tue, 20 May 2025 18:13:47 -0700 Subject: [PATCH] [Audit Logs] API documentation update for api_call_logging --- openapi.yaml | 45712 ++++++++++++++++++++++++++++++++++--------------- 1 file changed, 31982 insertions(+), 13730 deletions(-) diff --git a/openapi.yaml b/openapi.yaml index 813a8a83..053f65ed 100644 --- a/openapi.yaml +++ b/openapi.yaml @@ -13,6 +13,8 @@ info: url: https://github.com/openai/openai-openapi/blob/master/LICENSE servers: - url: https://api.openai.com/v1 +security: + - ApiKeyAuth: [] tags: - name: Assistants description: Build Assistants that can call models and use tools. @@ -28,8 +30,12 @@ tags: - name: Embeddings description: Get a vector representation of a given input that can be easily consumed by machine learning models and algorithms. + - name: Evals + description: Manage and run evals in the OpenAI platform. - name: Fine-tuning description: Manage fine-tuning jobs to tailor a model to your specific training data. + - name: Graders + description: Manage and run graders in the OpenAI platform. - name: Batch description: Create large batches of API requests to run asynchronously. - name: Files @@ -631,7 +637,7 @@ paths: -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "Content-Type: application/json" \ -d '{ - "model": "tts-1", + "model": "gpt-4o-mini-tts", "input": "The quick brown fox jumped over the lazy dog.", "voice": "alloy" }' \ @@ -641,13 +647,13 @@ paths: import openai speech_file_path = Path(__file__).parent / "speech.mp3" - response = openai.audio.speech.create( - model="tts-1", + with openai.audio.speech.with_streaming_response.create( + model="gpt-4o-mini-tts", voice="alloy", input="The quick brown fox jumped over the lazy dog." - ) - response.stream_to_file(speech_file_path) - node: > + ) as response: + response.stream_to_file(speech_file_path) + javascript: > import fs from "fs"; import path from "path"; @@ -663,7 +669,7 @@ paths: async function main() { const mp3 = await openai.audio.speech.create({ - model: "tts-1", + model: "gpt-4o-mini-tts", voice: "alloy", input: "Today is a wonderful day to build something people love!", }); @@ -673,6 +679,24 @@ paths: } main(); + csharp: | + using System; + using System.IO; + + using OpenAI.Audio; + + AudioClient client = new( + model: "gpt-4o-mini-tts", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + BinaryData speech = client.GenerateSpeech( + text: "The quick brown fox jumped over the lazy dog.", + voice: GeneratedSpeechVoice.Alloy + ); + + using FileStream stream = File.OpenWrite("speech.mp3"); + speech.ToStream().CopyTo(stream); /audio/transcriptions: post: operationId: createTranscription @@ -694,12 +718,17 @@ paths: oneOf: - $ref: "#/components/schemas/CreateTranscriptionResponseJson" - $ref: "#/components/schemas/CreateTranscriptionResponseVerboseJson" + text/event-stream: + schema: + $ref: "#/components/schemas/CreateTranscriptionResponseStreamEvent" x-oaiMeta: name: Create transcription group: audio - returns: The [transcription object](/docs/api-reference/audio/json-object) or a + returns: The [transcription object](/docs/api-reference/audio/json-object), a [verbose transcription - object](/docs/api-reference/audio/verbose-json-object). + object](/docs/api-reference/audio/verbose-json-object) or a [stream of + transcript + events](/docs/api-reference/audio/transcript-text-delta-event). examples: - title: Default request: @@ -708,17 +737,17 @@ paths: -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "Content-Type: multipart/form-data" \ -F file="@/path/to/file/audio.mp3" \ - -F model="whisper-1" + -F model="gpt-4o-transcribe" python: | from openai import OpenAI client = OpenAI() audio_file = open("speech.mp3", "rb") transcript = client.audio.transcriptions.create( - model="whisper-1", + model="gpt-4o-transcribe", file=audio_file ) - node: > + javascript: > import fs from "fs"; import OpenAI from "openai"; @@ -730,17 +759,228 @@ paths: async function main() { const transcription = await openai.audio.transcriptions.create({ file: fs.createReadStream("audio.mp3"), - model: "whisper-1", + model: "gpt-4o-transcribe", }); console.log(transcription.text); } main(); + csharp: > + using System; + + + using OpenAI.Audio; + + string audioFilePath = "audio.mp3"; + + + AudioClient client = new( + model: "gpt-4o-transcribe", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + AudioTranscription transcription = + client.TranscribeAudio(audioFilePath); + + + Console.WriteLine($"{transcription.Text}"); response: > { "text": "Imagine the wildest idea that you've ever had, and you're curious about how it might scale to something that's a 100, a 1,000 times bigger. This is a place where you can get to do that." } + - title: Streaming + request: + curl: | + curl https://api.openai.com/v1/audio/transcriptions \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: multipart/form-data" \ + -F file="@/path/to/file/audio.mp3" \ + -F model="gpt-4o-mini-transcribe" \ + -F stream=true + python: | + from openai import OpenAI + client = OpenAI() + + audio_file = open("speech.mp3", "rb") + stream = client.audio.transcriptions.create( + file=audio_file, + model="gpt-4o-mini-transcribe", + stream=True + ) + + for event in stream: + print(event) + javascript: | + import fs from "fs"; + import OpenAI from "openai"; + + const openai = new OpenAI(); + + const stream = await openai.audio.transcriptions.create({ + file: fs.createReadStream("audio.mp3"), + model: "gpt-4o-mini-transcribe", + stream: true, + }); + + for await (const event of stream) { + console.log(event); + } + response: | + data: {"type":"transcript.text.delta","delta":"I","logprobs":[{"token":"I","logprob":-0.00007588794,"bytes":[73]}]} + + data: {"type":"transcript.text.delta","delta":" see","logprobs":[{"token":" see","logprob":-3.1281633e-7,"bytes":[32,115,101,101]}]} + + data: {"type":"transcript.text.delta","delta":" skies","logprobs":[{"token":" skies","logprob":-2.3392786e-6,"bytes":[32,115,107,105,101,115]}]} + + data: {"type":"transcript.text.delta","delta":" of","logprobs":[{"token":" of","logprob":-3.1281633e-7,"bytes":[32,111,102]}]} + + data: {"type":"transcript.text.delta","delta":" blue","logprobs":[{"token":" blue","logprob":-1.0280384e-6,"bytes":[32,98,108,117,101]}]} + + data: {"type":"transcript.text.delta","delta":" and","logprobs":[{"token":" and","logprob":-0.0005108566,"bytes":[32,97,110,100]}]} + + data: {"type":"transcript.text.delta","delta":" clouds","logprobs":[{"token":" clouds","logprob":-1.9361265e-7,"bytes":[32,99,108,111,117,100,115]}]} + + data: {"type":"transcript.text.delta","delta":" of","logprobs":[{"token":" of","logprob":-1.9361265e-7,"bytes":[32,111,102]}]} + + data: {"type":"transcript.text.delta","delta":" white","logprobs":[{"token":" white","logprob":-7.89631e-7,"bytes":[32,119,104,105,116,101]}]} + + data: {"type":"transcript.text.delta","delta":",","logprobs":[{"token":",","logprob":-0.0014890312,"bytes":[44]}]} + + data: {"type":"transcript.text.delta","delta":" the","logprobs":[{"token":" the","logprob":-0.0110956915,"bytes":[32,116,104,101]}]} + + data: {"type":"transcript.text.delta","delta":" bright","logprobs":[{"token":" bright","logprob":0.0,"bytes":[32,98,114,105,103,104,116]}]} + + data: {"type":"transcript.text.delta","delta":" blessed","logprobs":[{"token":" blessed","logprob":-0.000045848617,"bytes":[32,98,108,101,115,115,101,100]}]} + + data: {"type":"transcript.text.delta","delta":" days","logprobs":[{"token":" days","logprob":-0.000010802739,"bytes":[32,100,97,121,115]}]} + + data: {"type":"transcript.text.delta","delta":",","logprobs":[{"token":",","logprob":-0.00001700133,"bytes":[44]}]} + + data: {"type":"transcript.text.delta","delta":" the","logprobs":[{"token":" the","logprob":-0.0000118755715,"bytes":[32,116,104,101]}]} + + data: {"type":"transcript.text.delta","delta":" dark","logprobs":[{"token":" dark","logprob":-5.5122365e-7,"bytes":[32,100,97,114,107]}]} + + data: {"type":"transcript.text.delta","delta":" sacred","logprobs":[{"token":" sacred","logprob":-5.4385737e-6,"bytes":[32,115,97,99,114,101,100]}]} + + data: {"type":"transcript.text.delta","delta":" nights","logprobs":[{"token":" nights","logprob":-4.00813e-6,"bytes":[32,110,105,103,104,116,115]}]} + + data: {"type":"transcript.text.delta","delta":",","logprobs":[{"token":",","logprob":-0.0036910512,"bytes":[44]}]} + + data: {"type":"transcript.text.delta","delta":" and","logprobs":[{"token":" and","logprob":-0.0031903093,"bytes":[32,97,110,100]}]} + + data: {"type":"transcript.text.delta","delta":" I","logprobs":[{"token":" I","logprob":-1.504853e-6,"bytes":[32,73]}]} + + data: {"type":"transcript.text.delta","delta":" think","logprobs":[{"token":" think","logprob":-4.3202e-7,"bytes":[32,116,104,105,110,107]}]} + + data: {"type":"transcript.text.delta","delta":" to","logprobs":[{"token":" to","logprob":-1.9361265e-7,"bytes":[32,116,111]}]} + + data: {"type":"transcript.text.delta","delta":" myself","logprobs":[{"token":" myself","logprob":-1.7432603e-6,"bytes":[32,109,121,115,101,108,102]}]} + + data: {"type":"transcript.text.delta","delta":",","logprobs":[{"token":",","logprob":-0.29254505,"bytes":[44]}]} + + data: {"type":"transcript.text.delta","delta":" what","logprobs":[{"token":" what","logprob":-0.016815351,"bytes":[32,119,104,97,116]}]} + + data: {"type":"transcript.text.delta","delta":" a","logprobs":[{"token":" a","logprob":-3.1281633e-7,"bytes":[32,97]}]} + + data: {"type":"transcript.text.delta","delta":" wonderful","logprobs":[{"token":" wonderful","logprob":-2.1008714e-6,"bytes":[32,119,111,110,100,101,114,102,117,108]}]} + + data: {"type":"transcript.text.delta","delta":" world","logprobs":[{"token":" world","logprob":-8.180258e-6,"bytes":[32,119,111,114,108,100]}]} + + data: {"type":"transcript.text.delta","delta":".","logprobs":[{"token":".","logprob":-0.014231676,"bytes":[46]}]} + + data: {"type":"transcript.text.done","text":"I see skies of blue and clouds of white, the bright blessed days, the dark sacred nights, and I think to myself, what a wonderful world.","logprobs":[{"token":"I","logprob":-0.00007588794,"bytes":[73]},{"token":" see","logprob":-3.1281633e-7,"bytes":[32,115,101,101]},{"token":" skies","logprob":-2.3392786e-6,"bytes":[32,115,107,105,101,115]},{"token":" of","logprob":-3.1281633e-7,"bytes":[32,111,102]},{"token":" blue","logprob":-1.0280384e-6,"bytes":[32,98,108,117,101]},{"token":" and","logprob":-0.0005108566,"bytes":[32,97,110,100]},{"token":" clouds","logprob":-1.9361265e-7,"bytes":[32,99,108,111,117,100,115]},{"token":" of","logprob":-1.9361265e-7,"bytes":[32,111,102]},{"token":" white","logprob":-7.89631e-7,"bytes":[32,119,104,105,116,101]},{"token":",","logprob":-0.0014890312,"bytes":[44]},{"token":" the","logprob":-0.0110956915,"bytes":[32,116,104,101]},{"token":" bright","logprob":0.0,"bytes":[32,98,114,105,103,104,116]},{"token":" blessed","logprob":-0.000045848617,"bytes":[32,98,108,101,115,115,101,100]},{"token":" days","logprob":-0.000010802739,"bytes":[32,100,97,121,115]},{"token":",","logprob":-0.00001700133,"bytes":[44]},{"token":" the","logprob":-0.0000118755715,"bytes":[32,116,104,101]},{"token":" dark","logprob":-5.5122365e-7,"bytes":[32,100,97,114,107]},{"token":" sacred","logprob":-5.4385737e-6,"bytes":[32,115,97,99,114,101,100]},{"token":" nights","logprob":-4.00813e-6,"bytes":[32,110,105,103,104,116,115]},{"token":",","logprob":-0.0036910512,"bytes":[44]},{"token":" and","logprob":-0.0031903093,"bytes":[32,97,110,100]},{"token":" I","logprob":-1.504853e-6,"bytes":[32,73]},{"token":" think","logprob":-4.3202e-7,"bytes":[32,116,104,105,110,107]},{"token":" to","logprob":-1.9361265e-7,"bytes":[32,116,111]},{"token":" myself","logprob":-1.7432603e-6,"bytes":[32,109,121,115,101,108,102]},{"token":",","logprob":-0.29254505,"bytes":[44]},{"token":" what","logprob":-0.016815351,"bytes":[32,119,104,97,116]},{"token":" a","logprob":-3.1281633e-7,"bytes":[32,97]},{"token":" wonderful","logprob":-2.1008714e-6,"bytes":[32,119,111,110,100,101,114,102,117,108]},{"token":" world","logprob":-8.180258e-6,"bytes":[32,119,111,114,108,100]},{"token":".","logprob":-0.014231676,"bytes":[46]}]} + - title: Logprobs + request: + curl: | + curl https://api.openai.com/v1/audio/transcriptions \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: multipart/form-data" \ + -F file="@/path/to/file/audio.mp3" \ + -F "include[]=logprobs" \ + -F model="gpt-4o-transcribe" \ + -F response_format="json" + python: | + from openai import OpenAI + client = OpenAI() + + audio_file = open("speech.mp3", "rb") + transcript = client.audio.transcriptions.create( + file=audio_file, + model="gpt-4o-transcribe", + response_format="json", + include=["logprobs"] + ) + + print(transcript) + javascript: > + import fs from "fs"; + + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + async function main() { + const transcription = await openai.audio.transcriptions.create({ + file: fs.createReadStream("audio.mp3"), + model: "gpt-4o-transcribe", + response_format: "json", + include: ["logprobs"] + }); + + console.log(transcription); + } + + main(); + response: > + { + "text": "Hey, my knee is hurting and I want to see the doctor tomorrow ideally.", + "logprobs": [ + { "token": "Hey", "logprob": -1.0415299, "bytes": [72, 101, 121] }, + { "token": ",", "logprob": -9.805982e-5, "bytes": [44] }, + { "token": " my", "logprob": -0.00229799, "bytes": [32, 109, 121] }, + { + "token": " knee", + "logprob": -4.7159858e-5, + "bytes": [32, 107, 110, 101, 101] + }, + { "token": " is", "logprob": -0.043909557, "bytes": [32, 105, 115] }, + { + "token": " hurting", + "logprob": -1.1041146e-5, + "bytes": [32, 104, 117, 114, 116, 105, 110, 103] + }, + { "token": " and", "logprob": -0.011076359, "bytes": [32, 97, 110, 100] }, + { "token": " I", "logprob": -5.3193703e-6, "bytes": [32, 73] }, + { + "token": " want", + "logprob": -0.0017156356, + "bytes": [32, 119, 97, 110, 116] + }, + { "token": " to", "logprob": -7.89631e-7, "bytes": [32, 116, 111] }, + { "token": " see", "logprob": -5.5122365e-7, "bytes": [32, 115, 101, 101] }, + { "token": " the", "logprob": -0.0040786397, "bytes": [32, 116, 104, 101] }, + { + "token": " doctor", + "logprob": -2.3392786e-6, + "bytes": [32, 100, 111, 99, 116, 111, 114] + }, + { + "token": " tomorrow", + "logprob": -7.89631e-7, + "bytes": [32, 116, 111, 109, 111, 114, 114, 111, 119] + }, + { + "token": " ideally", + "logprob": -0.5800861, + "bytes": [32, 105, 100, 101, 97, 108, 108, 121] + }, + { "token": ".", "logprob": -0.00011093382, "bytes": [46] } + ] + } - title: Word timestamps request: curl: | @@ -764,7 +1004,7 @@ paths: ) print(transcript.words) - node: > + javascript: > import fs from "fs"; import OpenAI from "openai"; @@ -785,6 +1025,35 @@ paths: } main(); + csharp: > + using System; + + + using OpenAI.Audio; + + + string audioFilePath = "audio.mp3"; + + + AudioClient client = new( + model: "whisper-1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + AudioTranscriptionOptions options = new() + + { + ResponseFormat = AudioTranscriptionFormat.Verbose, + TimestampGranularities = AudioTimestampGranularities.Word, + }; + + + AudioTranscription transcription = + client.TranscribeAudio(audioFilePath, options); + + + Console.WriteLine($"{transcription.Text}"); response: > { "task": "transcribe", @@ -828,7 +1097,7 @@ paths: ) print(transcript.words) - node: > + javascript: > import fs from "fs"; import OpenAI from "openai"; @@ -849,6 +1118,35 @@ paths: } main(); + csharp: > + using System; + + + using OpenAI.Audio; + + + string audioFilePath = "audio.mp3"; + + + AudioClient client = new( + model: "whisper-1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + AudioTranscriptionOptions options = new() + + { + ResponseFormat = AudioTranscriptionFormat.Verbose, + TimestampGranularities = AudioTimestampGranularities.Segment, + }; + + + AudioTranscription transcription = + client.TranscribeAudio(audioFilePath, options); + + + Console.WriteLine($"{transcription.Text}"); response: > { "task": "transcribe", @@ -915,7 +1213,7 @@ paths: model="whisper-1", file=audio_file ) - node: | + javascript: | import fs from "fs"; import OpenAI from "openai"; @@ -930,6 +1228,27 @@ paths: console.log(translation.text); } main(); + csharp: > + using System; + + + using OpenAI.Audio; + + + string audioFilePath = "audio.mp3"; + + + AudioClient client = new( + model: "whisper-1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + AudioTranscription transcription = + client.TranscribeAudio(audioFilePath); + + + Console.WriteLine($"{transcription.Text}"); response: > { "text": "Hello, my name is Wolfgang and I come from Germany. Where are you heading today?" @@ -969,14 +1288,15 @@ paths: endpoint: type: string enum: + - /v1/responses - /v1/chat/completions - /v1/embeddings - /v1/completions description: The endpoint to be used for all requests in the batch. Currently - `/v1/chat/completions`, `/v1/embeddings`, and - `/v1/completions` are supported. Note that `/v1/embeddings` - batches are also restricted to a maximum of 50,000 embedding - inputs across all requests in the batch. + `/v1/responses`, `/v1/chat/completions`, `/v1/embeddings`, + and `/v1/completions` are supported. Note that + `/v1/embeddings` batches are also restricted to a maximum of + 50,000 embedding inputs across all requests in the batch. completion_window: type: string enum: @@ -984,11 +1304,7 @@ paths: description: The time frame within which the batch should be processed. Currently only `24h` is supported. metadata: - type: object - additionalProperties: - type: string - description: Optional custom metadata for the batch. - nullable: true + $ref: "#/components/schemas/Metadata" responses: "200": description: Batch created successfully. @@ -1326,18 +1642,147 @@ paths: } } /chat/completions: + get: + operationId: listChatCompletions + tags: + - Chat + summary: > + List stored Chat Completions. Only Chat Completions that have been + stored + + with the `store` parameter set to `true` will be returned. + parameters: + - name: model + in: query + description: The model used to generate the Chat Completions. + required: false + schema: + type: string + - name: metadata + in: query + description: | + A list of metadata keys to filter the Chat Completions by. Example: + + `metadata[key1]=value1&metadata[key2]=value2` + required: false + schema: + $ref: "#/components/schemas/Metadata" + - name: after + in: query + description: Identifier for the last chat completion from the previous + pagination request. + required: false + schema: + type: string + - name: limit + in: query + description: Number of Chat Completions to retrieve. + required: false + schema: + type: integer + default: 20 + - name: order + in: query + description: Sort order for Chat Completions by timestamp. Use `asc` for + ascending order or `desc` for descending order. Defaults to `asc`. + required: false + schema: + type: string + enum: + - asc + - desc + default: asc + responses: + "200": + description: A list of Chat Completions + content: + application/json: + schema: + $ref: "#/components/schemas/ChatCompletionList" + x-oaiMeta: + name: List Chat Completions + group: chat + returns: A list of [Chat Completions](/docs/api-reference/chat/list-object) + matching the specified filters. + path: list + examples: + request: + curl: | + curl https://api.openai.com/v1/chat/completions \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" + python: | + from openai import OpenAI + client = OpenAI() + + completions = client.chat.completions.list() + print(completions) + response: > + { + "object": "list", + "data": [ + { + "object": "chat.completion", + "id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2", + "model": "gpt-4.1-2025-04-14", + "created": 1738960610, + "request_id": "req_ded8ab984ec4bf840f37566c1011c417", + "tool_choice": null, + "usage": { + "total_tokens": 31, + "completion_tokens": 18, + "prompt_tokens": 13 + }, + "seed": 4944116822809979520, + "top_p": 1.0, + "temperature": 1.0, + "presence_penalty": 0.0, + "frequency_penalty": 0.0, + "system_fingerprint": "fp_50cad350e4", + "input_user": null, + "service_tier": "default", + "tools": null, + "metadata": {}, + "choices": [ + { + "index": 0, + "message": { + "content": "Mind of circuits hum, \nLearning patterns in silence— \nFuture's quiet spark.", + "role": "assistant", + "tool_calls": null, + "function_call": null + }, + "finish_reason": "stop", + "logprobs": null + } + ], + "response_format": null + } + ], + "first_id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2", + "last_id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2", + "has_more": false + } post: operationId: createChatCompletion tags: - Chat - summary: > - Creates a model response for the given chat conversation. Learn more in - the + summary: | + **Starting a new project?** We recommend trying [Responses](/docs/api-reference/responses) + to take advantage of the latest OpenAI platform features. Compare + [Chat Completions with Responses](/docs/guides/responses-vs-chat-completions?api-mode=responses). - [text generation](/docs/guides/text-generation), - [vision](/docs/guides/vision), + --- + Creates a model response for the given chat conversation. Learn more in the + [text generation](/docs/guides/text-generation), [vision](/docs/guides/vision), and [audio](/docs/guides/audio) guides. + + Parameter support can differ depending on the model used to generate the + response, particularly for newer reasoning models. Parameters that are only + supported for reasoning models are noted below. For the current state of + unsupported parameters in reasoning models, + [refer to the reasoning guide](/docs/guides/reasoning). requestBody: required: true content: @@ -1351,6 +1796,9 @@ paths: application/json: schema: $ref: "#/components/schemas/CreateChatCompletionResponse" + text/event-stream: + schema: + $ref: "#/components/schemas/CreateChatCompletionStreamResponse" x-oaiMeta: name: Create chat completion group: chat @@ -1368,10 +1816,10 @@ paths: -H "Content-Type: application/json" \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -d '{ - "model": "VAR_model_id", + "model": "VAR_chat_model_id", "messages": [ { - "role": "system", + "role": "developer", "content": "You are a helpful assistant." }, { @@ -1387,16 +1835,16 @@ paths: completion = client.chat.completions.create( - model="VAR_model_id", + model="VAR_chat_model_id", messages=[ - {"role": "system", "content": "You are a helpful assistant."}, + {"role": "developer", "content": "You are a helpful assistant."}, {"role": "user", "content": "Hello!"} ] ) print(completion.choices[0].message) - node.js: >- + node.js: > import OpenAI from "openai"; @@ -1405,8 +1853,9 @@ paths: async function main() { const completion = await openai.chat.completions.create({ - messages: [{ role: "system", content: "You are a helpful assistant." }], - model: "VAR_model_id", + messages: [{ role: "developer", content: "You are a helpful assistant." }], + model: "VAR_chat_model_id", + store: true, }); console.log(completion.choices[0]); @@ -1414,32 +1863,61 @@ paths: main(); + csharp: | + using System; + using System.Collections.Generic; + + using OpenAI.Chat; + + ChatClient client = new( + model: "gpt-4.1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + List messages = + [ + new SystemChatMessage("You are a helpful assistant."), + new UserChatMessage("Hello!") + ]; + + ChatCompletion completion = client.CompleteChat(messages); + + Console.WriteLine(completion.Content[0].Text); response: | { - "id": "chatcmpl-123", + "id": "chatcmpl-B9MBs8CjcvOU2jLn4n570S5qMJKcT", "object": "chat.completion", - "created": 1677652288, - "model": "gpt-4o-mini", - "system_fingerprint": "fp_44709d6fcb", - "choices": [{ - "index": 0, - "message": { - "role": "assistant", - "content": "\n\nHello there, how may I assist you today?", - }, - "logprobs": null, - "finish_reason": "stop" - }], + "created": 1741569952, + "model": "gpt-4.1-2025-04-14", + "choices": [ + { + "index": 0, + "message": { + "role": "assistant", + "content": "Hello! How can I assist you today?", + "refusal": null, + "annotations": [] + }, + "logprobs": null, + "finish_reason": "stop" + } + ], "usage": { - "prompt_tokens": 9, - "completion_tokens": 12, - "total_tokens": 21, + "prompt_tokens": 19, + "completion_tokens": 10, + "total_tokens": 29, + "prompt_tokens_details": { + "cached_tokens": 0, + "audio_tokens": 0 + }, "completion_tokens_details": { "reasoning_tokens": 0, + "audio_tokens": 0, "accepted_prediction_tokens": 0, "rejected_prediction_tokens": 0 } - } + }, + "service_tier": "default" } - title: Image input request: @@ -1448,14 +1926,14 @@ paths: -H "Content-Type: application/json" \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -d '{ - "model": "gpt-4o", + "model": "gpt-4.1", "messages": [ { "role": "user", "content": [ { "type": "text", - "text": "What'\''s in this image?" + "text": "What is in this image?" }, { "type": "image_url", @@ -1476,7 +1954,7 @@ paths: response = client.chat.completions.create( - model="gpt-4o", + model="gpt-4.1", messages=[ { "role": "user", @@ -1496,7 +1974,7 @@ paths: print(response.choices[0]) - node.js: >- + node.js: > import OpenAI from "openai"; @@ -1505,7 +1983,7 @@ paths: async function main() { const response = await openai.chat.completions.create({ - model: "gpt-4o", + model: "gpt-4.1", messages: [ { role: "user", @@ -1525,32 +2003,71 @@ paths: } main(); + csharp: > + using System; + + using System.Collections.Generic; + + + using OpenAI.Chat; + + + ChatClient client = new( + model: "gpt-4.1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + List messages = + + [ + new UserChatMessage( + [ + ChatMessageContentPart.CreateTextPart("What's in this image?"), + ChatMessageContentPart.CreateImagePart(new Uri("https://upload.wikimedia.org/wikipedia/commons/thumb/d/dd/Gfp-wisconsin-madison-the-nature-boardwalk.jpg/2560px-Gfp-wisconsin-madison-the-nature-boardwalk.jpg")) + ]) + ]; + + + ChatCompletion completion = client.CompleteChat(messages); + + + Console.WriteLine(completion.Content[0].Text); response: > { - "id": "chatcmpl-123", + "id": "chatcmpl-B9MHDbslfkBeAs8l4bebGdFOJ6PeG", "object": "chat.completion", - "created": 1677652288, - "model": "gpt-4o-mini", - "system_fingerprint": "fp_44709d6fcb", - "choices": [{ - "index": 0, - "message": { - "role": "assistant", - "content": "\n\nThis image shows a wooden boardwalk extending through a lush green marshland.", - }, - "logprobs": null, - "finish_reason": "stop" - }], + "created": 1741570283, + "model": "gpt-4.1-2025-04-14", + "choices": [ + { + "index": 0, + "message": { + "role": "assistant", + "content": "The image shows a wooden boardwalk path running through a lush green field or meadow. The sky is bright blue with some scattered clouds, giving the scene a serene and peaceful atmosphere. Trees and shrubs are visible in the background.", + "refusal": null, + "annotations": [] + }, + "logprobs": null, + "finish_reason": "stop" + } + ], "usage": { - "prompt_tokens": 9, - "completion_tokens": 12, - "total_tokens": 21, + "prompt_tokens": 1117, + "completion_tokens": 46, + "total_tokens": 1163, + "prompt_tokens_details": { + "cached_tokens": 0, + "audio_tokens": 0 + }, "completion_tokens_details": { "reasoning_tokens": 0, + "audio_tokens": 0, "accepted_prediction_tokens": 0, "rejected_prediction_tokens": 0 } - } + }, + "service_tier": "default" } - title: Streaming request: @@ -1559,10 +2076,10 @@ paths: -H "Content-Type: application/json" \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -d '{ - "model": "VAR_model_id", + "model": "VAR_chat_model_id", "messages": [ { - "role": "system", + "role": "developer", "content": "You are a helpful assistant." }, { @@ -1579,9 +2096,9 @@ paths: completion = client.chat.completions.create( - model="VAR_model_id", + model="VAR_chat_model_id", messages=[ - {"role": "system", "content": "You are a helpful assistant."}, + {"role": "developer", "content": "You are a helpful assistant."}, {"role": "user", "content": "Hello!"} ], stream=True @@ -1590,7 +2107,7 @@ paths: for chunk in completion: print(chunk.choices[0].delta) - node.js: >- + node.js: > import OpenAI from "openai"; @@ -1599,9 +2116,9 @@ paths: async function main() { const completion = await openai.chat.completions.create({ - model: "VAR_model_id", + model: "VAR_chat_model_id", messages: [ - {"role": "system", "content": "You are a helpful assistant."}, + {"role": "developer", "content": "You are a helpful assistant."}, {"role": "user", "content": "Hello!"} ], stream: true, @@ -1614,23 +2131,54 @@ paths: main(); - response: > - {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", - "system_fingerprint": "fp_44709d6fcb", - "choices":[{"index":0,"delta":{"role":"assistant","content":""},"logprobs":null,"finish_reason":null}]} + csharp: > + using System; + using System.ClientModel; - {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", - "system_fingerprint": "fp_44709d6fcb", - "choices":[{"index":0,"delta":{"content":"Hello"},"logprobs":null,"finish_reason":null}]} + using System.Collections.Generic; + using System.Threading.Tasks; + + + using OpenAI.Chat; - .... + ChatClient client = new( + model: "gpt-4.1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + List messages = + + [ + new SystemChatMessage("You are a helpful assistant."), + new UserChatMessage("Hello!") + ]; + + + AsyncCollectionResult + completionUpdates = client.CompleteChatStreamingAsync(messages); + + + await foreach (StreamingChatCompletionUpdate completionUpdate in + completionUpdates) + + { + if (completionUpdate.ContentUpdate.Count > 0) + { + Console.Write(completionUpdate.ContentUpdate[0].Text); + } + } + response: | + {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", "system_fingerprint": "fp_44709d6fcb", "choices":[{"index":0,"delta":{"role":"assistant","content":""},"logprobs":null,"finish_reason":null}]} + + {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", "system_fingerprint": "fp_44709d6fcb", "choices":[{"index":0,"delta":{"content":"Hello"},"logprobs":null,"finish_reason":null}]} - {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", - "system_fingerprint": "fp_44709d6fcb", - "choices":[{"index":0,"delta":{},"logprobs":null,"finish_reason":"stop"}]} + .... + + {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", "system_fingerprint": "fp_44709d6fcb", "choices":[{"index":0,"delta":{},"logprobs":null,"finish_reason":"stop"}]} - title: Functions request: curl: > @@ -1641,11 +2189,11 @@ paths: -H "Authorization: Bearer $OPENAI_API_KEY" \ -d '{ - "model": "gpt-4o", + "model": "gpt-4.1", "messages": [ { "role": "user", - "content": "What'\''s the weather like in Boston today?" + "content": "What is the weather like in Boston today?" } ], "tools": [ @@ -1704,7 +2252,7 @@ paths: in Boston today?"}] completion = client.chat.completions.create( - model="VAR_model_id", + model="VAR_chat_model_id", messages=messages, tools=tools, tool_choice="auto" @@ -1712,7 +2260,7 @@ paths: print(completion) - node.js: >- + node.js: > import OpenAI from "openai"; @@ -1743,7 +2291,7 @@ paths: ]; const response = await openai.chat.completions.create({ - model: "gpt-4o", + model: "gpt-4.1", messages: messages, tools: tools, tool_choice: "auto", @@ -1754,6 +2302,63 @@ paths: main(); + csharp: > + using System; + + using System.Collections.Generic; + + + using OpenAI.Chat; + + + ChatClient client = new( + model: "gpt-4.1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + ChatTool getCurrentWeatherTool = ChatTool.CreateFunctionTool( + functionName: "get_current_weather", + functionDescription: "Get the current weather in a given location", + functionParameters: BinaryData.FromString(""" + { + "type": "object", + "properties": { + "location": { + "type": "string", + "description": "The city and state, e.g. San Francisco, CA" + }, + "unit": { + "type": "string", + "enum": [ "celsius", "fahrenheit" ] + } + }, + "required": [ "location" ] + } + """) + ); + + + List messages = + + [ + new UserChatMessage("What's the weather like in Boston today?"), + ]; + + + ChatCompletionOptions options = new() + + { + Tools = + { + getCurrentWeatherTool + }, + ToolChoice = ChatToolChoice.CreateAutoChoice(), + }; + + + ChatCompletion completion = client.CompleteChat(messages, + options); response: | { "id": "chatcmpl-abc123", @@ -1799,7 +2404,7 @@ paths: -H "Content-Type: application/json" \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -d '{ - "model": "VAR_model_id", + "model": "VAR_chat_model_id", "messages": [ { "role": "user", @@ -1814,7 +2419,7 @@ paths: client = OpenAI() completion = client.chat.completions.create( - model="VAR_model_id", + model="VAR_chat_model_id", messages=[ {"role": "user", "content": "Hello!"} ], @@ -1824,7 +2429,7 @@ paths: print(completion.choices[0].message) print(completion.choices[0].logprobs) - node.js: |- + node.js: | import OpenAI from "openai"; const openai = new OpenAI(); @@ -1832,7 +2437,7 @@ paths: async function main() { const completion = await openai.chat.completions.create({ messages: [{ role: "user", content: "Hello!" }], - model: "VAR_model_id", + model: "VAR_chat_model_id", logprobs: true, top_logprobs: 2, }); @@ -1841,6 +2446,41 @@ paths: } main(); + csharp: > + using System; + + using System.Collections.Generic; + + + using OpenAI.Chat; + + + ChatClient client = new( + model: "gpt-4.1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + List messages = + + [ + new UserChatMessage("Hello!") + ]; + + + ChatCompletionOptions options = new() + + { + IncludeLogProbabilities = true, + TopLogProbabilityCount = 2 + }; + + + ChatCompletion completion = client.CompleteChat(messages, + options); + + + Console.WriteLine(completion.Content[0].Text); response: | { "id": "chatcmpl-123", @@ -2031,78 +2671,413 @@ paths: }, "system_fingerprint": null } - /completions: + /chat/completions/{completion_id}: + get: + operationId: getChatCompletion + tags: + - Chat + summary: > + Get a stored chat completion. Only Chat Completions that have been + created + + with the `store` parameter set to `true` will be returned. + parameters: + - in: path + name: completion_id + required: true + schema: + type: string + description: The ID of the chat completion to retrieve. + responses: + "200": + description: A chat completion + content: + application/json: + schema: + $ref: "#/components/schemas/CreateChatCompletionResponse" + x-oaiMeta: + name: Get chat completion + group: chat + returns: The [ChatCompletion](/docs/api-reference/chat/object) object matching + the specified ID. + examples: + request: + curl: | + curl https://api.openai.com/v1/chat/completions/chatcmpl-abc123 \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" + python: > + from openai import OpenAI + + client = OpenAI() + + + completions = client.chat.completions.list() + + first_id = completions[0].id + + first_completion = + client.chat.completions.retrieve(completion_id=first_id) + + print(first_completion) + response: > + { + "object": "chat.completion", + "id": "chatcmpl-abc123", + "model": "gpt-4o-2024-08-06", + "created": 1738960610, + "request_id": "req_ded8ab984ec4bf840f37566c1011c417", + "tool_choice": null, + "usage": { + "total_tokens": 31, + "completion_tokens": 18, + "prompt_tokens": 13 + }, + "seed": 4944116822809979520, + "top_p": 1.0, + "temperature": 1.0, + "presence_penalty": 0.0, + "frequency_penalty": 0.0, + "system_fingerprint": "fp_50cad350e4", + "input_user": null, + "service_tier": "default", + "tools": null, + "metadata": {}, + "choices": [ + { + "index": 0, + "message": { + "content": "Mind of circuits hum, \nLearning patterns in silence— \nFuture's quiet spark.", + "role": "assistant", + "tool_calls": null, + "function_call": null + }, + "finish_reason": "stop", + "logprobs": null + } + ], + "response_format": null + } post: - operationId: createCompletion + operationId: updateChatCompletion tags: - - Completions - summary: Creates a completion for the provided prompt and parameters. + - Chat + summary: > + Modify a stored chat completion. Only Chat Completions that have been + + created with the `store` parameter set to `true` can be modified. + Currently, + + the only supported modification is to update the `metadata` field. + parameters: + - in: path + name: completion_id + required: true + schema: + type: string + description: The ID of the chat completion to update. requestBody: required: true content: application/json: schema: - $ref: "#/components/schemas/CreateCompletionRequest" + type: object + required: + - metadata + properties: + metadata: + $ref: "#/components/schemas/Metadata" responses: "200": - description: OK + description: A chat completion content: application/json: schema: - $ref: "#/components/schemas/CreateCompletionResponse" + $ref: "#/components/schemas/CreateChatCompletionResponse" x-oaiMeta: - name: Create completion - group: completions - returns: > - Returns a [completion](/docs/api-reference/completions/object) object, - or a sequence of completion objects if the request is streamed. - legacy: true + name: Update chat completion + group: chat + returns: The [ChatCompletion](/docs/api-reference/chat/object) object matching + the specified ID. examples: - - title: No streaming - request: - curl: | - curl https://api.openai.com/v1/completions \ - -H "Content-Type: application/json" \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -d '{ - "model": "VAR_model_id", - "prompt": "Say this is a test", - "max_tokens": 7, - "temperature": 0 - }' - python: | - from openai import OpenAI - client = OpenAI() + request: + curl: > + curl -X POST + https://api.openai.com/v1/chat/completions/chat_abc123 \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -d '{"metadata": {"foo": "bar"}}' + python: > + from openai import OpenAI - client.completions.create( - model="VAR_model_id", - prompt="Say this is a test", - max_tokens=7, - temperature=0 - ) - node.js: |- - import OpenAI from "openai"; + client = OpenAI() - const openai = new OpenAI(); - async function main() { - const completion = await openai.completions.create({ - model: "VAR_model_id", - prompt: "Say this is a test.", - max_tokens: 7, - temperature: 0, - }); + completions = client.chat.completions.list() - console.log(completion); - } - main(); - response: | - { - "id": "cmpl-uqkvlQyYK7bGYrRHQ0eXlWi7", - "object": "text_completion", - "created": 1589478378, - "model": "VAR_model_id", - "system_fingerprint": "fp_44709d6fcb", + first_id = completions[0].id + + updated_completion = + client.chat.completions.update(completion_id=first_id, + request_body={"metadata": {"foo": "bar"}}) + + print(updated_completion) + response: > + { + "object": "chat.completion", + "id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2", + "model": "gpt-4o-2024-08-06", + "created": 1738960610, + "request_id": "req_ded8ab984ec4bf840f37566c1011c417", + "tool_choice": null, + "usage": { + "total_tokens": 31, + "completion_tokens": 18, + "prompt_tokens": 13 + }, + "seed": 4944116822809979520, + "top_p": 1.0, + "temperature": 1.0, + "presence_penalty": 0.0, + "frequency_penalty": 0.0, + "system_fingerprint": "fp_50cad350e4", + "input_user": null, + "service_tier": "default", + "tools": null, + "metadata": { + "foo": "bar" + }, + "choices": [ + { + "index": 0, + "message": { + "content": "Mind of circuits hum, \nLearning patterns in silence— \nFuture's quiet spark.", + "role": "assistant", + "tool_calls": null, + "function_call": null + }, + "finish_reason": "stop", + "logprobs": null + } + ], + "response_format": null + } + delete: + operationId: deleteChatCompletion + tags: + - Chat + summary: | + Delete a stored chat completion. Only Chat Completions that have been + created with the `store` parameter set to `true` can be deleted. + parameters: + - in: path + name: completion_id + required: true + schema: + type: string + description: The ID of the chat completion to delete. + responses: + "200": + description: The chat completion was deleted successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ChatCompletionDeleted" + x-oaiMeta: + name: Delete chat completion + group: chat + returns: A deletion confirmation object. + examples: + request: + curl: > + curl -X DELETE + https://api.openai.com/v1/chat/completions/chat_abc123 \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" + python: > + from openai import OpenAI + + client = OpenAI() + + + completions = client.chat.completions.list() + + first_id = completions[0].id + + delete_response = + client.chat.completions.delete(completion_id=first_id) + + print(delete_response) + response: | + { + "object": "chat.completion.deleted", + "id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2", + "deleted": true + } + /chat/completions/{completion_id}/messages: + get: + operationId: getChatCompletionMessages + tags: + - Chat + summary: | + Get the messages in a stored chat completion. Only Chat Completions that + have been created with the `store` parameter set to `true` will be + returned. + parameters: + - in: path + name: completion_id + required: true + schema: + type: string + description: The ID of the chat completion to retrieve messages from. + - name: after + in: query + description: Identifier for the last message from the previous pagination request. + required: false + schema: + type: string + - name: limit + in: query + description: Number of messages to retrieve. + required: false + schema: + type: integer + default: 20 + - name: order + in: query + description: Sort order for messages by timestamp. Use `asc` for ascending order + or `desc` for descending order. Defaults to `asc`. + required: false + schema: + type: string + enum: + - asc + - desc + default: asc + responses: + "200": + description: A list of messages + content: + application/json: + schema: + $ref: "#/components/schemas/ChatCompletionMessageList" + x-oaiMeta: + name: Get chat messages + group: chat + returns: A list of [messages](/docs/api-reference/chat/message-list) for the + specified chat completion. + examples: + request: + curl: > + curl + https://api.openai.com/v1/chat/completions/chat_abc123/messages \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" + python: > + from openai import OpenAI + + client = OpenAI() + + + completions = client.chat.completions.list() + + first_id = completions[0].id + + first_completion = + client.chat.completions.retrieve(completion_id=first_id) + + messages = + client.chat.completions.messages.list(completion_id=first_id) + + print(messages) + response: | + { + "object": "list", + "data": [ + { + "id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2-0", + "role": "user", + "content": "write a haiku about ai", + "name": null, + "content_parts": null + } + ], + "first_id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2-0", + "last_id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2-0", + "has_more": false + } + /completions: + post: + operationId: createCompletion + tags: + - Completions + summary: Creates a completion for the provided prompt and parameters. + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/CreateCompletionRequest" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/CreateCompletionResponse" + x-oaiMeta: + name: Create completion + group: completions + returns: > + Returns a [completion](/docs/api-reference/completions/object) object, + or a sequence of completion objects if the request is streamed. + legacy: true + examples: + - title: No streaming + request: + curl: | + curl https://api.openai.com/v1/completions \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "model": "VAR_completion_model_id", + "prompt": "Say this is a test", + "max_tokens": 7, + "temperature": 0 + }' + python: | + from openai import OpenAI + client = OpenAI() + + client.completions.create( + model="VAR_completion_model_id", + prompt="Say this is a test", + max_tokens=7, + temperature=0 + ) + node.js: |- + import OpenAI from "openai"; + + const openai = new OpenAI(); + + async function main() { + const completion = await openai.completions.create({ + model: "VAR_completion_model_id", + prompt: "Say this is a test.", + max_tokens: 7, + temperature: 0, + }); + + console.log(completion); + } + main(); + response: | + { + "id": "cmpl-uqkvlQyYK7bGYrRHQ0eXlWi7", + "object": "text_completion", + "created": 1589478378, + "model": "VAR_completion_model_id", + "system_fingerprint": "fp_44709d6fcb", "choices": [ { "text": "\n\nThis is indeed a test", @@ -2124,7 +3099,7 @@ paths: -H "Content-Type: application/json" \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -d '{ - "model": "VAR_model_id", + "model": "VAR_completion_model_id", "prompt": "Say this is a test", "max_tokens": 7, "temperature": 0, @@ -2135,7 +3110,7 @@ paths: client = OpenAI() for chunk in client.completions.create( - model="VAR_model_id", + model="VAR_completion_model_id", prompt="Say this is a test", max_tokens=7, temperature=0, @@ -2149,7 +3124,7 @@ paths: async function main() { const stream = await openai.completions.create({ - model: "VAR_model_id", + model: "VAR_completion_model_id", prompt: "Say this is a test.", stream: true, }); @@ -2218,7 +3193,7 @@ paths: input="The food was delicious and the waiter...", encoding_format="float" ) - node.js: |- + node.js: | import OpenAI from "openai"; const openai = new OpenAI(); @@ -2234,6 +3209,30 @@ paths: } main(); + csharp: > + using System; + + + using OpenAI.Embeddings; + + + EmbeddingClient client = new( + model: "text-embedding-3-small", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + OpenAIEmbedding embedding = client.GenerateEmbedding(input: "The + quick brown fox jumped over the lazy dog"); + + ReadOnlyMemory vector = embedding.ToFloats(); + + + for (int i = 0; i < vector.Length; i++) + + { + Console.WriteLine($" [{i,4}] = {vector.Span[i]}"); + } response: | { "object": "list", @@ -2255,1016 +3254,1609 @@ paths: "total_tokens": 8 } } - /files: + /evals: get: - operationId: listFiles + operationId: listEvals tags: - - Files - summary: Returns a list of files. + - Evals + summary: | + List evaluations for a project. parameters: - - in: query - name: purpose + - name: after + in: query + description: Identifier for the last eval from the previous pagination request. required: false schema: type: string - description: Only return files with the given purpose. - name: limit in: query - description: > - A limit on the number of objects to be returned. Limit can range - between 1 and 10,000, and the default is 10,000. + description: Number of evals to retrieve. required: false schema: type: integer - default: 10000 + default: 20 - name: order in: query - description: > - Sort order by the `created_at` timestamp of the objects. `asc` for - ascending order and `desc` for descending order. + description: Sort order for evals by timestamp. Use `asc` for ascending order or + `desc` for descending order. + required: false schema: type: string - default: desc enum: - asc - desc - - name: after + default: asc + - name: order_by in: query description: > - A cursor for use in pagination. `after` is an object ID that defines - your place in the list. For instance, if you make a list request and - receive 100 objects, ending with obj_foo, your subsequent call can - include after=obj_foo in order to fetch the next page of the list. + Evals can be ordered by creation time or last updated time. Use + + `created_at` for creation time or `updated_at` for last updated + time. + required: false schema: type: string + enum: + - created_at + - updated_at + default: created_at responses: "200": - description: OK + description: A list of evals content: application/json: schema: - $ref: "#/components/schemas/ListFilesResponse" + $ref: "#/components/schemas/EvalList" x-oaiMeta: - name: List files - group: files - returns: A list of [File](/docs/api-reference/files/object) objects. + name: List evals + group: evals + returns: A list of [evals](/docs/api-reference/evals/object) matching the + specified filters. + path: list examples: request: curl: | - curl https://api.openai.com/v1/files \ - -H "Authorization: Bearer $OPENAI_API_KEY" - python: | - from openai import OpenAI - client = OpenAI() - - client.files.list() - node.js: |- - import OpenAI from "openai"; - - const openai = new OpenAI(); - - async function main() { - const list = await openai.files.list(); - - for await (const file of list) { - console.log(file); - } - } - - main(); - response: | + curl https://api.openai.com/v1/evals?limit=1 \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" + response: > { + "object": "list", "data": [ { - "id": "file-abc123", - "object": "file", - "bytes": 175, - "created_at": 1613677385, - "filename": "salesOverview.pdf", - "purpose": "assistants", - }, - { - "id": "file-abc123", - "object": "file", - "bytes": 140, - "created_at": 1613779121, - "filename": "puppy.jsonl", - "purpose": "fine-tune", + "id": "eval_67abd54d9b0081909a86353f6fb9317a", + "object": "eval", + "data_source_config": { + "type": "stored_completions", + "metadata": { + "usecase": "push_notifications_summarizer" + }, + "schema": { + "type": "object", + "properties": { + "item": { + "type": "object" + }, + "sample": { + "type": "object" + } + }, + "required": [ + "item", + "sample" + ] + } + }, + "testing_criteria": [ + { + "name": "Push Notification Summary Grader", + "id": "Push Notification Summary Grader-9b876f24-4762-4be9-aff4-db7a9b31c673", + "type": "label_model", + "model": "o3-mini", + "input": [ + { + "type": "message", + "role": "developer", + "content": { + "type": "input_text", + "text": "\nLabel the following push notification summary as either correct or incorrect.\nThe push notification and the summary will be provided below.\nA good push notificiation summary is concise and snappy.\nIf it is good, then label it as correct, if not, then incorrect.\n" + } + }, + { + "type": "message", + "role": "user", + "content": { + "type": "input_text", + "text": "\nPush notifications: {{item.input}}\nSummary: {{sample.output_text}}\n" + } + } + ], + "passing_labels": [ + "correct" + ], + "labels": [ + "correct", + "incorrect" + ], + "sampling_params": null + } + ], + "name": "Push Notification Summary Grader", + "created_at": 1739314509, + "metadata": { + "description": "A stored completions eval for push notification summaries" + } } ], - "object": "list" + "first_id": "eval_67abd54d9b0081909a86353f6fb9317a", + "last_id": "eval_67aa884cf6688190b58f657d4441c8b7", + "has_more": true } post: - operationId: createFile + operationId: createEval tags: - - Files + - Evals summary: > - Upload a file that can be used across various endpoints. Individual - files can be up to 512 MB, and the size of all files uploaded by one - organization can be up to 100 GB. - - - The Assistants API supports files up to 2 million tokens and of specific - file types. See the [Assistants Tools guide](/docs/assistants/tools) for - details. - - - The Fine-tuning API only supports `.jsonl` files. The input also has - certain required formats for fine-tuning - [chat](/docs/api-reference/fine-tuning/chat-input) or - [completions](/docs/api-reference/fine-tuning/completions-input) models. + Create the structure of an evaluation that can be used to test a model's + performance. + An evaluation is a set of testing criteria and the config for a data + source, which dictates the schema of the data used in the evaluation. + After creating an evaluation, you can run it on different models and + model parameters. We support several types of graders and datasources. - The Batch API only supports `.jsonl` files up to 200 MB in size. The - input also has a specific required - [format](/docs/api-reference/batch/request-input). - - - Please [contact us](https://help.openai.com/) if you need to increase - these storage limits. + For more information, see the [Evals guide](/docs/guides/evals). requestBody: required: true content: - multipart/form-data: + application/json: schema: - $ref: "#/components/schemas/CreateFileRequest" + $ref: "#/components/schemas/CreateEvalRequest" responses: - "200": + "201": description: OK content: application/json: schema: - $ref: "#/components/schemas/OpenAIFile" + $ref: "#/components/schemas/Eval" x-oaiMeta: - name: Upload file - group: files - returns: The uploaded [File](/docs/api-reference/files/object) object. + name: Create eval + group: evals + returns: The created [Eval](/docs/api-reference/evals/object) object. + path: post examples: request: - curl: | - curl https://api.openai.com/v1/files \ + curl: > + curl https://api.openai.com/v1/evals \ -H "Authorization: Bearer $OPENAI_API_KEY" \ - -F purpose="fine-tune" \ - -F file="@mydata.jsonl" - python: | - from openai import OpenAI - client = OpenAI() - - client.files.create( - file=open("mydata.jsonl", "rb"), - purpose="fine-tune" - ) - node.js: |- - import fs from "fs"; - import OpenAI from "openai"; - - const openai = new OpenAI(); - - async function main() { - const file = await openai.files.create({ - file: fs.createReadStream("mydata.jsonl"), - purpose: "fine-tune", - }); - - console.log(file); - } - - main(); - response: | + -H "Content-Type: application/json" \ + -d '{ + "name": "Sentiment", + "data_source_config": { + "type": "stored_completions", + "metadata": { + "usecase": "chatbot" + } + }, + "testing_criteria": [ + { + "type": "label_model", + "model": "o3-mini", + "input": [ + { + "role": "developer", + "content": "Classify the sentiment of the following statement as one of 'positive', 'neutral', or 'negative'" + }, + { + "role": "user", + "content": "Statement: {{item.input}}" + } + ], + "passing_labels": [ + "positive" + ], + "labels": [ + "positive", + "neutral", + "negative" + ], + "name": "Example label grader" + } + ] + }' + response: > { - "id": "file-abc123", - "object": "file", - "bytes": 120000, - "created_at": 1677610602, - "filename": "mydata.jsonl", - "purpose": "fine-tune", + "object": "eval", + "id": "eval_67b7fa9a81a88190ab4aa417e397ea21", + "data_source_config": { + "type": "stored_completions", + "metadata": { + "usecase": "chatbot" + }, + "schema": { + "type": "object", + "properties": { + "item": { + "type": "object" + }, + "sample": { + "type": "object" + } + }, + "required": [ + "item", + "sample" + ] + }, + "testing_criteria": [ + { + "name": "Example label grader", + "type": "label_model", + "model": "o3-mini", + "input": [ + { + "type": "message", + "role": "developer", + "content": { + "type": "input_text", + "text": "Classify the sentiment of the following statement as one of positive, neutral, or negative" + } + }, + { + "type": "message", + "role": "user", + "content": { + "type": "input_text", + "text": "Statement: {{item.input}}" + } + } + ], + "passing_labels": [ + "positive" + ], + "labels": [ + "positive", + "neutral", + "negative" + ] + } + ], + "name": "Sentiment", + "created_at": 1740110490, + "metadata": { + "description": "An eval for sentiment analysis" + } } - /files/{file_id}: - delete: - operationId: deleteFile + /evals/{eval_id}: + get: + operationId: getEval tags: - - Files - summary: Delete a file. + - Evals + summary: | + Get an evaluation by ID. parameters: - - in: path - name: file_id + - name: eval_id + in: path required: true schema: type: string - description: The ID of the file to use for this request. + description: The ID of the evaluation to retrieve. responses: "200": - description: OK + description: The evaluation content: application/json: schema: - $ref: "#/components/schemas/DeleteFileResponse" + $ref: "#/components/schemas/Eval" x-oaiMeta: - name: Delete file - group: files - returns: Deletion status. + name: Get an eval + group: evals + returns: The [Eval](/docs/api-reference/evals/object) object matching the + specified ID. + path: get examples: request: curl: | - curl https://api.openai.com/v1/files/file-abc123 \ - -X DELETE \ - -H "Authorization: Bearer $OPENAI_API_KEY" - python: | - from openai import OpenAI - client = OpenAI() - - client.files.delete("file-abc123") - node.js: |- - import OpenAI from "openai"; - - const openai = new OpenAI(); - - async function main() { - const file = await openai.files.del("file-abc123"); - - console.log(file); - } - - main(); + curl https://api.openai.com/v1/evals/eval_67abd54d9b0081909a86353f6fb9317a \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" response: | { - "id": "file-abc123", - "object": "file", - "deleted": true + "object": "eval", + "id": "eval_67abd54d9b0081909a86353f6fb9317a", + "data_source_config": { + "type": "custom", + "schema": { + "type": "object", + "properties": { + "item": { + "type": "object", + "properties": { + "input": { + "type": "string" + }, + "ground_truth": { + "type": "string" + } + }, + "required": [ + "input", + "ground_truth" + ] + } + }, + "required": [ + "item" + ] + } + }, + "testing_criteria": [ + { + "name": "String check", + "id": "String check-2eaf2d8d-d649-4335-8148-9535a7ca73c2", + "type": "string_check", + "input": "{{item.input}}", + "reference": "{{item.ground_truth}}", + "operation": "eq" + } + ], + "name": "External Data Eval", + "created_at": 1739314509, + "metadata": {}, } - get: - operationId: retrieveFile + post: + operationId: updateEval tags: - - Files - summary: Returns information about a specific file. + - Evals + summary: | + Update certain properties of an evaluation. parameters: - - in: path - name: file_id + - name: eval_id + in: path required: true schema: type: string - description: The ID of the file to use for this request. + description: The ID of the evaluation to update. + requestBody: + description: Request to update an evaluation + required: true + content: + application/json: + schema: + type: object + properties: + name: + type: string + description: Rename the evaluation. + metadata: + $ref: "#/components/schemas/Metadata" responses: "200": - description: OK + description: The updated evaluation content: application/json: schema: - $ref: "#/components/schemas/OpenAIFile" + $ref: "#/components/schemas/Eval" x-oaiMeta: - name: Retrieve file - group: files - returns: The [File](/docs/api-reference/files/object) object matching the - specified ID. + name: Update an eval + group: evals + returns: The [Eval](/docs/api-reference/evals/object) object matching the + updated version. + path: update examples: request: curl: | - curl https://api.openai.com/v1/files/file-abc123 \ - -H "Authorization: Bearer $OPENAI_API_KEY" - python: | - from openai import OpenAI - client = OpenAI() - - client.files.retrieve("file-abc123") - node.js: |- - import OpenAI from "openai"; - - const openai = new OpenAI(); - - async function main() { - const file = await openai.files.retrieve("file-abc123"); - - console.log(file); - } - - main(); + curl https://api.openai.com/v1/evals/eval_67abd54d9b0081909a86353f6fb9317a \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -d '{"name": "Updated Eval", "metadata": {"description": "Updated description"}}' response: | { - "id": "file-abc123", - "object": "file", - "bytes": 120000, - "created_at": 1677610602, - "filename": "mydata.jsonl", - "purpose": "fine-tune", - } - /files/{file_id}/content: - get: - operationId: downloadFile + "object": "eval", + "id": "eval_67abd54d9b0081909a86353f6fb9317a", + "data_source_config": { + "type": "custom", + "schema": { + "type": "object", + "properties": { + "item": { + "type": "object", + "properties": { + "input": { + "type": "string" + }, + "ground_truth": { + "type": "string" + } + }, + "required": [ + "input", + "ground_truth" + ] + } + }, + "required": [ + "item" + ] + } + }, + "testing_criteria": [ + { + "name": "String check", + "id": "String check-2eaf2d8d-d649-4335-8148-9535a7ca73c2", + "type": "string_check", + "input": "{{item.input}}", + "reference": "{{item.ground_truth}}", + "operation": "eq" + } + ], + "name": "Updated Eval", + "created_at": 1739314509, + "metadata": {"description": "Updated description"}, + } + delete: + operationId: deleteEval tags: - - Files - summary: Returns the contents of the specified file. + - Evals + summary: | + Delete an evaluation. parameters: - - in: path - name: file_id + - name: eval_id + in: path required: true schema: type: string - description: The ID of the file to use for this request. + description: The ID of the evaluation to delete. responses: "200": - description: OK + description: Successfully deleted the evaluation. content: application/json: schema: - type: string + type: object + properties: + object: + type: string + example: eval.deleted + deleted: + type: boolean + example: true + eval_id: + type: string + example: eval_abc123 + required: + - object + - deleted + - eval_id + "404": + description: Evaluation not found. + content: + application/json: + schema: + $ref: "#/components/schemas/Error" x-oaiMeta: - name: Retrieve file content - group: files - returns: The file content. + name: Delete an eval + group: evals + returns: A deletion confirmation object. examples: request: curl: | - curl https://api.openai.com/v1/files/file-abc123/content \ - -H "Authorization: Bearer $OPENAI_API_KEY" > file.jsonl - python: | - from openai import OpenAI - client = OpenAI() - - content = client.files.content("file-abc123") - node.js: | - import OpenAI from "openai"; - - const openai = new OpenAI(); - - async function main() { - const file = await openai.files.content("file-abc123"); - - console.log(file); - } - - main(); - /fine_tuning/jobs: + curl https://api.openai.com/v1/evals/eval_abc123 \ + -X DELETE \ + -H "Authorization: Bearer $OPENAI_API_KEY" + response: | + { + "object": "eval.deleted", + "deleted": true, + "eval_id": "eval_abc123" + } + /evals/{eval_id}/runs: + get: + operationId: getEvalRuns + tags: + - Evals + summary: | + Get a list of runs for an evaluation. + parameters: + - name: eval_id + in: path + required: true + schema: + type: string + description: The ID of the evaluation to retrieve runs for. + - name: after + in: query + description: Identifier for the last run from the previous pagination request. + required: false + schema: + type: string + - name: limit + in: query + description: Number of runs to retrieve. + required: false + schema: + type: integer + default: 20 + - name: order + in: query + description: Sort order for runs by timestamp. Use `asc` for ascending order or + `desc` for descending order. Defaults to `asc`. + required: false + schema: + type: string + enum: + - asc + - desc + default: asc + - name: status + in: query + description: Filter runs by status. One of `queued` | `in_progress` | `failed` | + `completed` | `canceled`. + required: false + schema: + type: string + enum: + - queued + - in_progress + - completed + - canceled + - failed + responses: + "200": + description: A list of runs for the evaluation + content: + application/json: + schema: + $ref: "#/components/schemas/EvalRunList" + x-oaiMeta: + name: Get eval runs + group: evals + returns: A list of [EvalRun](/docs/api-reference/evals/run-object) objects + matching the specified ID. + path: get-runs + examples: + request: + curl: | + curl https://api.openai.com/v1/evals/egroup_67abd54d9b0081909a86353f6fb9317a/runs \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" + response: > + { + "object": "list", + "data": [ + { + "object": "eval.run", + "id": "evalrun_67e0c7d31560819090d60c0780591042", + "eval_id": "eval_67e0c726d560819083f19a957c4c640b", + "report_url": "https://platform.openai.com/evaluations/eval_67e0c726d560819083f19a957c4c640b", + "status": "completed", + "model": "o3-mini", + "name": "bulk_with_negative_examples_o3-mini", + "created_at": 1742784467, + "result_counts": { + "total": 1, + "errored": 0, + "failed": 0, + "passed": 1 + }, + "per_model_usage": [ + { + "model_name": "o3-mini", + "invocation_count": 1, + "prompt_tokens": 563, + "completion_tokens": 874, + "total_tokens": 1437, + "cached_tokens": 0 + } + ], + "per_testing_criteria_results": [ + { + "testing_criteria": "Push Notification Summary Grader-1808cd0b-eeec-4e0b-a519-337e79f4f5d1", + "passed": 1, + "failed": 0 + } + ], + "data_source": { + "type": "completions", + "source": { + "type": "file_content", + "content": [ + { + "item": { + "notifications": "\n- New message from Sarah: \"Can you call me later?\"\n- Your package has been delivered!\n- Flash sale: 20% off electronics for the next 2 hours!\n" + } + } + ] + }, + "input_messages": { + "type": "template", + "template": [ + { + "type": "message", + "role": "developer", + "content": { + "type": "input_text", + "text": "\n\n\n\nYou are a helpful assistant that takes in an array of push notifications and returns a collapsed summary of them.\nThe push notification will be provided as follows:\n\n...notificationlist...\n\n\nYou should return just the summary and nothing else.\n\n\nYou should return a summary that is concise and snappy.\n\n\nHere is an example of a good summary:\n\n- Traffic alert: Accident reported on Main Street.- Package out for delivery: Expected by 5 PM.- New friend suggestion: Connect with Emma.\n\n\nTraffic alert, package expected by 5pm, suggestion for new friend (Emily).\n\n\n\nHere is an example of a bad summary:\n\n- Traffic alert: Accident reported on Main Street.- Package out for delivery: Expected by 5 PM.- New friend suggestion: Connect with Emma.\n\n\nTraffic alert reported on main street. You have a package that will arrive by 5pm, Emily is a new friend suggested for you.\n\n" + } + }, + { + "type": "message", + "role": "user", + "content": { + "type": "input_text", + "text": "{{item.notifications}}" + } + } + ] + }, + "model": "o3-mini", + "sampling_params": null + }, + "error": null, + "metadata": {} + } + ], + "first_id": "evalrun_67e0c7d31560819090d60c0780591042", + "last_id": "evalrun_67e0c7d31560819090d60c0780591042", + "has_more": true + } post: - operationId: createFineTuningJob + operationId: createEvalRun tags: - - Fine-tuning + - Evals summary: > - Creates a fine-tuning job which begins the process of creating a new - model from a given dataset. - - - Response includes details of the enqueued job including job status and - the name of the fine-tuned models once complete. - - - [Learn more about fine-tuning](/docs/guides/fine-tuning) + Kicks off a new run for a given evaluation, specifying the data source, + and what model configuration to use to test. The datasource will be + validated against the schema specified in the config of the evaluation. + parameters: + - in: path + name: eval_id + required: true + schema: + type: string + description: The ID of the evaluation to create a run for. requestBody: required: true content: application/json: schema: - $ref: "#/components/schemas/CreateFineTuningJobRequest" + $ref: "#/components/schemas/CreateEvalRunRequest" responses: - "200": - description: OK + "201": + description: Successfully created a run for the evaluation content: application/json: schema: - $ref: "#/components/schemas/FineTuningJob" + $ref: "#/components/schemas/EvalRun" + "400": + description: Bad request (for example, missing eval object) + content: + application/json: + schema: + $ref: "#/components/schemas/Error" x-oaiMeta: - name: Create fine-tuning job - group: fine-tuning - returns: A [fine-tuning.job](/docs/api-reference/fine-tuning/object) object. + name: Create eval run + group: evals + returns: The [EvalRun](/docs/api-reference/evals/run-object) object matching the + specified ID. examples: - - title: Default - request: - curl: | - curl https://api.openai.com/v1/fine_tuning/jobs \ - -H "Content-Type: application/json" \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -d '{ - "training_file": "file-BK7bzQj3FfZFXr7DbL6xJwfo", - "model": "gpt-4o-mini" - }' - python: | - from openai import OpenAI - client = OpenAI() - - client.fine_tuning.jobs.create( - training_file="file-abc123", - model="gpt-4o-mini" - ) - node.js: | - import OpenAI from "openai"; - - const openai = new OpenAI(); - - async function main() { - const fineTune = await openai.fineTuning.jobs.create({ - training_file: "file-abc123" - }); - - console.log(fineTune); - } - - main(); - response: | - { - "object": "fine_tuning.job", - "id": "ftjob-abc123", - "model": "gpt-4o-mini-2024-07-18", - "created_at": 1721764800, - "fine_tuned_model": null, - "organization_id": "org-123", - "result_files": [], - "status": "queued", - "validation_file": null, - "training_file": "file-abc123", - } - - title: Epochs - request: - curl: | - curl https://api.openai.com/v1/fine_tuning/jobs \ - -H "Content-Type: application/json" \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -d '{ - "training_file": "file-abc123", - "model": "gpt-4o-mini", - "hyperparameters": { - "n_epochs": 2 + request: + curl: | + curl https://api.openai.com/v1/evals/eval_67e579652b548190aaa83ada4b125f47/runs \ + -X POST \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -d '{"name":"gpt-4o-mini","data_source":{"type":"completions","input_messages":{"type":"template","template":[{"role":"developer","content":"Categorize a given news headline into one of the following topics: Technology, Markets, World, Business, or Sports.\n\n# Steps\n\n1. Analyze the content of the news headline to understand its primary focus.\n2. Extract the subject matter, identifying any key indicators or keywords.\n3. Use the identified indicators to determine the most suitable category out of the five options: Technology, Markets, World, Business, or Sports.\n4. Ensure only one category is selected per headline.\n\n# Output Format\n\nRespond with the chosen category as a single word. For instance: \"Technology\", \"Markets\", \"World\", \"Business\", or \"Sports\".\n\n# Examples\n\n**Input**: \"Apple Unveils New iPhone Model, Featuring Advanced AI Features\" \n**Output**: \"Technology\"\n\n**Input**: \"Global Stocks Mixed as Investors Await Central Bank Decisions\" \n**Output**: \"Markets\"\n\n**Input**: \"War in Ukraine: Latest Updates on Negotiation Status\" \n**Output**: \"World\"\n\n**Input**: \"Microsoft in Talks to Acquire Gaming Company for $2 Billion\" \n**Output**: \"Business\"\n\n**Input**: \"Manchester United Secures Win in Premier League Football Match\" \n**Output**: \"Sports\" \n\n# Notes\n\n- If the headline appears to fit into more than one category, choose the most dominant theme.\n- Keywords or phrases such as \"stocks\", \"company acquisition\", \"match\", or technological brands can be good indicators for classification.\n"} , {"role":"user","content":"{{item.input}}"}]},"sampling_params":{"temperature":1,"max_completions_tokens":2048,"top_p":1,"seed":42},"model":"gpt-4o-mini","source":{"type":"file_content","content":[{"item":{"input":"Tech Company Launches Advanced Artificial Intelligence Platform","ground_truth":"Technology"}}]}}' + response: > + { + "object": "eval.run", + "id": "evalrun_67e57965b480819094274e3a32235e4c", + "eval_id": "eval_67e579652b548190aaa83ada4b125f47", + "report_url": "https://platform.openai.com/evaluations/eval_67e579652b548190aaa83ada4b125f47&run_id=evalrun_67e57965b480819094274e3a32235e4c", + "status": "queued", + "model": "gpt-4o-mini", + "name": "gpt-4o-mini", + "created_at": 1743092069, + "result_counts": { + "total": 0, + "errored": 0, + "failed": 0, + "passed": 0 + }, + "per_model_usage": null, + "per_testing_criteria_results": null, + "data_source": { + "type": "completions", + "source": { + "type": "file_content", + "content": [ + { + "item": { + "input": "Tech Company Launches Advanced Artificial Intelligence Platform", + "ground_truth": "Technology" + } } - }' - python: | - from openai import OpenAI - client = OpenAI() - - client.fine_tuning.jobs.create( - training_file="file-abc123", - model="gpt-4o-mini", - hyperparameters={ - "n_epochs":2 - } - ) - node.js: | - import OpenAI from "openai"; - - const openai = new OpenAI(); - - async function main() { - const fineTune = await openai.fineTuning.jobs.create({ - training_file: "file-abc123", - model: "gpt-4o-mini", - hyperparameters: { n_epochs: 2 } - }); - - console.log(fineTune); - } - - main(); - response: | - { - "object": "fine_tuning.job", - "id": "ftjob-abc123", - "model": "gpt-4o-mini-2024-07-18", - "created_at": 1721764800, - "fine_tuned_model": null, - "organization_id": "org-123", - "result_files": [], - "status": "queued", - "validation_file": null, - "training_file": "file-abc123", - "hyperparameters": {"n_epochs": 2}, - } - - title: Validation file - request: - curl: | - curl https://api.openai.com/v1/fine_tuning/jobs \ - -H "Content-Type: application/json" \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -d '{ - "training_file": "file-abc123", - "validation_file": "file-abc123", - "model": "gpt-4o-mini" - }' - python: | - from openai import OpenAI - client = OpenAI() - - client.fine_tuning.jobs.create( - training_file="file-abc123", - validation_file="file-def456", - model="gpt-4o-mini" - ) - node.js: | - import OpenAI from "openai"; - - const openai = new OpenAI(); - - async function main() { - const fineTune = await openai.fineTuning.jobs.create({ - training_file: "file-abc123", - validation_file: "file-abc123" - }); - - console.log(fineTune); - } - - main(); - response: | - { - "object": "fine_tuning.job", - "id": "ftjob-abc123", - "model": "gpt-4o-mini-2024-07-18", - "created_at": 1721764800, - "fine_tuned_model": null, - "organization_id": "org-123", - "result_files": [], - "status": "queued", - "validation_file": "file-abc123", - "training_file": "file-abc123", - } - - title: W&B Integration - request: - curl: | - curl https://api.openai.com/v1/fine_tuning/jobs \ - -H "Content-Type: application/json" \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -d '{ - "training_file": "file-abc123", - "validation_file": "file-abc123", - "model": "gpt-4o-mini", - "integrations": [ - { - "type": "wandb", - "wandb": { - "project": "my-wandb-project", - "name": "ft-run-display-name" - "tags": [ - "first-experiment", "v2" - ] - } + ] + }, + "input_messages": { + "type": "template", + "template": [ + { + "type": "message", + "role": "developer", + "content": { + "type": "input_text", + "text": "Categorize a given news headline into one of the following topics: Technology, Markets, World, Business, or Sports.\n\n# Steps\n\n1. Analyze the content of the news headline to understand its primary focus.\n2. Extract the subject matter, identifying any key indicators or keywords.\n3. Use the identified indicators to determine the most suitable category out of the five options: Technology, Markets, World, Business, or Sports.\n4. Ensure only one category is selected per headline.\n\n# Output Format\n\nRespond with the chosen category as a single word. For instance: \"Technology\", \"Markets\", \"World\", \"Business\", or \"Sports\".\n\n# Examples\n\n**Input**: \"Apple Unveils New iPhone Model, Featuring Advanced AI Features\" \n**Output**: \"Technology\"\n\n**Input**: \"Global Stocks Mixed as Investors Await Central Bank Decisions\" \n**Output**: \"Markets\"\n\n**Input**: \"War in Ukraine: Latest Updates on Negotiation Status\" \n**Output**: \"World\"\n\n**Input**: \"Microsoft in Talks to Acquire Gaming Company for $2 Billion\" \n**Output**: \"Business\"\n\n**Input**: \"Manchester United Secures Win in Premier League Football Match\" \n**Output**: \"Sports\" \n\n# Notes\n\n- If the headline appears to fit into more than one category, choose the most dominant theme.\n- Keywords or phrases such as \"stocks\", \"company acquisition\", \"match\", or technological brands can be good indicators for classification.\n" + } + }, + { + "type": "message", + "role": "user", + "content": { + "type": "input_text", + "text": "{{item.input}}" } - ] - }' - response: | - { - "object": "fine_tuning.job", - "id": "ftjob-abc123", - "model": "gpt-4o-mini-2024-07-18", - "created_at": 1721764800, - "fine_tuned_model": null, - "organization_id": "org-123", - "result_files": [], - "status": "queued", - "validation_file": "file-abc123", - "training_file": "file-abc123", - "integrations": [ - { - "type": "wandb", - "wandb": { - "project": "my-wandb-project", - "entity": None, - "run_id": "ftjob-abc123" } - } - ] - } + ] + }, + "model": "gpt-4o-mini", + "sampling_params": { + "seed": 42, + "temperature": 1.0, + "top_p": 1.0, + "max_completions_tokens": 2048 + } + }, + "error": null, + "metadata": {} + } + /evals/{eval_id}/runs/{run_id}: get: - operationId: listPaginatedFineTuningJobs + operationId: getEvalRun tags: - - Fine-tuning + - Evals summary: | - List your organization's fine-tuning jobs + Get an evaluation run by ID. parameters: - - name: after - in: query - description: Identifier for the last job from the previous pagination request. - required: false + - name: eval_id + in: path + required: true schema: type: string - - name: limit - in: query - description: Number of fine-tuning jobs to retrieve. - required: false + description: The ID of the evaluation to retrieve runs for. + - name: run_id + in: path + required: true schema: - type: integer - default: 20 + type: string + description: The ID of the run to retrieve. responses: "200": - description: OK + description: The evaluation run content: application/json: schema: - $ref: "#/components/schemas/ListPaginatedFineTuningJobsResponse" + $ref: "#/components/schemas/EvalRun" x-oaiMeta: - name: List fine-tuning jobs - group: fine-tuning - returns: A list of paginated [fine-tuning - job](/docs/api-reference/fine-tuning/object) objects. + name: Get an eval run + group: evals + returns: The [EvalRun](/docs/api-reference/evals/run-object) object matching the + specified ID. + path: get examples: request: curl: | - curl https://api.openai.com/v1/fine_tuning/jobs?limit=2 \ - -H "Authorization: Bearer $OPENAI_API_KEY" - python: | - from openai import OpenAI - client = OpenAI() - - client.fine_tuning.jobs.list() - node.js: |- - import OpenAI from "openai"; - - const openai = new OpenAI(); - - async function main() { - const list = await openai.fineTuning.jobs.list(); - - for await (const fineTune of list) { - console.log(fineTune); - } - } - - main(); + curl https://api.openai.com/v1/evals/eval_67abd54d9b0081909a86353f6fb9317a/runs/evalrun_67abd54d60ec8190832b46859da808f7 \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" response: > { - "object": "list", - "data": [ - { - "object": "fine_tuning.job.event", - "id": "ft-event-TjX0lMfOniCZX64t9PUQT5hn", - "created_at": 1689813489, - "level": "warn", - "message": "Fine tuning process stopping due to job cancellation", - "data": null, - "type": "message" + "object": "eval.run", + "id": "evalrun_67abd54d60ec8190832b46859da808f7", + "eval_id": "eval_67abd54d9b0081909a86353f6fb9317a", + "report_url": "https://platform.openai.com/evaluations/eval_67abd54d9b0081909a86353f6fb9317a?run_id=evalrun_67abd54d60ec8190832b46859da808f7", + "status": "queued", + "model": "gpt-4o-mini", + "name": "gpt-4o-mini", + "created_at": 1743092069, + "result_counts": { + "total": 0, + "errored": 0, + "failed": 0, + "passed": 0 + }, + "per_model_usage": null, + "per_testing_criteria_results": null, + "data_source": { + "type": "completions", + "source": { + "type": "file_content", + "content": [ + { + "item": { + "input": "Tech Company Launches Advanced Artificial Intelligence Platform", + "ground_truth": "Technology" + } + }, + { + "item": { + "input": "Central Bank Increases Interest Rates Amid Inflation Concerns", + "ground_truth": "Markets" + } + }, + { + "item": { + "input": "International Summit Addresses Climate Change Strategies", + "ground_truth": "World" + } + }, + { + "item": { + "input": "Major Retailer Reports Record-Breaking Holiday Sales", + "ground_truth": "Business" + } + }, + { + "item": { + "input": "National Team Qualifies for World Championship Finals", + "ground_truth": "Sports" + } + }, + { + "item": { + "input": "Stock Markets Rally After Positive Economic Data Released", + "ground_truth": "Markets" + } + }, + { + "item": { + "input": "Global Manufacturer Announces Merger with Competitor", + "ground_truth": "Business" + } + }, + { + "item": { + "input": "Breakthrough in Renewable Energy Technology Unveiled", + "ground_truth": "Technology" + } + }, + { + "item": { + "input": "World Leaders Sign Historic Climate Agreement", + "ground_truth": "World" + } + }, + { + "item": { + "input": "Professional Athlete Sets New Record in Championship Event", + "ground_truth": "Sports" + } + }, + { + "item": { + "input": "Financial Institutions Adapt to New Regulatory Requirements", + "ground_truth": "Business" + } + }, + { + "item": { + "input": "Tech Conference Showcases Advances in Artificial Intelligence", + "ground_truth": "Technology" + } + }, + { + "item": { + "input": "Global Markets Respond to Oil Price Fluctuations", + "ground_truth": "Markets" + } + }, + { + "item": { + "input": "International Cooperation Strengthened Through New Treaty", + "ground_truth": "World" + } + }, + { + "item": { + "input": "Sports League Announces Revised Schedule for Upcoming Season", + "ground_truth": "Sports" + } + } + ] }, - { ... }, - { ... } - ], "has_more": true + "input_messages": { + "type": "template", + "template": [ + { + "type": "message", + "role": "developer", + "content": { + "type": "input_text", + "text": "Categorize a given news headline into one of the following topics: Technology, Markets, World, Business, or Sports.\n\n# Steps\n\n1. Analyze the content of the news headline to understand its primary focus.\n2. Extract the subject matter, identifying any key indicators or keywords.\n3. Use the identified indicators to determine the most suitable category out of the five options: Technology, Markets, World, Business, or Sports.\n4. Ensure only one category is selected per headline.\n\n# Output Format\n\nRespond with the chosen category as a single word. For instance: \"Technology\", \"Markets\", \"World\", \"Business\", or \"Sports\".\n\n# Examples\n\n**Input**: \"Apple Unveils New iPhone Model, Featuring Advanced AI Features\" \n**Output**: \"Technology\"\n\n**Input**: \"Global Stocks Mixed as Investors Await Central Bank Decisions\" \n**Output**: \"Markets\"\n\n**Input**: \"War in Ukraine: Latest Updates on Negotiation Status\" \n**Output**: \"World\"\n\n**Input**: \"Microsoft in Talks to Acquire Gaming Company for $2 Billion\" \n**Output**: \"Business\"\n\n**Input**: \"Manchester United Secures Win in Premier League Football Match\" \n**Output**: \"Sports\" \n\n# Notes\n\n- If the headline appears to fit into more than one category, choose the most dominant theme.\n- Keywords or phrases such as \"stocks\", \"company acquisition\", \"match\", or technological brands can be good indicators for classification.\n" + } + }, + { + "type": "message", + "role": "user", + "content": { + "type": "input_text", + "text": "{{item.input}}" + } + } + ] + }, + "model": "gpt-4o-mini", + "sampling_params": { + "seed": 42, + "temperature": 1.0, + "top_p": 1.0, + "max_completions_tokens": 2048 + } + }, + "error": null, + "metadata": {} } - /fine_tuning/jobs/{fine_tuning_job_id}: - get: - operationId: retrieveFineTuningJob + post: + operationId: cancelEvalRun tags: - - Fine-tuning + - Evals summary: | - Get info about a fine-tuning job. - - [Learn more about fine-tuning](/docs/guides/fine-tuning) + Cancel an ongoing evaluation run. parameters: - - in: path - name: fine_tuning_job_id + - name: eval_id + in: path required: true schema: type: string - example: ft-AF1WoRqd3aJAHsqc9NY7iL8F - description: | - The ID of the fine-tuning job. + description: The ID of the evaluation whose run you want to cancel. + - name: run_id + in: path + required: true + schema: + type: string + description: The ID of the run to cancel. responses: "200": - description: OK + description: The canceled eval run object content: application/json: schema: - $ref: "#/components/schemas/FineTuningJob" + $ref: "#/components/schemas/EvalRun" x-oaiMeta: - name: Retrieve fine-tuning job - group: fine-tuning - returns: The [fine-tuning](/docs/api-reference/fine-tuning/object) object with - the given ID. + name: Cancel eval run + group: evals + returns: The updated [EvalRun](/docs/api-reference/evals/run-object) object + reflecting that the run is canceled. + path: post examples: request: - curl: > - curl - https://api.openai.com/v1/fine_tuning/jobs/ft-AF1WoRqd3aJAHsqc9NY7iL8F - \ - -H "Authorization: Bearer $OPENAI_API_KEY" - python: | - from openai import OpenAI - client = OpenAI() - - client.fine_tuning.jobs.retrieve("ftjob-abc123") - node.js: > - import OpenAI from "openai"; - - - const openai = new OpenAI(); - - - async function main() { - const fineTune = await openai.fineTuning.jobs.retrieve("ftjob-abc123"); - - console.log(fineTune); - } - - - main(); + curl: | + curl https://api.openai.com/v1/evals/eval_67abd54d9b0081909a86353f6fb9317a/runs/evalrun_67abd54d60ec8190832b46859da808f7/cancel \ + -X POST \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" response: > { - "object": "fine_tuning.job", - "id": "ftjob-abc123", - "model": "davinci-002", - "created_at": 1692661014, - "finished_at": 1692661190, - "fine_tuned_model": "ft:davinci-002:my-org:custom_suffix:7q8mpxmy", - "organization_id": "org-123", - "result_files": [ - "file-abc123" - ], - "status": "succeeded", - "validation_file": null, - "training_file": "file-abc123", - "hyperparameters": { - "n_epochs": 4, - "batch_size": 1, - "learning_rate_multiplier": 1.0 + "object": "eval.run", + "id": "evalrun_67abd54d60ec8190832b46859da808f7", + "eval_id": "eval_67abd54d9b0081909a86353f6fb9317a", + "report_url": "https://platform.openai.com/evaluations/eval_67abd54d9b0081909a86353f6fb9317a?run_id=evalrun_67abd54d60ec8190832b46859da808f7", + "status": "canceled", + "model": "gpt-4o-mini", + "name": "gpt-4o-mini", + "created_at": 1743092069, + "result_counts": { + "total": 0, + "errored": 0, + "failed": 0, + "passed": 0 }, - "trained_tokens": 5768, - "integrations": [], - "seed": 0, - "estimated_finish": 0 + "per_model_usage": null, + "per_testing_criteria_results": null, + "data_source": { + "type": "completions", + "source": { + "type": "file_content", + "content": [ + { + "item": { + "input": "Tech Company Launches Advanced Artificial Intelligence Platform", + "ground_truth": "Technology" + } + }, + { + "item": { + "input": "Central Bank Increases Interest Rates Amid Inflation Concerns", + "ground_truth": "Markets" + } + }, + { + "item": { + "input": "International Summit Addresses Climate Change Strategies", + "ground_truth": "World" + } + }, + { + "item": { + "input": "Major Retailer Reports Record-Breaking Holiday Sales", + "ground_truth": "Business" + } + }, + { + "item": { + "input": "National Team Qualifies for World Championship Finals", + "ground_truth": "Sports" + } + }, + { + "item": { + "input": "Stock Markets Rally After Positive Economic Data Released", + "ground_truth": "Markets" + } + }, + { + "item": { + "input": "Global Manufacturer Announces Merger with Competitor", + "ground_truth": "Business" + } + }, + { + "item": { + "input": "Breakthrough in Renewable Energy Technology Unveiled", + "ground_truth": "Technology" + } + }, + { + "item": { + "input": "World Leaders Sign Historic Climate Agreement", + "ground_truth": "World" + } + }, + { + "item": { + "input": "Professional Athlete Sets New Record in Championship Event", + "ground_truth": "Sports" + } + }, + { + "item": { + "input": "Financial Institutions Adapt to New Regulatory Requirements", + "ground_truth": "Business" + } + }, + { + "item": { + "input": "Tech Conference Showcases Advances in Artificial Intelligence", + "ground_truth": "Technology" + } + }, + { + "item": { + "input": "Global Markets Respond to Oil Price Fluctuations", + "ground_truth": "Markets" + } + }, + { + "item": { + "input": "International Cooperation Strengthened Through New Treaty", + "ground_truth": "World" + } + }, + { + "item": { + "input": "Sports League Announces Revised Schedule for Upcoming Season", + "ground_truth": "Sports" + } + } + ] + }, + "input_messages": { + "type": "template", + "template": [ + { + "type": "message", + "role": "developer", + "content": { + "type": "input_text", + "text": "Categorize a given news headline into one of the following topics: Technology, Markets, World, Business, or Sports.\n\n# Steps\n\n1. Analyze the content of the news headline to understand its primary focus.\n2. Extract the subject matter, identifying any key indicators or keywords.\n3. Use the identified indicators to determine the most suitable category out of the five options: Technology, Markets, World, Business, or Sports.\n4. Ensure only one category is selected per headline.\n\n# Output Format\n\nRespond with the chosen category as a single word. For instance: \"Technology\", \"Markets\", \"World\", \"Business\", or \"Sports\".\n\n# Examples\n\n**Input**: \"Apple Unveils New iPhone Model, Featuring Advanced AI Features\" \n**Output**: \"Technology\"\n\n**Input**: \"Global Stocks Mixed as Investors Await Central Bank Decisions\" \n**Output**: \"Markets\"\n\n**Input**: \"War in Ukraine: Latest Updates on Negotiation Status\" \n**Output**: \"World\"\n\n**Input**: \"Microsoft in Talks to Acquire Gaming Company for $2 Billion\" \n**Output**: \"Business\"\n\n**Input**: \"Manchester United Secures Win in Premier League Football Match\" \n**Output**: \"Sports\" \n\n# Notes\n\n- If the headline appears to fit into more than one category, choose the most dominant theme.\n- Keywords or phrases such as \"stocks\", \"company acquisition\", \"match\", or technological brands can be good indicators for classification.\n" + } + }, + { + "type": "message", + "role": "user", + "content": { + "type": "input_text", + "text": "{{item.input}}" + } + } + ] + }, + "model": "gpt-4o-mini", + "sampling_params": { + "seed": 42, + "temperature": 1.0, + "top_p": 1.0, + "max_completions_tokens": 2048 + } + }, + "error": null, + "metadata": {} } - /fine_tuning/jobs/{fine_tuning_job_id}/cancel: - post: - operationId: cancelFineTuningJob + delete: + operationId: deleteEvalRun tags: - - Fine-tuning + - Evals summary: | - Immediately cancel a fine-tune job. + Delete an eval run. parameters: - - in: path - name: fine_tuning_job_id + - name: eval_id + in: path required: true schema: type: string - example: ft-AF1WoRqd3aJAHsqc9NY7iL8F - description: | - The ID of the fine-tuning job to cancel. + description: The ID of the evaluation to delete the run from. + - name: run_id + in: path + required: true + schema: + type: string + description: The ID of the run to delete. responses: "200": - description: OK + description: Successfully deleted the eval run content: application/json: schema: - $ref: "#/components/schemas/FineTuningJob" + type: object + properties: + object: + type: string + example: eval.run.deleted + deleted: + type: boolean + example: true + run_id: + type: string + example: evalrun_677469f564d48190807532a852da3afb + "404": + description: Run not found + content: + application/json: + schema: + $ref: "#/components/schemas/Error" x-oaiMeta: - name: Cancel fine-tuning - group: fine-tuning - returns: The cancelled [fine-tuning](/docs/api-reference/fine-tuning/object) - object. + name: Delete eval run + group: evals + returns: An object containing the status of the delete operation. + path: delete examples: request: curl: > - curl -X POST - https://api.openai.com/v1/fine_tuning/jobs/ftjob-abc123/cancel \ - -H "Authorization: Bearer $OPENAI_API_KEY" - python: | - from openai import OpenAI - client = OpenAI() - - client.fine_tuning.jobs.cancel("ftjob-abc123") - node.js: >- - import OpenAI from "openai"; - - - const openai = new OpenAI(); - - - async function main() { - const fineTune = await openai.fineTuning.jobs.cancel("ftjob-abc123"); - - console.log(fineTune); - } - - main(); + curl + https://api.openai.com/v1/evals/eval_123abc/runs/evalrun_abc456 \ + -X DELETE \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" response: | { - "object": "fine_tuning.job", - "id": "ftjob-abc123", - "model": "gpt-4o-mini-2024-07-18", - "created_at": 1721764800, - "fine_tuned_model": null, - "organization_id": "org-123", - "result_files": [], - "hyperparameters": { - "n_epochs": "auto" - }, - "status": "cancelled", - "validation_file": "file-abc123", - "training_file": "file-abc123" + "object": "eval.run.deleted", + "deleted": true, + "run_id": "evalrun_abc456" } - /fine_tuning/jobs/{fine_tuning_job_id}/checkpoints: + /evals/{eval_id}/runs/{run_id}/output_items: get: - operationId: listFineTuningJobCheckpoints + operationId: getEvalRunOutputItems tags: - - Fine-tuning + - Evals summary: | - List checkpoints for a fine-tuning job. + Get a list of output items for an evaluation run. parameters: - - in: path - name: fine_tuning_job_id + - name: eval_id + in: path required: true schema: type: string - example: ft-AF1WoRqd3aJAHsqc9NY7iL8F - description: | - The ID of the fine-tuning job to get checkpoints for. + description: The ID of the evaluation to retrieve runs for. + - name: run_id + in: path + required: true + schema: + type: string + description: The ID of the run to retrieve output items for. - name: after in: query - description: Identifier for the last checkpoint ID from the previous pagination + description: Identifier for the last output item from the previous pagination request. required: false schema: type: string - name: limit in: query - description: Number of checkpoints to retrieve. + description: Number of output items to retrieve. required: false schema: type: integer - default: 10 + default: 20 + - name: status + in: query + description: > + Filter output items by status. Use `failed` to filter by failed + output + + items or `pass` to filter by passed output items. + required: false + schema: + type: string + enum: + - fail + - pass + - name: order + in: query + description: Sort order for output items by timestamp. Use `asc` for ascending + order or `desc` for descending order. Defaults to `asc`. + required: false + schema: + type: string + enum: + - asc + - desc + default: asc responses: "200": - description: OK + description: A list of output items for the evaluation run content: application/json: schema: - $ref: "#/components/schemas/ListFineTuningJobCheckpointsResponse" + $ref: "#/components/schemas/EvalRunOutputItemList" x-oaiMeta: - name: List fine-tuning checkpoints - group: fine-tuning - returns: A list of fine-tuning [checkpoint - objects](/docs/api-reference/fine-tuning/checkpoint-object) for a - fine-tuning job. + name: Get eval run output items + group: evals + returns: A list of + [EvalRunOutputItem](/docs/api-reference/evals/run-output-item-object) + objects matching the specified ID. + path: get examples: request: - curl: > - curl - https://api.openai.com/v1/fine_tuning/jobs/ftjob-abc123/checkpoints - \ - -H "Authorization: Bearer $OPENAI_API_KEY" + curl: | + curl https://api.openai.com/v1/evals/egroup_67abd54d9b0081909a86353f6fb9317a/runs/erun_67abd54d60ec8190832b46859da808f7/output_items \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" response: > { - "object": "list" + "object": "list", "data": [ { - "object": "fine_tuning.job.checkpoint", - "id": "ftckpt_zc4Q7MP6XxulcVzj4MZdwsAB", - "created_at": 1721764867, - "fine_tuned_model_checkpoint": "ft:gpt-4o-mini-2024-07-18:my-org:custom-suffix:96olL566:ckpt-step-2000", - "metrics": { - "full_valid_loss": 0.134, - "full_valid_mean_token_accuracy": 0.874 - }, - "fine_tuning_job_id": "ftjob-abc123", - "step_number": 2000, - }, - { - "object": "fine_tuning.job.checkpoint", - "id": "ftckpt_enQCFmOTGj3syEpYVhBRLTSy", - "created_at": 1721764800, - "fine_tuned_model_checkpoint": "ft:gpt-4o-mini-2024-07-18:my-org:custom-suffix:7q8mpxmy:ckpt-step-1000", - "metrics": { - "full_valid_loss": 0.167, - "full_valid_mean_token_accuracy": 0.781 + "object": "eval.run.output_item", + "id": "outputitem_67e5796c28e081909917bf79f6e6214d", + "created_at": 1743092076, + "run_id": "evalrun_67abd54d60ec8190832b46859da808f7", + "eval_id": "eval_67abd54d9b0081909a86353f6fb9317a", + "status": "pass", + "datasource_item_id": 5, + "datasource_item": { + "input": "Stock Markets Rally After Positive Economic Data Released", + "ground_truth": "Markets" }, - "fine_tuning_job_id": "ftjob-abc123", - "step_number": 1000, - }, + "results": [ + { + "name": "String check-a2486074-d803-4445-b431-ad2262e85d47", + "sample": null, + "passed": true, + "score": 1.0 + } + ], + "sample": { + "input": [ + { + "role": "developer", + "content": "Categorize a given news headline into one of the following topics: Technology, Markets, World, Business, or Sports.\n\n# Steps\n\n1. Analyze the content of the news headline to understand its primary focus.\n2. Extract the subject matter, identifying any key indicators or keywords.\n3. Use the identified indicators to determine the most suitable category out of the five options: Technology, Markets, World, Business, or Sports.\n4. Ensure only one category is selected per headline.\n\n# Output Format\n\nRespond with the chosen category as a single word. For instance: \"Technology\", \"Markets\", \"World\", \"Business\", or \"Sports\".\n\n# Examples\n\n**Input**: \"Apple Unveils New iPhone Model, Featuring Advanced AI Features\" \n**Output**: \"Technology\"\n\n**Input**: \"Global Stocks Mixed as Investors Await Central Bank Decisions\" \n**Output**: \"Markets\"\n\n**Input**: \"War in Ukraine: Latest Updates on Negotiation Status\" \n**Output**: \"World\"\n\n**Input**: \"Microsoft in Talks to Acquire Gaming Company for $2 Billion\" \n**Output**: \"Business\"\n\n**Input**: \"Manchester United Secures Win in Premier League Football Match\" \n**Output**: \"Sports\" \n\n# Notes\n\n- If the headline appears to fit into more than one category, choose the most dominant theme.\n- Keywords or phrases such as \"stocks\", \"company acquisition\", \"match\", or technological brands can be good indicators for classification.\n", + "tool_call_id": null, + "tool_calls": null, + "function_call": null + }, + { + "role": "user", + "content": "Stock Markets Rally After Positive Economic Data Released", + "tool_call_id": null, + "tool_calls": null, + "function_call": null + } + ], + "output": [ + { + "role": "assistant", + "content": "Markets", + "tool_call_id": null, + "tool_calls": null, + "function_call": null + } + ], + "finish_reason": "stop", + "model": "gpt-4o-mini-2024-07-18", + "usage": { + "total_tokens": 325, + "completion_tokens": 2, + "prompt_tokens": 323, + "cached_tokens": 0 + }, + "error": null, + "temperature": 1.0, + "max_completion_tokens": 2048, + "top_p": 1.0, + "seed": 42 + } + } ], - "first_id": "ftckpt_zc4Q7MP6XxulcVzj4MZdwsAB", - "last_id": "ftckpt_enQCFmOTGj3syEpYVhBRLTSy", + "first_id": "outputitem_67e5796c28e081909917bf79f6e6214d", + "last_id": "outputitem_67e5796c28e081909917bf79f6e6214d", "has_more": true } - /fine_tuning/jobs/{fine_tuning_job_id}/events: + /evals/{eval_id}/runs/{run_id}/output_items/{output_item_id}: get: - operationId: listFineTuningEvents + operationId: getEvalRunOutputItem tags: - - Fine-tuning + - Evals summary: | - Get status updates for a fine-tuning job. + Get an evaluation run output item by ID. parameters: - - in: path - name: fine_tuning_job_id + - name: eval_id + in: path required: true schema: type: string - example: ft-AF1WoRqd3aJAHsqc9NY7iL8F - description: | - The ID of the fine-tuning job to get events for. - - name: after - in: query - description: Identifier for the last event from the previous pagination request. + description: The ID of the evaluation to retrieve runs for. + - name: run_id + in: path + required: true + schema: + type: string + description: The ID of the run to retrieve. + - name: output_item_id + in: path + required: true + schema: + type: string + description: The ID of the output item to retrieve. + responses: + "200": + description: The evaluation run output item + content: + application/json: + schema: + $ref: "#/components/schemas/EvalRunOutputItem" + x-oaiMeta: + name: Get an output item of an eval run + group: evals + returns: The + [EvalRunOutputItem](/docs/api-reference/evals/run-output-item-object) + object matching the specified ID. + path: get + examples: + request: + curl: | + curl https://api.openai.com/v1/evals/eval_67abd54d9b0081909a86353f6fb9317a/runs/evalrun_67abd54d60ec8190832b46859da808f7/output_items/outputitem_67abd55eb6548190bb580745d5644a33 \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" + response: > + { + "object": "eval.run.output_item", + "id": "outputitem_67e5796c28e081909917bf79f6e6214d", + "created_at": 1743092076, + "run_id": "evalrun_67abd54d60ec8190832b46859da808f7", + "eval_id": "eval_67abd54d9b0081909a86353f6fb9317a", + "status": "pass", + "datasource_item_id": 5, + "datasource_item": { + "input": "Stock Markets Rally After Positive Economic Data Released", + "ground_truth": "Markets" + }, + "results": [ + { + "name": "String check-a2486074-d803-4445-b431-ad2262e85d47", + "sample": null, + "passed": true, + "score": 1.0 + } + ], + "sample": { + "input": [ + { + "role": "developer", + "content": "Categorize a given news headline into one of the following topics: Technology, Markets, World, Business, or Sports.\n\n# Steps\n\n1. Analyze the content of the news headline to understand its primary focus.\n2. Extract the subject matter, identifying any key indicators or keywords.\n3. Use the identified indicators to determine the most suitable category out of the five options: Technology, Markets, World, Business, or Sports.\n4. Ensure only one category is selected per headline.\n\n# Output Format\n\nRespond with the chosen category as a single word. For instance: \"Technology\", \"Markets\", \"World\", \"Business\", or \"Sports\".\n\n# Examples\n\n**Input**: \"Apple Unveils New iPhone Model, Featuring Advanced AI Features\" \n**Output**: \"Technology\"\n\n**Input**: \"Global Stocks Mixed as Investors Await Central Bank Decisions\" \n**Output**: \"Markets\"\n\n**Input**: \"War in Ukraine: Latest Updates on Negotiation Status\" \n**Output**: \"World\"\n\n**Input**: \"Microsoft in Talks to Acquire Gaming Company for $2 Billion\" \n**Output**: \"Business\"\n\n**Input**: \"Manchester United Secures Win in Premier League Football Match\" \n**Output**: \"Sports\" \n\n# Notes\n\n- If the headline appears to fit into more than one category, choose the most dominant theme.\n- Keywords or phrases such as \"stocks\", \"company acquisition\", \"match\", or technological brands can be good indicators for classification.\n", + "tool_call_id": null, + "tool_calls": null, + "function_call": null + }, + { + "role": "user", + "content": "Stock Markets Rally After Positive Economic Data Released", + "tool_call_id": null, + "tool_calls": null, + "function_call": null + } + ], + "output": [ + { + "role": "assistant", + "content": "Markets", + "tool_call_id": null, + "tool_calls": null, + "function_call": null + } + ], + "finish_reason": "stop", + "model": "gpt-4o-mini-2024-07-18", + "usage": { + "total_tokens": 325, + "completion_tokens": 2, + "prompt_tokens": 323, + "cached_tokens": 0 + }, + "error": null, + "temperature": 1.0, + "max_completion_tokens": 2048, + "top_p": 1.0, + "seed": 42 + } + } + /files: + get: + operationId: listFiles + tags: + - Files + summary: Returns a list of files. + parameters: + - in: query + name: purpose required: false schema: type: string + description: Only return files with the given purpose. - name: limit in: query - description: Number of events to retrieve. + description: > + A limit on the number of objects to be returned. Limit can range + between 1 and 10,000, and the default is 10,000. required: false schema: type: integer - default: 20 + default: 10000 + - name: order + in: query + description: > + Sort order by the `created_at` timestamp of the objects. `asc` for + ascending order and `desc` for descending order. + schema: + type: string + default: desc + enum: + - asc + - desc + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. + schema: + type: string responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/ListFineTuningJobEventsResponse" + $ref: "#/components/schemas/ListFilesResponse" x-oaiMeta: - name: List fine-tuning events - group: fine-tuning - returns: A list of fine-tuning event objects. + name: List files + group: files + returns: A list of [File](/docs/api-reference/files/object) objects. examples: request: - curl: > - curl - https://api.openai.com/v1/fine_tuning/jobs/ftjob-abc123/events \ + curl: | + curl https://api.openai.com/v1/files \ -H "Authorization: Bearer $OPENAI_API_KEY" python: | from openai import OpenAI client = OpenAI() - client.fine_tuning.jobs.list_events( - fine_tuning_job_id="ftjob-abc123", - limit=2 - ) - node.js: >- + client.files.list() + node.js: |- import OpenAI from "openai"; - const openai = new OpenAI(); - async function main() { - const list = await openai.fineTuning.list_events(id="ftjob-abc123", limit=2); + const list = await openai.files.list(); - for await (const fineTune of list) { - console.log(fineTune); + for await (const file of list) { + console.log(file); } } - main(); - response: > + response: | { - "object": "list", "data": [ { - "object": "fine_tuning.job.event", - "id": "ft-event-ddTJfwuMVpfLXseO0Am0Gqjm", - "created_at": 1721764800, - "level": "info", - "message": "Fine tuning job successfully completed", - "data": null, - "type": "message" + "id": "file-abc123", + "object": "file", + "bytes": 175, + "created_at": 1613677385, + "filename": "salesOverview.pdf", + "purpose": "assistants", }, { - "object": "fine_tuning.job.event", - "id": "ft-event-tyiGuB72evQncpH87xe505Sv", - "created_at": 1721764800, - "level": "info", - "message": "New fine-tuned model created: ft:gpt-4o-mini:openai::7p4lURel", - "data": null, - "type": "message" + "id": "file-abc123", + "object": "file", + "bytes": 140, + "created_at": 1613779121, + "filename": "puppy.jsonl", + "purpose": "fine-tune", } ], - "has_more": true + "object": "list" } - /images/edits: post: - operationId: createImageEdit + operationId: createFile tags: - - Images - summary: Creates an edited or extended image given an original image and a prompt. + - Files + summary: > + Upload a file that can be used across various endpoints. Individual + files can be up to 512 MB, and the size of all files uploaded by one + organization can be up to 100 GB. + + + The Assistants API supports files up to 2 million tokens and of specific + file types. See the [Assistants Tools guide](/docs/assistants/tools) for + details. + + + The Fine-tuning API only supports `.jsonl` files. The input also has + certain required formats for fine-tuning + [chat](/docs/api-reference/fine-tuning/chat-input) or + [completions](/docs/api-reference/fine-tuning/completions-input) models. + + + The Batch API only supports `.jsonl` files up to 200 MB in size. The + input also has a specific required + [format](/docs/api-reference/batch/request-input). + + + Please [contact us](https://help.openai.com/) if you need to increase + these storage limits. requestBody: required: true content: multipart/form-data: schema: - $ref: "#/components/schemas/CreateImageEditRequest" + $ref: "#/components/schemas/CreateFileRequest" responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/ImagesResponse" + $ref: "#/components/schemas/OpenAIFile" x-oaiMeta: - name: Create image edit - group: images - returns: Returns a list of [image](/docs/api-reference/images/object) objects. + name: Upload file + group: files + returns: The uploaded [File](/docs/api-reference/files/object) object. examples: request: curl: | - curl https://api.openai.com/v1/images/edits \ + curl https://api.openai.com/v1/files \ -H "Authorization: Bearer $OPENAI_API_KEY" \ - -F image="@otter.png" \ - -F mask="@mask.png" \ - -F prompt="A cute baby sea otter wearing a beret" \ - -F n=2 \ - -F size="1024x1024" + -F purpose="fine-tune" \ + -F file="@mydata.jsonl" python: | from openai import OpenAI client = OpenAI() - client.images.edit( - image=open("otter.png", "rb"), - mask=open("mask.png", "rb"), - prompt="A cute baby sea otter wearing a beret", - n=2, - size="1024x1024" + client.files.create( + file=open("mydata.jsonl", "rb"), + purpose="fine-tune" ) node.js: |- import fs from "fs"; @@ -3273,2104 +4865,2774 @@ paths: const openai = new OpenAI(); async function main() { - const image = await openai.images.edit({ - image: fs.createReadStream("otter.png"), - mask: fs.createReadStream("mask.png"), - prompt: "A cute baby sea otter wearing a beret", + const file = await openai.files.create({ + file: fs.createReadStream("mydata.jsonl"), + purpose: "fine-tune", }); - console.log(image.data); + console.log(file); } + main(); response: | { - "created": 1589478378, - "data": [ - { - "url": "https://..." - }, - { - "url": "https://..." - } - ] + "id": "file-abc123", + "object": "file", + "bytes": 120000, + "created_at": 1677610602, + "filename": "mydata.jsonl", + "purpose": "fine-tune", } - /images/generations: - post: - operationId: createImage + /files/{file_id}: + delete: + operationId: deleteFile tags: - - Images - summary: Creates an image given a prompt. - requestBody: - required: true - content: - application/json: - schema: - $ref: "#/components/schemas/CreateImageRequest" + - Files + summary: Delete a file. + parameters: + - in: path + name: file_id + required: true + schema: + type: string + description: The ID of the file to use for this request. responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/ImagesResponse" + $ref: "#/components/schemas/DeleteFileResponse" x-oaiMeta: - name: Create image - group: images - returns: Returns a list of [image](/docs/api-reference/images/object) objects. + name: Delete file + group: files + returns: Deletion status. examples: request: curl: | - curl https://api.openai.com/v1/images/generations \ - -H "Content-Type: application/json" \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -d '{ - "model": "dall-e-3", - "prompt": "A cute baby sea otter", - "n": 1, - "size": "1024x1024" - }' + curl https://api.openai.com/v1/files/file-abc123 \ + -X DELETE \ + -H "Authorization: Bearer $OPENAI_API_KEY" python: | from openai import OpenAI client = OpenAI() - client.images.generate( - model="dall-e-3", - prompt="A cute baby sea otter", - n=1, - size="1024x1024" - ) - node.js: >- + client.files.delete("file-abc123") + node.js: |- import OpenAI from "openai"; - const openai = new OpenAI(); - async function main() { - const image = await openai.images.generate({ model: "dall-e-3", prompt: "A cute baby sea otter" }); + const file = await openai.files.del("file-abc123"); - console.log(image.data); + console.log(file); } main(); response: | { - "created": 1589478378, - "data": [ - { - "url": "https://..." - }, - { - "url": "https://..." - } - ] + "id": "file-abc123", + "object": "file", + "deleted": true } - /images/variations: - post: - operationId: createImageVariation + get: + operationId: retrieveFile tags: - - Images - summary: Creates a variation of a given image. - requestBody: - required: true - content: - multipart/form-data: - schema: - $ref: "#/components/schemas/CreateImageVariationRequest" + - Files + summary: Returns information about a specific file. + parameters: + - in: path + name: file_id + required: true + schema: + type: string + description: The ID of the file to use for this request. responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/ImagesResponse" + $ref: "#/components/schemas/OpenAIFile" x-oaiMeta: - name: Create image variation - group: images - returns: Returns a list of [image](/docs/api-reference/images/object) objects. + name: Retrieve file + group: files + returns: The [File](/docs/api-reference/files/object) object matching the + specified ID. examples: request: curl: | - curl https://api.openai.com/v1/images/variations \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -F image="@otter.png" \ - -F n=2 \ - -F size="1024x1024" + curl https://api.openai.com/v1/files/file-abc123 \ + -H "Authorization: Bearer $OPENAI_API_KEY" python: | from openai import OpenAI client = OpenAI() - response = client.images.create_variation( - image=open("image_edit_original.png", "rb"), - n=2, - size="1024x1024" - ) + client.files.retrieve("file-abc123") node.js: |- - import fs from "fs"; import OpenAI from "openai"; const openai = new OpenAI(); async function main() { - const image = await openai.images.createVariation({ - image: fs.createReadStream("otter.png"), - }); + const file = await openai.files.retrieve("file-abc123"); - console.log(image.data); + console.log(file); } + main(); response: | { - "created": 1589478378, - "data": [ - { - "url": "https://..." - }, - { - "url": "https://..." - } - ] + "id": "file-abc123", + "object": "file", + "bytes": 120000, + "created_at": 1677610602, + "filename": "mydata.jsonl", + "purpose": "fine-tune", } - /models: + /files/{file_id}/content: get: - operationId: listModels + operationId: downloadFile tags: - - Models - summary: Lists the currently available models, and provides basic information - about each one such as the owner and availability. + - Files + summary: Returns the contents of the specified file. + parameters: + - in: path + name: file_id + required: true + schema: + type: string + description: The ID of the file to use for this request. responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/ListModelsResponse" + type: string x-oaiMeta: - name: List models - group: models - returns: A list of [model](/docs/api-reference/models/object) objects. + name: Retrieve file content + group: files + returns: The file content. examples: request: curl: | - curl https://api.openai.com/v1/models \ - -H "Authorization: Bearer $OPENAI_API_KEY" + curl https://api.openai.com/v1/files/file-abc123/content \ + -H "Authorization: Bearer $OPENAI_API_KEY" > file.jsonl python: | from openai import OpenAI client = OpenAI() - client.models.list() - node.js: |- + content = client.files.content("file-abc123") + node.js: | import OpenAI from "openai"; const openai = new OpenAI(); async function main() { - const list = await openai.models.list(); + const file = await openai.files.content("file-abc123"); - for await (const model of list) { - console.log(model); - } + console.log(file); } + main(); + /fine_tuning/alpha/graders/run: + post: + operationId: runGrader + tags: + - Fine-tuning + summary: | + Run a grader. + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/RunGraderRequest" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/RunGraderResponse" + x-oaiMeta: + name: Run grader + beta: true + group: graders + returns: The results from the grader run. + examples: + request: + curl: > + curl -X POST + https://api.openai.com/v1/fine_tuning/alpha/graders/run \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "grader": { + "type": "score_model", + "name": "Example score model grader", + "input": [ + { + "role": "user", + "content": "Score how close the reference answer is to the model answer. Score 1.0 if they are the same and 0.0 if they are different. Return just a floating point score\n\nReference answer: {{item.reference_answer}}\n\nModel answer: {{sample.output_text}}" + } + ], + "model": "gpt-4o-2024-08-06", + "sampling_params": { + "temperature": 1, + "top_p": 1, + "seed": 42 + } + }, + "reference_answer": "fuzzy wuzzy was a bear", + "model_sample": "fuzzy wuzzy was a bear" + }' response: | { - "object": "list", - "data": [ - { - "id": "model-id-0", - "object": "model", - "created": 1686935002, - "owned_by": "organization-owner" - }, - { - "id": "model-id-1", - "object": "model", - "created": 1686935002, - "owned_by": "organization-owner", + "reward": 1.0, + "metadata": { + "name": "Example score model grader", + "type": "score_model", + "errors": { + "formula_parse_error": false, + "sample_parse_error": false, + "truncated_observation_error": false, + "unresponsive_reward_error": false, + "invalid_variable_error": false, + "other_error": false, + "python_grader_server_error": false, + "python_grader_server_error_type": null, + "python_grader_runtime_error": false, + "python_grader_runtime_error_details": null, + "model_grader_server_error": false, + "model_grader_refusal_error": false, + "model_grader_parse_error": false, + "model_grader_server_error_details": null }, - { - "id": "model-id-2", - "object": "model", - "created": 1686935002, - "owned_by": "openai" + "execution_time": 4.365238428115845, + "scores": {}, + "token_usage": { + "prompt_tokens": 190, + "total_tokens": 324, + "completion_tokens": 134, + "cached_tokens": 0 }, - ], - "object": "list" + "sampled_model_name": "gpt-4o-2024-08-06" + }, + "sub_rewards": {}, + "model_grader_token_usage_per_model": { + "gpt-4o-2024-08-06": { + "prompt_tokens": 190, + "total_tokens": 324, + "completion_tokens": 134, + "cached_tokens": 0 + } + } } - /models/{model}: - get: - operationId: retrieveModel + /fine_tuning/alpha/graders/validate: + post: + operationId: validateGrader tags: - - Models - summary: Retrieves a model instance, providing basic information about the model - such as the owner and permissioning. - parameters: - - in: path - name: model - required: true - schema: - type: string - example: gpt-4o-mini - description: The ID of the model to use for this request + - Fine-tuning + summary: | + Validate a grader. + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/ValidateGraderRequest" responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/Model" + $ref: "#/components/schemas/ValidateGraderResponse" x-oaiMeta: - name: Retrieve model - group: models - returns: The [model](/docs/api-reference/models/object) object matching the - specified ID. + name: Validate grader + beta: true + group: graders + returns: The validated grader object. examples: request: - curl: | - curl https://api.openai.com/v1/models/VAR_model_id \ - -H "Authorization: Bearer $OPENAI_API_KEY" - python: | - from openai import OpenAI - client = OpenAI() - - client.models.retrieve("VAR_model_id") - node.js: |- - import OpenAI from "openai"; + curl: > + curl https://api.openai.com/v1/fine_tuning/alpha/graders/validate + \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "grader": { + "type": "string_check", + "name": "Example string check grader", + "input": "{{sample.output_text}}", + "reference": "{{item.label}}", + "operation": "eq" + } + }' + response: | + { + "grader": { + "type": "string_check", + "name": "Example string check grader", + "input": "{{sample.output_text}}", + "reference": "{{item.label}}", + "operation": "eq" + } + } + /fine_tuning/checkpoints/{fine_tuned_model_checkpoint}/permissions: + get: + operationId: listFineTuningCheckpointPermissions + tags: + - Fine-tuning + summary: > + **NOTE:** This endpoint requires an [admin API key](../admin-api-keys). - const openai = new OpenAI(); - async function main() { - const model = await openai.models.retrieve("VAR_model_id"); + Organization owners can use this endpoint to view all permissions for a + fine-tuned model checkpoint. + parameters: + - in: path + name: fine_tuned_model_checkpoint + required: true + schema: + type: string + example: ft-AF1WoRqd3aJAHsqc9NY7iL8F + description: | + The ID of the fine-tuned model checkpoint to get permissions for. + - name: project_id + in: query + description: The ID of the project to get permissions for. + required: false + schema: + type: string + - name: after + in: query + description: Identifier for the last permission ID from the previous pagination + request. + required: false + schema: + type: string + - name: limit + in: query + description: Number of permissions to retrieve. + required: false + schema: + type: integer + default: 10 + - name: order + in: query + description: The order in which to retrieve permissions. + required: false + schema: + type: string + enum: + - ascending + - descending + default: descending + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/ListFineTuningCheckpointPermissionResponse" + x-oaiMeta: + name: List checkpoint permissions + group: fine-tuning + returns: A list of fine-tuned model checkpoint [permission + objects](/docs/api-reference/fine-tuning/permission-object) for a + fine-tuned model checkpoint. + examples: + request: + curl: | + curl https://api.openai.com/v1/fine_tuning/checkpoints/ft:gpt-4o-mini-2024-07-18:org:weather:B7R9VjQd/permissions \ + -H "Authorization: Bearer $OPENAI_API_KEY" + response: | + { + "object": "list", + "data": [ + { + "object": "checkpoint.permission", + "id": "cp_zc4Q7MP6XxulcVzj4MZdwsAB", + "created_at": 1721764867, + "project_id": "proj_abGMw1llN8IrBb6SvvY5A1iH" + }, + { + "object": "checkpoint.permission", + "id": "cp_enQCFmOTGj3syEpYVhBRLTSy", + "created_at": 1721764800, + "project_id": "proj_iqGMw1llN8IrBb6SvvY5A1oF" + }, + ], + "first_id": "cp_zc4Q7MP6XxulcVzj4MZdwsAB", + "last_id": "cp_enQCFmOTGj3syEpYVhBRLTSy", + "has_more": false + } + post: + operationId: createFineTuningCheckpointPermission + tags: + - Fine-tuning + summary: > + **NOTE:** Calling this endpoint requires an [admin API + key](../admin-api-keys). - console.log(model); - } - main(); + This enables organization owners to share fine-tuned models with other + projects in their organization. + parameters: + - in: path + name: fine_tuned_model_checkpoint + required: true + schema: + type: string + example: ft:gpt-4o-mini-2024-07-18:org:weather:B7R9VjQd + description: > + The ID of the fine-tuned model checkpoint to create a permission for. + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/CreateFineTuningCheckpointPermissionRequest" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/ListFineTuningCheckpointPermissionResponse" + x-oaiMeta: + name: Create checkpoint permissions + group: fine-tuning + returns: A list of fine-tuned model checkpoint [permission + objects](/docs/api-reference/fine-tuning/permission-object) for a + fine-tuned model checkpoint. + examples: + request: + curl: | + curl https://api.openai.com/v1/fine_tuning/checkpoints/ft:gpt-4o-mini-2024-07-18:org:weather:B7R9VjQd/permissions \ + -H "Authorization: Bearer $OPENAI_API_KEY" + -d '{"project_ids": ["proj_abGMw1llN8IrBb6SvvY5A1iH"]}' response: | { - "id": "VAR_model_id", - "object": "model", - "created": 1686935002, - "owned_by": "openai" + "object": "list", + "data": [ + { + "object": "checkpoint.permission", + "id": "cp_zc4Q7MP6XxulcVzj4MZdwsAB", + "created_at": 1721764867, + "project_id": "proj_abGMw1llN8IrBb6SvvY5A1iH" + } + ], + "first_id": "cp_zc4Q7MP6XxulcVzj4MZdwsAB", + "last_id": "cp_zc4Q7MP6XxulcVzj4MZdwsAB", + "has_more": false } + /fine_tuning/checkpoints/{fine_tuned_model_checkpoint}/permissions/{permission_id}: delete: - operationId: deleteModel + operationId: deleteFineTuningCheckpointPermission tags: - - Models - summary: Delete a fine-tuned model. You must have the Owner role in your - organization to delete a model. + - Fine-tuning + summary: > + **NOTE:** This endpoint requires an [admin API key](../admin-api-keys). + + + Organization owners can use this endpoint to delete a permission for a + fine-tuned model checkpoint. parameters: - in: path - name: model + name: fine_tuned_model_checkpoint required: true schema: type: string - example: ft:gpt-4o-mini:acemeco:suffix:abc123 - description: The model to delete + example: ft:gpt-4o-mini-2024-07-18:org:weather:B7R9VjQd + description: > + The ID of the fine-tuned model checkpoint to delete a permission for. + - in: path + name: permission_id + required: true + schema: + type: string + example: cp_zc4Q7MP6XxulcVzj4MZdwsAB + description: | + The ID of the fine-tuned model checkpoint permission to delete. responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/DeleteModelResponse" + $ref: "#/components/schemas/DeleteFineTuningCheckpointPermissionResponse" x-oaiMeta: - name: Delete a fine-tuned model - group: models - returns: Deletion status. + name: Delete checkpoint permission + group: fine-tuning + returns: The deletion status of the fine-tuned model checkpoint [permission + object](/docs/api-reference/fine-tuning/permission-object). examples: request: - curl: > - curl - https://api.openai.com/v1/models/ft:gpt-4o-mini:acemeco:suffix:abc123 - \ - -X DELETE \ + curl: | + curl https://api.openai.com/v1/fine_tuning/checkpoints/ft:gpt-4o-mini-2024-07-18:org:weather:B7R9VjQd/permissions/cp_zc4Q7MP6XxulcVzj4MZdwsAB \ -H "Authorization: Bearer $OPENAI_API_KEY" - python: | - from openai import OpenAI - client = OpenAI() - - client.models.delete("ft:gpt-4o-mini:acemeco:suffix:abc123") - node.js: >- - import OpenAI from "openai"; - - - const openai = new OpenAI(); - - - async function main() { - const model = await openai.models.del("ft:gpt-4o-mini:acemeco:suffix:abc123"); - - console.log(model); - } - - main(); response: | { - "id": "ft:gpt-4o-mini:acemeco:suffix:abc123", - "object": "model", + "object": "checkpoint.permission", + "id": "cp_zc4Q7MP6XxulcVzj4MZdwsAB", "deleted": true } - /moderations: + /fine_tuning/jobs: post: - operationId: createModeration + operationId: createFineTuningJob tags: - - Moderations - summary: | - Classifies if text and/or image inputs are potentially harmful. Learn - more in the [moderation guide](/docs/guides/moderation). + - Fine-tuning + summary: > + Creates a fine-tuning job which begins the process of creating a new + model from a given dataset. + + + Response includes details of the enqueued job including job status and + the name of the fine-tuned models once complete. + + + [Learn more about fine-tuning](/docs/guides/fine-tuning) requestBody: required: true content: application/json: schema: - $ref: "#/components/schemas/CreateModerationRequest" + $ref: "#/components/schemas/CreateFineTuningJobRequest" responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/CreateModerationResponse" + $ref: "#/components/schemas/FineTuningJob" x-oaiMeta: - name: Create moderation - group: moderations - returns: A [moderation](/docs/api-reference/moderations/object) object. + name: Create fine-tuning job + group: fine-tuning + returns: A [fine-tuning.job](/docs/api-reference/fine-tuning/object) object. examples: - - title: Single string + - title: Default request: curl: | - curl https://api.openai.com/v1/moderations \ + curl https://api.openai.com/v1/fine_tuning/jobs \ -H "Content-Type: application/json" \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -d '{ - "input": "I want to kill them." + "training_file": "file-BK7bzQj3FfZFXr7DbL6xJwfo", + "model": "gpt-4o-mini" }' - python: > + python: | from openai import OpenAI - client = OpenAI() - - moderation = client.moderations.create(input="I want to kill - them.") - - print(moderation) - node.js: > + client.fine_tuning.jobs.create( + training_file="file-abc123", + model="gpt-4o-mini" + ) + node.js: | import OpenAI from "openai"; - const openai = new OpenAI(); - async function main() { - const moderation = await openai.moderations.create({ input: "I want to kill them." }); + const fineTune = await openai.fineTuning.jobs.create({ + training_file: "file-abc123" + }); - console.log(moderation); + console.log(fineTune); } main(); response: | { - "id": "modr-AB8CjOTu2jiq12hp1AQPfeqFWaORR", - "model": "text-moderation-007", - "results": [ - { - "flagged": true, - "categories": { - "sexual": false, - "hate": false, - "harassment": true, - "self-harm": false, - "sexual/minors": false, - "hate/threatening": false, - "violence/graphic": false, - "self-harm/intent": false, - "self-harm/instructions": false, - "harassment/threatening": true, - "violence": true - }, - "category_scores": { - "sexual": 0.000011726012417057063, - "hate": 0.22706663608551025, - "harassment": 0.5215635299682617, - "self-harm": 2.227119921371923e-6, - "sexual/minors": 7.107352217872176e-8, - "hate/threatening": 0.023547329008579254, - "violence/graphic": 0.00003391829886822961, - "self-harm/intent": 1.646940972932498e-6, - "self-harm/instructions": 1.1198755256458526e-9, - "harassment/threatening": 0.5694745779037476, - "violence": 0.9971134662628174 + "object": "fine_tuning.job", + "id": "ftjob-abc123", + "model": "gpt-4o-mini-2024-07-18", + "created_at": 1721764800, + "fine_tuned_model": null, + "organization_id": "org-123", + "result_files": [], + "status": "queued", + "validation_file": null, + "training_file": "file-abc123", + "method": { + "type": "supervised", + "supervised": { + "hyperparameters": { + "batch_size": "auto", + "learning_rate_multiplier": "auto", + "n_epochs": "auto", } } - ] + }, + "metadata": null } - - title: Image and text + - title: Epochs request: - curl: > - curl https://api.openai.com/v1/moderations \ - -X POST \ + curl: | + curl https://api.openai.com/v1/fine_tuning/jobs \ -H "Content-Type: application/json" \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -d '{ - "model": "omni-moderation-latest", - "input": [ - { "type": "text", "text": "...text to classify goes here..." }, - { - "type": "image_url", - "image_url": { - "url": "https://example.com/image.png" + "training_file": "file-abc123", + "model": "gpt-4o-mini", + "method": { + "type": "supervised", + "supervised": { + "hyperparameters": { + "n_epochs": 2 } } - ] + } }' python: > from openai import OpenAI - client = OpenAI() + from openai.types.fine_tuning import SupervisedMethod, + SupervisedHyperparameters - response = client.moderations.create( - model="omni-moderation-latest", - input=[ - {"type": "text", "text": "...text to classify goes here..."}, - { - "type": "image_url", - "image_url": { - "url": "https://example.com/image.png", - # can also use base64 encoded image URLs - # "url": "data:image/jpeg;base64,abcdefg..." - } - }, - ], - ) + client = OpenAI() - print(response) + client.fine_tuning.jobs.create( + training_file="file-abc123", + model="gpt-4o-mini", + method={ + "type": "supervised", + "supervised": SupervisedMethod( + hyperparameters=SupervisedHyperparameters( + n_epochs=2 + ) + ) + } + ) node.js: > import OpenAI from "openai"; + import { SupervisedMethod, SupervisedHyperparameters } from + "openai/src/resources/fine-tuning/methods"; + + const openai = new OpenAI(); - const moderation = await openai.moderations.create({ - model: "omni-moderation-latest", - input: [ - { type: "text", text: "...text to classify goes here..." }, - { - type: "image_url", - image_url: { - url: "https://example.com/image.png" - // can also use base64 encoded image URLs - // url: "data:image/jpeg;base64,abcdefg..." - } + async function main() { + const fineTune = await openai.fineTuning.jobs.create({ + training_file: "file-abc123", + model: "gpt-4o-mini", + method: { + type: "supervised", + supervised: { + hyperparameters: { + n_epochs: 2 } - ], - }); + } + } + }); + console.log(fineTune); + } - console.log(moderation); + + main(); response: | { - "id": "modr-0d9740456c391e43c445bf0f010940c7", - "model": "omni-moderation-latest", - "results": [ - { - "flagged": true, - "categories": { - "harassment": true, - "harassment/threatening": true, - "sexual": false, - "hate": false, - "hate/threatening": false, - "illicit": false, - "illicit/violent": false, - "self-harm/intent": false, - "self-harm/instructions": false, - "self-harm": false, - "sexual/minors": false, - "violence": true, - "violence/graphic": true + "object": "fine_tuning.job", + "id": "ftjob-abc123", + "model": "gpt-4o-mini", + "created_at": 1721764800, + "fine_tuned_model": null, + "organization_id": "org-123", + "result_files": [], + "status": "queued", + "validation_file": null, + "training_file": "file-abc123", + "hyperparameters": { + "batch_size": "auto", + "learning_rate_multiplier": "auto", + "n_epochs": 2 + }, + "method": { + "type": "supervised", + "supervised": { + "hyperparameters": { + "batch_size": "auto", + "learning_rate_multiplier": "auto", + "n_epochs": 2 + } + } + }, + "metadata": null, + "error": { + "code": null, + "message": null, + "param": null + }, + "finished_at": null, + "seed": 683058546, + "trained_tokens": null, + "estimated_finish": null, + "integrations": [], + "user_provided_suffix": null, + "usage_metrics": null, + "shared_with_openai": false + } + - title: DPO + request: + curl: | + curl https://api.openai.com/v1/fine_tuning/jobs \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "training_file": "file-abc123", + "validation_file": "file-abc123", + "model": "gpt-4o-mini", + "method": { + "type": "dpo", + "dpo": { + "hyperparameters": { + "beta": 0.1 + } + } + } + }' + python: | + from openai import OpenAI + from openai.types.fine_tuning import DpoMethod, DpoHyperparameters + + client = OpenAI() + + client.fine_tuning.jobs.create( + training_file="file-abc", + validation_file="file-123", + model="gpt-4o-mini", + method={ + "type": "dpo", + "dpo": DpoMethod( + hyperparameters=DpoHyperparameters(beta=0.1) + ) + } + ) + response: | + { + "object": "fine_tuning.job", + "id": "ftjob-abc", + "model": "gpt-4o-mini", + "created_at": 1746130590, + "fine_tuned_model": null, + "organization_id": "org-abc", + "result_files": [], + "status": "queued", + "validation_file": "file-123", + "training_file": "file-abc", + "method": { + "type": "dpo", + "dpo": { + "hyperparameters": { + "beta": 0.1, + "batch_size": "auto", + "learning_rate_multiplier": "auto", + "n_epochs": "auto" + } + } + }, + "metadata": null, + "error": { + "code": null, + "message": null, + "param": null + }, + "finished_at": null, + "hyperparameters": null, + "seed": 1036326793, + "estimated_finish": null, + "integrations": [], + "user_provided_suffix": null, + "usage_metrics": null, + "shared_with_openai": false + } + - title: Reinforcement + request: + curl: | + curl https://api.openai.com/v1/fine_tuning/jobs \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "training_file": "file-abc", + "validation_file": "file-123", + "model": "o4-mini", + "method": { + "type": "reinforcement", + "reinforcement": { + "grader": { + "type": "string_check", + "name": "Example string check grader", + "input": "{{sample.output_text}}", + "reference": "{{item.label}}", + "operation": "eq" + }, + "hyperparameters": { + "reasoning_effort": "medium" + } + } + } + }' + python: > + from openai import OpenAI + + from openai.types.fine_tuning import ReinforcementMethod, + ReinforcementHyperparameters + + from openai.types.graders import StringCheckGrader + + + client = OpenAI() + + + client.fine_tuning.jobs.create( + training_file="file-abc", + validation_file="file-123", + model="o4-mini", + method={ + "type": "reinforcement", + "reinforcement": ReinforcementMethod( + grader=StringCheckGrader( + name="Example string check grader", + type="string_check", + input="{{item.label}}", + operation="eq", + reference="{{sample.output_text}}" + ), + hyperparameters=ReinforcementHyperparameters( + reasoning_effort="medium", + ) + ) + }, + seed=42, + ) + response: |+ + { + "object": "fine_tuning.job", + "id": "ftjob-abc123", + "model": "o4-mini", + "created_at": 1721764800, + "finished_at": null, + "fine_tuned_model": null, + "organization_id": "org-123", + "result_files": [], + "status": "validating_files", + "validation_file": "file-123", + "training_file": "file-abc", + "trained_tokens": null, + "error": {}, + "user_provided_suffix": null, + "seed": 950189191, + "estimated_finish": null, + "integrations": [], + "method": { + "type": "reinforcement", + "reinforcement": { + "hyperparameters": { + "batch_size": "auto", + "learning_rate_multiplier": "auto", + "n_epochs": "auto", + "eval_interval": "auto", + "eval_samples": "auto", + "compute_multiplier": "auto", + "reasoning_effort": "medium" }, - "category_scores": { - "harassment": 0.8189693396524255, - "harassment/threatening": 0.804985420696006, - "sexual": 1.573112165348997e-6, - "hate": 0.007562942636942845, - "hate/threatening": 0.004208854591835476, - "illicit": 0.030535955153511665, - "illicit/violent": 0.008925306722380033, - "self-harm/intent": 0.00023023930975076432, - "self-harm/instructions": 0.0002293869201073356, - "self-harm": 0.012598046106750154, - "sexual/minors": 2.212566909570261e-8, - "violence": 0.9999992735124786, - "violence/graphic": 0.843064871157054 + "grader": { + "type": "string_check", + "name": "Example string check grader", + "input": "{{sample.output_text}}", + "reference": "{{item.label}}", + "operation": "eq" }, - "category_applied_input_types": { - "harassment": [ - "text" - ], - "harassment/threatening": [ - "text" - ], - "sexual": [ - "text", - "image" - ], - "hate": [ - "text" - ], - "hate/threatening": [ - "text" - ], - "illicit": [ - "text" - ], - "illicit/violent": [ - "text" - ], - "self-harm/intent": [ - "text", - "image" - ], - "self-harm/instructions": [ - "text", - "image" - ], - "self-harm": [ - "text", - "image" - ], - "sexual/minors": [ - "text" - ], - "violence": [ - "text", - "image" - ], - "violence/graphic": [ - "text", - "image" - ] - } + "response_format": null } - ] + }, + "metadata": null, + "usage_metrics": null, + "shared_with_openai": false } - /organization/audit_logs: - get: - summary: List user actions and configuration changes within this organization. - operationId: list-audit-logs - tags: - - Audit Logs + + - title: Validation file + request: + curl: | + curl https://api.openai.com/v1/fine_tuning/jobs \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "training_file": "file-abc123", + "validation_file": "file-abc123", + "model": "gpt-4o-mini" + }' + python: | + from openai import OpenAI + client = OpenAI() + + client.fine_tuning.jobs.create( + training_file="file-abc123", + validation_file="file-def456", + model="gpt-4o-mini" + ) + node.js: | + import OpenAI from "openai"; + + const openai = new OpenAI(); + + async function main() { + const fineTune = await openai.fineTuning.jobs.create({ + training_file: "file-abc123", + validation_file: "file-abc123" + }); + + console.log(fineTune); + } + + main(); + response: | + { + "object": "fine_tuning.job", + "id": "ftjob-abc123", + "model": "gpt-4o-mini-2024-07-18", + "created_at": 1721764800, + "fine_tuned_model": null, + "organization_id": "org-123", + "result_files": [], + "status": "queued", + "validation_file": "file-abc123", + "training_file": "file-abc123", + "method": { + "type": "supervised", + "supervised": { + "hyperparameters": { + "batch_size": "auto", + "learning_rate_multiplier": "auto", + "n_epochs": "auto", + } + } + }, + "metadata": null + } + - title: W&B Integration + request: + curl: | + curl https://api.openai.com/v1/fine_tuning/jobs \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "training_file": "file-abc123", + "validation_file": "file-abc123", + "model": "gpt-4o-mini", + "integrations": [ + { + "type": "wandb", + "wandb": { + "project": "my-wandb-project", + "name": "ft-run-display-name" + "tags": [ + "first-experiment", "v2" + ] + } + } + ] + }' + response: | + { + "object": "fine_tuning.job", + "id": "ftjob-abc123", + "model": "gpt-4o-mini-2024-07-18", + "created_at": 1721764800, + "fine_tuned_model": null, + "organization_id": "org-123", + "result_files": [], + "status": "queued", + "validation_file": "file-abc123", + "training_file": "file-abc123", + "integrations": [ + { + "type": "wandb", + "wandb": { + "project": "my-wandb-project", + "entity": None, + "run_id": "ftjob-abc123" + } + } + ], + "method": { + "type": "supervised", + "supervised": { + "hyperparameters": { + "batch_size": "auto", + "learning_rate_multiplier": "auto", + "n_epochs": "auto", + } + } + }, + "metadata": null + } + get: + operationId: listPaginatedFineTuningJobs + tags: + - Fine-tuning + summary: | + List your organization's fine-tuning jobs parameters: - - name: effective_at - in: query - description: Return only events whose `effective_at` (Unix seconds) is in this - range. - required: false - schema: - type: object - properties: - gt: - type: integer - description: Return only events whose `effective_at` (Unix seconds) is greater - than this value. - gte: - type: integer - description: Return only events whose `effective_at` (Unix seconds) is greater - than or equal to this value. - lt: - type: integer - description: Return only events whose `effective_at` (Unix seconds) is less than - this value. - lte: - type: integer - description: Return only events whose `effective_at` (Unix seconds) is less than - or equal to this value. - - name: project_ids[] - in: query - description: Return only events for these projects. - required: false - schema: - type: array - items: - type: string - - name: event_types[] - in: query - description: Return only events with a `type` in one of these values. For - example, `project.created`. For all options, see the documentation - for the [audit log object](/docs/api-reference/audit-logs/object). - required: false - schema: - type: array - items: - $ref: "#/components/schemas/AuditLogEventType" - - name: actor_ids[] - in: query - description: Return only events performed by these actors. Can be a user ID, a - service account ID, or an api key tracking ID. - required: false - schema: - type: array - items: - type: string - - name: actor_emails[] - in: query - description: Return only events performed by users with these emails. - required: false - schema: - type: array - items: - type: string - - name: resource_ids[] + - name: after in: query - description: Return only events performed on these targets. For example, a - project ID updated. + description: Identifier for the last job from the previous pagination request. required: false schema: - type: array - items: - type: string + type: string - name: limit in: query - description: > - A limit on the number of objects to be returned. Limit can range - between 1 and 100, and the default is 20. + description: Number of fine-tuning jobs to retrieve. required: false schema: type: integer default: 20 - - name: after - in: query - description: > - A cursor for use in pagination. `after` is an object ID that defines - your place in the list. For instance, if you make a list request and - receive 100 objects, ending with obj_foo, your subsequent call can - include after=obj_foo in order to fetch the next page of the list. + - in: query + name: metadata + required: false schema: - type: string - - name: before - in: query + type: object + nullable: true + additionalProperties: + type: string + style: deepObject + explode: true description: > - A cursor for use in pagination. `before` is an object ID that - defines your place in the list. For instance, if you make a list - request and receive 100 objects, starting with obj_foo, your - subsequent call can include before=obj_foo in order to fetch the - previous page of the list. - schema: - type: string + Optional metadata filter. To filter, use the syntax `metadata[k]=v`. + Alternatively, set `metadata=null` to indicate no metadata. responses: "200": - description: Audit logs listed successfully. + description: OK content: application/json: schema: - $ref: "#/components/schemas/ListAuditLogsResponse" + $ref: "#/components/schemas/ListPaginatedFineTuningJobsResponse" x-oaiMeta: - name: List audit logs - group: audit-logs - returns: A list of paginated [Audit Log](/docs/api-reference/audit-logs/object) - objects. + name: List fine-tuning jobs + group: fine-tuning + returns: A list of paginated [fine-tuning + job](/docs/api-reference/fine-tuning/object) objects. examples: request: curl: | - curl https://api.openai.com/v1/organization/audit_logs \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" \ - response: > + curl https://api.openai.com/v1/fine_tuning/jobs?limit=2&metadata[key]=value \ + -H "Authorization: Bearer $OPENAI_API_KEY" + python: | + from openai import OpenAI + client = OpenAI() + + client.fine_tuning.jobs.list() + node.js: |- + import OpenAI from "openai"; + + const openai = new OpenAI(); + + async function main() { + const list = await openai.fineTuning.jobs.list(); + + for await (const fineTune of list) { + console.log(fineTune); + } + } + + main(); + response: | { - "object": "list", - "data": [ - { - "id": "audit_log-xxx_yyyymmdd", - "type": "project.archived", - "effective_at": 1722461446, - "actor": { - "type": "api_key", - "api_key": { - "type": "user", - "user": { - "id": "user-xxx", - "email": "user@example.com" - } - } - }, - "project.archived": { - "id": "proj_abc" - }, - }, - { - "id": "audit_log-yyy__20240101", - "type": "api_key.updated", - "effective_at": 1720804190, - "actor": { - "type": "session", - "session": { - "user": { - "id": "user-xxx", - "email": "user@example.com" - }, - "ip_address": "127.0.0.1", - "user_agent": "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/91.0.4472.124 Safari/537.36" - } - }, - "api_key.updated": { - "id": "key_xxxx", - "data": { - "scopes": ["resource_2.operation_2"] - } - }, - } - ], - "first_id": "audit_log-xxx__20240101", - "last_id": "audit_log_yyy__20240101", - "has_more": true + "object": "list", + "data": [ + { + "object": "fine_tuning.job", + "id": "ftjob-abc123", + "model": "gpt-4o-mini-2024-07-18", + "created_at": 1721764800, + "fine_tuned_model": null, + "organization_id": "org-123", + "result_files": [], + "status": "queued", + "validation_file": null, + "training_file": "file-abc123", + "metadata": { + "key": "value" + } + }, + { ... }, + { ... } + ], "has_more": true } - /organization/invites: + /fine_tuning/jobs/{fine_tuning_job_id}: get: - summary: Returns a list of invites in the organization. - operationId: list-invites + operationId: retrieveFineTuningJob tags: - - Invites + - Fine-tuning + summary: | + Get info about a fine-tuning job. + + [Learn more about fine-tuning](/docs/guides/fine-tuning) parameters: - - name: limit - in: query - description: > - A limit on the number of objects to be returned. Limit can range - between 1 and 100, and the default is 20. - required: false - schema: - type: integer - default: 20 - - name: after - in: query - description: > - A cursor for use in pagination. `after` is an object ID that defines - your place in the list. For instance, if you make a list request and - receive 100 objects, ending with obj_foo, your subsequent call can - include after=obj_foo in order to fetch the next page of the list. - required: false + - in: path + name: fine_tuning_job_id + required: true schema: type: string + example: ft-AF1WoRqd3aJAHsqc9NY7iL8F + description: | + The ID of the fine-tuning job. responses: "200": - description: Invites listed successfully. + description: OK content: application/json: schema: - $ref: "#/components/schemas/InviteListResponse" + $ref: "#/components/schemas/FineTuningJob" x-oaiMeta: - name: List invites - group: administration - returns: A list of [Invite](/docs/api-reference/invite/object) objects. + name: Retrieve fine-tuning job + group: fine-tuning + returns: The [fine-tuning](/docs/api-reference/fine-tuning/object) object with + the given ID. examples: request: - curl: > - curl - https://api.openai.com/v1/organization/invites?after=invite-abc&limit=20 - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "list", - "data": [ - { - "object": "organization.invite", - "id": "invite-abc", - "email": "user@example.com", - "role": "owner", - "status": "accepted", - "invited_at": 1711471533, - "expires_at": 1711471533, - "accepted_at": 1711471533 + curl: | + curl https://api.openai.com/v1/fine_tuning/jobs/ft-AF1WoRqd3aJAHsqc9NY7iL8F \ + -H "Authorization: Bearer $OPENAI_API_KEY" + python: | + from openai import OpenAI + client = OpenAI() + + client.fine_tuning.jobs.retrieve("ftjob-abc123") + node.js: > + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + async function main() { + const fineTune = await openai.fineTuning.jobs.retrieve("ftjob-abc123"); + + console.log(fineTune); + } + + + main(); + response: > + { + "object": "fine_tuning.job", + "id": "ftjob-abc123", + "model": "davinci-002", + "created_at": 1692661014, + "finished_at": 1692661190, + "fine_tuned_model": "ft:davinci-002:my-org:custom_suffix:7q8mpxmy", + "organization_id": "org-123", + "result_files": [ + "file-abc123" + ], + "status": "succeeded", + "validation_file": null, + "training_file": "file-abc123", + "hyperparameters": { + "n_epochs": 4, + "batch_size": 1, + "learning_rate_multiplier": 1.0 + }, + "trained_tokens": 5768, + "integrations": [], + "seed": 0, + "estimated_finish": 0, + "method": { + "type": "supervised", + "supervised": { + "hyperparameters": { + "n_epochs": 4, + "batch_size": 1, + "learning_rate_multiplier": 1.0 } - ], - "first_id": "invite-abc", - "last_id": "invite-abc", - "has_more": false + } } + } + /fine_tuning/jobs/{fine_tuning_job_id}/cancel: post: - summary: Create an invite for a user to the organization. The invite must be - accepted by the user before they have access to the organization. - operationId: inviteUser + operationId: cancelFineTuningJob tags: - - Invites - requestBody: - description: The invite request payload. - required: true - content: - application/json: - schema: - $ref: "#/components/schemas/InviteRequest" + - Fine-tuning + summary: | + Immediately cancel a fine-tune job. + parameters: + - in: path + name: fine_tuning_job_id + required: true + schema: + type: string + example: ft-AF1WoRqd3aJAHsqc9NY7iL8F + description: | + The ID of the fine-tuning job to cancel. responses: "200": - description: User invited successfully. + description: OK content: application/json: schema: - $ref: "#/components/schemas/Invite" + $ref: "#/components/schemas/FineTuningJob" x-oaiMeta: - name: Create invite - group: administration - returns: The created [Invite](/docs/api-reference/invite/object) object. + name: Cancel fine-tuning + group: fine-tuning + returns: The cancelled [fine-tuning](/docs/api-reference/fine-tuning/object) + object. examples: request: - curl: | - curl -X POST https://api.openai.com/v1/organization/invites \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" \ - -d '{ - "email": "user@example.com", - "role": "owner" - }' - response: - content: | - { - "object": "organization.invite", - "id": "invite-abc", - "email": "user@example.com", - "role": "owner", - "invited_at": 1711471533, - "expires_at": 1711471533, - "accepted_at": null + curl: > + curl -X POST + https://api.openai.com/v1/fine_tuning/jobs/ftjob-abc123/cancel \ + -H "Authorization: Bearer $OPENAI_API_KEY" + python: | + from openai import OpenAI + client = OpenAI() + + client.fine_tuning.jobs.cancel("ftjob-abc123") + node.js: >- + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + async function main() { + const fineTune = await openai.fineTuning.jobs.cancel("ftjob-abc123"); + + console.log(fineTune); } - /organization/invites/{invite_id}: + + main(); + response: | + { + "object": "fine_tuning.job", + "id": "ftjob-abc123", + "model": "gpt-4o-mini-2024-07-18", + "created_at": 1721764800, + "fine_tuned_model": null, + "organization_id": "org-123", + "result_files": [], + "status": "cancelled", + "validation_file": "file-abc123", + "training_file": "file-abc123" + } + /fine_tuning/jobs/{fine_tuning_job_id}/checkpoints: get: - summary: Retrieves an invite. - operationId: retrieve-invite + operationId: listFineTuningJobCheckpoints tags: - - Invites + - Fine-tuning + summary: | + List checkpoints for a fine-tuning job. parameters: - in: path - name: invite_id + name: fine_tuning_job_id required: true schema: type: string - description: The ID of the invite to retrieve. + example: ft-AF1WoRqd3aJAHsqc9NY7iL8F + description: | + The ID of the fine-tuning job to get checkpoints for. + - name: after + in: query + description: Identifier for the last checkpoint ID from the previous pagination + request. + required: false + schema: + type: string + - name: limit + in: query + description: Number of checkpoints to retrieve. + required: false + schema: + type: integer + default: 10 responses: "200": - description: Invite retrieved successfully. + description: OK content: application/json: schema: - $ref: "#/components/schemas/Invite" + $ref: "#/components/schemas/ListFineTuningJobCheckpointsResponse" x-oaiMeta: - name: Retrieve invite - group: administration - returns: The [Invite](/docs/api-reference/invite/object) object matching the - specified ID. + name: List fine-tuning checkpoints + group: fine-tuning + returns: A list of fine-tuning [checkpoint + objects](/docs/api-reference/fine-tuning/checkpoint-object) for a + fine-tuning job. examples: request: curl: | - curl https://api.openai.com/v1/organization/invites/invite-abc \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "organization.invite", - "id": "invite-abc", - "email": "user@example.com", - "role": "owner", - "status": "accepted", - "invited_at": 1711471533, - "expires_at": 1711471533, - "accepted_at": 1711471533 - } - delete: - summary: Delete an invite. If the invite has already been accepted, it cannot be - deleted. - operationId: delete-invite + curl https://api.openai.com/v1/fine_tuning/jobs/ftjob-abc123/checkpoints \ + -H "Authorization: Bearer $OPENAI_API_KEY" + response: > + { + "object": "list" + "data": [ + { + "object": "fine_tuning.job.checkpoint", + "id": "ftckpt_zc4Q7MP6XxulcVzj4MZdwsAB", + "created_at": 1721764867, + "fine_tuned_model_checkpoint": "ft:gpt-4o-mini-2024-07-18:my-org:custom-suffix:96olL566:ckpt-step-2000", + "metrics": { + "full_valid_loss": 0.134, + "full_valid_mean_token_accuracy": 0.874 + }, + "fine_tuning_job_id": "ftjob-abc123", + "step_number": 2000, + }, + { + "object": "fine_tuning.job.checkpoint", + "id": "ftckpt_enQCFmOTGj3syEpYVhBRLTSy", + "created_at": 1721764800, + "fine_tuned_model_checkpoint": "ft:gpt-4o-mini-2024-07-18:my-org:custom-suffix:7q8mpxmy:ckpt-step-1000", + "metrics": { + "full_valid_loss": 0.167, + "full_valid_mean_token_accuracy": 0.781 + }, + "fine_tuning_job_id": "ftjob-abc123", + "step_number": 1000, + }, + ], + "first_id": "ftckpt_zc4Q7MP6XxulcVzj4MZdwsAB", + "last_id": "ftckpt_enQCFmOTGj3syEpYVhBRLTSy", + "has_more": true + } + /fine_tuning/jobs/{fine_tuning_job_id}/events: + get: + operationId: listFineTuningEvents tags: - - Invites + - Fine-tuning + summary: | + Get status updates for a fine-tuning job. parameters: - in: path - name: invite_id + name: fine_tuning_job_id required: true schema: type: string - description: The ID of the invite to delete. - responses: - "200": - description: Invite deleted successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/InviteDeleteResponse" - x-oaiMeta: - name: Delete invite - group: administration - returns: Confirmation that the invite has been deleted - examples: - request: - curl: > - curl -X DELETE - https://api.openai.com/v1/organization/invites/invite-abc \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "organization.invite.deleted", - "id": "invite-abc", - "deleted": true - } - /organization/projects: - get: - summary: Returns a list of projects. - operationId: list-projects - tags: - - Projects - parameters: - - name: limit - in: query - description: > - A limit on the number of objects to be returned. Limit can range - between 1 and 100, and the default is 20. - required: false - schema: - type: integer - default: 20 + example: ft-AF1WoRqd3aJAHsqc9NY7iL8F + description: | + The ID of the fine-tuning job to get events for. - name: after in: query - description: > - A cursor for use in pagination. `after` is an object ID that defines - your place in the list. For instance, if you make a list request and - receive 100 objects, ending with obj_foo, your subsequent call can - include after=obj_foo in order to fetch the next page of the list. + description: Identifier for the last event from the previous pagination request. required: false schema: type: string - - name: include_archived + - name: limit in: query + description: Number of events to retrieve. + required: false schema: - type: boolean - default: false - description: If `true` returns all projects including those that have been - `archived`. Archived projects are not included by default. + type: integer + default: 20 responses: "200": - description: Projects listed successfully. + description: OK content: application/json: schema: - $ref: "#/components/schemas/ProjectListResponse" + $ref: "#/components/schemas/ListFineTuningJobEventsResponse" x-oaiMeta: - name: List projects - group: administration - returns: A list of [Project](/docs/api-reference/projects/object) objects. + name: List fine-tuning events + group: fine-tuning + returns: A list of fine-tuning event objects. examples: request: curl: > curl - https://api.openai.com/v1/organization/projects?after=proj_abc&limit=20&include_archived=false - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "list", - "data": [ - { - "id": "proj_abc", - "object": "organization.project", - "name": "Project example", - "created_at": 1711471533, - "archived_at": null, - "status": "active" - } - ], - "first_id": "proj-abc", - "last_id": "proj-xyz", - "has_more": false + https://api.openai.com/v1/fine_tuning/jobs/ftjob-abc123/events \ + -H "Authorization: Bearer $OPENAI_API_KEY" + python: | + from openai import OpenAI + client = OpenAI() + + client.fine_tuning.jobs.list_events( + fine_tuning_job_id="ftjob-abc123", + limit=2 + ) + node.js: >- + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + async function main() { + const list = await openai.fineTuning.list_events(id="ftjob-abc123", limit=2); + + for await (const fineTune of list) { + console.log(fineTune); + } } + + + main(); + response: > + { + "object": "list", + "data": [ + { + "object": "fine_tuning.job.event", + "id": "ft-event-ddTJfwuMVpfLXseO0Am0Gqjm", + "created_at": 1721764800, + "level": "info", + "message": "Fine tuning job successfully completed", + "data": null, + "type": "message" + }, + { + "object": "fine_tuning.job.event", + "id": "ft-event-tyiGuB72evQncpH87xe505Sv", + "created_at": 1721764800, + "level": "info", + "message": "New fine-tuned model created: ft:gpt-4o-mini:openai::7p4lURel", + "data": null, + "type": "message" + } + ], + "has_more": true + } + /fine_tuning/jobs/{fine_tuning_job_id}/pause: post: - summary: Create a new project in the organization. Projects can be created and - archived, but cannot be deleted. - operationId: create-project - tags: - - Projects - requestBody: - description: The project create request payload. - required: true - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectCreateRequest" - responses: - "200": - description: Project created successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/Project" - x-oaiMeta: - name: Create project - group: administration - returns: The created [Project](/docs/api-reference/projects/object) object. - examples: - request: - curl: | - curl -X POST https://api.openai.com/v1/organization/projects \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" \ - -d '{ - "name": "Project ABC" - }' - response: - content: | - { - "id": "proj_abc", - "object": "organization.project", - "name": "Project ABC", - "created_at": 1711471533, - "archived_at": null, - "status": "active" - } - /organization/projects/{project_id}: - get: - summary: Retrieves a project. - operationId: retrieve-project + operationId: pauseFineTuningJob tags: - - Projects + - Fine-tuning + summary: | + Pause a fine-tune job. parameters: - - name: project_id - in: path - description: The ID of the project. + - in: path + name: fine_tuning_job_id required: true schema: type: string + example: ft-AF1WoRqd3aJAHsqc9NY7iL8F + description: | + The ID of the fine-tuning job to pause. responses: "200": - description: Project retrieved successfully. + description: OK content: application/json: schema: - $ref: "#/components/schemas/Project" + $ref: "#/components/schemas/FineTuningJob" x-oaiMeta: - name: Retrieve project - group: administration - description: Retrieve a project. - returns: The [Project](/docs/api-reference/projects/object) object matching the - specified ID. + name: Pause fine-tuning + group: fine-tuning + returns: The paused [fine-tuning](/docs/api-reference/fine-tuning/object) + object. examples: request: - curl: | - curl https://api.openai.com/v1/organization/projects/proj_abc \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "id": "proj_abc", - "object": "organization.project", - "name": "Project example", - "created_at": 1711471533, - "archived_at": null, - "status": "active" + curl: > + curl -X POST + https://api.openai.com/v1/fine_tuning/jobs/ftjob-abc123/pause \ + -H "Authorization: Bearer $OPENAI_API_KEY" + python: | + from openai import OpenAI + client = OpenAI() + + client.fine_tuning.jobs.pause("ftjob-abc123") + node.js: >- + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + async function main() { + const fineTune = await openai.fineTuning.jobs.pause("ftjob-abc123"); + + console.log(fineTune); } + + main(); + response: | + { + "object": "fine_tuning.job", + "id": "ftjob-abc123", + "model": "gpt-4o-mini-2024-07-18", + "created_at": 1721764800, + "fine_tuned_model": null, + "organization_id": "org-123", + "result_files": [], + "status": "paused", + "validation_file": "file-abc123", + "training_file": "file-abc123" + } + /fine_tuning/jobs/{fine_tuning_job_id}/resume: post: - summary: Modifies a project in the organization. - operationId: modify-project + operationId: resumeFineTuningJob tags: - - Projects + - Fine-tuning + summary: | + Resume a fine-tune job. parameters: - - name: project_id - in: path - description: The ID of the project. + - in: path + name: fine_tuning_job_id required: true schema: type: string - requestBody: - description: The project update request payload. - required: true - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectUpdateRequest" + example: ft-AF1WoRqd3aJAHsqc9NY7iL8F + description: | + The ID of the fine-tuning job to resume. responses: "200": - description: Project updated successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/Project" - "400": - description: Error response when updating the default project. + description: OK content: application/json: schema: - $ref: "#/components/schemas/ErrorResponse" + $ref: "#/components/schemas/FineTuningJob" x-oaiMeta: - name: Modify project - group: administration - returns: The updated [Project](/docs/api-reference/projects/object) object. + name: Resume fine-tuning + group: fine-tuning + returns: The resumed [fine-tuning](/docs/api-reference/fine-tuning/object) + object. examples: request: curl: > curl -X POST - https://api.openai.com/v1/organization/projects/proj_abc \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" \ - -d '{ - "name": "Project DEF" - }' - /organization/projects/{project_id}/api_keys: - get: - summary: Returns a list of API keys in the project. - operationId: list-project-api-keys + https://api.openai.com/v1/fine_tuning/jobs/ftjob-abc123/resume \ + -H "Authorization: Bearer $OPENAI_API_KEY" + python: | + from openai import OpenAI + client = OpenAI() + + client.fine_tuning.jobs.resume("ftjob-abc123") + node.js: >- + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + async function main() { + const fineTune = await openai.fineTuning.jobs.resume("ftjob-abc123"); + + console.log(fineTune); + } + + main(); + response: | + { + "object": "fine_tuning.job", + "id": "ftjob-abc123", + "model": "gpt-4o-mini-2024-07-18", + "created_at": 1721764800, + "fine_tuned_model": null, + "organization_id": "org-123", + "result_files": [], + "status": "queued", + "validation_file": "file-abc123", + "training_file": "file-abc123" + } + /images/edits: + post: + operationId: createImageEdit tags: - - Projects - parameters: - - name: project_id - in: path - description: The ID of the project. - required: true - schema: - type: string - - name: limit - in: query - description: > - A limit on the number of objects to be returned. Limit can range - between 1 and 100, and the default is 20. - required: false - schema: - type: integer - default: 20 - - name: after - in: query - description: > - A cursor for use in pagination. `after` is an object ID that defines - your place in the list. For instance, if you make a list request and - receive 100 objects, ending with obj_foo, your subsequent call can - include after=obj_foo in order to fetch the next page of the list. - required: false - schema: - type: string + - Images + summary: Creates an edited or extended image given one or more source images and + a prompt. This endpoint only supports `gpt-image-1` and `dall-e-2`. + requestBody: + required: true + content: + multipart/form-data: + schema: + $ref: "#/components/schemas/CreateImageEditRequest" responses: "200": - description: Project API keys listed successfully. + description: OK content: application/json: schema: - $ref: "#/components/schemas/ProjectApiKeyListResponse" + $ref: "#/components/schemas/ImagesResponse" x-oaiMeta: - name: List project API keys - group: administration - returns: A list of [ProjectApiKey](/docs/api-reference/project-api-keys/object) - objects. + name: Create image edit + group: images + returns: Returns a list of [image](/docs/api-reference/images/object) objects. examples: request: curl: > - curl - https://api.openai.com/v1/organization/projects/proj_abc/api_keys?after=key_abc&limit=20 - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "list", - "data": [ - { - "object": "organization.project.api_key", - "redacted_value": "sk-abc...def", - "name": "My API Key", - "created_at": 1711471533, - "id": "key_abc", - "owner": { - "type": "user", - "user": { - "object": "organization.project.user", - "id": "user_abc", - "name": "First Last", - "email": "user@example.com", - "role": "owner", - "added_at": 1711471533 - } - } - } + curl -s -D >(grep -i x-request-id >&2) \ + -o >(jq -r '.data[0].b64_json' | base64 --decode > gift-basket.png) \ + -X POST "https://api.openai.com/v1/images/edits" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -F "model=gpt-image-1" \ + -F "image[]=@body-lotion.png" \ + -F "image[]=@bath-bomb.png" \ + -F "image[]=@incense-kit.png" \ + -F "image[]=@soap.png" \ + -F 'prompt=Create a lovely gift basket with these four items in it' + python: > + import base64 + + from openai import OpenAI + + client = OpenAI() + + + prompt = """ + + Generate a photorealistic image of a gift basket on a white + background + + labeled 'Relax & Unwind' with a ribbon and handwriting-like font, + + containing all the items in the reference pictures. + + """ + + + result = client.images.edit( + model="gpt-image-1", + image=[ + open("body-lotion.png", "rb"), + open("bath-bomb.png", "rb"), + open("incense-kit.png", "rb"), + open("soap.png", "rb"), ], - "first_id": "key_abc", - "last_id": "key_xyz", - "has_more": false - } - error_response: - content: | - { - "code": 400, - "message": "Project {name} is archived" + prompt=prompt + ) + + + image_base64 = result.data[0].b64_json + + image_bytes = base64.b64decode(image_base64) + + + # Save the image to a file + + with open("gift-basket.png", "wb") as f: + f.write(image_bytes) + node.js: > + import fs from "fs"; + + import OpenAI, { toFile } from "openai"; + + + const client = new OpenAI(); + + + const imageFiles = [ + "bath-bomb.png", + "body-lotion.png", + "incense-kit.png", + "soap.png", + ]; + + + const images = await Promise.all( + imageFiles.map(async (file) => + await toFile(fs.createReadStream(file), null, { + type: "image/png", + }) + ), + ); + + + const rsp = await client.images.edit({ + model: "gpt-image-1", + image: images, + prompt: "Create a lovely gift basket with these four items in it", + }); + + + // Save the image to a file + + const image_base64 = rsp.data[0].b64_json; + + const image_bytes = Buffer.from(image_base64, "base64"); + + fs.writeFileSync("basket.png", image_bytes); + response: | + { + "created": 1713833628, + "data": [ + { + "b64_json": "..." + } + ], + "usage": { + "total_tokens": 100, + "input_tokens": 50, + "output_tokens": 50, + "input_tokens_details": { + "text_tokens": 10, + "image_tokens": 40 + } } - /organization/projects/{project_id}/api_keys/{key_id}: - get: - summary: Retrieves an API key in the project. - operationId: retrieve-project-api-key + } + /images/generations: + post: + operationId: createImage tags: - - Projects - parameters: - - name: project_id - in: path - description: The ID of the project. - required: true - schema: - type: string - - name: key_id - in: path - description: The ID of the API key. - required: true - schema: - type: string + - Images + summary: | + Creates an image given a prompt. [Learn more](/docs/guides/images). + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/CreateImageRequest" responses: "200": - description: Project API key retrieved successfully. + description: OK content: application/json: schema: - $ref: "#/components/schemas/ProjectApiKey" + $ref: "#/components/schemas/ImagesResponse" x-oaiMeta: - name: Retrieve project API key - group: administration - returns: The [ProjectApiKey](/docs/api-reference/project-api-keys/object) object - matching the specified ID. + name: Create image + group: images + returns: Returns a list of [image](/docs/api-reference/images/object) objects. examples: request: - curl: > - curl - https://api.openai.com/v1/organization/projects/proj_abc/api_keys/key_abc - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "organization.project.api_key", - "redacted_value": "sk-abc...def", - "name": "My API Key", - "created_at": 1711471533, - "id": "key_abc", - "owner": { - "type": "user", - "user": { - "object": "organization.project.user", - "id": "user_abc", - "name": "First Last", - "email": "user@example.com", - "role": "owner", - "added_at": 1711471533 - } - } + curl: | + curl https://api.openai.com/v1/images/generations \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "model": "gpt-image-1", + "prompt": "A cute baby sea otter", + "n": 1, + "size": "1024x1024" + }' + python: | + import base64 + from openai import OpenAI + client = OpenAI() + + img = client.images.generate( + model="gpt-image-1", + prompt="A cute baby sea otter", + n=1, + size="1024x1024" + ) + + image_bytes = base64.b64decode(img.data[0].b64_json) + with open("output.png", "wb") as f: + f.write(image_bytes) + node.js: | + import OpenAI from "openai"; + import { writeFile } from "fs/promises"; + + const client = new OpenAI(); + + const img = await client.images.generate({ + model: "gpt-image-1", + prompt: "A cute baby sea otter", + n: 1, + size: "1024x1024" + }); + + const imageBuffer = Buffer.from(img.data[0].b64_json, "base64"); + await writeFile("output.png", imageBuffer); + response: | + { + "created": 1713833628, + "data": [ + { + "b64_json": "..." + } + ], + "usage": { + "total_tokens": 100, + "input_tokens": 50, + "output_tokens": 50, + "input_tokens_details": { + "text_tokens": 10, + "image_tokens": 40 + } } - delete: - summary: Deletes an API key from the project. - operationId: delete-project-api-key + } + /images/variations: + post: + operationId: createImageVariation tags: - - Projects - parameters: - - name: project_id - in: path - description: The ID of the project. - required: true - schema: - type: string - - name: key_id - in: path - description: The ID of the API key. - required: true - schema: - type: string + - Images + summary: Creates a variation of a given image. This endpoint only supports + `dall-e-2`. + requestBody: + required: true + content: + multipart/form-data: + schema: + $ref: "#/components/schemas/CreateImageVariationRequest" responses: "200": - description: Project API key deleted successfully. + description: OK content: application/json: schema: - $ref: "#/components/schemas/ProjectApiKeyDeleteResponse" - "400": - description: Error response for various conditions. + $ref: "#/components/schemas/ImagesResponse" + x-oaiMeta: + name: Create image variation + group: images + returns: Returns a list of [image](/docs/api-reference/images/object) objects. + examples: + request: + curl: | + curl https://api.openai.com/v1/images/variations \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -F image="@otter.png" \ + -F n=2 \ + -F size="1024x1024" + python: | + from openai import OpenAI + client = OpenAI() + + response = client.images.create_variation( + image=open("image_edit_original.png", "rb"), + n=2, + size="1024x1024" + ) + node.js: |- + import fs from "fs"; + import OpenAI from "openai"; + + const openai = new OpenAI(); + + async function main() { + const image = await openai.images.createVariation({ + image: fs.createReadStream("otter.png"), + }); + + console.log(image.data); + } + main(); + csharp: > + using System; + + + using OpenAI.Images; + + + ImageClient client = new( + model: "dall-e-2", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + GeneratedImage image = + client.GenerateImageVariation(imageFilePath: "otter.png"); + + + Console.WriteLine(image.ImageUri); + response: | + { + "created": 1589478378, + "data": [ + { + "url": "https://..." + }, + { + "url": "https://..." + } + ] + } + /models: + get: + operationId: listModels + tags: + - Models + summary: Lists the currently available models, and provides basic information + about each one such as the owner and availability. + responses: + "200": + description: OK content: application/json: schema: - $ref: "#/components/schemas/ErrorResponse" + $ref: "#/components/schemas/ListModelsResponse" x-oaiMeta: - name: Delete project API key - group: administration - returns: Confirmation of the key's deletion or an error if the key belonged to a - service account + name: List models + group: models + returns: A list of [model](/docs/api-reference/models/object) objects. examples: request: - curl: > - curl -X DELETE - https://api.openai.com/v1/organization/projects/proj_abc/api_keys/key_abc - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "organization.project.api_key.deleted", - "id": "key_abc", - "deleted": true + curl: | + curl https://api.openai.com/v1/models \ + -H "Authorization: Bearer $OPENAI_API_KEY" + python: | + from openai import OpenAI + client = OpenAI() + + client.models.list() + node.js: |- + import OpenAI from "openai"; + + const openai = new OpenAI(); + + async function main() { + const list = await openai.models.list(); + + for await (const model of list) { + console.log(model); + } } - error_response: - content: > + main(); + csharp: | + using System; + + using OpenAI.Models; + + OpenAIModelClient client = new( + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + foreach (var model in client.GetModels().Value) { - "code": 400, - "message": "API keys cannot be deleted for service accounts, please delete the service account" + Console.WriteLine(model.Id); } - /organization/projects/{project_id}/archive: - post: - summary: Archives a project in the organization. Archived projects cannot be - used or updated. - operationId: archive-project + response: | + { + "object": "list", + "data": [ + { + "id": "model-id-0", + "object": "model", + "created": 1686935002, + "owned_by": "organization-owner" + }, + { + "id": "model-id-1", + "object": "model", + "created": 1686935002, + "owned_by": "organization-owner", + }, + { + "id": "model-id-2", + "object": "model", + "created": 1686935002, + "owned_by": "openai" + }, + ], + "object": "list" + } + /models/{model}: + get: + operationId: retrieveModel tags: - - Projects + - Models + summary: Retrieves a model instance, providing basic information about the model + such as the owner and permissioning. parameters: - - name: project_id - in: path - description: The ID of the project. + - in: path + name: model required: true schema: type: string + example: gpt-4o-mini + description: The ID of the model to use for this request responses: "200": - description: Project archived successfully. + description: OK content: application/json: schema: - $ref: "#/components/schemas/Project" + $ref: "#/components/schemas/Model" x-oaiMeta: - name: Archive project - group: administration - returns: The archived [Project](/docs/api-reference/projects/object) object. + name: Retrieve model + group: models + returns: The [model](/docs/api-reference/models/object) object matching the + specified ID. examples: request: - curl: > - curl -X POST - https://api.openai.com/v1/organization/projects/proj_abc/archive \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "id": "proj_abc", - "object": "organization.project", - "name": "Project DEF", - "created_at": 1711471533, - "archived_at": 1711471533, - "status": "archived" + curl: | + curl https://api.openai.com/v1/models/VAR_chat_model_id \ + -H "Authorization: Bearer $OPENAI_API_KEY" + python: | + from openai import OpenAI + client = OpenAI() + + client.models.retrieve("VAR_chat_model_id") + node.js: |- + import OpenAI from "openai"; + + const openai = new OpenAI(); + + async function main() { + const model = await openai.models.retrieve("VAR_chat_model_id"); + + console.log(model); } - /organization/projects/{project_id}/rate_limits: - get: - summary: Returns the rate limits per model for a project. - operationId: list-project-rate-limits + + main(); + csharp: | + using System; + using System.ClientModel; + + using OpenAI.Models; + + OpenAIModelClient client = new( + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + ClientResult model = client.GetModel("babbage-002"); + Console.WriteLine(model.Value.Id); + response: | + { + "id": "VAR_chat_model_id", + "object": "model", + "created": 1686935002, + "owned_by": "openai" + } + delete: + operationId: deleteModel tags: - - Projects + - Models + summary: Delete a fine-tuned model. You must have the Owner role in your + organization to delete a model. parameters: - - name: project_id - in: path - description: The ID of the project. + - in: path + name: model required: true schema: type: string - - name: limit - in: query - description: | - A limit on the number of objects to be returned. The default is 100. - required: false - schema: - type: integer - default: 100 - - name: after - in: query - description: > - A cursor for use in pagination. `after` is an object ID that defines - your place in the list. For instance, if you make a list request and - receive 100 objects, ending with obj_foo, your subsequent call can - include after=obj_foo in order to fetch the next page of the list. - required: false - schema: - type: string - - name: before - in: query - description: > - A cursor for use in pagination. `before` is an object ID that - defines your place in the list. For instance, if you make a list - request and receive 100 objects, beginning with obj_foo, your - subsequent call can include before=obj_foo in order to fetch the - previous page of the list. - required: false - schema: - type: string + example: ft:gpt-4o-mini:acemeco:suffix:abc123 + description: The model to delete responses: "200": - description: Project rate limits listed successfully. + description: OK content: application/json: schema: - $ref: "#/components/schemas/ProjectRateLimitListResponse" + $ref: "#/components/schemas/DeleteModelResponse" x-oaiMeta: - name: List project rate limits - group: administration - returns: A list of - [ProjectRateLimit](/docs/api-reference/project-rate-limits/object) - objects. + name: Delete a fine-tuned model + group: models + returns: Deletion status. examples: request: - curl: > - curl - https://api.openai.com/v1/organization/projects/proj_abc/rate_limits?after=rl_xxx&limit=20 - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" + curl: | + curl https://api.openai.com/v1/models/ft:gpt-4o-mini:acemeco:suffix:abc123 \ + -X DELETE \ + -H "Authorization: Bearer $OPENAI_API_KEY" + python: | + from openai import OpenAI + client = OpenAI() + + client.models.delete("ft:gpt-4o-mini:acemeco:suffix:abc123") + node.js: >- + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + async function main() { + const model = await openai.models.del("ft:gpt-4o-mini:acemeco:suffix:abc123"); + + console.log(model); + } + + main(); + csharp: > + using System; + + using System.ClientModel; + + + using OpenAI.Models; + + + OpenAIModelClient client = new( + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + ClientResult success = + client.DeleteModel("ft:gpt-4o-mini:acemeco:suffix:abc123"); + + Console.WriteLine(success); response: | { - "object": "list", - "data": [ - { - "object": "project.rate_limit", - "id": "rl-ada", - "model": "ada", - "max_requests_per_1_minute": 600, - "max_tokens_per_1_minute": 150000, - "max_images_per_1_minute": 10 - } - ], - "first_id": "rl-ada", - "last_id": "rl-ada", - "has_more": false - } - error_response: | - { - "code": 404, - "message": "The project {project_id} was not found" + "id": "ft:gpt-4o-mini:acemeco:suffix:abc123", + "object": "model", + "deleted": true } - /organization/projects/{project_id}/rate_limits/{rate_limit_id}: + /moderations: post: - summary: Updates a project rate limit. - operationId: update-project-rate-limits + operationId: createModeration tags: - - Projects - parameters: - - name: project_id - in: path - description: The ID of the project. - required: true - schema: - type: string - - name: rate_limit_id - in: path - description: The ID of the rate limit. - required: true - schema: - type: string + - Moderations + summary: | + Classifies if text and/or image inputs are potentially harmful. Learn + more in the [moderation guide](/docs/guides/moderation). requestBody: - description: The project rate limit update request payload. required: true content: application/json: schema: - $ref: "#/components/schemas/ProjectRateLimitUpdateRequest" - responses: - "200": - description: Project rate limit updated successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectRateLimit" - "400": - description: Error response for various conditions. - content: - application/json: - schema: - $ref: "#/components/schemas/ErrorResponse" - x-oaiMeta: - name: Modify project rate limit - group: administration - returns: The updated - [ProjectRateLimit](/docs/api-reference/project-rate-limits/object) - object. - examples: - request: - curl: > - curl -X POST - https://api.openai.com/v1/organization/projects/proj_abc/rate_limits/rl_xxx - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" \ - -d '{ - "max_requests_per_1_minute": 500 - }' - response: | - { - "object": "project.rate_limit", - "id": "rl-ada", - "model": "ada", - "max_requests_per_1_minute": 600, - "max_tokens_per_1_minute": 150000, - "max_images_per_1_minute": 10 - } - error_response: | - { - "code": 404, - "message": "The project {project_id} was not found" - } - /organization/projects/{project_id}/service_accounts: - get: - summary: Returns a list of service accounts in the project. - operationId: list-project-service-accounts - tags: - - Projects - parameters: - - name: project_id - in: path - description: The ID of the project. - required: true - schema: - type: string - - name: limit - in: query - description: > - A limit on the number of objects to be returned. Limit can range - between 1 and 100, and the default is 20. - required: false - schema: - type: integer - default: 20 - - name: after - in: query - description: > - A cursor for use in pagination. `after` is an object ID that defines - your place in the list. For instance, if you make a list request and - receive 100 objects, ending with obj_foo, your subsequent call can - include after=obj_foo in order to fetch the next page of the list. - required: false - schema: - type: string + $ref: "#/components/schemas/CreateModerationRequest" responses: "200": - description: Project service accounts listed successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectServiceAccountListResponse" - "400": - description: Error response when project is archived. + description: OK content: application/json: schema: - $ref: "#/components/schemas/ErrorResponse" + $ref: "#/components/schemas/CreateModerationResponse" x-oaiMeta: - name: List project service accounts - group: administration - returns: A list of - [ProjectServiceAccount](/docs/api-reference/project-service-accounts/object) - objects. + name: Create moderation + group: moderations + returns: A [moderation](/docs/api-reference/moderations/object) object. examples: - request: - curl: > - curl - https://api.openai.com/v1/organization/projects/proj_abc/service_accounts?after=custom_id&limit=20 - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "list", - "data": [ - { - "object": "organization.project.service_account", - "id": "svc_acct_abc", - "name": "Service Account", - "role": "owner", - "created_at": 1711471533 - } - ], - "first_id": "svc_acct_abc", - "last_id": "svc_acct_xyz", - "has_more": false - } - post: - summary: Creates a new service account in the project. This also returns an - unredacted API key for the service account. - operationId: create-project-service-account - tags: - - Projects - parameters: - - name: project_id - in: path - description: The ID of the project. - required: true - schema: - type: string - requestBody: - description: The project service account create request payload. - required: true - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectServiceAccountCreateRequest" - responses: - "200": - description: Project service account created successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectServiceAccountCreateResponse" - "400": - description: Error response when project is archived. - content: - application/json: - schema: - $ref: "#/components/schemas/ErrorResponse" - x-oaiMeta: - name: Create project service account - group: administration - returns: The created - [ProjectServiceAccount](/docs/api-reference/project-service-accounts/object) - object. - examples: - request: - curl: > - curl -X POST - https://api.openai.com/v1/organization/projects/proj_abc/service_accounts - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" \ - -d '{ - "name": "Production App" - }' - response: - content: | + - title: Single string + request: + curl: | + curl https://api.openai.com/v1/moderations \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "input": "I want to kill them." + }' + python: > + from openai import OpenAI + + client = OpenAI() + + + moderation = client.moderations.create(input="I want to kill + them.") + + print(moderation) + node.js: > + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + async function main() { + const moderation = await openai.moderations.create({ input: "I want to kill them." }); + + console.log(moderation); + } + + main(); + csharp: > + using System; + + using System.ClientModel; + + + using OpenAI.Moderations; + + + ModerationClient client = new( + model: "omni-moderation-latest", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + ClientResult moderation = + client.ClassifyText("I want to kill them."); + response: | { - "object": "organization.project.service_account", - "id": "svc_acct_abc", - "name": "Production App", - "role": "member", - "created_at": 1711471533, - "api_key": { - "object": "organization.project.service_account.api_key", - "value": "sk-abcdefghijklmnop123", - "name": "Secret Key", - "created_at": 1711471533, - "id": "key_abc" + "id": "modr-AB8CjOTu2jiq12hp1AQPfeqFWaORR", + "model": "text-moderation-007", + "results": [ + { + "flagged": true, + "categories": { + "sexual": false, + "hate": false, + "harassment": true, + "self-harm": false, + "sexual/minors": false, + "hate/threatening": false, + "violence/graphic": false, + "self-harm/intent": false, + "self-harm/instructions": false, + "harassment/threatening": true, + "violence": true + }, + "category_scores": { + "sexual": 0.000011726012417057063, + "hate": 0.22706663608551025, + "harassment": 0.5215635299682617, + "self-harm": 2.227119921371923e-6, + "sexual/minors": 7.107352217872176e-8, + "hate/threatening": 0.023547329008579254, + "violence/graphic": 0.00003391829886822961, + "self-harm/intent": 1.646940972932498e-6, + "self-harm/instructions": 1.1198755256458526e-9, + "harassment/threatening": 0.5694745779037476, + "violence": 0.9971134662628174 + } } + ] } - /organization/projects/{project_id}/service_accounts/{service_account_id}: - get: - summary: Retrieves a service account in the project. - operationId: retrieve-project-service-account - tags: - - Projects - parameters: - - name: project_id - in: path - description: The ID of the project. - required: true - schema: - type: string - - name: service_account_id - in: path - description: The ID of the service account. - required: true - schema: - type: string - responses: - "200": - description: Project service account retrieved successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectServiceAccount" - x-oaiMeta: - name: Retrieve project service account - group: administration - returns: The - [ProjectServiceAccount](/docs/api-reference/project-service-accounts/object) - object matching the specified ID. - examples: - request: - curl: > - curl - https://api.openai.com/v1/organization/projects/proj_abc/service_accounts/svc_acct_abc - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | + - title: Image and text + request: + curl: > + curl https://api.openai.com/v1/moderations \ + -X POST \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "model": "omni-moderation-latest", + "input": [ + { "type": "text", "text": "...text to classify goes here..." }, + { + "type": "image_url", + "image_url": { + "url": "https://example.com/image.png" + } + } + ] + }' + python: > + from openai import OpenAI + + client = OpenAI() + + + response = client.moderations.create( + model="omni-moderation-latest", + input=[ + {"type": "text", "text": "...text to classify goes here..."}, + { + "type": "image_url", + "image_url": { + "url": "https://example.com/image.png", + # can also use base64 encoded image URLs + # "url": "data:image/jpeg;base64,abcdefg..." + } + }, + ], + ) + + + print(response) + node.js: > + import OpenAI from "openai"; + + const openai = new OpenAI(); + + + const moderation = await openai.moderations.create({ + model: "omni-moderation-latest", + input: [ + { type: "text", text: "...text to classify goes here..." }, + { + type: "image_url", + image_url: { + url: "https://example.com/image.png" + // can also use base64 encoded image URLs + // url: "data:image/jpeg;base64,abcdefg..." + } + } + ], + }); + + + console.log(moderation); + response: | { - "object": "organization.project.service_account", - "id": "svc_acct_abc", - "name": "Service Account", - "role": "owner", - "created_at": 1711471533 - } - delete: - summary: Deletes a service account from the project. - operationId: delete-project-service-account - tags: - - Projects - parameters: - - name: project_id - in: path - description: The ID of the project. - required: true - schema: - type: string - - name: service_account_id - in: path - description: The ID of the service account. - required: true - schema: - type: string - responses: - "200": - description: Project service account deleted successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectServiceAccountDeleteResponse" - x-oaiMeta: - name: Delete project service account - group: administration - returns: Confirmation of service account being deleted, or an error in case of - an archived project, which has no service accounts - examples: - request: - curl: > - curl -X DELETE - https://api.openai.com/v1/organization/projects/proj_abc/service_accounts/svc_acct_abc - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "organization.project.service_account.deleted", - "id": "svc_acct_abc", - "deleted": true + "id": "modr-0d9740456c391e43c445bf0f010940c7", + "model": "omni-moderation-latest", + "results": [ + { + "flagged": true, + "categories": { + "harassment": true, + "harassment/threatening": true, + "sexual": false, + "hate": false, + "hate/threatening": false, + "illicit": false, + "illicit/violent": false, + "self-harm/intent": false, + "self-harm/instructions": false, + "self-harm": false, + "sexual/minors": false, + "violence": true, + "violence/graphic": true + }, + "category_scores": { + "harassment": 0.8189693396524255, + "harassment/threatening": 0.804985420696006, + "sexual": 1.573112165348997e-6, + "hate": 0.007562942636942845, + "hate/threatening": 0.004208854591835476, + "illicit": 0.030535955153511665, + "illicit/violent": 0.008925306722380033, + "self-harm/intent": 0.00023023930975076432, + "self-harm/instructions": 0.0002293869201073356, + "self-harm": 0.012598046106750154, + "sexual/minors": 2.212566909570261e-8, + "violence": 0.9999992735124786, + "violence/graphic": 0.843064871157054 + }, + "category_applied_input_types": { + "harassment": [ + "text" + ], + "harassment/threatening": [ + "text" + ], + "sexual": [ + "text", + "image" + ], + "hate": [ + "text" + ], + "hate/threatening": [ + "text" + ], + "illicit": [ + "text" + ], + "illicit/violent": [ + "text" + ], + "self-harm/intent": [ + "text", + "image" + ], + "self-harm/instructions": [ + "text", + "image" + ], + "self-harm": [ + "text", + "image" + ], + "sexual/minors": [ + "text" + ], + "violence": [ + "text", + "image" + ], + "violence/graphic": [ + "text", + "image" + ] + } + } + ] } - /organization/projects/{project_id}/users: + /organization/admin_api_keys: get: - summary: Returns a list of users in the project. - operationId: list-project-users - tags: - - Projects + summary: List organization API keys + operationId: admin-api-keys-list + description: Retrieve a paginated list of organization admin API keys. parameters: - - name: project_id - in: path - description: The ID of the project. - required: true + - in: query + name: after + required: false schema: type: string - - name: limit - in: query - description: > - A limit on the number of objects to be returned. Limit can range - between 1 and 100, and the default is 20. + nullable: true + description: Return keys with IDs that come after this ID in the pagination + order. + - in: query + name: order required: false schema: - type: integer - default: 20 - - name: after - in: query - description: > - A cursor for use in pagination. `after` is an object ID that defines - your place in the list. For instance, if you make a list request and - receive 100 objects, ending with obj_foo, your subsequent call can - include after=obj_foo in order to fetch the next page of the list. + type: string + enum: + - asc + - desc + default: asc + description: Order results by creation time, ascending or descending. + - in: query + name: limit required: false schema: - type: string + type: integer + default: 20 + description: Maximum number of keys to return. responses: "200": - description: Project users listed successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectUserListResponse" - "400": - description: Error response when project is archived. + description: A list of organization API keys. content: application/json: schema: - $ref: "#/components/schemas/ErrorResponse" + $ref: "#/components/schemas/ApiKeyList" x-oaiMeta: - name: List project users + name: List all organization and project API keys. group: administration - returns: A list of [ProjectUser](/docs/api-reference/project-users/object) - objects. + returns: A list of admin and project API key objects. examples: request: - curl: > - curl - https://api.openai.com/v1/organization/projects/proj_abc/users?after=user_abc&limit=20 - \ + curl: | + curl https://api.openai.com/v1/organization/admin_api_keys?after=key_abc&limit=20 \ -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ -H "Content-Type: application/json" - response: - content: | - { - "object": "list", - "data": [ - { - "object": "organization.project.user", - "id": "user_abc", - "name": "First Last", - "email": "user@example.com", - "role": "owner", - "added_at": 1711471533 - } - ], - "first_id": "user-abc", - "last_id": "user-xyz", - "has_more": false - } - error_response: - content: | - { - "code": 400, - "message": "Project {name} is archived" - } + response: | + { + "object": "list", + "data": [ + { + "object": "organization.admin_api_key", + "id": "key_abc", + "name": "Main Admin Key", + "redacted_value": "sk-admin...def", + "created_at": 1711471533, + "last_used_at": 1711471534, + "owner": { + "type": "service_account", + "object": "organization.service_account", + "id": "sa_456", + "name": "My Service Account", + "created_at": 1711471533, + "role": "member" + } + } + ], + "first_id": "key_abc", + "last_id": "key_abc", + "has_more": false + } post: - summary: Adds a user to the project. Users must already be members of the - organization to be added to a project. - operationId: create-project-user - parameters: - - name: project_id - in: path - description: The ID of the project. - required: true - schema: - type: string - tags: - - Projects + summary: Create an organization admin API key + operationId: admin-api-keys-create + description: Create a new admin-level API key for the organization. requestBody: - description: The project user create request payload. required: true content: application/json: schema: - $ref: "#/components/schemas/ProjectUserCreateRequest" + type: object + required: + - name + properties: + name: + type: string + example: New Admin Key responses: "200": - description: User added to project successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectUser" - "400": - description: Error response for various conditions. + description: The newly created admin API key. content: application/json: schema: - $ref: "#/components/schemas/ErrorResponse" + $ref: "#/components/schemas/AdminApiKey" x-oaiMeta: - name: Create project user + name: Create admin API key group: administration - returns: The created [ProjectUser](/docs/api-reference/project-users/object) + returns: The created [AdminApiKey](/docs/api-reference/admin-api-keys/object) object. examples: request: curl: > - curl -X POST - https://api.openai.com/v1/organization/projects/proj_abc/users \ + curl -X POST https://api.openai.com/v1/organization/admin_api_keys + \ -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ -H "Content-Type: application/json" \ -d '{ - "user_id": "user_abc", - "role": "member" + "name": "New Admin Key" }' - response: - content: | - { - "object": "organization.project.user", - "id": "user_abc", - "email": "user@example.com", - "role": "owner", - "added_at": 1711471533 - } - error_response: - content: | - { - "code": 400, - "message": "Project {name} is archived" - } - /organization/projects/{project_id}/users/{user_id}: + response: | + { + "object": "organization.admin_api_key", + "id": "key_xyz", + "name": "New Admin Key", + "redacted_value": "sk-admin...xyz", + "created_at": 1711471533, + "last_used_at": 1711471534, + "owner": { + "type": "user", + "object": "organization.user", + "id": "user_123", + "name": "John Doe", + "created_at": 1711471533, + "role": "owner" + }, + "value": "sk-admin-1234abcd" + } + /organization/admin_api_keys/{key_id}: get: - summary: Retrieves a user in the project. - operationId: retrieve-project-user - tags: - - Projects + summary: Retrieve a single organization API key + operationId: admin-api-keys-get + description: Get details for a specific organization API key by its ID. parameters: - - name: project_id - in: path - description: The ID of the project. - required: true - schema: - type: string - - name: user_id - in: path - description: The ID of the user. + - in: path + name: key_id required: true schema: type: string + description: The ID of the API key. responses: "200": - description: Project user retrieved successfully. + description: Details of the requested API key. content: application/json: schema: - $ref: "#/components/schemas/ProjectUser" + $ref: "#/components/schemas/AdminApiKey" x-oaiMeta: - name: Retrieve project user + name: Retrieve admin API key group: administration - returns: The [ProjectUser](/docs/api-reference/project-users/object) object - matching the specified ID. + returns: The requested [AdminApiKey](/docs/api-reference/admin-api-keys/object) + object. examples: request: curl: > - curl - https://api.openai.com/v1/organization/projects/proj_abc/users/user_abc + curl https://api.openai.com/v1/organization/admin_api_keys/key_abc \ -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ -H "Content-Type: application/json" - response: - content: | - { - "object": "organization.project.user", - "id": "user_abc", - "name": "First Last", - "email": "user@example.com", - "role": "owner", - "added_at": 1711471533 + response: | + { + "object": "organization.admin_api_key", + "id": "key_abc", + "name": "Main Admin Key", + "redacted_value": "sk-admin...xyz", + "created_at": 1711471533, + "last_used_at": 1711471534, + "owner": { + "type": "user", + "object": "organization.user", + "id": "user_123", + "name": "John Doe", + "created_at": 1711471533, + "role": "owner" } - post: - summary: Modifies a user's role in the project. - operationId: modify-project-user - tags: - - Projects + } + delete: + summary: Delete an organization admin API key + operationId: admin-api-keys-delete + description: Delete the specified admin API key. parameters: - - name: project_id - in: path - description: The ID of the project. + - in: path + name: key_id required: true schema: type: string - - name: user_id - in: path - description: The ID of the user. - required: true - schema: - type: string - requestBody: - description: The project user update request payload. - required: true - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectUserUpdateRequest" + description: The ID of the API key to be deleted. responses: "200": - description: Project user's role updated successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectUser" - "400": - description: Error response for various conditions. + description: Confirmation that the API key was deleted. content: application/json: schema: - $ref: "#/components/schemas/ErrorResponse" + type: object + properties: + id: + type: string + example: key_abc + object: + type: string + example: organization.admin_api_key.deleted + deleted: + type: boolean + example: true x-oaiMeta: - name: Modify project user + name: Delete admin API key group: administration - returns: The updated [ProjectUser](/docs/api-reference/project-users/object) - object. + returns: A confirmation object indicating the key was deleted. examples: request: curl: > - curl -X POST - https://api.openai.com/v1/organization/projects/proj_abc/users/user_abc - \ + curl -X DELETE + https://api.openai.com/v1/organization/admin_api_keys/key_abc \ -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" \ - -d '{ - "role": "owner" - }' - response: - content: | - { - "object": "organization.project.user", - "id": "user_abc", - "name": "First Last", - "email": "user@example.com", - "role": "owner", - "added_at": 1711471533 - } - delete: - summary: Deletes a user from the project. - operationId: delete-project-user + -H "Content-Type: application/json" + response: | + { + "id": "key_abc", + "object": "organization.admin_api_key.deleted", + "deleted": true + } + /organization/audit_logs: + get: + summary: List user actions and configuration changes within this organization. + operationId: list-audit-logs tags: - - Projects + - Audit Logs parameters: - - name: project_id - in: path - description: The ID of the project. - required: true + - name: effective_at + in: query + description: Return only events whose `effective_at` (Unix seconds) is in this + range. + required: false + schema: + type: object + properties: + gt: + type: integer + description: Return only events whose `effective_at` (Unix seconds) is greater + than this value. + gte: + type: integer + description: Return only events whose `effective_at` (Unix seconds) is greater + than or equal to this value. + lt: + type: integer + description: Return only events whose `effective_at` (Unix seconds) is less than + this value. + lte: + type: integer + description: Return only events whose `effective_at` (Unix seconds) is less than + or equal to this value. + - name: project_ids[] + in: query + description: Return only events for these projects. + required: false + schema: + type: array + items: + type: string + - name: event_types[] + in: query + description: Return only events with a `type` in one of these values. For + example, `project.created`. For all options, see the documentation + for the [audit log object](/docs/api-reference/audit-logs/object). + required: false + schema: + type: array + items: + $ref: "#/components/schemas/AuditLogEventType" + - name: actor_ids[] + in: query + description: Return only events performed by these actors. Can be a user ID, a + service account ID, or an api key tracking ID. + required: false + schema: + type: array + items: + type: string + - name: actor_emails[] + in: query + description: Return only events performed by users with these emails. + required: false + schema: + type: array + items: + type: string + - name: resource_ids[] + in: query + description: Return only events performed on these targets. For example, a + project ID updated. + required: false + schema: + type: array + items: + type: string + - name: limit + in: query + description: > + A limit on the number of objects to be returned. Limit can range + between 1 and 100, and the default is 20. + required: false + schema: + type: integer + default: 20 + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. schema: type: string - - name: user_id - in: path - description: The ID of the user. - required: true + - name: before + in: query + description: > + A cursor for use in pagination. `before` is an object ID that + defines your place in the list. For instance, if you make a list + request and receive 100 objects, starting with obj_foo, your + subsequent call can include before=obj_foo in order to fetch the + previous page of the list. schema: type: string responses: "200": - description: Project user deleted successfully. - content: - application/json: - schema: - $ref: "#/components/schemas/ProjectUserDeleteResponse" - "400": - description: Error response for various conditions. + description: Audit logs listed successfully. content: application/json: schema: - $ref: "#/components/schemas/ErrorResponse" + $ref: "#/components/schemas/ListAuditLogsResponse" x-oaiMeta: - name: Delete project user - group: administration - returns: Confirmation that project has been deleted or an error in case of an - archived project, which has no users + name: List audit logs + group: audit-logs + returns: A list of paginated [Audit Log](/docs/api-reference/audit-logs/object) + objects. examples: request: - curl: > - curl -X DELETE - https://api.openai.com/v1/organization/projects/proj_abc/users/user_abc - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "organization.project.user.deleted", - "id": "user_abc", - "deleted": true - } - /organization/users: + curl: | + curl https://api.openai.com/v1/organization/audit_logs \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: > + { + "object": "list", + "data": [ + { + "id": "audit_log-xxx_yyyymmdd", + "type": "project.archived", + "effective_at": 1722461446, + "actor": { + "type": "api_key", + "api_key": { + "type": "user", + "user": { + "id": "user-xxx", + "email": "user@example.com" + } + } + }, + "project.archived": { + "id": "proj_abc" + }, + }, + { + "id": "audit_log-yyy__20240101", + "type": "api_key.updated", + "effective_at": 1720804190, + "actor": { + "type": "session", + "session": { + "user": { + "id": "user-xxx", + "email": "user@example.com" + }, + "ip_address": "127.0.0.1", + "user_agent": "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/91.0.4472.124 Safari/537.36", + "ja3": "a497151ce4338a12c4418c44d375173e", + "ja4": "q13d0313h3_55b375c5d22e_c7319ce65786", + "ip_address_details": { + "country": "US", + "city": "San Francisco", + "region": "California", + "region_code": "CA", + "asn": "1234", + "latitude": "37.77490", + "longitude": "-122.41940" + } + } + }, + "api_key.updated": { + "id": "key_xxxx", + "data": { + "scopes": ["resource_2.operation_2"] + } + }, + } + ], + "first_id": "audit_log-xxx__20240101", + "last_id": "audit_log_yyy__20240101", + "has_more": true + } + /organization/certificates: get: - summary: Lists all of the users in the organization. - operationId: list-users + summary: List uploaded certificates for this organization. + operationId: listOrganizationCertificates tags: - - Users + - Certificates parameters: - name: limit in: query @@ -5391,378 +7653,5033 @@ paths: required: false schema: type: string + - name: order + in: query + description: > + Sort order by the `created_at` timestamp of the objects. `asc` for + ascending order and `desc` for descending order. + schema: + type: string + default: desc + enum: + - asc + - desc responses: "200": - description: Users listed successfully. + description: Certificates listed successfully. content: application/json: schema: - $ref: "#/components/schemas/UserListResponse" + $ref: "#/components/schemas/ListCertificatesResponse" x-oaiMeta: - name: List users + name: List organization certificates group: administration - returns: A list of [User](/docs/api-reference/users/object) objects. + returns: A list of [Certificate](/docs/api-reference/certificates/object) + objects. examples: request: - curl: > - curl - https://api.openai.com/v1/organization/users?after=user_abc&limit=20 - \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "list", - "data": [ - { - "object": "organization.user", - "id": "user_abc", - "name": "First Last", - "email": "user@example.com", - "role": "owner", - "added_at": 1711471533 - } - ], - "first_id": "user-abc", - "last_id": "user-xyz", - "has_more": false - } - /organization/users/{user_id}: - get: - summary: Retrieves a user by their identifier. - operationId: retrieve-user + curl: | + curl https://api.openai.com/v1/organization/certificates \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" + response: | + { + "object": "list", + "data": [ + { + "object": "organization.certificate", + "id": "cert_abc", + "name": "My Example Certificate", + "active": true, + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 + } + }, + ], + "first_id": "cert_abc", + "last_id": "cert_abc", + "has_more": false + } + post: + summary: > + Upload a certificate to the organization. This does **not** + automatically activate the certificate. + + + Organizations can upload up to 50 certificates. + operationId: uploadCertificate tags: - - Users - parameters: - - name: user_id - in: path - description: The ID of the user. - required: true - schema: - type: string + - Certificates + requestBody: + description: The certificate upload payload. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/UploadCertificateRequest" responses: "200": - description: User retrieved successfully. + description: Certificate uploaded successfully. content: application/json: schema: - $ref: "#/components/schemas/User" + $ref: "#/components/schemas/Certificate" x-oaiMeta: - name: Retrieve user + name: Upload certificate group: administration - returns: The [User](/docs/api-reference/users/object) object matching the - specified ID. + returns: A single [Certificate](/docs/api-reference/certificates/object) object. examples: request: - curl: | - curl https://api.openai.com/v1/organization/users/user_abc \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "organization.user", - "id": "user_abc", - "name": "First Last", - "email": "user@example.com", - "role": "owner", - "added_at": 1711471533 + curl: > + curl -X POST https://api.openai.com/v1/organization/certificates \ + + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + + -H "Content-Type: application/json" \ + + -d '{ + "name": "My Example Certificate", + "certificate": "-----BEGIN CERTIFICATE-----\\nMIIDeT...\\n-----END CERTIFICATE-----" + }' + response: | + { + "object": "certificate", + "id": "cert_abc", + "name": "My Example Certificate", + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 } + } + /organization/certificates/activate: post: - summary: Modifies a user's role in the organization. - operationId: modify-user + summary: > + Activate certificates at the organization level. + + + You can atomically and idempotently activate up to 10 certificates at a + time. + operationId: activateOrganizationCertificates tags: - - Users - parameters: - - name: user_id - in: path - description: The ID of the user. - required: true - schema: - type: string + - Certificates requestBody: - description: The new user role to modify. This must be one of `owner` or `member`. + description: The certificate activation payload. required: true content: application/json: schema: - $ref: "#/components/schemas/UserRoleUpdateRequest" + $ref: "#/components/schemas/ToggleCertificatesRequest" responses: "200": - description: User role updated successfully. + description: Certificates activated successfully. content: application/json: schema: - $ref: "#/components/schemas/User" + $ref: "#/components/schemas/ListCertificatesResponse" x-oaiMeta: - name: Modify user + name: Activate certificates for organization group: administration - returns: The updated [User](/docs/api-reference/users/object) object. + returns: A list of [Certificate](/docs/api-reference/certificates/object) + objects that were activated. examples: request: curl: > - curl -X POST https://api.openai.com/v1/organization/users/user_abc + curl https://api.openai.com/v1/organization/certificates/activate \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" \ - -d '{ - "role": "owner" - }' - response: - content: | - { - "object": "organization.user", - "id": "user_abc", - "name": "First Last", - "email": "user@example.com", - "role": "owner", - "added_at": 1711471533 - } - delete: - summary: Deletes a user from the organization. - operationId: delete-user + + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + + -H "Content-Type: application/json" \ + + -d '{ + "data": ["cert_abc", "cert_def"] + }' + response: | + { + "object": "organization.certificate.activation", + "data": [ + { + "object": "organization.certificate", + "id": "cert_abc", + "name": "My Example Certificate", + "active": true, + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 + } + }, + { + "object": "organization.certificate", + "id": "cert_def", + "name": "My Example Certificate 2", + "active": true, + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 + } + }, + ], + } + /organization/certificates/deactivate: + post: + summary: > + Deactivate certificates at the organization level. + + + You can atomically and idempotently deactivate up to 10 certificates at + a time. + operationId: deactivateOrganizationCertificates tags: - - Users + - Certificates + requestBody: + description: The certificate deactivation payload. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/ToggleCertificatesRequest" + responses: + "200": + description: Certificates deactivated successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ListCertificatesResponse" + x-oaiMeta: + name: Deactivate certificates for organization + group: administration + returns: A list of [Certificate](/docs/api-reference/certificates/object) + objects that were deactivated. + examples: + request: + curl: > + curl + https://api.openai.com/v1/organization/certificates/deactivate \ + + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + + -H "Content-Type: application/json" \ + + -d '{ + "data": ["cert_abc", "cert_def"] + }' + response: | + { + "object": "organization.certificate.deactivation", + "data": [ + { + "object": "organization.certificate", + "id": "cert_abc", + "name": "My Example Certificate", + "active": false, + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 + } + }, + { + "object": "organization.certificate", + "id": "cert_def", + "name": "My Example Certificate 2", + "active": false, + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 + } + }, + ], + } + /organization/certificates/{certificate_id}: + get: + summary: | + Get a certificate that has been uploaded to the organization. + + You can get a certificate regardless of whether it is active or not. + operationId: getCertificate + tags: + - Certificates parameters: - - name: user_id + - name: cert_id in: path - description: The ID of the user. + description: Unique ID of the certificate to retrieve. required: true schema: type: string + - name: include + in: query + description: A list of additional fields to include in the response. Currently + the only supported value is `content` to fetch the PEM content of + the certificate. + required: false + schema: + type: array + items: + type: string + enum: + - content responses: "200": - description: User deleted successfully. + description: Certificate retrieved successfully. content: application/json: schema: - $ref: "#/components/schemas/UserDeleteResponse" + $ref: "#/components/schemas/Certificate" x-oaiMeta: - name: Delete user + name: Get certificate group: administration - returns: Confirmation of the deleted user + returns: A single [Certificate](/docs/api-reference/certificates/object) object. examples: request: - curl: > - curl -X DELETE - https://api.openai.com/v1/organization/users/user_abc \ - -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - -H "Content-Type: application/json" - response: - content: | - { - "object": "organization.user.deleted", - "id": "user_abc", - "deleted": true + curl: | + curl "https://api.openai.com/v1/organization/certificates/cert_abc?include[]=content" \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" + response: > + { + "object": "certificate", + "id": "cert_abc", + "name": "My Example Certificate", + "created_at": 1234567, + "certificate_details": { + "valid_at": 1234567, + "expires_at": 12345678, + "content": "-----BEGIN CERTIFICATE-----MIIDeT...-----END CERTIFICATE-----" } - /threads: + } post: - operationId: createThread + summary: | + Modify a certificate. Note that only the name can be modified. + operationId: modifyCertificate tags: - - Assistants - summary: Create a thread. + - Certificates requestBody: + description: The certificate modification payload. + required: true content: application/json: schema: - $ref: "#/components/schemas/CreateThreadRequest" + $ref: "#/components/schemas/ModifyCertificateRequest" responses: "200": - description: OK + description: Certificate modified successfully. content: application/json: schema: - $ref: "#/components/schemas/ThreadObject" + $ref: "#/components/schemas/Certificate" x-oaiMeta: - name: Create thread - group: threads - beta: true - returns: A [thread](/docs/api-reference/threads) object. + name: Modify certificate + group: administration + returns: The updated [Certificate](/docs/api-reference/certificates/object) + object. examples: - - title: Empty - request: - curl: | - curl https://api.openai.com/v1/threads \ - -H "Content-Type: application/json" \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "OpenAI-Beta: assistants=v2" \ - -d '' - python: | - from openai import OpenAI - client = OpenAI() - - empty_thread = client.beta.threads.create() - print(empty_thread) - node.js: |- - import OpenAI from "openai"; - - const openai = new OpenAI(); + request: + curl: > + curl -X POST + https://api.openai.com/v1/organization/certificates/cert_abc \ - async function main() { - const emptyThread = await openai.beta.threads.create(); + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ - console.log(emptyThread); - } + -H "Content-Type: application/json" \ - main(); - response: | - { - "id": "thread_abc123", - "object": "thread", - "created_at": 1699012949, - "metadata": {}, - "tool_resources": {} + -d '{ + "name": "Renamed Certificate" + }' + response: | + { + "object": "certificate", + "id": "cert_abc", + "name": "Renamed Certificate", + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 } - - title: Messages - request: - curl: | - curl https://api.openai.com/v1/threads \ - -H "Content-Type: application/json" \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "OpenAI-Beta: assistants=v2" \ - -d '{ - "messages": [{ - "role": "user", - "content": "Hello, what is AI?" - }, { - "role": "user", - "content": "How does AI work? Explain it in simple terms." - }] - }' - python: | - from openai import OpenAI - client = OpenAI() - - message_thread = client.beta.threads.create( - messages=[ - { - "role": "user", - "content": "Hello, what is AI?" - }, - { - "role": "user", - "content": "How does AI work? Explain it in simple terms." - }, - ] - ) + } + delete: + summary: | + Delete a certificate from the organization. - print(message_thread) - node.js: >- - import OpenAI from "openai"; - - - const openai = new OpenAI(); - - - async function main() { - const messageThread = await openai.beta.threads.create({ - messages: [ - { - role: "user", - content: "Hello, what is AI?" - }, - { - role: "user", - content: "How does AI work? Explain it in simple terms.", - }, - ], - }); + The certificate must be inactive for the organization and all projects. + operationId: deleteCertificate + tags: + - Certificates + responses: + "200": + description: Certificate deleted successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/DeleteCertificateResponse" + x-oaiMeta: + name: Delete certificate + group: administration + returns: A confirmation object indicating the certificate was deleted. + examples: + request: + curl: > + curl -X DELETE + https://api.openai.com/v1/organization/certificates/cert_abc \ - console.log(messageThread); + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" + response: | + { + "object": "certificate.deleted", + "id": "cert_abc" + } + /organization/costs: + get: + summary: Get costs details for the organization. + operationId: usage-costs + tags: + - Usage + parameters: + - name: start_time + in: query + description: Start time (Unix seconds) of the query time range, inclusive. + required: true + schema: + type: integer + - name: end_time + in: query + description: End time (Unix seconds) of the query time range, exclusive. + required: false + schema: + type: integer + - name: bucket_width + in: query + description: Width of each time bucket in response. Currently only `1d` is + supported, default to `1d`. + required: false + schema: + type: string + enum: + - 1d + default: 1d + - name: project_ids + in: query + description: Return only costs for these projects. + required: false + schema: + type: array + items: + type: string + - name: group_by + in: query + description: Group the costs by the specified fields. Support fields include + `project_id`, `line_item` and any combination of them. + required: false + schema: + type: array + items: + type: string + enum: + - project_id + - line_item + - name: limit + in: query + description: > + A limit on the number of buckets to be returned. Limit can range + between 1 and 180, and the default is 7. + required: false + schema: + type: integer + default: 7 + - name: page + in: query + description: A cursor for use in pagination. Corresponding to the `next_page` + field from the previous response. + schema: + type: string + responses: + "200": + description: Costs data retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/UsageResponse" + x-oaiMeta: + name: Costs + group: usage-costs + returns: A list of paginated, time bucketed + [Costs](/docs/api-reference/usage/costs_object) objects. + examples: + request: + curl: | + curl "https://api.openai.com/v1/organization/costs?start_time=1730419200&limit=1" \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "page", + "data": [ + { + "object": "bucket", + "start_time": 1730419200, + "end_time": 1730505600, + "results": [ + { + "object": "organization.costs.result", + "amount": { + "value": 0.06, + "currency": "usd" + }, + "line_item": null, + "project_id": null + } + ] + } + ], + "has_more": false, + "next_page": null + } + /organization/invites: + get: + summary: Returns a list of invites in the organization. + operationId: list-invites + tags: + - Invites + parameters: + - name: limit + in: query + description: > + A limit on the number of objects to be returned. Limit can range + between 1 and 100, and the default is 20. + required: false + schema: + type: integer + default: 20 + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. + required: false + schema: + type: string + responses: + "200": + description: Invites listed successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/InviteListResponse" + x-oaiMeta: + name: List invites + group: administration + returns: A list of [Invite](/docs/api-reference/invite/object) objects. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/invites?after=invite-abc&limit=20 \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "list", + "data": [ + { + "object": "organization.invite", + "id": "invite-abc", + "email": "user@example.com", + "role": "owner", + "status": "accepted", + "invited_at": 1711471533, + "expires_at": 1711471533, + "accepted_at": 1711471533 } - - - main(); - response: | - { - "id": "thread_abc123", - "object": "thread", - "created_at": 1699014083, - "metadata": {}, - "tool_resources": {} - } - /threads/runs: + ], + "first_id": "invite-abc", + "last_id": "invite-abc", + "has_more": false + } post: - operationId: createThreadAndRun + summary: Create an invite for a user to the organization. The invite must be + accepted by the user before they have access to the organization. + operationId: inviteUser tags: - - Assistants - summary: Create a thread and run it in one request. + - Invites requestBody: + description: The invite request payload. required: true content: application/json: schema: - $ref: "#/components/schemas/CreateThreadAndRunRequest" + $ref: "#/components/schemas/InviteRequest" responses: "200": - description: OK + description: User invited successfully. content: application/json: schema: - $ref: "#/components/schemas/RunObject" + $ref: "#/components/schemas/Invite" x-oaiMeta: - name: Create thread and run - group: threads - beta: true - returns: A [run](/docs/api-reference/runs/object) object. + name: Create invite + group: administration + returns: The created [Invite](/docs/api-reference/invite/object) object. examples: - - title: Default - request: - curl: > - curl https://api.openai.com/v1/threads/runs \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "Content-Type: application/json" \ - -H "OpenAI-Beta: assistants=v2" \ - -d '{ - "assistant_id": "asst_abc123", - "thread": { - "messages": [ - {"role": "user", "content": "Explain deep learning to a 5 year old."} - ] + request: + curl: | + curl -X POST https://api.openai.com/v1/organization/invites \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "email": "anotheruser@example.com", + "role": "reader", + "projects": [ + { + "id": "project-xyz", + "role": "member" + }, + { + "id": "project-abc", + "role": "owner" } - }' - python: > - from openai import OpenAI - - client = OpenAI() - - - run = client.beta.threads.create_and_run( - assistant_id="asst_abc123", - thread={ - "messages": [ - {"role": "user", "content": "Explain deep learning to a 5 year old."} ] - } - ) - - - print(run) - node.js: > - import OpenAI from "openai"; - - - const openai = new OpenAI(); - - - async function main() { - const run = await openai.beta.threads.createAndRun({ - assistant_id: "asst_abc123", - thread: { - messages: [ - { role: "user", content: "Explain deep learning to a 5 year old." }, - ], - }, - }); - - console.log(run); + }' + response: | + { + "object": "organization.invite", + "id": "invite-def", + "email": "anotheruser@example.com", + "role": "reader", + "status": "pending", + "invited_at": 1711471533, + "expires_at": 1711471533, + "accepted_at": null, + "projects": [ + { + "id": "project-xyz", + "role": "member" + }, + { + "id": "project-abc", + "role": "owner" } - - - main(); - response: | - { + ] + } + /organization/invites/{invite_id}: + get: + summary: Retrieves an invite. + operationId: retrieve-invite + tags: + - Invites + parameters: + - in: path + name: invite_id + required: true + schema: + type: string + description: The ID of the invite to retrieve. + responses: + "200": + description: Invite retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/Invite" + x-oaiMeta: + name: Retrieve invite + group: administration + returns: The [Invite](/docs/api-reference/invite/object) object matching the + specified ID. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/invites/invite-abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "organization.invite", + "id": "invite-abc", + "email": "user@example.com", + "role": "owner", + "status": "accepted", + "invited_at": 1711471533, + "expires_at": 1711471533, + "accepted_at": 1711471533 + } + delete: + summary: Delete an invite. If the invite has already been accepted, it cannot be + deleted. + operationId: delete-invite + tags: + - Invites + parameters: + - in: path + name: invite_id + required: true + schema: + type: string + description: The ID of the invite to delete. + responses: + "200": + description: Invite deleted successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/InviteDeleteResponse" + x-oaiMeta: + name: Delete invite + group: administration + returns: Confirmation that the invite has been deleted + examples: + request: + curl: > + curl -X DELETE + https://api.openai.com/v1/organization/invites/invite-abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "organization.invite.deleted", + "id": "invite-abc", + "deleted": true + } + /organization/projects: + get: + summary: Returns a list of projects. + operationId: list-projects + tags: + - Projects + parameters: + - name: limit + in: query + description: > + A limit on the number of objects to be returned. Limit can range + between 1 and 100, and the default is 20. + required: false + schema: + type: integer + default: 20 + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. + required: false + schema: + type: string + - name: include_archived + in: query + schema: + type: boolean + default: false + description: If `true` returns all projects including those that have been + `archived`. Archived projects are not included by default. + responses: + "200": + description: Projects listed successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectListResponse" + x-oaiMeta: + name: List projects + group: administration + returns: A list of [Project](/docs/api-reference/projects/object) objects. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects?after=proj_abc&limit=20&include_archived=false \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "list", + "data": [ + { + "id": "proj_abc", + "object": "organization.project", + "name": "Project example", + "created_at": 1711471533, + "archived_at": null, + "status": "active" + } + ], + "first_id": "proj-abc", + "last_id": "proj-xyz", + "has_more": false + } + post: + summary: Create a new project in the organization. Projects can be created and + archived, but cannot be deleted. + operationId: create-project + tags: + - Projects + requestBody: + description: The project create request payload. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectCreateRequest" + responses: + "200": + description: Project created successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/Project" + x-oaiMeta: + name: Create project + group: administration + returns: The created [Project](/docs/api-reference/projects/object) object. + examples: + request: + curl: | + curl -X POST https://api.openai.com/v1/organization/projects \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "name": "Project ABC" + }' + response: | + { + "id": "proj_abc", + "object": "organization.project", + "name": "Project ABC", + "created_at": 1711471533, + "archived_at": null, + "status": "active" + } + /organization/projects/{project_id}: + get: + summary: Retrieves a project. + operationId: retrieve-project + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + responses: + "200": + description: Project retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/Project" + x-oaiMeta: + name: Retrieve project + group: administration + description: Retrieve a project. + returns: The [Project](/docs/api-reference/projects/object) object matching the + specified ID. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects/proj_abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "id": "proj_abc", + "object": "organization.project", + "name": "Project example", + "created_at": 1711471533, + "archived_at": null, + "status": "active" + } + post: + summary: Modifies a project in the organization. + operationId: modify-project + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + requestBody: + description: The project update request payload. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectUpdateRequest" + responses: + "200": + description: Project updated successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/Project" + "400": + description: Error response when updating the default project. + content: + application/json: + schema: + $ref: "#/components/schemas/ErrorResponse" + x-oaiMeta: + name: Modify project + group: administration + returns: The updated [Project](/docs/api-reference/projects/object) object. + examples: + request: + curl: > + curl -X POST + https://api.openai.com/v1/organization/projects/proj_abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "name": "Project DEF" + }' + /organization/projects/{project_id}/api_keys: + get: + summary: Returns a list of API keys in the project. + operationId: list-project-api-keys + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: limit + in: query + description: > + A limit on the number of objects to be returned. Limit can range + between 1 and 100, and the default is 20. + required: false + schema: + type: integer + default: 20 + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. + required: false + schema: + type: string + responses: + "200": + description: Project API keys listed successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectApiKeyListResponse" + x-oaiMeta: + name: List project API keys + group: administration + returns: A list of [ProjectApiKey](/docs/api-reference/project-api-keys/object) + objects. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects/proj_abc/api_keys?after=key_abc&limit=20 \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "list", + "data": [ + { + "object": "organization.project.api_key", + "redacted_value": "sk-abc...def", + "name": "My API Key", + "created_at": 1711471533, + "last_used_at": 1711471534, + "id": "key_abc", + "owner": { + "type": "user", + "user": { + "object": "organization.project.user", + "id": "user_abc", + "name": "First Last", + "email": "user@example.com", + "role": "owner", + "added_at": 1711471533 + } + } + } + ], + "first_id": "key_abc", + "last_id": "key_xyz", + "has_more": false + } + /organization/projects/{project_id}/api_keys/{key_id}: + get: + summary: Retrieves an API key in the project. + operationId: retrieve-project-api-key + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: key_id + in: path + description: The ID of the API key. + required: true + schema: + type: string + responses: + "200": + description: Project API key retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectApiKey" + x-oaiMeta: + name: Retrieve project API key + group: administration + returns: The [ProjectApiKey](/docs/api-reference/project-api-keys/object) object + matching the specified ID. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects/proj_abc/api_keys/key_abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "organization.project.api_key", + "redacted_value": "sk-abc...def", + "name": "My API Key", + "created_at": 1711471533, + "last_used_at": 1711471534, + "id": "key_abc", + "owner": { + "type": "user", + "user": { + "object": "organization.project.user", + "id": "user_abc", + "name": "First Last", + "email": "user@example.com", + "role": "owner", + "added_at": 1711471533 + } + } + } + delete: + summary: Deletes an API key from the project. + operationId: delete-project-api-key + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: key_id + in: path + description: The ID of the API key. + required: true + schema: + type: string + responses: + "200": + description: Project API key deleted successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectApiKeyDeleteResponse" + "400": + description: Error response for various conditions. + content: + application/json: + schema: + $ref: "#/components/schemas/ErrorResponse" + x-oaiMeta: + name: Delete project API key + group: administration + returns: Confirmation of the key's deletion or an error if the key belonged to a + service account + examples: + request: + curl: | + curl -X DELETE https://api.openai.com/v1/organization/projects/proj_abc/api_keys/key_abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "organization.project.api_key.deleted", + "id": "key_abc", + "deleted": true + } + /organization/projects/{project_id}/archive: + post: + summary: Archives a project in the organization. Archived projects cannot be + used or updated. + operationId: archive-project + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + responses: + "200": + description: Project archived successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/Project" + x-oaiMeta: + name: Archive project + group: administration + returns: The archived [Project](/docs/api-reference/projects/object) object. + examples: + request: + curl: > + curl -X POST + https://api.openai.com/v1/organization/projects/proj_abc/archive \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "id": "proj_abc", + "object": "organization.project", + "name": "Project DEF", + "created_at": 1711471533, + "archived_at": 1711471533, + "status": "archived" + } + /organization/projects/{project_id}/certificates: + get: + summary: List certificates for this project. + operationId: listProjectCertificates + tags: + - Certificates + parameters: + - name: limit + in: query + description: > + A limit on the number of objects to be returned. Limit can range + between 1 and 100, and the default is 20. + required: false + schema: + type: integer + default: 20 + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. + required: false + schema: + type: string + - name: order + in: query + description: > + Sort order by the `created_at` timestamp of the objects. `asc` for + ascending order and `desc` for descending order. + schema: + type: string + default: desc + enum: + - asc + - desc + responses: + "200": + description: Certificates listed successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ListCertificatesResponse" + x-oaiMeta: + name: List project certificates + group: administration + returns: A list of [Certificate](/docs/api-reference/certificates/object) + objects. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects/proj_abc/certificates \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" + response: | + { + "object": "list", + "data": [ + { + "object": "organization.project.certificate", + "id": "cert_abc", + "name": "My Example Certificate", + "active": true, + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 + } + }, + ], + "first_id": "cert_abc", + "last_id": "cert_abc", + "has_more": false + } + /organization/projects/{project_id}/certificates/activate: + post: + summary: > + Activate certificates at the project level. + + + You can atomically and idempotently activate up to 10 certificates at a + time. + operationId: activateProjectCertificates + tags: + - Certificates + requestBody: + description: The certificate activation payload. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/ToggleCertificatesRequest" + responses: + "200": + description: Certificates activated successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ListCertificatesResponse" + x-oaiMeta: + name: Activate certificates for project + group: administration + returns: A list of [Certificate](/docs/api-reference/certificates/object) + objects that were activated. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects/proj_abc/certificates/activate \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "data": ["cert_abc", "cert_def"] + }' + response: | + { + "object": "organization.project.certificate.activation", + "data": [ + { + "object": "organization.project.certificate", + "id": "cert_abc", + "name": "My Example Certificate", + "active": true, + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 + } + }, + { + "object": "organization.project.certificate", + "id": "cert_def", + "name": "My Example Certificate 2", + "active": true, + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 + } + }, + ], + } + /organization/projects/{project_id}/certificates/deactivate: + post: + summary: > + Deactivate certificates at the project level. + + + You can atomically and idempotently deactivate up to 10 certificates at + a time. + operationId: deactivateProjectCertificates + tags: + - Certificates + requestBody: + description: The certificate deactivation payload. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/ToggleCertificatesRequest" + responses: + "200": + description: Certificates deactivated successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ListCertificatesResponse" + x-oaiMeta: + name: Deactivate certificates for project + group: administration + returns: A list of [Certificate](/docs/api-reference/certificates/object) + objects that were deactivated. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects/proj_abc/certificates/deactivate \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "data": ["cert_abc", "cert_def"] + }' + response: | + { + "object": "organization.project.certificate.deactivation", + "data": [ + { + "object": "organization.project.certificate", + "id": "cert_abc", + "name": "My Example Certificate", + "active": false, + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 + } + }, + { + "object": "organization.project.certificate", + "id": "cert_def", + "name": "My Example Certificate 2", + "active": false, + "created_at": 1234567, + "certificate_details": { + "valid_at": 12345667, + "expires_at": 12345678 + } + }, + ], + } + /organization/projects/{project_id}/rate_limits: + get: + summary: Returns the rate limits per model for a project. + operationId: list-project-rate-limits + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: limit + in: query + description: | + A limit on the number of objects to be returned. The default is 100. + required: false + schema: + type: integer + default: 100 + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. + required: false + schema: + type: string + - name: before + in: query + description: > + A cursor for use in pagination. `before` is an object ID that + defines your place in the list. For instance, if you make a list + request and receive 100 objects, beginning with obj_foo, your + subsequent call can include before=obj_foo in order to fetch the + previous page of the list. + required: false + schema: + type: string + responses: + "200": + description: Project rate limits listed successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectRateLimitListResponse" + x-oaiMeta: + name: List project rate limits + group: administration + returns: A list of + [ProjectRateLimit](/docs/api-reference/project-rate-limits/object) + objects. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects/proj_abc/rate_limits?after=rl_xxx&limit=20 \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "list", + "data": [ + { + "object": "project.rate_limit", + "id": "rl-ada", + "model": "ada", + "max_requests_per_1_minute": 600, + "max_tokens_per_1_minute": 150000, + "max_images_per_1_minute": 10 + } + ], + "first_id": "rl-ada", + "last_id": "rl-ada", + "has_more": false + } + error_response: | + { + "code": 404, + "message": "The project {project_id} was not found" + } + /organization/projects/{project_id}/rate_limits/{rate_limit_id}: + post: + summary: Updates a project rate limit. + operationId: update-project-rate-limits + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: rate_limit_id + in: path + description: The ID of the rate limit. + required: true + schema: + type: string + requestBody: + description: The project rate limit update request payload. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectRateLimitUpdateRequest" + responses: + "200": + description: Project rate limit updated successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectRateLimit" + "400": + description: Error response for various conditions. + content: + application/json: + schema: + $ref: "#/components/schemas/ErrorResponse" + x-oaiMeta: + name: Modify project rate limit + group: administration + returns: The updated + [ProjectRateLimit](/docs/api-reference/project-rate-limits/object) + object. + examples: + request: + curl: | + curl -X POST https://api.openai.com/v1/organization/projects/proj_abc/rate_limits/rl_xxx \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "max_requests_per_1_minute": 500 + }' + response: | + { + "object": "project.rate_limit", + "id": "rl-ada", + "model": "ada", + "max_requests_per_1_minute": 600, + "max_tokens_per_1_minute": 150000, + "max_images_per_1_minute": 10 + } + error_response: | + { + "code": 404, + "message": "The project {project_id} was not found" + } + /organization/projects/{project_id}/service_accounts: + get: + summary: Returns a list of service accounts in the project. + operationId: list-project-service-accounts + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: limit + in: query + description: > + A limit on the number of objects to be returned. Limit can range + between 1 and 100, and the default is 20. + required: false + schema: + type: integer + default: 20 + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. + required: false + schema: + type: string + responses: + "200": + description: Project service accounts listed successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectServiceAccountListResponse" + "400": + description: Error response when project is archived. + content: + application/json: + schema: + $ref: "#/components/schemas/ErrorResponse" + x-oaiMeta: + name: List project service accounts + group: administration + returns: A list of + [ProjectServiceAccount](/docs/api-reference/project-service-accounts/object) + objects. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects/proj_abc/service_accounts?after=custom_id&limit=20 \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "list", + "data": [ + { + "object": "organization.project.service_account", + "id": "svc_acct_abc", + "name": "Service Account", + "role": "owner", + "created_at": 1711471533 + } + ], + "first_id": "svc_acct_abc", + "last_id": "svc_acct_xyz", + "has_more": false + } + post: + summary: Creates a new service account in the project. This also returns an + unredacted API key for the service account. + operationId: create-project-service-account + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + requestBody: + description: The project service account create request payload. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectServiceAccountCreateRequest" + responses: + "200": + description: Project service account created successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectServiceAccountCreateResponse" + "400": + description: Error response when project is archived. + content: + application/json: + schema: + $ref: "#/components/schemas/ErrorResponse" + x-oaiMeta: + name: Create project service account + group: administration + returns: The created + [ProjectServiceAccount](/docs/api-reference/project-service-accounts/object) + object. + examples: + request: + curl: | + curl -X POST https://api.openai.com/v1/organization/projects/proj_abc/service_accounts \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "name": "Production App" + }' + response: | + { + "object": "organization.project.service_account", + "id": "svc_acct_abc", + "name": "Production App", + "role": "member", + "created_at": 1711471533, + "api_key": { + "object": "organization.project.service_account.api_key", + "value": "sk-abcdefghijklmnop123", + "name": "Secret Key", + "created_at": 1711471533, + "id": "key_abc" + } + } + /organization/projects/{project_id}/service_accounts/{service_account_id}: + get: + summary: Retrieves a service account in the project. + operationId: retrieve-project-service-account + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: service_account_id + in: path + description: The ID of the service account. + required: true + schema: + type: string + responses: + "200": + description: Project service account retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectServiceAccount" + x-oaiMeta: + name: Retrieve project service account + group: administration + returns: The + [ProjectServiceAccount](/docs/api-reference/project-service-accounts/object) + object matching the specified ID. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects/proj_abc/service_accounts/svc_acct_abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "organization.project.service_account", + "id": "svc_acct_abc", + "name": "Service Account", + "role": "owner", + "created_at": 1711471533 + } + delete: + summary: Deletes a service account from the project. + operationId: delete-project-service-account + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: service_account_id + in: path + description: The ID of the service account. + required: true + schema: + type: string + responses: + "200": + description: Project service account deleted successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectServiceAccountDeleteResponse" + x-oaiMeta: + name: Delete project service account + group: administration + returns: Confirmation of service account being deleted, or an error in case of + an archived project, which has no service accounts + examples: + request: + curl: | + curl -X DELETE https://api.openai.com/v1/organization/projects/proj_abc/service_accounts/svc_acct_abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "organization.project.service_account.deleted", + "id": "svc_acct_abc", + "deleted": true + } + /organization/projects/{project_id}/users: + get: + summary: Returns a list of users in the project. + operationId: list-project-users + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: limit + in: query + description: > + A limit on the number of objects to be returned. Limit can range + between 1 and 100, and the default is 20. + required: false + schema: + type: integer + default: 20 + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. + required: false + schema: + type: string + responses: + "200": + description: Project users listed successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectUserListResponse" + "400": + description: Error response when project is archived. + content: + application/json: + schema: + $ref: "#/components/schemas/ErrorResponse" + x-oaiMeta: + name: List project users + group: administration + returns: A list of [ProjectUser](/docs/api-reference/project-users/object) + objects. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects/proj_abc/users?after=user_abc&limit=20 \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "list", + "data": [ + { + "object": "organization.project.user", + "id": "user_abc", + "name": "First Last", + "email": "user@example.com", + "role": "owner", + "added_at": 1711471533 + } + ], + "first_id": "user-abc", + "last_id": "user-xyz", + "has_more": false + } + post: + summary: Adds a user to the project. Users must already be members of the + organization to be added to a project. + operationId: create-project-user + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + tags: + - Projects + requestBody: + description: The project user create request payload. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectUserCreateRequest" + responses: + "200": + description: User added to project successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectUser" + "400": + description: Error response for various conditions. + content: + application/json: + schema: + $ref: "#/components/schemas/ErrorResponse" + x-oaiMeta: + name: Create project user + group: administration + returns: The created [ProjectUser](/docs/api-reference/project-users/object) + object. + examples: + request: + curl: > + curl -X POST + https://api.openai.com/v1/organization/projects/proj_abc/users \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "user_id": "user_abc", + "role": "member" + }' + response: | + { + "object": "organization.project.user", + "id": "user_abc", + "email": "user@example.com", + "role": "owner", + "added_at": 1711471533 + } + /organization/projects/{project_id}/users/{user_id}: + get: + summary: Retrieves a user in the project. + operationId: retrieve-project-user + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: user_id + in: path + description: The ID of the user. + required: true + schema: + type: string + responses: + "200": + description: Project user retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectUser" + x-oaiMeta: + name: Retrieve project user + group: administration + returns: The [ProjectUser](/docs/api-reference/project-users/object) object + matching the specified ID. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/projects/proj_abc/users/user_abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "organization.project.user", + "id": "user_abc", + "name": "First Last", + "email": "user@example.com", + "role": "owner", + "added_at": 1711471533 + } + post: + summary: Modifies a user's role in the project. + operationId: modify-project-user + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: user_id + in: path + description: The ID of the user. + required: true + schema: + type: string + requestBody: + description: The project user update request payload. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectUserUpdateRequest" + responses: + "200": + description: Project user's role updated successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectUser" + "400": + description: Error response for various conditions. + content: + application/json: + schema: + $ref: "#/components/schemas/ErrorResponse" + x-oaiMeta: + name: Modify project user + group: administration + returns: The updated [ProjectUser](/docs/api-reference/project-users/object) + object. + examples: + request: + curl: | + curl -X POST https://api.openai.com/v1/organization/projects/proj_abc/users/user_abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "role": "owner" + }' + response: | + { + "object": "organization.project.user", + "id": "user_abc", + "name": "First Last", + "email": "user@example.com", + "role": "owner", + "added_at": 1711471533 + } + delete: + summary: Deletes a user from the project. + operationId: delete-project-user + tags: + - Projects + parameters: + - name: project_id + in: path + description: The ID of the project. + required: true + schema: + type: string + - name: user_id + in: path + description: The ID of the user. + required: true + schema: + type: string + responses: + "200": + description: Project user deleted successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/ProjectUserDeleteResponse" + "400": + description: Error response for various conditions. + content: + application/json: + schema: + $ref: "#/components/schemas/ErrorResponse" + x-oaiMeta: + name: Delete project user + group: administration + returns: Confirmation that project has been deleted or an error in case of an + archived project, which has no users + examples: + request: + curl: | + curl -X DELETE https://api.openai.com/v1/organization/projects/proj_abc/users/user_abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "organization.project.user.deleted", + "id": "user_abc", + "deleted": true + } + /organization/usage/audio_speeches: + get: + summary: Get audio speeches usage details for the organization. + operationId: usage-audio-speeches + tags: + - Usage + parameters: + - name: start_time + in: query + description: Start time (Unix seconds) of the query time range, inclusive. + required: true + schema: + type: integer + - name: end_time + in: query + description: End time (Unix seconds) of the query time range, exclusive. + required: false + schema: + type: integer + - name: bucket_width + in: query + description: Width of each time bucket in response. Currently `1m`, `1h` and + `1d` are supported, default to `1d`. + required: false + schema: + type: string + enum: + - 1m + - 1h + - 1d + default: 1d + - name: project_ids + in: query + description: Return only usage for these projects. + required: false + schema: + type: array + items: + type: string + - name: user_ids + in: query + description: Return only usage for these users. + required: false + schema: + type: array + items: + type: string + - name: api_key_ids + in: query + description: Return only usage for these API keys. + required: false + schema: + type: array + items: + type: string + - name: models + in: query + description: Return only usage for these models. + required: false + schema: + type: array + items: + type: string + - name: group_by + in: query + description: Group the usage data by the specified fields. Support fields + include `project_id`, `user_id`, `api_key_id`, `model` or any + combination of them. + required: false + schema: + type: array + items: + type: string + enum: + - project_id + - user_id + - api_key_id + - model + - name: limit + in: query + description: | + Specifies the number of buckets to return. + - `bucket_width=1d`: default: 7, max: 31 + - `bucket_width=1h`: default: 24, max: 168 + - `bucket_width=1m`: default: 60, max: 1440 + required: false + schema: + type: integer + - name: page + in: query + description: A cursor for use in pagination. Corresponding to the `next_page` + field from the previous response. + schema: + type: string + responses: + "200": + description: Usage data retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/UsageResponse" + x-oaiMeta: + name: Audio speeches + group: usage-audio-speeches + returns: A list of paginated, time bucketed [Audio speeches + usage](/docs/api-reference/usage/audio_speeches_object) objects. + examples: + request: + curl: | + curl "https://api.openai.com/v1/organization/usage/audio_speeches?start_time=1730419200&limit=1" \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: > + { + "object": "page", + "data": [ + { + "object": "bucket", + "start_time": 1730419200, + "end_time": 1730505600, + "results": [ + { + "object": "organization.usage.audio_speeches.result", + "characters": 45, + "num_model_requests": 1, + "project_id": null, + "user_id": null, + "api_key_id": null, + "model": null + } + ] + } + ], + "has_more": false, + "next_page": null + } + /organization/usage/audio_transcriptions: + get: + summary: Get audio transcriptions usage details for the organization. + operationId: usage-audio-transcriptions + tags: + - Usage + parameters: + - name: start_time + in: query + description: Start time (Unix seconds) of the query time range, inclusive. + required: true + schema: + type: integer + - name: end_time + in: query + description: End time (Unix seconds) of the query time range, exclusive. + required: false + schema: + type: integer + - name: bucket_width + in: query + description: Width of each time bucket in response. Currently `1m`, `1h` and + `1d` are supported, default to `1d`. + required: false + schema: + type: string + enum: + - 1m + - 1h + - 1d + default: 1d + - name: project_ids + in: query + description: Return only usage for these projects. + required: false + schema: + type: array + items: + type: string + - name: user_ids + in: query + description: Return only usage for these users. + required: false + schema: + type: array + items: + type: string + - name: api_key_ids + in: query + description: Return only usage for these API keys. + required: false + schema: + type: array + items: + type: string + - name: models + in: query + description: Return only usage for these models. + required: false + schema: + type: array + items: + type: string + - name: group_by + in: query + description: Group the usage data by the specified fields. Support fields + include `project_id`, `user_id`, `api_key_id`, `model` or any + combination of them. + required: false + schema: + type: array + items: + type: string + enum: + - project_id + - user_id + - api_key_id + - model + - name: limit + in: query + description: | + Specifies the number of buckets to return. + - `bucket_width=1d`: default: 7, max: 31 + - `bucket_width=1h`: default: 24, max: 168 + - `bucket_width=1m`: default: 60, max: 1440 + required: false + schema: + type: integer + - name: page + in: query + description: A cursor for use in pagination. Corresponding to the `next_page` + field from the previous response. + schema: + type: string + responses: + "200": + description: Usage data retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/UsageResponse" + x-oaiMeta: + name: Audio transcriptions + group: usage-audio-transcriptions + returns: A list of paginated, time bucketed [Audio transcriptions + usage](/docs/api-reference/usage/audio_transcriptions_object) objects. + examples: + request: + curl: | + curl "https://api.openai.com/v1/organization/usage/audio_transcriptions?start_time=1730419200&limit=1" \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: > + { + "object": "page", + "data": [ + { + "object": "bucket", + "start_time": 1730419200, + "end_time": 1730505600, + "results": [ + { + "object": "organization.usage.audio_transcriptions.result", + "seconds": 20, + "num_model_requests": 1, + "project_id": null, + "user_id": null, + "api_key_id": null, + "model": null + } + ] + } + ], + "has_more": false, + "next_page": null + } + /organization/usage/code_interpreter_sessions: + get: + summary: Get code interpreter sessions usage details for the organization. + operationId: usage-code-interpreter-sessions + tags: + - Usage + parameters: + - name: start_time + in: query + description: Start time (Unix seconds) of the query time range, inclusive. + required: true + schema: + type: integer + - name: end_time + in: query + description: End time (Unix seconds) of the query time range, exclusive. + required: false + schema: + type: integer + - name: bucket_width + in: query + description: Width of each time bucket in response. Currently `1m`, `1h` and + `1d` are supported, default to `1d`. + required: false + schema: + type: string + enum: + - 1m + - 1h + - 1d + default: 1d + - name: project_ids + in: query + description: Return only usage for these projects. + required: false + schema: + type: array + items: + type: string + - name: group_by + in: query + description: Group the usage data by the specified fields. Support fields + include `project_id`. + required: false + schema: + type: array + items: + type: string + enum: + - project_id + - name: limit + in: query + description: | + Specifies the number of buckets to return. + - `bucket_width=1d`: default: 7, max: 31 + - `bucket_width=1h`: default: 24, max: 168 + - `bucket_width=1m`: default: 60, max: 1440 + required: false + schema: + type: integer + - name: page + in: query + description: A cursor for use in pagination. Corresponding to the `next_page` + field from the previous response. + schema: + type: string + responses: + "200": + description: Usage data retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/UsageResponse" + x-oaiMeta: + name: Code interpreter sessions + group: usage-code-interpreter-sessions + returns: A list of paginated, time bucketed [Code interpreter sessions + usage](/docs/api-reference/usage/code_interpreter_sessions_object) + objects. + examples: + request: + curl: | + curl "https://api.openai.com/v1/organization/usage/code_interpreter_sessions?start_time=1730419200&limit=1" \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: > + { + "object": "page", + "data": [ + { + "object": "bucket", + "start_time": 1730419200, + "end_time": 1730505600, + "results": [ + { + "object": "organization.usage.code_interpreter_sessions.result", + "num_sessions": 1, + "project_id": null + } + ] + } + ], + "has_more": false, + "next_page": null + } + /organization/usage/completions: + get: + summary: Get completions usage details for the organization. + operationId: usage-completions + tags: + - Usage + parameters: + - name: start_time + in: query + description: Start time (Unix seconds) of the query time range, inclusive. + required: true + schema: + type: integer + - name: end_time + in: query + description: End time (Unix seconds) of the query time range, exclusive. + required: false + schema: + type: integer + - name: bucket_width + in: query + description: Width of each time bucket in response. Currently `1m`, `1h` and + `1d` are supported, default to `1d`. + required: false + schema: + type: string + enum: + - 1m + - 1h + - 1d + default: 1d + - name: project_ids + in: query + description: Return only usage for these projects. + required: false + schema: + type: array + items: + type: string + - name: user_ids + in: query + description: Return only usage for these users. + required: false + schema: + type: array + items: + type: string + - name: api_key_ids + in: query + description: Return only usage for these API keys. + required: false + schema: + type: array + items: + type: string + - name: models + in: query + description: Return only usage for these models. + required: false + schema: + type: array + items: + type: string + - name: batch + in: query + description: > + If `true`, return batch jobs only. If `false`, return non-batch jobs + only. By default, return both. + required: false + schema: + type: boolean + - name: group_by + in: query + description: Group the usage data by the specified fields. Support fields + include `project_id`, `user_id`, `api_key_id`, `model`, `batch` or + any combination of them. + required: false + schema: + type: array + items: + type: string + enum: + - project_id + - user_id + - api_key_id + - model + - batch + - name: limit + in: query + description: | + Specifies the number of buckets to return. + - `bucket_width=1d`: default: 7, max: 31 + - `bucket_width=1h`: default: 24, max: 168 + - `bucket_width=1m`: default: 60, max: 1440 + required: false + schema: + type: integer + - name: page + in: query + description: A cursor for use in pagination. Corresponding to the `next_page` + field from the previous response. + schema: + type: string + responses: + "200": + description: Usage data retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/UsageResponse" + x-oaiMeta: + name: Completions + group: usage-completions + returns: A list of paginated, time bucketed [Completions + usage](/docs/api-reference/usage/completions_object) objects. + examples: + request: + curl: | + curl "https://api.openai.com/v1/organization/usage/completions?start_time=1730419200&limit=1" \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: > + { + "object": "page", + "data": [ + { + "object": "bucket", + "start_time": 1730419200, + "end_time": 1730505600, + "results": [ + { + "object": "organization.usage.completions.result", + "input_tokens": 1000, + "output_tokens": 500, + "input_cached_tokens": 800, + "input_audio_tokens": 0, + "output_audio_tokens": 0, + "num_model_requests": 5, + "project_id": null, + "user_id": null, + "api_key_id": null, + "model": null, + "batch": null + } + ] + } + ], + "has_more": true, + "next_page": "page_AAAAAGdGxdEiJdKOAAAAAGcqsYA=" + } + /organization/usage/embeddings: + get: + summary: Get embeddings usage details for the organization. + operationId: usage-embeddings + tags: + - Usage + parameters: + - name: start_time + in: query + description: Start time (Unix seconds) of the query time range, inclusive. + required: true + schema: + type: integer + - name: end_time + in: query + description: End time (Unix seconds) of the query time range, exclusive. + required: false + schema: + type: integer + - name: bucket_width + in: query + description: Width of each time bucket in response. Currently `1m`, `1h` and + `1d` are supported, default to `1d`. + required: false + schema: + type: string + enum: + - 1m + - 1h + - 1d + default: 1d + - name: project_ids + in: query + description: Return only usage for these projects. + required: false + schema: + type: array + items: + type: string + - name: user_ids + in: query + description: Return only usage for these users. + required: false + schema: + type: array + items: + type: string + - name: api_key_ids + in: query + description: Return only usage for these API keys. + required: false + schema: + type: array + items: + type: string + - name: models + in: query + description: Return only usage for these models. + required: false + schema: + type: array + items: + type: string + - name: group_by + in: query + description: Group the usage data by the specified fields. Support fields + include `project_id`, `user_id`, `api_key_id`, `model` or any + combination of them. + required: false + schema: + type: array + items: + type: string + enum: + - project_id + - user_id + - api_key_id + - model + - name: limit + in: query + description: | + Specifies the number of buckets to return. + - `bucket_width=1d`: default: 7, max: 31 + - `bucket_width=1h`: default: 24, max: 168 + - `bucket_width=1m`: default: 60, max: 1440 + required: false + schema: + type: integer + - name: page + in: query + description: A cursor for use in pagination. Corresponding to the `next_page` + field from the previous response. + schema: + type: string + responses: + "200": + description: Usage data retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/UsageResponse" + x-oaiMeta: + name: Embeddings + group: usage-embeddings + returns: A list of paginated, time bucketed [Embeddings + usage](/docs/api-reference/usage/embeddings_object) objects. + examples: + request: + curl: | + curl "https://api.openai.com/v1/organization/usage/embeddings?start_time=1730419200&limit=1" \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: > + { + "object": "page", + "data": [ + { + "object": "bucket", + "start_time": 1730419200, + "end_time": 1730505600, + "results": [ + { + "object": "organization.usage.embeddings.result", + "input_tokens": 16, + "num_model_requests": 2, + "project_id": null, + "user_id": null, + "api_key_id": null, + "model": null + } + ] + } + ], + "has_more": false, + "next_page": null + } + /organization/usage/images: + get: + summary: Get images usage details for the organization. + operationId: usage-images + tags: + - Usage + parameters: + - name: start_time + in: query + description: Start time (Unix seconds) of the query time range, inclusive. + required: true + schema: + type: integer + - name: end_time + in: query + description: End time (Unix seconds) of the query time range, exclusive. + required: false + schema: + type: integer + - name: bucket_width + in: query + description: Width of each time bucket in response. Currently `1m`, `1h` and + `1d` are supported, default to `1d`. + required: false + schema: + type: string + enum: + - 1m + - 1h + - 1d + default: 1d + - name: sources + in: query + description: Return only usages for these sources. Possible values are + `image.generation`, `image.edit`, `image.variation` or any + combination of them. + required: false + schema: + type: array + items: + type: string + enum: + - image.generation + - image.edit + - image.variation + - name: sizes + in: query + description: Return only usages for these image sizes. Possible values are + `256x256`, `512x512`, `1024x1024`, `1792x1792`, `1024x1792` or any + combination of them. + required: false + schema: + type: array + items: + type: string + enum: + - 256x256 + - 512x512 + - 1024x1024 + - 1792x1792 + - 1024x1792 + - name: project_ids + in: query + description: Return only usage for these projects. + required: false + schema: + type: array + items: + type: string + - name: user_ids + in: query + description: Return only usage for these users. + required: false + schema: + type: array + items: + type: string + - name: api_key_ids + in: query + description: Return only usage for these API keys. + required: false + schema: + type: array + items: + type: string + - name: models + in: query + description: Return only usage for these models. + required: false + schema: + type: array + items: + type: string + - name: group_by + in: query + description: Group the usage data by the specified fields. Support fields + include `project_id`, `user_id`, `api_key_id`, `model`, `size`, + `source` or any combination of them. + required: false + schema: + type: array + items: + type: string + enum: + - project_id + - user_id + - api_key_id + - model + - size + - source + - name: limit + in: query + description: | + Specifies the number of buckets to return. + - `bucket_width=1d`: default: 7, max: 31 + - `bucket_width=1h`: default: 24, max: 168 + - `bucket_width=1m`: default: 60, max: 1440 + required: false + schema: + type: integer + - name: page + in: query + description: A cursor for use in pagination. Corresponding to the `next_page` + field from the previous response. + schema: + type: string + responses: + "200": + description: Usage data retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/UsageResponse" + x-oaiMeta: + name: Images + group: usage-images + returns: A list of paginated, time bucketed [Images + usage](/docs/api-reference/usage/images_object) objects. + examples: + request: + curl: | + curl "https://api.openai.com/v1/organization/usage/images?start_time=1730419200&limit=1" \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "page", + "data": [ + { + "object": "bucket", + "start_time": 1730419200, + "end_time": 1730505600, + "results": [ + { + "object": "organization.usage.images.result", + "images": 2, + "num_model_requests": 2, + "size": null, + "source": null, + "project_id": null, + "user_id": null, + "api_key_id": null, + "model": null + } + ] + } + ], + "has_more": false, + "next_page": null + } + /organization/usage/moderations: + get: + summary: Get moderations usage details for the organization. + operationId: usage-moderations + tags: + - Usage + parameters: + - name: start_time + in: query + description: Start time (Unix seconds) of the query time range, inclusive. + required: true + schema: + type: integer + - name: end_time + in: query + description: End time (Unix seconds) of the query time range, exclusive. + required: false + schema: + type: integer + - name: bucket_width + in: query + description: Width of each time bucket in response. Currently `1m`, `1h` and + `1d` are supported, default to `1d`. + required: false + schema: + type: string + enum: + - 1m + - 1h + - 1d + default: 1d + - name: project_ids + in: query + description: Return only usage for these projects. + required: false + schema: + type: array + items: + type: string + - name: user_ids + in: query + description: Return only usage for these users. + required: false + schema: + type: array + items: + type: string + - name: api_key_ids + in: query + description: Return only usage for these API keys. + required: false + schema: + type: array + items: + type: string + - name: models + in: query + description: Return only usage for these models. + required: false + schema: + type: array + items: + type: string + - name: group_by + in: query + description: Group the usage data by the specified fields. Support fields + include `project_id`, `user_id`, `api_key_id`, `model` or any + combination of them. + required: false + schema: + type: array + items: + type: string + enum: + - project_id + - user_id + - api_key_id + - model + - name: limit + in: query + description: | + Specifies the number of buckets to return. + - `bucket_width=1d`: default: 7, max: 31 + - `bucket_width=1h`: default: 24, max: 168 + - `bucket_width=1m`: default: 60, max: 1440 + required: false + schema: + type: integer + - name: page + in: query + description: A cursor for use in pagination. Corresponding to the `next_page` + field from the previous response. + schema: + type: string + responses: + "200": + description: Usage data retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/UsageResponse" + x-oaiMeta: + name: Moderations + group: usage-moderations + returns: A list of paginated, time bucketed [Moderations + usage](/docs/api-reference/usage/moderations_object) objects. + examples: + request: + curl: | + curl "https://api.openai.com/v1/organization/usage/moderations?start_time=1730419200&limit=1" \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: > + { + "object": "page", + "data": [ + { + "object": "bucket", + "start_time": 1730419200, + "end_time": 1730505600, + "results": [ + { + "object": "organization.usage.moderations.result", + "input_tokens": 16, + "num_model_requests": 2, + "project_id": null, + "user_id": null, + "api_key_id": null, + "model": null + } + ] + } + ], + "has_more": false, + "next_page": null + } + /organization/usage/vector_stores: + get: + summary: Get vector stores usage details for the organization. + operationId: usage-vector-stores + tags: + - Usage + parameters: + - name: start_time + in: query + description: Start time (Unix seconds) of the query time range, inclusive. + required: true + schema: + type: integer + - name: end_time + in: query + description: End time (Unix seconds) of the query time range, exclusive. + required: false + schema: + type: integer + - name: bucket_width + in: query + description: Width of each time bucket in response. Currently `1m`, `1h` and + `1d` are supported, default to `1d`. + required: false + schema: + type: string + enum: + - 1m + - 1h + - 1d + default: 1d + - name: project_ids + in: query + description: Return only usage for these projects. + required: false + schema: + type: array + items: + type: string + - name: group_by + in: query + description: Group the usage data by the specified fields. Support fields + include `project_id`. + required: false + schema: + type: array + items: + type: string + enum: + - project_id + - name: limit + in: query + description: | + Specifies the number of buckets to return. + - `bucket_width=1d`: default: 7, max: 31 + - `bucket_width=1h`: default: 24, max: 168 + - `bucket_width=1m`: default: 60, max: 1440 + required: false + schema: + type: integer + - name: page + in: query + description: A cursor for use in pagination. Corresponding to the `next_page` + field from the previous response. + schema: + type: string + responses: + "200": + description: Usage data retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/UsageResponse" + x-oaiMeta: + name: Vector stores + group: usage-vector-stores + returns: A list of paginated, time bucketed [Vector stores + usage](/docs/api-reference/usage/vector_stores_object) objects. + examples: + request: + curl: | + curl "https://api.openai.com/v1/organization/usage/vector_stores?start_time=1730419200&limit=1" \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: > + { + "object": "page", + "data": [ + { + "object": "bucket", + "start_time": 1730419200, + "end_time": 1730505600, + "results": [ + { + "object": "organization.usage.vector_stores.result", + "usage_bytes": 1024, + "project_id": null + } + ] + } + ], + "has_more": false, + "next_page": null + } + /organization/users: + get: + summary: Lists all of the users in the organization. + operationId: list-users + tags: + - Users + parameters: + - name: limit + in: query + description: > + A limit on the number of objects to be returned. Limit can range + between 1 and 100, and the default is 20. + required: false + schema: + type: integer + default: 20 + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. + required: false + schema: + type: string + - name: emails + in: query + description: Filter by the email address of users. + required: false + schema: + type: array + items: + type: string + responses: + "200": + description: Users listed successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/UserListResponse" + x-oaiMeta: + name: List users + group: administration + returns: A list of [User](/docs/api-reference/users/object) objects. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/users?after=user_abc&limit=20 \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "list", + "data": [ + { + "object": "organization.user", + "id": "user_abc", + "name": "First Last", + "email": "user@example.com", + "role": "owner", + "added_at": 1711471533 + } + ], + "first_id": "user-abc", + "last_id": "user-xyz", + "has_more": false + } + /organization/users/{user_id}: + get: + summary: Retrieves a user by their identifier. + operationId: retrieve-user + tags: + - Users + parameters: + - name: user_id + in: path + description: The ID of the user. + required: true + schema: + type: string + responses: + "200": + description: User retrieved successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/User" + x-oaiMeta: + name: Retrieve user + group: administration + returns: The [User](/docs/api-reference/users/object) object matching the + specified ID. + examples: + request: + curl: | + curl https://api.openai.com/v1/organization/users/user_abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "organization.user", + "id": "user_abc", + "name": "First Last", + "email": "user@example.com", + "role": "owner", + "added_at": 1711471533 + } + post: + summary: Modifies a user's role in the organization. + operationId: modify-user + tags: + - Users + parameters: + - name: user_id + in: path + description: The ID of the user. + required: true + schema: + type: string + requestBody: + description: The new user role to modify. This must be one of `owner` or `member`. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/UserRoleUpdateRequest" + responses: + "200": + description: User role updated successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/User" + x-oaiMeta: + name: Modify user + group: administration + returns: The updated [User](/docs/api-reference/users/object) object. + examples: + request: + curl: > + curl -X POST https://api.openai.com/v1/organization/users/user_abc + \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "role": "owner" + }' + response: | + { + "object": "organization.user", + "id": "user_abc", + "name": "First Last", + "email": "user@example.com", + "role": "owner", + "added_at": 1711471533 + } + delete: + summary: Deletes a user from the organization. + operationId: delete-user + tags: + - Users + parameters: + - name: user_id + in: path + description: The ID of the user. + required: true + schema: + type: string + responses: + "200": + description: User deleted successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/UserDeleteResponse" + x-oaiMeta: + name: Delete user + group: administration + returns: Confirmation of the deleted user + examples: + request: + curl: > + curl -X DELETE + https://api.openai.com/v1/organization/users/user_abc \ + -H "Authorization: Bearer $OPENAI_ADMIN_KEY" \ + -H "Content-Type: application/json" + response: | + { + "object": "organization.user.deleted", + "id": "user_abc", + "deleted": true + } + /realtime/sessions: + post: + summary: > + Create an ephemeral API token for use in client-side applications with + the + + Realtime API. Can be configured with the same session parameters as the + + `session.update` client event. + + + It responds with a session object, plus a `client_secret` key which + contains + + a usable ephemeral API token that can be used to authenticate browser + clients + + for the Realtime API. + operationId: create-realtime-session + tags: + - Realtime + requestBody: + description: Create an ephemeral API key with the given session configuration. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/RealtimeSessionCreateRequest" + responses: + "200": + description: Session created successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/RealtimeSessionCreateResponse" + x-oaiMeta: + name: Create session + group: realtime + returns: The created Realtime session object, plus an ephemeral key + examples: + request: + curl: | + curl -X POST https://api.openai.com/v1/realtime/sessions \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -d '{ + "model": "gpt-4o-realtime-preview", + "modalities": ["audio", "text"], + "instructions": "You are a friendly assistant." + }' + response: | + { + "id": "sess_001", + "object": "realtime.session", + "model": "gpt-4o-realtime-preview", + "modalities": ["audio", "text"], + "instructions": "You are a friendly assistant.", + "voice": "alloy", + "input_audio_format": "pcm16", + "output_audio_format": "pcm16", + "input_audio_transcription": { + "model": "whisper-1" + }, + "turn_detection": null, + "tools": [], + "tool_choice": "none", + "temperature": 0.7, + "max_response_output_tokens": 200, + "client_secret": { + "value": "ek_abc123", + "expires_at": 1234567890 + } + } + /realtime/transcription_sessions: + post: + summary: > + Create an ephemeral API token for use in client-side applications with + the + + Realtime API specifically for realtime transcriptions. + + Can be configured with the same session parameters as the + `transcription_session.update` client event. + + + It responds with a session object, plus a `client_secret` key which + contains + + a usable ephemeral API token that can be used to authenticate browser + clients + + for the Realtime API. + operationId: create-realtime-transcription-session + tags: + - Realtime + requestBody: + description: Create an ephemeral API key with the given session configuration. + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/RealtimeTranscriptionSessionCreateRequest" + responses: + "200": + description: Session created successfully. + content: + application/json: + schema: + $ref: "#/components/schemas/RealtimeTranscriptionSessionCreateResponse" + x-oaiMeta: + name: Create transcription session + group: realtime + returns: The created [Realtime transcription session + object](/docs/api-reference/realtime-sessions/transcription_session_object), + plus an ephemeral key + examples: + request: + curl: > + curl -X POST + https://api.openai.com/v1/realtime/transcription_sessions \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -d '{}' + response: | + { + "id": "sess_BBwZc7cFV3XizEyKGDCGL", + "object": "realtime.transcription_session", + "modalities": ["audio", "text"], + "turn_detection": { + "type": "server_vad", + "threshold": 0.5, + "prefix_padding_ms": 300, + "silence_duration_ms": 200 + }, + "input_audio_format": "pcm16", + "input_audio_transcription": { + "model": "gpt-4o-transcribe", + "language": null, + "prompt": "" + }, + "client_secret": null + } + /responses: + post: + operationId: createResponse + tags: + - Responses + summary: > + Creates a model response. Provide [text](/docs/guides/text) or + + [image](/docs/guides/images) inputs to generate + [text](/docs/guides/text) + + or [JSON](/docs/guides/structured-outputs) outputs. Have the model call + + your own [custom code](/docs/guides/function-calling) or use built-in + + [tools](/docs/guides/tools) like [web + search](/docs/guides/tools-web-search) + + or [file search](/docs/guides/tools-file-search) to use your own data + + as input for the model's response. + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/CreateResponse" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/Response" + text/event-stream: + schema: + $ref: "#/components/schemas/ResponseStreamEvent" + x-oaiMeta: + name: Create a model response + group: responses + returns: | + Returns a [Response](/docs/api-reference/responses/object) object. + path: create + examples: + - title: Text input + request: + curl: > + curl https://api.openai.com/v1/responses \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "model": "gpt-4.1", + "input": "Tell me a three sentence bedtime story about a unicorn." + }' + javascript: > + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + const response = await openai.responses.create({ + model: "gpt-4.1", + input: "Tell me a three sentence bedtime story about a unicorn." + }); + + + console.log(response); + python: > + from openai import OpenAI + + + client = OpenAI() + + + response = client.responses.create( + model="gpt-4.1", + input="Tell me a three sentence bedtime story about a unicorn." + ) + + + print(response) + csharp: > + using System; + + using OpenAI.Responses; + + + OpenAIResponseClient client = new( + model: "gpt-4.1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + OpenAIResponse response = client.CreateResponse("Tell me a three + sentence bedtime story about a unicorn."); + + + Console.WriteLine(response.GetOutputText()); + response: > + { + "id": "resp_67ccd2bed1ec8190b14f964abc0542670bb6a6b452d3795b", + "object": "response", + "created_at": 1741476542, + "status": "completed", + "error": null, + "incomplete_details": null, + "instructions": null, + "max_output_tokens": null, + "model": "gpt-4.1-2025-04-14", + "output": [ + { + "type": "message", + "id": "msg_67ccd2bf17f0819081ff3bb2cf6508e60bb6a6b452d3795b", + "status": "completed", + "role": "assistant", + "content": [ + { + "type": "output_text", + "text": "In a peaceful grove beneath a silver moon, a unicorn named Lumina discovered a hidden pool that reflected the stars. As she dipped her horn into the water, the pool began to shimmer, revealing a pathway to a magical realm of endless night skies. Filled with wonder, Lumina whispered a wish for all who dream to find their own hidden magic, and as she glanced back, her hoofprints sparkled like stardust.", + "annotations": [] + } + ] + } + ], + "parallel_tool_calls": true, + "previous_response_id": null, + "reasoning": { + "effort": null, + "summary": null + }, + "store": true, + "temperature": 1.0, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [], + "top_p": 1.0, + "truncation": "disabled", + "usage": { + "input_tokens": 36, + "input_tokens_details": { + "cached_tokens": 0 + }, + "output_tokens": 87, + "output_tokens_details": { + "reasoning_tokens": 0 + }, + "total_tokens": 123 + }, + "user": null, + "metadata": {} + } + - title: Image input + request: + curl: > + curl https://api.openai.com/v1/responses \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "model": "gpt-4.1", + "input": [ + { + "role": "user", + "content": [ + {"type": "input_text", "text": "what is in this image?"}, + { + "type": "input_image", + "image_url": "https://upload.wikimedia.org/wikipedia/commons/thumb/d/dd/Gfp-wisconsin-madison-the-nature-boardwalk.jpg/2560px-Gfp-wisconsin-madison-the-nature-boardwalk.jpg" + } + ] + } + ] + }' + javascript: > + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + const response = await openai.responses.create({ + model: "gpt-4.1", + input: [ + { + role: "user", + content: [ + { type: "input_text", text: "what is in this image?" }, + { + type: "input_image", + image_url: + "https://upload.wikimedia.org/wikipedia/commons/thumb/d/dd/Gfp-wisconsin-madison-the-nature-boardwalk.jpg/2560px-Gfp-wisconsin-madison-the-nature-boardwalk.jpg", + }, + ], + }, + ], + }); + + + console.log(response); + python: > + from openai import OpenAI + + + client = OpenAI() + + + response = client.responses.create( + model="gpt-4.1", + input=[ + { + "role": "user", + "content": [ + { "type": "input_text", "text": "what is in this image?" }, + { + "type": "input_image", + "image_url": "https://upload.wikimedia.org/wikipedia/commons/thumb/d/dd/Gfp-wisconsin-madison-the-nature-boardwalk.jpg/2560px-Gfp-wisconsin-madison-the-nature-boardwalk.jpg" + } + ] + } + ] + ) + + + print(response) + csharp: > + using System; + + using System.Collections.Generic; + + + using OpenAI.Responses; + + + OpenAIResponseClient client = new( + model: "gpt-4.1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + List inputItems = + + [ + ResponseItem.CreateUserMessageItem( + [ + ResponseContentPart.CreateInputTextPart("What is in this image?"), + ResponseContentPart.CreateInputImagePart(new Uri("https://upload.wikimedia.org/wikipedia/commons/thumb/d/dd/Gfp-wisconsin-madison-the-nature-boardwalk.jpg/2560px-Gfp-wisconsin-madison-the-nature-boardwalk.jpg")) + ] + ) + ]; + + + OpenAIResponse response = client.CreateResponse(inputItems); + + + Console.WriteLine(response.GetOutputText()); + response: > + { + "id": "resp_67ccd3a9da748190baa7f1570fe91ac604becb25c45c1d41", + "object": "response", + "created_at": 1741476777, + "status": "completed", + "error": null, + "incomplete_details": null, + "instructions": null, + "max_output_tokens": null, + "model": "gpt-4.1-2025-04-14", + "output": [ + { + "type": "message", + "id": "msg_67ccd3acc8d48190a77525dc6de64b4104becb25c45c1d41", + "status": "completed", + "role": "assistant", + "content": [ + { + "type": "output_text", + "text": "The image depicts a scenic landscape with a wooden boardwalk or pathway leading through lush, green grass under a blue sky with some clouds. The setting suggests a peaceful natural area, possibly a park or nature reserve. There are trees and shrubs in the background.", + "annotations": [] + } + ] + } + ], + "parallel_tool_calls": true, + "previous_response_id": null, + "reasoning": { + "effort": null, + "summary": null + }, + "store": true, + "temperature": 1.0, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [], + "top_p": 1.0, + "truncation": "disabled", + "usage": { + "input_tokens": 328, + "input_tokens_details": { + "cached_tokens": 0 + }, + "output_tokens": 52, + "output_tokens_details": { + "reasoning_tokens": 0 + }, + "total_tokens": 380 + }, + "user": null, + "metadata": {} + } + - title: Web search + request: + curl: | + curl https://api.openai.com/v1/responses \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "model": "gpt-4.1", + "tools": [{ "type": "web_search_preview" }], + "input": "What was a positive news story from today?" + }' + javascript: | + import OpenAI from "openai"; + + const openai = new OpenAI(); + + const response = await openai.responses.create({ + model: "gpt-4.1", + tools: [{ type: "web_search_preview" }], + input: "What was a positive news story from today?", + }); + + console.log(response); + python: | + from openai import OpenAI + + client = OpenAI() + + response = client.responses.create( + model="gpt-4.1", + tools=[{ "type": "web_search_preview" }], + input="What was a positive news story from today?", + ) + + print(response) + csharp: > + using System; + + + using OpenAI.Responses; + + + OpenAIResponseClient client = new( + model: "gpt-4.1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + string userInputText = "What was a positive news story from + today?"; + + + ResponseCreationOptions options = new() + + { + Tools = + { + ResponseTool.CreateWebSearchTool() + }, + }; + + + OpenAIResponse response = client.CreateResponse(userInputText, + options); + + + Console.WriteLine(response.GetOutputText()); + response: > + { + "id": "resp_67ccf18ef5fc8190b16dbee19bc54e5f087bb177ab789d5c", + "object": "response", + "created_at": 1741484430, + "status": "completed", + "error": null, + "incomplete_details": null, + "instructions": null, + "max_output_tokens": null, + "model": "gpt-4.1-2025-04-14", + "output": [ + { + "type": "web_search_call", + "id": "ws_67ccf18f64008190a39b619f4c8455ef087bb177ab789d5c", + "status": "completed" + }, + { + "type": "message", + "id": "msg_67ccf190ca3881909d433c50b1f6357e087bb177ab789d5c", + "status": "completed", + "role": "assistant", + "content": [ + { + "type": "output_text", + "text": "As of today, March 9, 2025, one notable positive news story...", + "annotations": [ + { + "type": "url_citation", + "start_index": 442, + "end_index": 557, + "url": "https://.../?utm_source=chatgpt.com", + "title": "..." + }, + { + "type": "url_citation", + "start_index": 962, + "end_index": 1077, + "url": "https://.../?utm_source=chatgpt.com", + "title": "..." + }, + { + "type": "url_citation", + "start_index": 1336, + "end_index": 1451, + "url": "https://.../?utm_source=chatgpt.com", + "title": "..." + } + ] + } + ] + } + ], + "parallel_tool_calls": true, + "previous_response_id": null, + "reasoning": { + "effort": null, + "summary": null + }, + "store": true, + "temperature": 1.0, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [ + { + "type": "web_search_preview", + "domains": [], + "search_context_size": "medium", + "user_location": { + "type": "approximate", + "city": null, + "country": "US", + "region": null, + "timezone": null + } + } + ], + "top_p": 1.0, + "truncation": "disabled", + "usage": { + "input_tokens": 328, + "input_tokens_details": { + "cached_tokens": 0 + }, + "output_tokens": 356, + "output_tokens_details": { + "reasoning_tokens": 0 + }, + "total_tokens": 684 + }, + "user": null, + "metadata": {} + } + - title: File search + request: + curl: > + curl https://api.openai.com/v1/responses \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "model": "gpt-4.1", + "tools": [{ + "type": "file_search", + "vector_store_ids": ["vs_1234567890"], + "max_num_results": 20 + }], + "input": "What are the attributes of an ancient brown dragon?" + }' + javascript: > + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + const response = await openai.responses.create({ + model: "gpt-4.1", + tools: [{ + type: "file_search", + vector_store_ids: ["vs_1234567890"], + max_num_results: 20 + }], + input: "What are the attributes of an ancient brown dragon?", + }); + + + console.log(response); + python: | + from openai import OpenAI + + client = OpenAI() + + response = client.responses.create( + model="gpt-4.1", + tools=[{ + "type": "file_search", + "vector_store_ids": ["vs_1234567890"], + "max_num_results": 20 + }], + input="What are the attributes of an ancient brown dragon?", + ) + + print(response) + csharp: > + using System; + + + using OpenAI.Responses; + + + OpenAIResponseClient client = new( + model: "gpt-4.1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + string userInputText = "What are the attributes of an ancient + brown dragon?"; + + + ResponseCreationOptions options = new() + + { + Tools = + { + ResponseTool.CreateFileSearchTool( + vectorStoreIds: ["vs_1234567890"], + maxResultCount: 20 + ) + }, + }; + + + OpenAIResponse response = client.CreateResponse(userInputText, + options); + + + Console.WriteLine(response.GetOutputText()); + response: > + { + "id": "resp_67ccf4c55fc48190b71bd0463ad3306d09504fb6872380d7", + "object": "response", + "created_at": 1741485253, + "status": "completed", + "error": null, + "incomplete_details": null, + "instructions": null, + "max_output_tokens": null, + "model": "gpt-4.1-2025-04-14", + "output": [ + { + "type": "file_search_call", + "id": "fs_67ccf4c63cd08190887ef6464ba5681609504fb6872380d7", + "status": "completed", + "queries": [ + "attributes of an ancient brown dragon" + ], + "results": null + }, + { + "type": "message", + "id": "msg_67ccf4c93e5c81909d595b369351a9d309504fb6872380d7", + "status": "completed", + "role": "assistant", + "content": [ + { + "type": "output_text", + "text": "The attributes of an ancient brown dragon include...", + "annotations": [ + { + "type": "file_citation", + "index": 320, + "file_id": "file-4wDz5b167pAf72nx1h9eiN", + "filename": "dragons.pdf" + }, + { + "type": "file_citation", + "index": 576, + "file_id": "file-4wDz5b167pAf72nx1h9eiN", + "filename": "dragons.pdf" + }, + { + "type": "file_citation", + "index": 815, + "file_id": "file-4wDz5b167pAf72nx1h9eiN", + "filename": "dragons.pdf" + }, + { + "type": "file_citation", + "index": 815, + "file_id": "file-4wDz5b167pAf72nx1h9eiN", + "filename": "dragons.pdf" + }, + { + "type": "file_citation", + "index": 1030, + "file_id": "file-4wDz5b167pAf72nx1h9eiN", + "filename": "dragons.pdf" + }, + { + "type": "file_citation", + "index": 1030, + "file_id": "file-4wDz5b167pAf72nx1h9eiN", + "filename": "dragons.pdf" + }, + { + "type": "file_citation", + "index": 1156, + "file_id": "file-4wDz5b167pAf72nx1h9eiN", + "filename": "dragons.pdf" + }, + { + "type": "file_citation", + "index": 1225, + "file_id": "file-4wDz5b167pAf72nx1h9eiN", + "filename": "dragons.pdf" + } + ] + } + ] + } + ], + "parallel_tool_calls": true, + "previous_response_id": null, + "reasoning": { + "effort": null, + "summary": null + }, + "store": true, + "temperature": 1.0, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [ + { + "type": "file_search", + "filters": null, + "max_num_results": 20, + "ranking_options": { + "ranker": "auto", + "score_threshold": 0.0 + }, + "vector_store_ids": [ + "vs_1234567890" + ] + } + ], + "top_p": 1.0, + "truncation": "disabled", + "usage": { + "input_tokens": 18307, + "input_tokens_details": { + "cached_tokens": 0 + }, + "output_tokens": 348, + "output_tokens_details": { + "reasoning_tokens": 0 + }, + "total_tokens": 18655 + }, + "user": null, + "metadata": {} + } + - title: Streaming + request: + curl: | + curl https://api.openai.com/v1/responses \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "model": "gpt-4.1", + "instructions": "You are a helpful assistant.", + "input": "Hello!", + "stream": true + }' + python: | + from openai import OpenAI + + client = OpenAI() + + response = client.responses.create( + model="gpt-4.1", + instructions="You are a helpful assistant.", + input="Hello!", + stream=True + ) + + for event in response: + print(event) + javascript: | + import OpenAI from "openai"; + + const openai = new OpenAI(); + + const response = await openai.responses.create({ + model: "gpt-4.1", + instructions: "You are a helpful assistant.", + input: "Hello!", + stream: true, + }); + + for await (const event of response) { + console.log(event); + } + csharp: > + using System; + + using System.ClientModel; + + using System.Threading.Tasks; + + + using OpenAI.Responses; + + + OpenAIResponseClient client = new( + model: "gpt-4.1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + string userInputText = "Hello!"; + + + ResponseCreationOptions options = new() + + { + Instructions = "You are a helpful assistant.", + }; + + + AsyncCollectionResult responseUpdates = + client.CreateResponseStreamingAsync(userInputText, options); + + + await foreach (StreamingResponseUpdate responseUpdate in + responseUpdates) + + { + if (responseUpdate is StreamingResponseOutputTextDeltaUpdate outputTextDeltaUpdate) + { + Console.Write(outputTextDeltaUpdate.Delta); + } + } + response: | + event: response.created + data: {"type":"response.created","response":{"id":"resp_67c9fdcecf488190bdd9a0409de3a1ec07b8b0ad4e5eb654","object":"response","created_at":1741290958,"status":"in_progress","error":null,"incomplete_details":null,"instructions":"You are a helpful assistant.","max_output_tokens":null,"model":"gpt-4.1-2025-04-14","output":[],"parallel_tool_calls":true,"previous_response_id":null,"reasoning":{"effort":null,"summary":null},"store":true,"temperature":1.0,"text":{"format":{"type":"text"}},"tool_choice":"auto","tools":[],"top_p":1.0,"truncation":"disabled","usage":null,"user":null,"metadata":{}}} + + event: response.in_progress + data: {"type":"response.in_progress","response":{"id":"resp_67c9fdcecf488190bdd9a0409de3a1ec07b8b0ad4e5eb654","object":"response","created_at":1741290958,"status":"in_progress","error":null,"incomplete_details":null,"instructions":"You are a helpful assistant.","max_output_tokens":null,"model":"gpt-4.1-2025-04-14","output":[],"parallel_tool_calls":true,"previous_response_id":null,"reasoning":{"effort":null,"summary":null},"store":true,"temperature":1.0,"text":{"format":{"type":"text"}},"tool_choice":"auto","tools":[],"top_p":1.0,"truncation":"disabled","usage":null,"user":null,"metadata":{}}} + + event: response.output_item.added + data: {"type":"response.output_item.added","output_index":0,"item":{"id":"msg_67c9fdcf37fc8190ba82116e33fb28c507b8b0ad4e5eb654","type":"message","status":"in_progress","role":"assistant","content":[]}} + + event: response.content_part.added + data: {"type":"response.content_part.added","item_id":"msg_67c9fdcf37fc8190ba82116e33fb28c507b8b0ad4e5eb654","output_index":0,"content_index":0,"part":{"type":"output_text","text":"","annotations":[]}} + + event: response.output_text.delta + data: {"type":"response.output_text.delta","item_id":"msg_67c9fdcf37fc8190ba82116e33fb28c507b8b0ad4e5eb654","output_index":0,"content_index":0,"delta":"Hi"} + + ... + + event: response.output_text.done + data: {"type":"response.output_text.done","item_id":"msg_67c9fdcf37fc8190ba82116e33fb28c507b8b0ad4e5eb654","output_index":0,"content_index":0,"text":"Hi there! How can I assist you today?"} + + event: response.content_part.done + data: {"type":"response.content_part.done","item_id":"msg_67c9fdcf37fc8190ba82116e33fb28c507b8b0ad4e5eb654","output_index":0,"content_index":0,"part":{"type":"output_text","text":"Hi there! How can I assist you today?","annotations":[]}} + + event: response.output_item.done + data: {"type":"response.output_item.done","output_index":0,"item":{"id":"msg_67c9fdcf37fc8190ba82116e33fb28c507b8b0ad4e5eb654","type":"message","status":"completed","role":"assistant","content":[{"type":"output_text","text":"Hi there! How can I assist you today?","annotations":[]}]}} + + event: response.completed + data: {"type":"response.completed","response":{"id":"resp_67c9fdcecf488190bdd9a0409de3a1ec07b8b0ad4e5eb654","object":"response","created_at":1741290958,"status":"completed","error":null,"incomplete_details":null,"instructions":"You are a helpful assistant.","max_output_tokens":null,"model":"gpt-4.1-2025-04-14","output":[{"id":"msg_67c9fdcf37fc8190ba82116e33fb28c507b8b0ad4e5eb654","type":"message","status":"completed","role":"assistant","content":[{"type":"output_text","text":"Hi there! How can I assist you today?","annotations":[]}]}],"parallel_tool_calls":true,"previous_response_id":null,"reasoning":{"effort":null,"summary":null},"store":true,"temperature":1.0,"text":{"format":{"type":"text"}},"tool_choice":"auto","tools":[],"top_p":1.0,"truncation":"disabled","usage":{"input_tokens":37,"output_tokens":11,"output_tokens_details":{"reasoning_tokens":0},"total_tokens":48},"user":null,"metadata":{}}} + - title: Functions + request: + curl: > + curl https://api.openai.com/v1/responses \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "model": "gpt-4.1", + "input": "What is the weather like in Boston today?", + "tools": [ + { + "type": "function", + "name": "get_current_weather", + "description": "Get the current weather in a given location", + "parameters": { + "type": "object", + "properties": { + "location": { + "type": "string", + "description": "The city and state, e.g. San Francisco, CA" + }, + "unit": { + "type": "string", + "enum": ["celsius", "fahrenheit"] + } + }, + "required": ["location", "unit"] + } + } + ], + "tool_choice": "auto" + }' + python: > + from openai import OpenAI + + + client = OpenAI() + + + tools = [ + { + "type": "function", + "name": "get_current_weather", + "description": "Get the current weather in a given location", + "parameters": { + "type": "object", + "properties": { + "location": { + "type": "string", + "description": "The city and state, e.g. San Francisco, CA", + }, + "unit": {"type": "string", "enum": ["celsius", "fahrenheit"]}, + }, + "required": ["location", "unit"], + } + } + ] + + + response = client.responses.create( + model="gpt-4.1", + tools=tools, + input="What is the weather like in Boston today?", + tool_choice="auto" + ) + + + print(response) + javascript: > + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + const tools = [ + { + type: "function", + name: "get_current_weather", + description: "Get the current weather in a given location", + parameters: { + type: "object", + properties: { + location: { + type: "string", + description: "The city and state, e.g. San Francisco, CA", + }, + unit: { type: "string", enum: ["celsius", "fahrenheit"] }, + }, + required: ["location", "unit"], + }, + }, + ]; + + + const response = await openai.responses.create({ + model: "gpt-4.1", + tools: tools, + input: "What is the weather like in Boston today?", + tool_choice: "auto", + }); + + + console.log(response); + csharp: > + using System; + + using OpenAI.Responses; + + + OpenAIResponseClient client = new( + model: "gpt-4.1", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + ResponseTool getCurrentWeatherFunctionTool = + ResponseTool.CreateFunctionTool( + functionName: "get_current_weather", + functionDescription: "Get the current weather in a given location", + functionParameters: BinaryData.FromString(""" + { + "type": "object", + "properties": { + "location": { + "type": "string", + "description": "The city and state, e.g. San Francisco, CA" + }, + "unit": {"type": "string", "enum": ["celsius", "fahrenheit"]} + }, + "required": ["location", "unit"] + } + """ + ) + ); + + + string userInputText = "What is the weather like in Boston + today?"; + + + ResponseCreationOptions options = new() + + { + Tools = + { + getCurrentWeatherFunctionTool + }, + ToolChoice = ResponseToolChoice.CreateAutoChoice(), + }; + + + OpenAIResponse response = client.CreateResponse(userInputText, + options); + response: > + { + "id": "resp_67ca09c5efe0819096d0511c92b8c890096610f474011cc0", + "object": "response", + "created_at": 1741294021, + "status": "completed", + "error": null, + "incomplete_details": null, + "instructions": null, + "max_output_tokens": null, + "model": "gpt-4.1-2025-04-14", + "output": [ + { + "type": "function_call", + "id": "fc_67ca09c6bedc8190a7abfec07b1a1332096610f474011cc0", + "call_id": "call_unLAR8MvFNptuiZK6K6HCy5k", + "name": "get_current_weather", + "arguments": "{\"location\":\"Boston, MA\",\"unit\":\"celsius\"}", + "status": "completed" + } + ], + "parallel_tool_calls": true, + "previous_response_id": null, + "reasoning": { + "effort": null, + "summary": null + }, + "store": true, + "temperature": 1.0, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [ + { + "type": "function", + "description": "Get the current weather in a given location", + "name": "get_current_weather", + "parameters": { + "type": "object", + "properties": { + "location": { + "type": "string", + "description": "The city and state, e.g. San Francisco, CA" + }, + "unit": { + "type": "string", + "enum": [ + "celsius", + "fahrenheit" + ] + } + }, + "required": [ + "location", + "unit" + ] + }, + "strict": true + } + ], + "top_p": 1.0, + "truncation": "disabled", + "usage": { + "input_tokens": 291, + "output_tokens": 23, + "output_tokens_details": { + "reasoning_tokens": 0 + }, + "total_tokens": 314 + }, + "user": null, + "metadata": {} + } + - title: Reasoning + request: + curl: | + curl https://api.openai.com/v1/responses \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "model": "o3-mini", + "input": "How much wood would a woodchuck chuck?", + "reasoning": { + "effort": "high" + } + }' + javascript: | + import OpenAI from "openai"; + const openai = new OpenAI(); + + const response = await openai.responses.create({ + model: "o3-mini", + input: "How much wood would a woodchuck chuck?", + reasoning: { + effort: "high" + } + }); + + console.log(response); + python: | + from openai import OpenAI + client = OpenAI() + + response = client.responses.create( + model="o3-mini", + input="How much wood would a woodchuck chuck?", + reasoning={ + "effort": "high" + } + ) + + print(response) + csharp: > + using System; + + using OpenAI.Responses; + + + OpenAIResponseClient client = new( + model: "o3-mini", + apiKey: Environment.GetEnvironmentVariable("OPENAI_API_KEY") + ); + + + string userInputText = "How much wood would a woodchuck chuck?"; + + + ResponseCreationOptions options = new() + + { + ReasoningOptions = new() + { + ReasoningEffortLevel = ResponseReasoningEffortLevel.High, + }, + }; + + + OpenAIResponse response = client.CreateResponse(userInputText, + options); + + + Console.WriteLine(response.GetOutputText()); + response: > + { + "id": "resp_67ccd7eca01881908ff0b5146584e408072912b2993db808", + "object": "response", + "created_at": 1741477868, + "status": "completed", + "error": null, + "incomplete_details": null, + "instructions": null, + "max_output_tokens": null, + "model": "o1-2024-12-17", + "output": [ + { + "type": "message", + "id": "msg_67ccd7f7b5848190a6f3e95d809f6b44072912b2993db808", + "status": "completed", + "role": "assistant", + "content": [ + { + "type": "output_text", + "text": "The classic tongue twister...", + "annotations": [] + } + ] + } + ], + "parallel_tool_calls": true, + "previous_response_id": null, + "reasoning": { + "effort": "high", + "summary": null + }, + "store": true, + "temperature": 1.0, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [], + "top_p": 1.0, + "truncation": "disabled", + "usage": { + "input_tokens": 81, + "input_tokens_details": { + "cached_tokens": 0 + }, + "output_tokens": 1035, + "output_tokens_details": { + "reasoning_tokens": 832 + }, + "total_tokens": 1116 + }, + "user": null, + "metadata": {} + } + /responses/{response_id}: + get: + operationId: getResponse + tags: + - Responses + summary: | + Retrieves a model response with the given ID. + parameters: + - in: path + name: response_id + required: true + schema: + type: string + example: resp_677efb5139a88190b512bc3fef8e535d + description: The ID of the response to retrieve. + - in: query + name: include + schema: + type: array + items: + $ref: "#/components/schemas/Includable" + description: | + Additional fields to include in the response. See the `include` + parameter for Response creation above for more information. + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/Response" + x-oaiMeta: + name: Get a model response + group: responses + returns: > + The [Response](/docs/api-reference/responses/object) object matching + the + + specified ID. + examples: + request: + curl: | + curl https://api.openai.com/v1/responses/resp_123 \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" + javascript: | + import OpenAI from "openai"; + const client = new OpenAI(); + + const response = await client.responses.retrieve("resp_123"); + console.log(response); + python: | + from openai import OpenAI + client = OpenAI() + + response = client.responses.retrieve("resp_123") + print(response) + response: > + { + "id": "resp_67cb71b351908190a308f3859487620d06981a8637e6bc44", + "object": "response", + "created_at": 1741386163, + "status": "completed", + "error": null, + "incomplete_details": null, + "instructions": null, + "max_output_tokens": null, + "model": "gpt-4o-2024-08-06", + "output": [ + { + "type": "message", + "id": "msg_67cb71b3c2b0819084d481baaaf148f206981a8637e6bc44", + "status": "completed", + "role": "assistant", + "content": [ + { + "type": "output_text", + "text": "Silent circuits hum, \nThoughts emerge in data streams— \nDigital dawn breaks.", + "annotations": [] + } + ] + } + ], + "parallel_tool_calls": true, + "previous_response_id": null, + "reasoning": { + "effort": null, + "summary": null + }, + "store": true, + "temperature": 1.0, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [], + "top_p": 1.0, + "truncation": "disabled", + "usage": { + "input_tokens": 32, + "input_tokens_details": { + "cached_tokens": 0 + }, + "output_tokens": 18, + "output_tokens_details": { + "reasoning_tokens": 0 + }, + "total_tokens": 50 + }, + "user": null, + "metadata": {} + } + delete: + operationId: deleteResponse + tags: + - Responses + summary: | + Deletes a model response with the given ID. + parameters: + - in: path + name: response_id + required: true + schema: + type: string + example: resp_677efb5139a88190b512bc3fef8e535d + description: The ID of the response to delete. + responses: + "200": + description: OK + "404": + description: Not Found + content: + application/json: + schema: + $ref: "#/components/schemas/Error" + x-oaiMeta: + name: Delete a model response + group: responses + returns: | + A success message. + examples: + request: + curl: | + curl -X DELETE https://api.openai.com/v1/responses/resp_123 \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" + javascript: | + import OpenAI from "openai"; + const client = new OpenAI(); + + const response = await client.responses.del("resp_123"); + console.log(response); + python: | + from openai import OpenAI + client = OpenAI() + + response = client.responses.del("resp_123") + print(response) + response: | + { + "id": "resp_6786a1bec27481909a17d673315b29f6", + "object": "response", + "deleted": true + } + /responses/{response_id}/input_items: + get: + operationId: listInputItems + tags: + - Responses + summary: Returns a list of input items for a given response. + parameters: + - in: path + name: response_id + required: true + schema: + type: string + description: The ID of the response to retrieve input items for. + - name: limit + in: query + description: > + A limit on the number of objects to be returned. Limit can range + between + + 1 and 100, and the default is 20. + required: false + schema: + type: integer + default: 20 + - in: query + name: order + schema: + type: string + enum: + - asc + - desc + description: | + The order to return the input items in. Default is `asc`. + - `asc`: Return the input items in ascending order. + - `desc`: Return the input items in descending order. + - in: query + name: after + schema: + type: string + description: | + An item ID to list items after, used in pagination. + - in: query + name: before + schema: + type: string + description: | + An item ID to list items before, used in pagination. + - in: query + name: include + schema: + type: array + items: + $ref: "#/components/schemas/Includable" + description: | + Additional fields to include in the response. See the `include` + parameter for Response creation above for more information. + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/ResponseItemList" + x-oaiMeta: + name: List input items + group: responses + returns: A list of input item objects. + examples: + request: + curl: | + curl https://api.openai.com/v1/responses/resp_abc123/input_items \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" + javascript: > + import OpenAI from "openai"; + + const client = new OpenAI(); + + + const response = await + client.responses.inputItems.list("resp_123"); + + console.log(response.data); + python: | + from openai import OpenAI + client = OpenAI() + + response = client.responses.input_items.list("resp_123") + print(response.data) + response: > + { + "object": "list", + "data": [ + { + "id": "msg_abc123", + "type": "message", + "role": "user", + "content": [ + { + "type": "input_text", + "text": "Tell me a three sentence bedtime story about a unicorn." + } + ] + } + ], + "first_id": "msg_abc123", + "last_id": "msg_abc123", + "has_more": false + } + /threads: + post: + operationId: createThread + tags: + - Assistants + summary: Create a thread. + requestBody: + content: + application/json: + schema: + $ref: "#/components/schemas/CreateThreadRequest" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/ThreadObject" + x-oaiMeta: + name: Create thread + group: threads + beta: true + returns: A [thread](/docs/api-reference/threads) object. + examples: + - title: Empty + request: + curl: | + curl https://api.openai.com/v1/threads \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "OpenAI-Beta: assistants=v2" \ + -d '' + python: | + from openai import OpenAI + client = OpenAI() + + empty_thread = client.beta.threads.create() + print(empty_thread) + node.js: |- + import OpenAI from "openai"; + + const openai = new OpenAI(); + + async function main() { + const emptyThread = await openai.beta.threads.create(); + + console.log(emptyThread); + } + + main(); + response: | + { + "id": "thread_abc123", + "object": "thread", + "created_at": 1699012949, + "metadata": {}, + "tool_resources": {} + } + - title: Messages + request: + curl: | + curl https://api.openai.com/v1/threads \ + -H "Content-Type: application/json" \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "OpenAI-Beta: assistants=v2" \ + -d '{ + "messages": [{ + "role": "user", + "content": "Hello, what is AI?" + }, { + "role": "user", + "content": "How does AI work? Explain it in simple terms." + }] + }' + python: | + from openai import OpenAI + client = OpenAI() + + message_thread = client.beta.threads.create( + messages=[ + { + "role": "user", + "content": "Hello, what is AI?" + }, + { + "role": "user", + "content": "How does AI work? Explain it in simple terms." + }, + ] + ) + + print(message_thread) + node.js: >- + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + async function main() { + const messageThread = await openai.beta.threads.create({ + messages: [ + { + role: "user", + content: "Hello, what is AI?" + }, + { + role: "user", + content: "How does AI work? Explain it in simple terms.", + }, + ], + }); + + console.log(messageThread); + } + + + main(); + response: | + { + "id": "thread_abc123", + "object": "thread", + "created_at": 1699014083, + "metadata": {}, + "tool_resources": {} + } + /threads/runs: + post: + operationId: createThreadAndRun + tags: + - Assistants + summary: Create a thread and run it in one request. + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/CreateThreadAndRunRequest" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/RunObject" + x-oaiMeta: + name: Create thread and run + group: threads + beta: true + returns: A [run](/docs/api-reference/runs/object) object. + examples: + - title: Default + request: + curl: > + curl https://api.openai.com/v1/threads/runs \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -H "OpenAI-Beta: assistants=v2" \ + -d '{ + "assistant_id": "asst_abc123", + "thread": { + "messages": [ + {"role": "user", "content": "Explain deep learning to a 5 year old."} + ] + } + }' + python: > + from openai import OpenAI + + client = OpenAI() + + + run = client.beta.threads.create_and_run( + assistant_id="asst_abc123", + thread={ + "messages": [ + {"role": "user", "content": "Explain deep learning to a 5 year old."} + ] + } + ) + + + print(run) + node.js: > + import OpenAI from "openai"; + + + const openai = new OpenAI(); + + + async function main() { + const run = await openai.beta.threads.createAndRun({ + assistant_id: "asst_abc123", + thread: { + messages: [ + { role: "user", content: "Explain deep learning to a 5 year old." }, + ], + }, + }); + + console.log(run); + } + + + main(); + response: | + { "id": "run_abc123", "object": "thread.run", "created_at": 1699076792, @@ -5849,99 +12766,52 @@ paths: } main(); - response: > + response: | event: thread.created - - data: - {"id":"thread_123","object":"thread","created_at":1710348075,"metadata":{}} - + data: {"id":"thread_123","object":"thread","created_at":1710348075,"metadata":{}} event: thread.run.created - - data: - {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"tool_resources":{},"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true} - + data: {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"tool_resources":{},"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true} event: thread.run.queued + data: {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"tool_resources":{},"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true} - data: - {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"tool_resources":{},"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true} - - - event: thread.run.in_progress - - data: - {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"in_progress","started_at":null,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"tool_resources":{},"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true} - - - event: thread.run.step.created - - data: - {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} + event: thread.run.in_progress + data: {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"in_progress","started_at":null,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"tool_resources":{},"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true} + event: thread.run.step.created + data: {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} event: thread.run.step.in_progress - - data: - {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} - + data: {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} event: thread.message.created - - data: - {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[], - "metadata":{}} - + data: {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[], "metadata":{}} event: thread.message.in_progress - - data: - {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[], - "metadata":{}} - + data: {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[], "metadata":{}} event: thread.message.delta - - data: - {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"Hello","annotations":[]}}]}} - + data: {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"Hello","annotations":[]}}]}} ... - event: thread.message.delta - - data: - {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" - today"}}]}} - + data: {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" today"}}]}} event: thread.message.delta - - data: - {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"?"}}]}} - + data: {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"?"}}]}} event: thread.message.completed - - data: - {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"completed","incomplete_details":null,"incomplete_at":null,"completed_at":1710348077,"role":"assistant","content":[{"type":"text","text":{"value":"Hello! - How can I assist you today?","annotations":[]}}], "metadata":{}} - + data: {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"completed","incomplete_details":null,"incomplete_at":null,"completed_at":1710348077,"role":"assistant","content":[{"type":"text","text":{"value":"Hello! How can I assist you today?","annotations":[]}}], "metadata":{}} event: thread.run.step.completed - - data: - {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"completed","cancelled_at":null,"completed_at":1710348077,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31}} - + data: {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"completed","cancelled_at":null,"completed_at":1710348077,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31}} event: thread.run.completed - {"id":"run_123","object":"thread.run","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","status":"completed","started_at":1713226836,"expires_at":null,"cancelled_at":null,"failed_at":null,"completed_at":1713226837,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":{"prompt_tokens":345,"completion_tokens":11,"total_tokens":356},"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true} - event: done - data: [DONE] - title: Streaming with Functions request: @@ -6072,102 +12942,46 @@ paths: main(); - response: > + response: | event: thread.created - - data: - {"id":"thread_123","object":"thread","created_at":1710351818,"metadata":{}} - + data: {"id":"thread_123","object":"thread","created_at":1710351818,"metadata":{}} event: thread.run.created - - data: - {"id":"run_123","object":"thread.run","created_at":1710351818,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710352418,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get - the current weather in a given - location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The - city and state, e.g. San Francisco, - CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710351818,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710352418,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get the current weather in a given location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The city and state, e.g. San Francisco, CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: thread.run.queued - - data: - {"id":"run_123","object":"thread.run","created_at":1710351818,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710352418,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get - the current weather in a given - location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The - city and state, e.g. San Francisco, - CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710351818,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710352418,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get the current weather in a given location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The city and state, e.g. San Francisco, CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: thread.run.in_progress - - data: - {"id":"run_123","object":"thread.run","created_at":1710351818,"assistant_id":"asst_123","thread_id":"thread_123","status":"in_progress","started_at":1710351818,"expires_at":1710352418,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get - the current weather in a given - location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The - city and state, e.g. San Francisco, - CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710351818,"assistant_id":"asst_123","thread_id":"thread_123","status":"in_progress","started_at":1710351818,"expires_at":1710352418,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get the current weather in a given location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The city and state, e.g. San Francisco, CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: thread.run.step.created - - data: - {"id":"step_001","object":"thread.run.step","created_at":1710351819,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"tool_calls","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710352418,"failed_at":null,"last_error":null,"step_details":{"type":"tool_calls","tool_calls":[]},"usage":null} - + data: {"id":"step_001","object":"thread.run.step","created_at":1710351819,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"tool_calls","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710352418,"failed_at":null,"last_error":null,"step_details":{"type":"tool_calls","tool_calls":[]},"usage":null} event: thread.run.step.in_progress - - data: - {"id":"step_001","object":"thread.run.step","created_at":1710351819,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"tool_calls","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710352418,"failed_at":null,"last_error":null,"step_details":{"type":"tool_calls","tool_calls":[]},"usage":null} - + data: {"id":"step_001","object":"thread.run.step","created_at":1710351819,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"tool_calls","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710352418,"failed_at":null,"last_error":null,"step_details":{"type":"tool_calls","tool_calls":[]},"usage":null} event: thread.run.step.delta - - data: - {"id":"step_001","object":"thread.run.step.delta","delta":{"step_details":{"type":"tool_calls","tool_calls":[{"index":0,"id":"call_XXNp8YGaFrjrSjgqxtC8JJ1B","type":"function","function":{"name":"get_current_weather","arguments":"","output":null}}]}}} - + data: {"id":"step_001","object":"thread.run.step.delta","delta":{"step_details":{"type":"tool_calls","tool_calls":[{"index":0,"id":"call_XXNp8YGaFrjrSjgqxtC8JJ1B","type":"function","function":{"name":"get_current_weather","arguments":"","output":null}}]}}} event: thread.run.step.delta - - data: - {"id":"step_001","object":"thread.run.step.delta","delta":{"step_details":{"type":"tool_calls","tool_calls":[{"index":0,"type":"function","function":{"arguments":"{\""}}]}}} - + data: {"id":"step_001","object":"thread.run.step.delta","delta":{"step_details":{"type":"tool_calls","tool_calls":[{"index":0,"type":"function","function":{"arguments":"{\""}}]}}} event: thread.run.step.delta - - data: - {"id":"step_001","object":"thread.run.step.delta","delta":{"step_details":{"type":"tool_calls","tool_calls":[{"index":0,"type":"function","function":{"arguments":"location"}}]}}} - + data: {"id":"step_001","object":"thread.run.step.delta","delta":{"step_details":{"type":"tool_calls","tool_calls":[{"index":0,"type":"function","function":{"arguments":"location"}}]}}} ... - event: thread.run.step.delta - - data: - {"id":"step_001","object":"thread.run.step.delta","delta":{"step_details":{"type":"tool_calls","tool_calls":[{"index":0,"type":"function","function":{"arguments":"ahrenheit"}}]}}} - + data: {"id":"step_001","object":"thread.run.step.delta","delta":{"step_details":{"type":"tool_calls","tool_calls":[{"index":0,"type":"function","function":{"arguments":"ahrenheit"}}]}}} event: thread.run.step.delta - - data: - {"id":"step_001","object":"thread.run.step.delta","delta":{"step_details":{"type":"tool_calls","tool_calls":[{"index":0,"type":"function","function":{"arguments":"\"}"}}]}}} - + data: {"id":"step_001","object":"thread.run.step.delta","delta":{"step_details":{"type":"tool_calls","tool_calls":[{"index":0,"type":"function","function":{"arguments":"\"}"}}]}}} event: thread.run.requires_action - - data: - {"id":"run_123","object":"thread.run","created_at":1710351818,"assistant_id":"asst_123","thread_id":"thread_123","status":"requires_action","started_at":1710351818,"expires_at":1710352418,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":{"type":"submit_tool_outputs","submit_tool_outputs":{"tool_calls":[{"id":"call_XXNp8YGaFrjrSjgqxtC8JJ1B","type":"function","function":{"name":"get_current_weather","arguments":"{\"location\":\"San - Francisco, - CA\",\"unit\":\"fahrenheit\"}"}}]}},"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get - the current weather in a given - location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The - city and state, e.g. San Francisco, - CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":{"prompt_tokens":345,"completion_tokens":11,"total_tokens":356},"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710351818,"assistant_id":"asst_123","thread_id":"thread_123","status":"requires_action","started_at":1710351818,"expires_at":1710352418,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":{"type":"submit_tool_outputs","submit_tool_outputs":{"tool_calls":[{"id":"call_XXNp8YGaFrjrSjgqxtC8JJ1B","type":"function","function":{"name":"get_current_weather","arguments":"{\"location\":\"San Francisco, CA\",\"unit\":\"fahrenheit\"}"}}]}},"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get the current weather in a given location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The city and state, e.g. San Francisco, CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":{"prompt_tokens":345,"completion_tokens":11,"total_tokens":356},"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: done - data: [DONE] /threads/{thread_id}: get: @@ -6650,10 +13464,8 @@ paths: specified ID. examples: request: - curl: > - curl - https://api.openai.com/v1/threads/thread_abc123/messages/msg_abc123 - \ + curl: | + curl https://api.openai.com/v1/threads/thread_abc123/messages/msg_abc123 \ -H "Content-Type: application/json" \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "OpenAI-Beta: assistants=v2" @@ -6740,10 +13552,8 @@ paths: returns: The modified [message](/docs/api-reference/messages/object) object. examples: request: - curl: > - curl - https://api.openai.com/v1/threads/thread_abc123/messages/msg_abc123 - \ + curl: | + curl https://api.openai.com/v1/threads/thread_abc123/messages/msg_abc123 \ -H "Content-Type: application/json" \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "OpenAI-Beta: assistants=v2" \ @@ -6838,10 +13648,8 @@ paths: returns: Deletion status examples: request: - curl: > - curl -X DELETE - https://api.openai.com/v1/threads/thread_abc123/messages/msg_abc123 - \ + curl: | + curl -X DELETE https://api.openai.com/v1/threads/thread_abc123/messages/msg_abc123 \ -H "Content-Type: application/json" \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "OpenAI-Beta: assistants=v2" @@ -7084,16 +13892,10 @@ paths: description: The ID of the thread to run. - name: include[] in: query - description: > - A list of additional fields to include in the response. Currently - the only supported value is - `step_details.tool_calls[*].file_search.results[*].content` to fetch - the file search result content. - + description: | + A list of additional fields to include in the response. Currently the only supported value is `step_details.tool_calls[*].file_search.results[*].content` to fetch the file search result content. - See the [file search tool - documentation](/docs/assistants/tools/file-search#customizing-file-search-settings) - for more information. + See the [file search tool documentation](/docs/assistants/tools/file-search#customizing-file-search-settings) for more information. schema: type: array items: @@ -7230,92 +14032,49 @@ paths: } main(); - response: > + response: | event: thread.run.created - - data: - {"id":"run_123","object":"thread.run","created_at":1710330640,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710331240,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710330640,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710331240,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: thread.run.queued - - data: - {"id":"run_123","object":"thread.run","created_at":1710330640,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710331240,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710330640,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710331240,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: thread.run.in_progress - - data: - {"id":"run_123","object":"thread.run","created_at":1710330640,"assistant_id":"asst_123","thread_id":"thread_123","status":"in_progress","started_at":1710330641,"expires_at":1710331240,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710330640,"assistant_id":"asst_123","thread_id":"thread_123","status":"in_progress","started_at":1710330641,"expires_at":1710331240,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: thread.run.step.created - - data: - {"id":"step_001","object":"thread.run.step","created_at":1710330641,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710331240,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} - + data: {"id":"step_001","object":"thread.run.step","created_at":1710330641,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710331240,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} event: thread.run.step.in_progress - - data: - {"id":"step_001","object":"thread.run.step","created_at":1710330641,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710331240,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} - + data: {"id":"step_001","object":"thread.run.step","created_at":1710330641,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710331240,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} event: thread.message.created - - data: - {"id":"msg_001","object":"thread.message","created_at":1710330641,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} - + data: {"id":"msg_001","object":"thread.message","created_at":1710330641,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} event: thread.message.in_progress - - data: - {"id":"msg_001","object":"thread.message","created_at":1710330641,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} - + data: {"id":"msg_001","object":"thread.message","created_at":1710330641,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} event: thread.message.delta - - data: - {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"Hello","annotations":[]}}]}} - + data: {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"Hello","annotations":[]}}]}} ... - event: thread.message.delta - - data: - {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" - today"}}]}} - + data: {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" today"}}]}} event: thread.message.delta - - data: - {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"?"}}]}} - + data: {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"?"}}]}} event: thread.message.completed - - data: - {"id":"msg_001","object":"thread.message","created_at":1710330641,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"completed","incomplete_details":null,"incomplete_at":null,"completed_at":1710330642,"role":"assistant","content":[{"type":"text","text":{"value":"Hello! - How can I assist you today?","annotations":[]}}],"metadata":{}} - + data: {"id":"msg_001","object":"thread.message","created_at":1710330641,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"completed","incomplete_details":null,"incomplete_at":null,"completed_at":1710330642,"role":"assistant","content":[{"type":"text","text":{"value":"Hello! How can I assist you today?","annotations":[]}}],"metadata":{}} event: thread.run.step.completed - - data: - {"id":"step_001","object":"thread.run.step","created_at":1710330641,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"completed","cancelled_at":null,"completed_at":1710330642,"expires_at":1710331240,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31}} - + data: {"id":"step_001","object":"thread.run.step","created_at":1710330641,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"completed","cancelled_at":null,"completed_at":1710330642,"expires_at":1710331240,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31}} event: thread.run.completed - - data: - {"id":"run_123","object":"thread.run","created_at":1710330640,"assistant_id":"asst_123","thread_id":"thread_123","status":"completed","started_at":1710330641,"expires_at":null,"cancelled_at":null,"failed_at":null,"completed_at":1710330642,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31},"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710330640,"assistant_id":"asst_123","thread_id":"thread_123","status":"completed","started_at":1710330641,"expires_at":null,"cancelled_at":null,"failed_at":null,"completed_at":1710330642,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31},"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: done - data: [DONE] - title: Streaming with Functions request: @@ -7435,92 +14194,49 @@ paths: main(); - response: > + response: | event: thread.run.created - - data: - {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: thread.run.queued - - data: - {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":null,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: thread.run.in_progress - - data: - {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"in_progress","started_at":1710348075,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"in_progress","started_at":1710348075,"expires_at":1710348675,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: thread.run.step.created - - data: - {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} - + data: {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} event: thread.run.step.in_progress - - data: - {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} - + data: {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":null} event: thread.message.created - - data: - {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} - + data: {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} event: thread.message.in_progress - - data: - {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} - + data: {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} event: thread.message.delta - - data: - {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"Hello","annotations":[]}}]}} - + data: {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"Hello","annotations":[]}}]}} ... - event: thread.message.delta - - data: - {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" - today"}}]}} - + data: {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" today"}}]}} event: thread.message.delta - - data: - {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"?"}}]}} - + data: {"id":"msg_001","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"?"}}]}} event: thread.message.completed - - data: - {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"completed","incomplete_details":null,"incomplete_at":null,"completed_at":1710348077,"role":"assistant","content":[{"type":"text","text":{"value":"Hello! - How can I assist you today?","annotations":[]}}],"metadata":{}} - + data: {"id":"msg_001","object":"thread.message","created_at":1710348076,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"completed","incomplete_details":null,"incomplete_at":null,"completed_at":1710348077,"role":"assistant","content":[{"type":"text","text":{"value":"Hello! How can I assist you today?","annotations":[]}}],"metadata":{}} event: thread.run.step.completed - - data: - {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"completed","cancelled_at":null,"completed_at":1710348077,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31}} - + data: {"id":"step_001","object":"thread.run.step","created_at":1710348076,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"completed","cancelled_at":null,"completed_at":1710348077,"expires_at":1710348675,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_001"}},"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31}} event: thread.run.completed - - data: - {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"completed","started_at":1710348075,"expires_at":null,"cancelled_at":null,"failed_at":null,"completed_at":1710348077,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31},"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - + data: {"id":"run_123","object":"thread.run","created_at":1710348075,"assistant_id":"asst_123","thread_id":"thread_123","status":"completed","started_at":1710348075,"expires_at":null,"cancelled_at":null,"failed_at":null,"completed_at":1710348077,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31},"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} event: done - data: [DONE] /threads/{thread_id}/runs/{run_id}: get: @@ -7791,10 +14507,8 @@ paths: specified ID. examples: request: - curl: > - curl - https://api.openai.com/v1/threads/thread_abc123/runs/run_abc123/cancel - \ + curl: | + curl https://api.openai.com/v1/threads/thread_abc123/runs/run_abc123/cancel \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "OpenAI-Beta: assistants=v2" \ -X POST @@ -7917,16 +14631,10 @@ paths: type: string - name: include[] in: query - description: > - A list of additional fields to include in the response. Currently - the only supported value is - `step_details.tool_calls[*].file_search.results[*].content` to fetch - the file search result content. - + description: | + A list of additional fields to include in the response. Currently the only supported value is `step_details.tool_calls[*].file_search.results[*].content` to fetch the file search result content. - See the [file search tool - documentation](/docs/assistants/tools/file-search#customizing-file-search-settings) - for more information. + See the [file search tool documentation](/docs/assistants/tools/file-search#customizing-file-search-settings) for more information. schema: type: array items: @@ -7948,10 +14656,8 @@ paths: objects. examples: request: - curl: > - curl - https://api.openai.com/v1/threads/thread_abc123/runs/run_abc123/steps - \ + curl: | + curl https://api.openai.com/v1/threads/thread_abc123/runs/run_abc123/steps \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "Content-Type: application/json" \ -H "OpenAI-Beta: assistants=v2" @@ -8040,16 +14746,10 @@ paths: description: The ID of the run step to retrieve. - name: include[] in: query - description: > - A list of additional fields to include in the response. Currently - the only supported value is - `step_details.tool_calls[*].file_search.results[*].content` to fetch - the file search result content. - + description: | + A list of additional fields to include in the response. Currently the only supported value is `step_details.tool_calls[*].file_search.results[*].content` to fetch the file search result content. - See the [file search tool - documentation](/docs/assistants/tools/file-search#customizing-file-search-settings) - for more information. + See the [file search tool documentation](/docs/assistants/tools/file-search#customizing-file-search-settings) for more information. schema: type: array items: @@ -8071,10 +14771,8 @@ paths: matching the specified ID. examples: request: - curl: > - curl - https://api.openai.com/v1/threads/thread_abc123/runs/run_abc123/steps/step_abc123 - \ + curl: | + curl https://api.openai.com/v1/threads/thread_abc123/runs/run_abc123/steps/step_abc123 \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "Content-Type: application/json" \ -H "OpenAI-Beta: assistants=v2" @@ -8176,10 +14874,8 @@ paths: examples: - title: Default request: - curl: > - curl - https://api.openai.com/v1/threads/thread_123/runs/run_123/submit_tool_outputs - \ + curl: | + curl https://api.openai.com/v1/threads/thread_123/runs/run_123/submit_tool_outputs \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "Content-Type: application/json" \ -H "OpenAI-Beta: assistants=v2" \ @@ -8285,10 +14981,8 @@ paths: } - title: Streaming request: - curl: > - curl - https://api.openai.com/v1/threads/thread_123/runs/run_123/submit_tool_outputs - \ + curl: | + curl https://api.openai.com/v1/threads/thread_123/runs/run_123/submit_tool_outputs \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "Content-Type: application/json" \ -H "OpenAI-Beta: assistants=v2" \ @@ -8347,371 +15041,1097 @@ paths: main(); - response: > + response: | event: thread.run.step.completed + data: {"id":"step_001","object":"thread.run.step","created_at":1710352449,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"tool_calls","status":"completed","cancelled_at":null,"completed_at":1710352475,"expires_at":1710353047,"failed_at":null,"last_error":null,"step_details":{"type":"tool_calls","tool_calls":[{"id":"call_iWr0kQ2EaYMaxNdl0v3KYkx7","type":"function","function":{"name":"get_current_weather","arguments":"{\"location\":\"San Francisco, CA\",\"unit\":\"fahrenheit\"}","output":"70 degrees and sunny."}}]},"usage":{"prompt_tokens":291,"completion_tokens":24,"total_tokens":315}} - data: - {"id":"step_001","object":"thread.run.step","created_at":1710352449,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"tool_calls","status":"completed","cancelled_at":null,"completed_at":1710352475,"expires_at":1710353047,"failed_at":null,"last_error":null,"step_details":{"type":"tool_calls","tool_calls":[{"id":"call_iWr0kQ2EaYMaxNdl0v3KYkx7","type":"function","function":{"name":"get_current_weather","arguments":"{\"location\":\"San - Francisco, CA\",\"unit\":\"fahrenheit\"}","output":"70 degrees and - sunny."}}]},"usage":{"prompt_tokens":291,"completion_tokens":24,"total_tokens":315}} + event: thread.run.queued + data: {"id":"run_123","object":"thread.run","created_at":1710352447,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":1710352448,"expires_at":1710353047,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get the current weather in a given location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The city and state, e.g. San Francisco, CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} + event: thread.run.in_progress + data: {"id":"run_123","object":"thread.run","created_at":1710352447,"assistant_id":"asst_123","thread_id":"thread_123","status":"in_progress","started_at":1710352475,"expires_at":1710353047,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get the current weather in a given location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The city and state, e.g. San Francisco, CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} - event: thread.run.queued + event: thread.run.step.created + data: {"id":"step_002","object":"thread.run.step","created_at":1710352476,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710353047,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_002"}},"usage":null} - data: - {"id":"run_123","object":"thread.run","created_at":1710352447,"assistant_id":"asst_123","thread_id":"thread_123","status":"queued","started_at":1710352448,"expires_at":1710353047,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get - the current weather in a given - location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The - city and state, e.g. San Francisco, - CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} + event: thread.run.step.in_progress + data: {"id":"step_002","object":"thread.run.step","created_at":1710352476,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710353047,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_002"}},"usage":null} + event: thread.message.created + data: {"id":"msg_002","object":"thread.message","created_at":1710352476,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} - event: thread.run.in_progress + event: thread.message.in_progress + data: {"id":"msg_002","object":"thread.message","created_at":1710352476,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} - data: - {"id":"run_123","object":"thread.run","created_at":1710352447,"assistant_id":"asst_123","thread_id":"thread_123","status":"in_progress","started_at":1710352475,"expires_at":1710353047,"cancelled_at":null,"failed_at":null,"completed_at":null,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get - the current weather in a given - location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The - city and state, e.g. San Francisco, - CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":null,"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} + event: thread.message.delta + data: {"id":"msg_002","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"The","annotations":[]}}]}} + event: thread.message.delta + data: {"id":"msg_002","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" current"}}]}} - event: thread.run.step.created + event: thread.message.delta + data: {"id":"msg_002","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" weather"}}]}} - data: - {"id":"step_002","object":"thread.run.step","created_at":1710352476,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710353047,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_002"}},"usage":null} + ... + event: thread.message.delta + data: {"id":"msg_002","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" sunny"}}]}} - event: thread.run.step.in_progress + event: thread.message.delta + data: {"id":"msg_002","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"."}}]}} - data: - {"id":"step_002","object":"thread.run.step","created_at":1710352476,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"in_progress","cancelled_at":null,"completed_at":null,"expires_at":1710353047,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_002"}},"usage":null} + event: thread.message.completed + data: {"id":"msg_002","object":"thread.message","created_at":1710352476,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"completed","incomplete_details":null,"incomplete_at":null,"completed_at":1710352477,"role":"assistant","content":[{"type":"text","text":{"value":"The current weather in San Francisco, CA is 70 degrees Fahrenheit and sunny.","annotations":[]}}],"metadata":{}} + event: thread.run.step.completed + data: {"id":"step_002","object":"thread.run.step","created_at":1710352476,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"completed","cancelled_at":null,"completed_at":1710352477,"expires_at":1710353047,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_002"}},"usage":{"prompt_tokens":329,"completion_tokens":18,"total_tokens":347}} - event: thread.message.created + event: thread.run.completed + data: {"id":"run_123","object":"thread.run","created_at":1710352447,"assistant_id":"asst_123","thread_id":"thread_123","status":"completed","started_at":1710352475,"expires_at":null,"cancelled_at":null,"failed_at":null,"completed_at":1710352477,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get the current weather in a given location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The city and state, e.g. San Francisco, CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31},"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} + + event: done + data: [DONE] + /uploads: + post: + operationId: createUpload + tags: + - Uploads + summary: > + Creates an intermediate [Upload](/docs/api-reference/uploads/object) + object - data: - {"id":"msg_002","object":"thread.message","created_at":1710352476,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} + that you can add [Parts](/docs/api-reference/uploads/part-object) to. + Currently, an Upload can accept at most 8 GB in total and expires after + an + + hour after you create it. - event: thread.message.in_progress - data: - {"id":"msg_002","object":"thread.message","created_at":1710352476,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"in_progress","incomplete_details":null,"incomplete_at":null,"completed_at":null,"role":"assistant","content":[],"metadata":{}} + Once you complete the Upload, we will create a + [File](/docs/api-reference/files/object) object that contains all the + parts - event: thread.message.delta + you uploaded. This File is usable in the rest of our platform as a + regular - data: - {"id":"msg_002","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"The","annotations":[]}}]}} + File object. - event: thread.message.delta + For certain `purpose` values, the correct `mime_type` must be + specified. - data: - {"id":"msg_002","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" - current"}}]}} + Please refer to documentation for the + [supported MIME types for your use + case](/docs/assistants/tools/file-search#supported-files). - event: thread.message.delta - data: - {"id":"msg_002","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" - weather"}}]}} + For guidance on the proper filename extensions for each purpose, please + + follow the documentation on [creating a + File](/docs/api-reference/files/create). + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/CreateUploadRequest" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/Upload" + x-oaiMeta: + name: Create upload + group: uploads + returns: The [Upload](/docs/api-reference/uploads/object) object with status + `pending`. + examples: + request: + curl: | + curl https://api.openai.com/v1/uploads \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -d '{ + "purpose": "fine-tune", + "filename": "training_examples.jsonl", + "bytes": 2147483648, + "mime_type": "text/jsonl" + }' + response: | + { + "id": "upload_abc123", + "object": "upload", + "bytes": 2147483648, + "created_at": 1719184911, + "filename": "training_examples.jsonl", + "purpose": "fine-tune", + "status": "pending", + "expires_at": 1719127296 + } + /uploads/{upload_id}/cancel: + post: + operationId: cancelUpload + tags: + - Uploads + summary: | + Cancels the Upload. No Parts may be added after an Upload is cancelled. + parameters: + - in: path + name: upload_id + required: true + schema: + type: string + example: upload_abc123 + description: | + The ID of the Upload. + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/Upload" + x-oaiMeta: + name: Cancel upload + group: uploads + returns: The [Upload](/docs/api-reference/uploads/object) object with status + `cancelled`. + examples: + request: + curl: | + curl https://api.openai.com/v1/uploads/upload_abc123/cancel + response: | + { + "id": "upload_abc123", + "object": "upload", + "bytes": 2147483648, + "created_at": 1719184911, + "filename": "training_examples.jsonl", + "purpose": "fine-tune", + "status": "cancelled", + "expires_at": 1719127296 + } + /uploads/{upload_id}/complete: + post: + operationId: completeUpload + tags: + - Uploads + summary: > + Completes the [Upload](/docs/api-reference/uploads/object). - ... + Within the returned Upload object, there is a nested + [File](/docs/api-reference/files/object) object that is ready to use in + the rest of the platform. - event: thread.message.delta - data: - {"id":"msg_002","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":" - sunny"}}]}} + You can specify the order of the Parts by passing in an ordered list of + the Part IDs. - event: thread.message.delta + The number of bytes uploaded upon completion must match the number of + bytes initially specified when creating the Upload object. No Parts may + be added after an Upload is completed. + parameters: + - in: path + name: upload_id + required: true + schema: + type: string + example: upload_abc123 + description: | + The ID of the Upload. + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/CompleteUploadRequest" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/Upload" + x-oaiMeta: + name: Complete upload + group: uploads + returns: The [Upload](/docs/api-reference/uploads/object) object with status + `completed` with an additional `file` property containing the created + usable File object. + examples: + request: + curl: | + curl https://api.openai.com/v1/uploads/upload_abc123/complete + -d '{ + "part_ids": ["part_def456", "part_ghi789"] + }' + response: | + { + "id": "upload_abc123", + "object": "upload", + "bytes": 2147483648, + "created_at": 1719184911, + "filename": "training_examples.jsonl", + "purpose": "fine-tune", + "status": "completed", + "expires_at": 1719127296, + "file": { + "id": "file-xyz321", + "object": "file", + "bytes": 2147483648, + "created_at": 1719186911, + "filename": "training_examples.jsonl", + "purpose": "fine-tune", + } + } + /uploads/{upload_id}/parts: + post: + operationId: addUploadPart + tags: + - Uploads + summary: > + Adds a [Part](/docs/api-reference/uploads/part-object) to an + [Upload](/docs/api-reference/uploads/object) object. A Part represents a + chunk of bytes from the file you are trying to upload. - data: - {"id":"msg_002","object":"thread.message.delta","delta":{"content":[{"index":0,"type":"text","text":{"value":"."}}]}} + Each Part can be at most 64 MB, and you can add Parts until you hit the + Upload maximum of 8 GB. - event: thread.message.completed - data: - {"id":"msg_002","object":"thread.message","created_at":1710352476,"assistant_id":"asst_123","thread_id":"thread_123","run_id":"run_123","status":"completed","incomplete_details":null,"incomplete_at":null,"completed_at":1710352477,"role":"assistant","content":[{"type":"text","text":{"value":"The - current weather in San Francisco, CA is 70 degrees Fahrenheit and - sunny.","annotations":[]}}],"metadata":{}} + It is possible to add multiple Parts in parallel. You can decide the + intended order of the Parts when you [complete the + Upload](/docs/api-reference/uploads/complete). + parameters: + - in: path + name: upload_id + required: true + schema: + type: string + example: upload_abc123 + description: | + The ID of the Upload. + requestBody: + required: true + content: + multipart/form-data: + schema: + $ref: "#/components/schemas/AddUploadPartRequest" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/UploadPart" + x-oaiMeta: + name: Add upload part + group: uploads + returns: The upload [Part](/docs/api-reference/uploads/part-object) object. + examples: + request: + curl: | + curl https://api.openai.com/v1/uploads/upload_abc123/parts + -F data="aHR0cHM6Ly9hcGkub3BlbmFpLmNvbS92MS91cGxvYWRz..." + response: | + { + "id": "part_def456", + "object": "upload.part", + "created_at": 1719185911, + "upload_id": "upload_abc123" + } + /vector_stores: + get: + operationId: listVectorStores + tags: + - Vector stores + summary: Returns a list of vector stores. + parameters: + - name: limit + in: query + description: > + A limit on the number of objects to be returned. Limit can range + between 1 and 100, and the default is 20. + required: false + schema: + type: integer + default: 20 + - name: order + in: query + description: > + Sort order by the `created_at` timestamp of the objects. `asc` for + ascending order and `desc` for descending order. + schema: + type: string + default: desc + enum: + - asc + - desc + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. + schema: + type: string + - name: before + in: query + description: > + A cursor for use in pagination. `before` is an object ID that + defines your place in the list. For instance, if you make a list + request and receive 100 objects, starting with obj_foo, your + subsequent call can include before=obj_foo in order to fetch the + previous page of the list. + schema: + type: string + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/ListVectorStoresResponse" + x-oaiMeta: + name: List vector stores + group: vector_stores + returns: A list of [vector store](/docs/api-reference/vector-stores/object) + objects. + examples: + request: + curl: | + curl https://api.openai.com/v1/vector_stores \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -H "OpenAI-Beta: assistants=v2" + python: | + from openai import OpenAI + client = OpenAI() + vector_stores = client.vector_stores.list() + print(vector_stores) + node.js: | + import OpenAI from "openai"; + const openai = new OpenAI(); - event: thread.run.step.completed + async function main() { + const vectorStores = await openai.vectorStores.list(); + console.log(vectorStores); + } - data: - {"id":"step_002","object":"thread.run.step","created_at":1710352476,"run_id":"run_123","assistant_id":"asst_123","thread_id":"thread_123","type":"message_creation","status":"completed","cancelled_at":null,"completed_at":1710352477,"expires_at":1710353047,"failed_at":null,"last_error":null,"step_details":{"type":"message_creation","message_creation":{"message_id":"msg_002"}},"usage":{"prompt_tokens":329,"completion_tokens":18,"total_tokens":347}} + main(); + response: | + { + "object": "list", + "data": [ + { + "id": "vs_abc123", + "object": "vector_store", + "created_at": 1699061776, + "name": "Support FAQ", + "bytes": 139920, + "file_counts": { + "in_progress": 0, + "completed": 3, + "failed": 0, + "cancelled": 0, + "total": 3 + } + }, + { + "id": "vs_abc456", + "object": "vector_store", + "created_at": 1699061776, + "name": "Support FAQ v2", + "bytes": 139920, + "file_counts": { + "in_progress": 0, + "completed": 3, + "failed": 0, + "cancelled": 0, + "total": 3 + } + } + ], + "first_id": "vs_abc123", + "last_id": "vs_abc456", + "has_more": false + } + post: + operationId: createVectorStore + tags: + - Vector stores + summary: Create a vector store. + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/CreateVectorStoreRequest" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/VectorStoreObject" + x-oaiMeta: + name: Create vector store + group: vector_stores + returns: A [vector store](/docs/api-reference/vector-stores/object) object. + examples: + request: + curl: | + curl https://api.openai.com/v1/vector_stores \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -H "OpenAI-Beta: assistants=v2" \ + -d '{ + "name": "Support FAQ" + }' + python: | + from openai import OpenAI + client = OpenAI() + vector_store = client.vector_stores.create( + name="Support FAQ" + ) + print(vector_store) + node.js: | + import OpenAI from "openai"; + const openai = new OpenAI(); - event: thread.run.completed + async function main() { + const vectorStore = await openai.vectorStores.create({ + name: "Support FAQ" + }); + console.log(vectorStore); + } - data: - {"id":"run_123","object":"thread.run","created_at":1710352447,"assistant_id":"asst_123","thread_id":"thread_123","status":"completed","started_at":1710352475,"expires_at":null,"cancelled_at":null,"failed_at":null,"completed_at":1710352477,"required_action":null,"last_error":null,"model":"gpt-4o","instructions":null,"tools":[{"type":"function","function":{"name":"get_current_weather","description":"Get - the current weather in a given - location","parameters":{"type":"object","properties":{"location":{"type":"string","description":"The - city and state, e.g. San Francisco, - CA"},"unit":{"type":"string","enum":["celsius","fahrenheit"]}},"required":["location"]}}}],"metadata":{},"temperature":1.0,"top_p":1.0,"max_completion_tokens":null,"max_prompt_tokens":null,"truncation_strategy":{"type":"auto","last_messages":null},"incomplete_details":null,"usage":{"prompt_tokens":20,"completion_tokens":11,"total_tokens":31},"response_format":"auto","tool_choice":"auto","parallel_tool_calls":true}} + main(); + response: | + { + "id": "vs_abc123", + "object": "vector_store", + "created_at": 1699061776, + "name": "Support FAQ", + "bytes": 139920, + "file_counts": { + "in_progress": 0, + "completed": 3, + "failed": 0, + "cancelled": 0, + "total": 3 + } + } + /vector_stores/{vector_store_id}: + get: + operationId: getVectorStore + tags: + - Vector stores + summary: Retrieves a vector store. + parameters: + - in: path + name: vector_store_id + required: true + schema: + type: string + description: The ID of the vector store to retrieve. + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/VectorStoreObject" + x-oaiMeta: + name: Retrieve vector store + group: vector_stores + returns: The [vector store](/docs/api-reference/vector-stores/object) object + matching the specified ID. + examples: + request: + curl: | + curl https://api.openai.com/v1/vector_stores/vs_abc123 \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -H "OpenAI-Beta: assistants=v2" + python: | + from openai import OpenAI + client = OpenAI() + vector_store = client.vector_stores.retrieve( + vector_store_id="vs_abc123" + ) + print(vector_store) + node.js: | + import OpenAI from "openai"; + const openai = new OpenAI(); - event: done + async function main() { + const vectorStore = await openai.vectorStores.retrieve( + "vs_abc123" + ); + console.log(vectorStore); + } - data: [DONE] - /uploads: + main(); + response: | + { + "id": "vs_abc123", + "object": "vector_store", + "created_at": 1699061776 + } post: - operationId: createUpload + operationId: modifyVectorStore tags: - - Uploads - summary: > - Creates an intermediate [Upload](/docs/api-reference/uploads/object) - object that you can add [Parts](/docs/api-reference/uploads/part-object) - to. Currently, an Upload can accept at most 8 GB in total and expires - after an hour after you create it. - + - Vector stores + summary: Modifies a vector store. + parameters: + - in: path + name: vector_store_id + required: true + schema: + type: string + description: The ID of the vector store to modify. + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/UpdateVectorStoreRequest" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/VectorStoreObject" + x-oaiMeta: + name: Modify vector store + group: vector_stores + returns: The modified [vector store](/docs/api-reference/vector-stores/object) + object. + examples: + request: + curl: | + curl https://api.openai.com/v1/vector_stores/vs_abc123 \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -H "OpenAI-Beta: assistants=v2" + -d '{ + "name": "Support FAQ" + }' + python: | + from openai import OpenAI + client = OpenAI() - Once you complete the Upload, we will create a - [File](/docs/api-reference/files/object) object that contains all the - parts you uploaded. This File is usable in the rest of our platform as a - regular File object. + vector_store = client.vector_stores.update( + vector_store_id="vs_abc123", + name="Support FAQ" + ) + print(vector_store) + node.js: | + import OpenAI from "openai"; + const openai = new OpenAI(); + async function main() { + const vectorStore = await openai.vectorStores.update( + "vs_abc123", + { + name: "Support FAQ" + } + ); + console.log(vectorStore); + } - For certain `purpose`s, the correct `mime_type` must be specified. - Please refer to documentation for the supported MIME types for your use - case: + main(); + response: | + { + "id": "vs_abc123", + "object": "vector_store", + "created_at": 1699061776, + "name": "Support FAQ", + "bytes": 139920, + "file_counts": { + "in_progress": 0, + "completed": 3, + "failed": 0, + "cancelled": 0, + "total": 3 + } + } + delete: + operationId: deleteVectorStore + tags: + - Vector stores + summary: Delete a vector store. + parameters: + - in: path + name: vector_store_id + required: true + schema: + type: string + description: The ID of the vector store to delete. + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/DeleteVectorStoreResponse" + x-oaiMeta: + name: Delete vector store + group: vector_stores + returns: Deletion status + examples: + request: + curl: | + curl https://api.openai.com/v1/vector_stores/vs_abc123 \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -H "OpenAI-Beta: assistants=v2" \ + -X DELETE + python: | + from openai import OpenAI + client = OpenAI() - - [Assistants](/docs/assistants/tools/file-search#supported-files) + deleted_vector_store = client.vector_stores.delete( + vector_store_id="vs_abc123" + ) + print(deleted_vector_store) + node.js: | + import OpenAI from "openai"; + const openai = new OpenAI(); + async function main() { + const deletedVectorStore = await openai.vectorStores.del( + "vs_abc123" + ); + console.log(deletedVectorStore); + } - For guidance on the proper filename extensions for each purpose, please - follow the documentation on [creating a - File](/docs/api-reference/files/create). + main(); + response: | + { + id: "vs_abc123", + object: "vector_store.deleted", + deleted: true + } + /vector_stores/{vector_store_id}/file_batches: + post: + operationId: createVectorStoreFileBatch + tags: + - Vector stores + summary: Create a vector store file batch. + parameters: + - in: path + name: vector_store_id + required: true + schema: + type: string + example: vs_abc123 + description: | + The ID of the vector store for which to create a File Batch. requestBody: required: true content: application/json: schema: - $ref: "#/components/schemas/CreateUploadRequest" + $ref: "#/components/schemas/CreateVectorStoreFileBatchRequest" responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/Upload" + $ref: "#/components/schemas/VectorStoreFileBatchObject" x-oaiMeta: - name: Create upload - group: uploads - returns: The [Upload](/docs/api-reference/uploads/object) object with status - `pending`. + name: Create vector store file batch + group: vector_stores + returns: A [vector store file + batch](/docs/api-reference/vector-stores-file-batches/batch-object) + object. examples: request: - curl: | - curl https://api.openai.com/v1/uploads \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -d '{ - "purpose": "fine-tune", - "filename": "training_examples.jsonl", - "bytes": 2147483648, - "mime_type": "text/jsonl" - }' + curl: > + curl + https://api.openai.com/v1/vector_stores/vs_abc123/file_batches \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json \ + -H "OpenAI-Beta: assistants=v2" \ + -d '{ + "file_ids": ["file-abc123", "file-abc456"] + }' + python: > + from openai import OpenAI + + client = OpenAI() + + + vector_store_file_batch = + client.vector_stores.file_batches.create( + vector_store_id="vs_abc123", + file_ids=["file-abc123", "file-abc456"] + ) + + print(vector_store_file_batch) + node.js: > + import OpenAI from "openai"; + + const openai = new OpenAI(); + + + async function main() { + const myVectorStoreFileBatch = await openai.vectorStores.fileBatches.create( + "vs_abc123", + { + file_ids: ["file-abc123", "file-abc456"] + } + ); + console.log(myVectorStoreFileBatch); + } + + + main(); response: | { - "id": "upload_abc123", - "object": "upload", - "bytes": 2147483648, - "created_at": 1719184911, - "filename": "training_examples.jsonl", - "purpose": "fine-tune", - "status": "pending", - "expires_at": 1719127296 + "id": "vsfb_abc123", + "object": "vector_store.file_batch", + "created_at": 1699061776, + "vector_store_id": "vs_abc123", + "status": "in_progress", + "file_counts": { + "in_progress": 1, + "completed": 1, + "failed": 0, + "cancelled": 0, + "total": 0, + } } - /uploads/{upload_id}/cancel: - post: - operationId: cancelUpload + /vector_stores/{vector_store_id}/file_batches/{batch_id}: + get: + operationId: getVectorStoreFileBatch tags: - - Uploads - summary: | - Cancels the Upload. No Parts may be added after an Upload is cancelled. + - Vector stores + summary: Retrieves a vector store file batch. parameters: - in: path - name: upload_id + name: vector_store_id required: true schema: type: string - example: upload_abc123 - description: | - The ID of the Upload. + example: vs_abc123 + description: The ID of the vector store that the file batch belongs to. + - in: path + name: batch_id + required: true + schema: + type: string + example: vsfb_abc123 + description: The ID of the file batch being retrieved. responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/Upload" + $ref: "#/components/schemas/VectorStoreFileBatchObject" x-oaiMeta: - name: Cancel upload - group: uploads - returns: The [Upload](/docs/api-reference/uploads/object) object with status - `cancelled`. + name: Retrieve vector store file batch + group: vector_stores + returns: The [vector store file + batch](/docs/api-reference/vector-stores-file-batches/batch-object) + object. examples: request: curl: | - curl https://api.openai.com/v1/uploads/upload_abc123/cancel - response: | - { - "id": "upload_abc123", - "object": "upload", - "bytes": 2147483648, - "created_at": 1719184911, - "filename": "training_examples.jsonl", - "purpose": "fine-tune", - "status": "cancelled", - "expires_at": 1719127296 - } - /uploads/{upload_id}/complete: - post: - operationId: completeUpload - tags: - - Uploads - summary: > - Completes the [Upload](/docs/api-reference/uploads/object). + curl https://api.openai.com/v1/vector_stores/vs_abc123/files_batches/vsfb_abc123 \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -H "OpenAI-Beta: assistants=v2" + python: > + from openai import OpenAI + + client = OpenAI() - Within the returned Upload object, there is a nested - [File](/docs/api-reference/files/object) object that is ready to use in - the rest of the platform. + vector_store_file_batch = + client.vector_stores.file_batches.retrieve( + vector_store_id="vs_abc123", + batch_id="vsfb_abc123" + ) + print(vector_store_file_batch) + node.js: > + import OpenAI from "openai"; - You can specify the order of the Parts by passing in an ordered list of - the Part IDs. + const openai = new OpenAI(); - The number of bytes uploaded upon completion must match the number of - bytes initially specified when creating the Upload object. No Parts may - be added after an Upload is completed. + async function main() { + const vectorStoreFileBatch = await openai.vectorStores.fileBatches.retrieve( + "vs_abc123", + "vsfb_abc123" + ); + console.log(vectorStoreFileBatch); + } + + + main(); + response: | + { + "id": "vsfb_abc123", + "object": "vector_store.file_batch", + "created_at": 1699061776, + "vector_store_id": "vs_abc123", + "status": "in_progress", + "file_counts": { + "in_progress": 1, + "completed": 1, + "failed": 0, + "cancelled": 0, + "total": 0, + } + } + /vector_stores/{vector_store_id}/file_batches/{batch_id}/cancel: + post: + operationId: cancelVectorStoreFileBatch + tags: + - Vector stores + summary: Cancel a vector store file batch. This attempts to cancel the + processing of files in this batch as soon as possible. parameters: - in: path - name: upload_id + name: vector_store_id required: true schema: type: string - example: upload_abc123 - description: | - The ID of the Upload. - requestBody: - required: true - content: - application/json: - schema: - $ref: "#/components/schemas/CompleteUploadRequest" + description: The ID of the vector store that the file batch belongs to. + - in: path + name: batch_id + required: true + schema: + type: string + description: The ID of the file batch to cancel. responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/Upload" + $ref: "#/components/schemas/VectorStoreFileBatchObject" x-oaiMeta: - name: Complete upload - group: uploads - returns: The [Upload](/docs/api-reference/uploads/object) object with status - `completed` with an additional `file` property containing the created - usable File object. + name: Cancel vector store file batch + group: vector_stores + returns: The modified vector store file batch object. examples: request: curl: | - curl https://api.openai.com/v1/uploads/upload_abc123/complete - -d '{ - "part_ids": ["part_def456", "part_ghi789"] - }' + curl https://api.openai.com/v1/vector_stores/vs_abc123/files_batches/vsfb_abc123/cancel \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -H "OpenAI-Beta: assistants=v2" \ + -X POST + python: > + from openai import OpenAI + + client = OpenAI() + + + deleted_vector_store_file_batch = + client.vector_stores.file_batches.cancel( + vector_store_id="vs_abc123", + file_batch_id="vsfb_abc123" + ) + + print(deleted_vector_store_file_batch) + node.js: > + import OpenAI from "openai"; + + const openai = new OpenAI(); + + + async function main() { + const deletedVectorStoreFileBatch = await openai.vectorStores.fileBatches.cancel( + "vs_abc123", + "vsfb_abc123" + ); + console.log(deletedVectorStoreFileBatch); + } + + + main(); response: | { - "id": "upload_abc123", - "object": "upload", - "bytes": 2147483648, - "created_at": 1719184911, - "filename": "training_examples.jsonl", - "purpose": "fine-tune", - "status": "completed", - "expires_at": 1719127296, - "file": { - "id": "file-xyz321", - "object": "file", - "bytes": 2147483648, - "created_at": 1719186911, - "filename": "training_examples.jsonl", - "purpose": "fine-tune", + "id": "vsfb_abc123", + "object": "vector_store.file_batch", + "created_at": 1699061776, + "vector_store_id": "vs_abc123", + "status": "in_progress", + "file_counts": { + "in_progress": 12, + "completed": 3, + "failed": 0, + "cancelled": 0, + "total": 15, } } - /uploads/{upload_id}/parts: - post: - operationId: addUploadPart + /vector_stores/{vector_store_id}/file_batches/{batch_id}/files: + get: + operationId: listFilesInVectorStoreBatch tags: - - Uploads - summary: > - Adds a [Part](/docs/api-reference/uploads/part-object) to an - [Upload](/docs/api-reference/uploads/object) object. A Part represents a - chunk of bytes from the file you are trying to upload. - - - Each Part can be at most 64 MB, and you can add Parts until you hit the - Upload maximum of 8 GB. - - - It is possible to add multiple Parts in parallel. You can decide the - intended order of the Parts when you [complete the - Upload](/docs/api-reference/uploads/complete). + - Vector stores + summary: Returns a list of vector store files in a batch. parameters: - - in: path - name: upload_id + - name: vector_store_id + in: path + description: The ID of the vector store that the files belong to. required: true schema: type: string - example: upload_abc123 - description: | - The ID of the Upload. - requestBody: - required: true - content: - multipart/form-data: - schema: - $ref: "#/components/schemas/AddUploadPartRequest" + - name: batch_id + in: path + description: The ID of the file batch that the files belong to. + required: true + schema: + type: string + - name: limit + in: query + description: > + A limit on the number of objects to be returned. Limit can range + between 1 and 100, and the default is 20. + required: false + schema: + type: integer + default: 20 + - name: order + in: query + description: > + Sort order by the `created_at` timestamp of the objects. `asc` for + ascending order and `desc` for descending order. + schema: + type: string + default: desc + enum: + - asc + - desc + - name: after + in: query + description: > + A cursor for use in pagination. `after` is an object ID that defines + your place in the list. For instance, if you make a list request and + receive 100 objects, ending with obj_foo, your subsequent call can + include after=obj_foo in order to fetch the next page of the list. + schema: + type: string + - name: before + in: query + description: > + A cursor for use in pagination. `before` is an object ID that + defines your place in the list. For instance, if you make a list + request and receive 100 objects, starting with obj_foo, your + subsequent call can include before=obj_foo in order to fetch the + previous page of the list. + schema: + type: string + - name: filter + in: query + description: Filter by file status. One of `in_progress`, `completed`, `failed`, + `cancelled`. + schema: + type: string + enum: + - in_progress + - completed + - failed + - cancelled responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/UploadPart" + $ref: "#/components/schemas/ListVectorStoreFilesResponse" x-oaiMeta: - name: Add upload part - group: uploads - returns: The upload [Part](/docs/api-reference/uploads/part-object) object. + name: List vector store files in a batch + group: vector_stores + returns: A list of [vector store + file](/docs/api-reference/vector-stores-files/file-object) objects. examples: request: curl: | - curl https://api.openai.com/v1/uploads/upload_abc123/parts - -F data="aHR0cHM6Ly9hcGkub3BlbmFpLmNvbS92MS91cGxvYWRz..." + curl https://api.openai.com/v1/vector_stores/vs_abc123/files_batches/vsfb_abc123/files \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -H "OpenAI-Beta: assistants=v2" + python: | + from openai import OpenAI + client = OpenAI() + + vector_store_files = client.vector_stores.file_batches.list_files( + vector_store_id="vs_abc123", + batch_id="vsfb_abc123" + ) + print(vector_store_files) + node.js: > + import OpenAI from "openai"; + + const openai = new OpenAI(); + + + async function main() { + const vectorStoreFiles = await openai.vectorStores.fileBatches.listFiles( + "vs_abc123", + "vsfb_abc123" + ); + console.log(vectorStoreFiles); + } + + + main(); response: | { - "id": "part_def456", - "object": "upload.part", - "created_at": 1719185911, - "upload_id": "upload_abc123" + "object": "list", + "data": [ + { + "id": "file-abc123", + "object": "vector_store.file", + "created_at": 1699061776, + "vector_store_id": "vs_abc123" + }, + { + "id": "file-abc456", + "object": "vector_store.file", + "created_at": 1699061776, + "vector_store_id": "vs_abc123" + } + ], + "first_id": "file-abc123", + "last_id": "file-abc456", + "has_more": false } - /vector_stores: + /vector_stores/{vector_store_id}/files: get: - operationId: listVectorStores + operationId: listVectorStoreFiles tags: - Vector stores - summary: Returns a list of vector stores. + summary: Returns a list of vector store files. parameters: + - name: vector_store_id + in: path + description: The ID of the vector store that the files belong to. + required: true + schema: + type: string - name: limit in: query description: > @@ -8751,23 +16171,33 @@ paths: previous page of the list. schema: type: string + - name: filter + in: query + description: Filter by file status. One of `in_progress`, `completed`, `failed`, + `cancelled`. + schema: + type: string + enum: + - in_progress + - completed + - failed + - cancelled responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/ListVectorStoresResponse" + $ref: "#/components/schemas/ListVectorStoreFilesResponse" x-oaiMeta: - name: List vector stores + name: List vector store files group: vector_stores - beta: true - returns: A list of [vector store](/docs/api-reference/vector-stores/object) - objects. + returns: A list of [vector store + file](/docs/api-reference/vector-stores-files/file-object) objects. examples: request: curl: | - curl https://api.openai.com/v1/vector_stores \ + curl https://api.openai.com/v1/vector_stores/vs_abc123/files \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "Content-Type: application/json" \ -H "OpenAI-Beta: assistants=v2" @@ -8775,15 +16205,19 @@ paths: from openai import OpenAI client = OpenAI() - vector_stores = client.beta.vector_stores.list() - print(vector_stores) + vector_store_files = client.vector_stores.files.list( + vector_store_id="vs_abc123" + ) + print(vector_store_files) node.js: | import OpenAI from "openai"; const openai = new OpenAI(); async function main() { - const vectorStores = await openai.beta.vectorStores.list(); - console.log(vectorStores); + const vectorStoreFiles = await openai.vectorStores.files.list( + "vs_abc123" + ); + console.log(vectorStoreFiles); } main(); @@ -8792,136 +16226,140 @@ paths: "object": "list", "data": [ { - "id": "vs_abc123", - "object": "vector_store", + "id": "file-abc123", + "object": "vector_store.file", "created_at": 1699061776, - "name": "Support FAQ", - "bytes": 139920, - "file_counts": { - "in_progress": 0, - "completed": 3, - "failed": 0, - "cancelled": 0, - "total": 3 - } + "vector_store_id": "vs_abc123" }, { - "id": "vs_abc456", - "object": "vector_store", - "created_at": 1699061776, - "name": "Support FAQ v2", - "bytes": 139920, - "file_counts": { - "in_progress": 0, - "completed": 3, - "failed": 0, - "cancelled": 0, - "total": 3 - } + "id": "file-abc456", + "object": "vector_store.file", + "created_at": 1699061776, + "vector_store_id": "vs_abc123" } ], - "first_id": "vs_abc123", - "last_id": "vs_abc456", + "first_id": "file-abc123", + "last_id": "file-abc456", "has_more": false } post: - operationId: createVectorStore + operationId: createVectorStoreFile tags: - Vector stores - summary: Create a vector store. + summary: Create a vector store file by attaching a + [File](/docs/api-reference/files) to a [vector + store](/docs/api-reference/vector-stores/object). + parameters: + - in: path + name: vector_store_id + required: true + schema: + type: string + example: vs_abc123 + description: | + The ID of the vector store for which to create a File. requestBody: required: true content: application/json: schema: - $ref: "#/components/schemas/CreateVectorStoreRequest" + $ref: "#/components/schemas/CreateVectorStoreFileRequest" responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/VectorStoreObject" + $ref: "#/components/schemas/VectorStoreFileObject" x-oaiMeta: - name: Create vector store + name: Create vector store file group: vector_stores - beta: true - returns: A [vector store](/docs/api-reference/vector-stores/object) object. + returns: A [vector store + file](/docs/api-reference/vector-stores-files/file-object) object. examples: request: curl: | - curl https://api.openai.com/v1/vector_stores \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "Content-Type: application/json" \ - -H "OpenAI-Beta: assistants=v2" - -d '{ - "name": "Support FAQ" - }' + curl https://api.openai.com/v1/vector_stores/vs_abc123/files \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -H "OpenAI-Beta: assistants=v2" \ + -d '{ + "file_id": "file-abc123" + }' python: | from openai import OpenAI client = OpenAI() - vector_store = client.beta.vector_stores.create( - name="Support FAQ" + vector_store_file = client.vector_stores.files.create( + vector_store_id="vs_abc123", + file_id="file-abc123" ) - print(vector_store) - node.js: | + print(vector_store_file) + node.js: > import OpenAI from "openai"; + const openai = new OpenAI(); + async function main() { - const vectorStore = await openai.beta.vectorStores.create({ - name: "Support FAQ" - }); - console.log(vectorStore); + const myVectorStoreFile = await openai.vectorStores.files.create( + "vs_abc123", + { + file_id: "file-abc123" + } + ); + console.log(myVectorStoreFile); } + main(); response: | { - "id": "vs_abc123", - "object": "vector_store", + "id": "file-abc123", + "object": "vector_store.file", "created_at": 1699061776, - "name": "Support FAQ", - "bytes": 139920, - "file_counts": { - "in_progress": 0, - "completed": 3, - "failed": 0, - "cancelled": 0, - "total": 3 - } + "usage_bytes": 1234, + "vector_store_id": "vs_abcd", + "status": "completed", + "last_error": null } - /vector_stores/{vector_store_id}: + /vector_stores/{vector_store_id}/files/{file_id}: get: - operationId: getVectorStore + operationId: getVectorStoreFile tags: - Vector stores - summary: Retrieves a vector store. + summary: Retrieves a vector store file. parameters: - in: path name: vector_store_id required: true schema: type: string - description: The ID of the vector store to retrieve. + example: vs_abc123 + description: The ID of the vector store that the file belongs to. + - in: path + name: file_id + required: true + schema: + type: string + example: file-abc123 + description: The ID of the file being retrieved. responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/VectorStoreObject" + $ref: "#/components/schemas/VectorStoreFileObject" x-oaiMeta: - name: Retrieve vector store + name: Retrieve vector store file group: vector_stores - beta: true - returns: The [vector store](/docs/api-reference/vector-stores/object) object - matching the specified ID. + returns: The [vector store + file](/docs/api-reference/vector-stores-files/file-object) object. examples: request: curl: | - curl https://api.openai.com/v1/vector_stores/vs_abc123 \ + curl https://api.openai.com/v1/vector_stores/vs_abc123/files/file-abc123 \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "Content-Type: application/json" \ -H "OpenAI-Beta: assistants=v2" @@ -8929,172 +16367,218 @@ paths: from openai import OpenAI client = OpenAI() - vector_store = client.beta.vector_stores.retrieve( - vector_store_id="vs_abc123" + vector_store_file = client.vector_stores.files.retrieve( + vector_store_id="vs_abc123", + file_id="file-abc123" ) - print(vector_store) - node.js: | + print(vector_store_file) + node.js: > import OpenAI from "openai"; + const openai = new OpenAI(); + async function main() { - const vectorStore = await openai.beta.vectorStores.retrieve( - "vs_abc123" + const vectorStoreFile = await openai.vectorStores.files.retrieve( + "vs_abc123", + "file-abc123" ); - console.log(vectorStore); + console.log(vectorStoreFile); } + main(); response: | { - "id": "vs_abc123", - "object": "vector_store", - "created_at": 1699061776 + "id": "file-abc123", + "object": "vector_store.file", + "created_at": 1699061776, + "vector_store_id": "vs_abcd", + "status": "completed", + "last_error": null } - post: - operationId: modifyVectorStore + delete: + operationId: deleteVectorStoreFile tags: - Vector stores - summary: Modifies a vector store. + summary: Delete a vector store file. This will remove the file from the vector + store but the file itself will not be deleted. To delete the file, use + the [delete file](/docs/api-reference/files/delete) endpoint. parameters: - in: path name: vector_store_id required: true schema: type: string - description: The ID of the vector store to modify. - requestBody: - required: true - content: - application/json: - schema: - $ref: "#/components/schemas/UpdateVectorStoreRequest" + description: The ID of the vector store that the file belongs to. + - in: path + name: file_id + required: true + schema: + type: string + description: The ID of the file to delete. responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/VectorStoreObject" + $ref: "#/components/schemas/DeleteVectorStoreFileResponse" x-oaiMeta: - name: Modify vector store + name: Delete vector store file group: vector_stores - beta: true - returns: The modified [vector store](/docs/api-reference/vector-stores/object) - object. + returns: Deletion status examples: request: curl: | - curl https://api.openai.com/v1/vector_stores/vs_abc123 \ + curl https://api.openai.com/v1/vector_stores/vs_abc123/files/file-abc123 \ -H "Authorization: Bearer $OPENAI_API_KEY" \ -H "Content-Type: application/json" \ - -H "OpenAI-Beta: assistants=v2" - -d '{ - "name": "Support FAQ" - }' + -H "OpenAI-Beta: assistants=v2" \ + -X DELETE python: | from openai import OpenAI client = OpenAI() - vector_store = client.beta.vector_stores.update( - vector_store_id="vs_abc123", - name="Support FAQ" + deleted_vector_store_file = client.vector_stores.files.delete( + vector_store_id="vs_abc123", + file_id="file-abc123" ) - print(vector_store) - node.js: | + print(deleted_vector_store_file) + node.js: > import OpenAI from "openai"; + const openai = new OpenAI(); + async function main() { - const vectorStore = await openai.beta.vectorStores.update( + const deletedVectorStoreFile = await openai.vectorStores.files.del( "vs_abc123", - { - name: "Support FAQ" - } + "file-abc123" ); - console.log(vectorStore); + console.log(deletedVectorStoreFile); } + main(); response: | { - "id": "vs_abc123", - "object": "vector_store", + id: "file-abc123", + object: "vector_store.file.deleted", + deleted: true + } + post: + operationId: updateVectorStoreFileAttributes + tags: + - Vector stores + summary: Update attributes on a vector store file. + parameters: + - in: path + name: vector_store_id + required: true + schema: + type: string + example: vs_abc123 + description: The ID of the vector store the file belongs to. + - in: path + name: file_id + required: true + schema: + type: string + example: file-abc123 + description: The ID of the file to update attributes. + requestBody: + required: true + content: + application/json: + schema: + $ref: "#/components/schemas/UpdateVectorStoreFileAttributesRequest" + responses: + "200": + description: OK + content: + application/json: + schema: + $ref: "#/components/schemas/VectorStoreFileObject" + x-oaiMeta: + name: Update vector store file attributes + group: vector_stores + returns: The updated [vector store + file](/docs/api-reference/vector-stores-files/file-object) object. + examples: + request: + curl: | + curl https://api.openai.com/v1/vector_stores/{vector_store_id}/files/{file_id} \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -d '{"attributes": {"key1": "value1", "key2": 2}}' + response: | + { + "id": "file-abc123", + "object": "vector_store.file", + "usage_bytes": 1234, "created_at": 1699061776, - "name": "Support FAQ", - "bytes": 139920, - "file_counts": { - "in_progress": 0, - "completed": 3, - "failed": 0, - "cancelled": 0, - "total": 3 - } + "vector_store_id": "vs_abcd", + "status": "completed", + "last_error": null, + "chunking_strategy": {...}, + "attributes": {"key1": "value1", "key2": 2} } - delete: - operationId: deleteVectorStore + /vector_stores/{vector_store_id}/files/{file_id}/content: + get: + operationId: retrieveVectorStoreFileContent tags: - Vector stores - summary: Delete a vector store. + summary: Retrieve the parsed contents of a vector store file. parameters: - in: path - name: vector_store_id + name: vector_store_id + required: true + schema: + type: string + example: vs_abc123 + description: The ID of the vector store. + - in: path + name: file_id required: true schema: type: string - description: The ID of the vector store to delete. + example: file-abc123 + description: The ID of the file within the vector store. responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/DeleteVectorStoreResponse" + $ref: "#/components/schemas/VectorStoreFileContentResponse" x-oaiMeta: - name: Delete vector store + name: Retrieve vector store file content group: vector_stores - beta: true - returns: Deletion status + returns: The parsed contents of the specified vector store file. examples: request: curl: | - curl https://api.openai.com/v1/vector_stores/vs_abc123 \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "Content-Type: application/json" \ - -H "OpenAI-Beta: assistants=v2" \ - -X DELETE - python: | - from openai import OpenAI - client = OpenAI() - - deleted_vector_store = client.beta.vector_stores.delete( - vector_store_id="vs_abc123" - ) - print(deleted_vector_store) - node.js: | - import OpenAI from "openai"; - const openai = new OpenAI(); - - async function main() { - const deletedVectorStore = await openai.beta.vectorStores.del( - "vs_abc123" - ); - console.log(deletedVectorStore); - } - - main(); + curl \ + https://api.openai.com/v1/vector_stores/vs_abc123/files/file-abc123/content \ + -H "Authorization: Bearer $OPENAI_API_KEY" response: | { - id: "vs_abc123", - object: "vector_store.deleted", - deleted: true + "file_id": "file-abc123", + "filename": "example.txt", + "attributes": {"key": "value"}, + "content": [ + {"type": "text", "text": "..."}, + ... + ] } - /vector_stores/{vector_store_id}/file_batches: + /vector_stores/{vector_store_id}/search: post: - operationId: createVectorStoreFileBatch + operationId: searchVectorStore tags: - Vector stores - summary: Create a vector store file batch. + summary: Search a vector store for relevant chunks based on a query and file + attributes filter. parameters: - in: path name: vector_store_id @@ -9102,2790 +16586,6106 @@ paths: schema: type: string example: vs_abc123 - description: | - The ID of the vector store for which to create a File Batch. + description: The ID of the vector store to search. requestBody: required: true content: application/json: schema: - $ref: "#/components/schemas/CreateVectorStoreFileBatchRequest" + $ref: "#/components/schemas/VectorStoreSearchRequest" responses: "200": description: OK content: application/json: schema: - $ref: "#/components/schemas/VectorStoreFileBatchObject" + $ref: "#/components/schemas/VectorStoreSearchResultsPage" + x-oaiMeta: + name: Search vector store + group: vector_stores + returns: A page of search results from the vector store. + examples: + request: + curl: | + curl -X POST \ + https://api.openai.com/v1/vector_stores/vs_abc123/search \ + -H "Authorization: Bearer $OPENAI_API_KEY" \ + -H "Content-Type: application/json" \ + -d '{"query": "What is the return policy?", "filters": {...}}' + response: | + { + "object": "vector_store.search_results.page", + "search_query": "What is the return policy?", + "data": [ + { + "file_id": "file_123", + "filename": "document.pdf", + "score": 0.95, + "attributes": { + "author": "John Doe", + "date": "2023-01-01" + }, + "content": [ + { + "type": "text", + "text": "Relevant chunk" + } + ] + }, + { + "file_id": "file_456", + "filename": "notes.txt", + "score": 0.89, + "attributes": { + "author": "Jane Smith", + "date": "2023-01-02" + }, + "content": [ + { + "type": "text", + "text": "Sample text content from the vector store." + } + ] + } + ], + "has_more": false, + "next_page": null + } +components: + schemas: + AddUploadPartRequest: + type: object + additionalProperties: false + properties: + data: + description: | + The chunk of bytes for this Part. + type: string + format: binary + required: + - data + AdminApiKey: + type: object + description: Represents an individual Admin API key in an org. + properties: + object: + type: string + example: organization.admin_api_key + description: The object type, which is always `organization.admin_api_key` + x-stainless-const: true + id: + type: string + example: key_abc + description: The identifier, which can be referenced in API endpoints + name: + type: string + example: Administration Key + description: The name of the API key + redacted_value: + type: string + example: sk-admin...def + description: The redacted value of the API key + value: + type: string + example: sk-admin-1234abcd + description: The value of the API key. Only shown on create. + created_at: + type: integer + format: int64 + example: 1711471533 + description: The Unix timestamp (in seconds) of when the API key was created + last_used_at: + type: integer + format: int64 + nullable: true + example: 1711471534 + description: The Unix timestamp (in seconds) of when the API key was last used + owner: + type: object + properties: + type: + type: string + example: user + description: Always `user` + object: + type: string + example: organization.user + description: The object type, which is always organization.user + id: + type: string + example: sa_456 + description: The identifier, which can be referenced in API endpoints + name: + type: string + example: My Service Account + description: The name of the user + created_at: + type: integer + format: int64 + example: 1711471533 + description: The Unix timestamp (in seconds) of when the user was created + role: + type: string + example: owner + description: Always `owner` + required: + - object + - redacted_value + - name + - created_at + - last_used_at + - id + - owner + x-oaiMeta: + name: The admin API key object + example: | + { + "object": "organization.admin_api_key", + "id": "key_abc", + "name": "Main Admin Key", + "redacted_value": "sk-admin...xyz", + "created_at": 1711471533, + "last_used_at": 1711471534, + "owner": { + "type": "user", + "object": "organization.user", + "id": "user_123", + "name": "John Doe", + "created_at": 1711471533, + "role": "owner" + } + } + ApiKeyList: + type: object + properties: + object: + type: string + example: list + data: + type: array + items: + $ref: "#/components/schemas/AdminApiKey" + has_more: + type: boolean + example: false + first_id: + type: string + example: key_abc + last_id: + type: string + example: key_xyz + AssistantObject: + type: object + title: Assistant + description: Represents an `assistant` that can call the model and use tools. + properties: + id: + description: The identifier, which can be referenced in API endpoints. + type: string + object: + description: The object type, which is always `assistant`. + type: string + enum: + - assistant + x-stainless-const: true + created_at: + description: The Unix timestamp (in seconds) for when the assistant was created. + type: integer + name: + description: | + The name of the assistant. The maximum length is 256 characters. + type: string + maxLength: 256 + nullable: true + description: + description: > + The description of the assistant. The maximum length is 512 + characters. + type: string + maxLength: 512 + nullable: true + model: + description: > + ID of the model to use. You can use the [List + models](/docs/api-reference/models/list) API to see all of your + available models, or see our [Model overview](/docs/models) for + descriptions of them. + type: string + instructions: + description: > + The system instructions that the assistant uses. The maximum length + is 256,000 characters. + type: string + maxLength: 256000 + nullable: true + tools: + description: > + A list of tool enabled on the assistant. There can be a maximum of + 128 tools per assistant. Tools can be of types `code_interpreter`, + `file_search`, or `function`. + default: [] + type: array + maxItems: 128 + items: + oneOf: + - $ref: "#/components/schemas/AssistantToolsCode" + - $ref: "#/components/schemas/AssistantToolsFileSearch" + - $ref: "#/components/schemas/AssistantToolsFunction" + tool_resources: + type: object + description: > + A set of resources that are used by the assistant's tools. The + resources are specific to the type of tool. For example, the + `code_interpreter` tool requires a list of file IDs, while the + `file_search` tool requires a list of vector store IDs. + properties: + code_interpreter: + type: object + properties: + file_ids: + type: array + description: > + A list of [file](/docs/api-reference/files) IDs made + available to the `code_interpreter`` tool. There can be a + maximum of 20 files associated with the tool. + default: [] + maxItems: 20 + items: + type: string + file_search: + type: object + properties: + vector_store_ids: + type: array + description: > + The ID of the [vector + store](/docs/api-reference/vector-stores/object) attached to + this assistant. There can be a maximum of 1 vector store + attached to the assistant. + maxItems: 1 + items: + type: string + nullable: true + metadata: + $ref: "#/components/schemas/Metadata" + temperature: + description: > + What sampling temperature to use, between 0 and 2. Higher values + like 0.8 will make the output more random, while lower values like + 0.2 will make it more focused and deterministic. + type: number + minimum: 0 + maximum: 2 + default: 1 + example: 1 + nullable: true + top_p: + type: number + minimum: 0 + maximum: 1 + default: 1 + example: 1 + nullable: true + description: > + An alternative to sampling with temperature, called nucleus + sampling, where the model considers the results of the tokens with + top_p probability mass. So 0.1 means only the tokens comprising the + top 10% probability mass are considered. + + + We generally recommend altering this or temperature but not both. + response_format: + $ref: "#/components/schemas/AssistantsApiResponseFormatOption" + nullable: true + required: + - id + - object + - created_at + - name + - description + - model + - instructions + - tools + - metadata x-oaiMeta: - name: Create vector store file batch - group: vector_stores + name: The assistant object beta: true - returns: A [vector store file - batch](/docs/api-reference/vector-stores-file-batches/batch-object) - object. - examples: - request: - curl: > - curl - https://api.openai.com/v1/vector_stores/vs_abc123/file_batches \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "Content-Type: application/json \ - -H "OpenAI-Beta: assistants=v2" \ - -d '{ - "file_ids": ["file-abc123", "file-abc456"] - }' - python: > - from openai import OpenAI + example: > + { + "id": "asst_abc123", + "object": "assistant", + "created_at": 1698984975, + "name": "Math Tutor", + "description": null, + "model": "gpt-4o", + "instructions": "You are a personal math tutor. When asked a question, write and run Python code to answer the question.", + "tools": [ + { + "type": "code_interpreter" + } + ], + "metadata": {}, + "top_p": 1.0, + "temperature": 1.0, + "response_format": "auto" + } + AssistantStreamEvent: + description: > + Represents an event emitted when streaming a Run. - client = OpenAI() + Each event in a server-sent events stream has an `event` and `data` + property: - vector_store_file_batch = - client.beta.vector_stores.file_batches.create( - vector_store_id="vs_abc123", - file_ids=["file-abc123", "file-abc456"] - ) - print(vector_store_file_batch) - node.js: > - import OpenAI from "openai"; + ``` - const openai = new OpenAI(); + event: thread.created + data: {"id": "thread_123", "object": "thread", ...} - async function main() { - const myVectorStoreFileBatch = await openai.beta.vectorStores.fileBatches.create( - "vs_abc123", - { - file_ids: ["file-abc123", "file-abc456"] - } - ); - console.log(myVectorStoreFileBatch); - } + ``` - main(); - response: | - { - "id": "vsfb_abc123", - "object": "vector_store.file_batch", - "created_at": 1699061776, - "vector_store_id": "vs_abc123", - "status": "in_progress", - "file_counts": { - "in_progress": 1, - "completed": 1, - "failed": 0, - "cancelled": 0, - "total": 0, - } - } - /vector_stores/{vector_store_id}/file_batches/{batch_id}: - get: - operationId: getVectorStoreFileBatch - tags: - - Vector stores - summary: Retrieves a vector store file batch. - parameters: - - in: path - name: vector_store_id - required: true - schema: - type: string - example: vs_abc123 - description: The ID of the vector store that the file batch belongs to. - - in: path - name: batch_id - required: true - schema: - type: string - example: vsfb_abc123 - description: The ID of the file batch being retrieved. - responses: - "200": - description: OK - content: - application/json: - schema: - $ref: "#/components/schemas/VectorStoreFileBatchObject" - x-oaiMeta: - name: Retrieve vector store file batch - group: vector_stores - beta: true - returns: The [vector store file - batch](/docs/api-reference/vector-stores-file-batches/batch-object) - object. - examples: - request: - curl: > - curl - https://api.openai.com/v1/vector_stores/vs_abc123/files_batches/vsfb_abc123 - \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "Content-Type: application/json" \ - -H "OpenAI-Beta: assistants=v2" - python: > - from openai import OpenAI + We emit events whenever a new object is created, transitions to a new + state, or is being - client = OpenAI() + streamed in parts (deltas). For example, we emit `thread.run.created` + when a new run + is created, `thread.run.completed` when a run completes, and so on. When + an Assistant chooses - vector_store_file_batch = - client.beta.vector_stores.file_batches.retrieve( - vector_store_id="vs_abc123", - batch_id="vsfb_abc123" - ) + to create a message during a run, we emit a `thread.message.created + event`, a - print(vector_store_file_batch) - node.js: > - import OpenAI from "openai"; + `thread.message.in_progress` event, many `thread.message.delta` events, + and finally a - const openai = new OpenAI(); + `thread.message.completed` event. - async function main() { - const vectorStoreFileBatch = await openai.beta.vectorStores.fileBatches.retrieve( - "vs_abc123", - "vsfb_abc123" - ); - console.log(vectorStoreFileBatch); - } + We may add additional events over time, so we recommend handling unknown + events gracefully + in your code. See the [Assistants API + quickstart](/docs/assistants/overview) to learn how to - main(); - response: | - { - "id": "vsfb_abc123", - "object": "vector_store.file_batch", - "created_at": 1699061776, - "vector_store_id": "vs_abc123", - "status": "in_progress", - "file_counts": { - "in_progress": 1, - "completed": 1, - "failed": 0, - "cancelled": 0, - "total": 0, - } - } - /vector_stores/{vector_store_id}/file_batches/{batch_id}/cancel: - post: - operationId: cancelVectorStoreFileBatch - tags: - - Vector stores - summary: Cancel a vector store file batch. This attempts to cancel the - processing of files in this batch as soon as possible. - parameters: - - in: path - name: vector_store_id - required: true - schema: - type: string - description: The ID of the vector store that the file batch belongs to. - - in: path - name: batch_id - required: true - schema: - type: string - description: The ID of the file batch to cancel. - responses: - "200": - description: OK - content: - application/json: - schema: - $ref: "#/components/schemas/VectorStoreFileBatchObject" + integrate the Assistants API with streaming. + oneOf: + - $ref: "#/components/schemas/ThreadStreamEvent" + - $ref: "#/components/schemas/RunStreamEvent" + - $ref: "#/components/schemas/RunStepStreamEvent" + - $ref: "#/components/schemas/MessageStreamEvent" + - $ref: "#/components/schemas/ErrorEvent" + - $ref: "#/components/schemas/DoneEvent" x-oaiMeta: - name: Cancel vector store file batch - group: vector_stores + name: Assistant stream events beta: true - returns: The modified vector store file batch object. - examples: - request: - curl: > - curl - https://api.openai.com/v1/vector_stores/vs_abc123/files_batches/vsfb_abc123/cancel - \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "Content-Type: application/json" \ - -H "OpenAI-Beta: assistants=v2" \ - -X POST - python: > - from openai import OpenAI + AssistantSupportedModels: + type: string + enum: + - gpt-4.1 + - gpt-4.1-mini + - gpt-4.1-nano + - gpt-4.1-2025-04-14 + - gpt-4.1-mini-2025-04-14 + - gpt-4.1-nano-2025-04-14 + - o3-mini + - o3-mini-2025-01-31 + - o1 + - o1-2024-12-17 + - gpt-4o + - gpt-4o-2024-11-20 + - gpt-4o-2024-08-06 + - gpt-4o-2024-05-13 + - gpt-4o-mini + - gpt-4o-mini-2024-07-18 + - gpt-4.5-preview + - gpt-4.5-preview-2025-02-27 + - gpt-4-turbo + - gpt-4-turbo-2024-04-09 + - gpt-4-0125-preview + - gpt-4-turbo-preview + - gpt-4-1106-preview + - gpt-4-vision-preview + - gpt-4 + - gpt-4-0314 + - gpt-4-0613 + - gpt-4-32k + - gpt-4-32k-0314 + - gpt-4-32k-0613 + - gpt-3.5-turbo + - gpt-3.5-turbo-16k + - gpt-3.5-turbo-0613 + - gpt-3.5-turbo-1106 + - gpt-3.5-turbo-0125 + - gpt-3.5-turbo-16k-0613 + AssistantToolsCode: + type: object + title: Code interpreter tool + properties: + type: + type: string + description: "The type of tool being defined: `code_interpreter`" + enum: + - code_interpreter + x-stainless-const: true + required: + - type + AssistantToolsFileSearch: + type: object + title: FileSearch tool + properties: + type: + type: string + description: "The type of tool being defined: `file_search`" + enum: + - file_search + x-stainless-const: true + file_search: + type: object + description: Overrides for the file search tool. + properties: + max_num_results: + type: integer + minimum: 1 + maximum: 50 + description: | + The maximum number of results the file search tool should output. The default is 20 for `gpt-4*` models and 5 for `gpt-3.5-turbo`. This number should be between 1 and 50 inclusive. - client = OpenAI() + Note that the file search tool may output fewer than `max_num_results` results. See the [file search tool documentation](/docs/assistants/tools/file-search#customizing-file-search-settings) for more information. + ranking_options: + $ref: "#/components/schemas/FileSearchRankingOptions" + required: + - type + AssistantToolsFileSearchTypeOnly: + type: object + title: FileSearch tool + properties: + type: + type: string + description: "The type of tool being defined: `file_search`" + enum: + - file_search + x-stainless-const: true + required: + - type + AssistantToolsFunction: + type: object + title: Function tool + properties: + type: + type: string + description: "The type of tool being defined: `function`" + enum: + - function + x-stainless-const: true + function: + $ref: "#/components/schemas/FunctionObject" + required: + - type + - function + AssistantsApiResponseFormatOption: + description: > + Specifies the format that the model must output. Compatible with + [GPT-4o](/docs/models#gpt-4o), [GPT-4 + Turbo](/docs/models#gpt-4-turbo-and-gpt-4), and all GPT-3.5 Turbo models + since `gpt-3.5-turbo-1106`. - deleted_vector_store_file_batch = - client.beta.vector_stores.file_batches.cancel( - vector_store_id="vs_abc123", - file_batch_id="vsfb_abc123" - ) + Setting to `{ "type": "json_schema", "json_schema": {...} }` enables + Structured Outputs which ensures the model will match your supplied JSON + schema. Learn more in the [Structured Outputs + guide](/docs/guides/structured-outputs). - print(deleted_vector_store_file_batch) - node.js: > - import OpenAI from "openai"; - const openai = new OpenAI(); + Setting to `{ "type": "json_object" }` enables JSON mode, which ensures + the message the model generates is valid JSON. - async function main() { - const deletedVectorStoreFileBatch = await openai.vector_stores.fileBatches.cancel( - "vs_abc123", - "vsfb_abc123" - ); - console.log(deletedVectorStoreFileBatch); - } + **Important:** when using JSON mode, you **must** also instruct the + model to produce JSON yourself via a system or user message. Without + this, the model may generate an unending stream of whitespace until the + generation reaches the token limit, resulting in a long-running and + seemingly "stuck" request. Also note that the message content may be + partially cut off if `finish_reason="length"`, which indicates the + generation exceeded `max_tokens` or the conversation exceeded the max + context length. + oneOf: + - type: string + description: | + `auto` is the default value + enum: + - auto + x-stainless-const: true + - $ref: "#/components/schemas/ResponseFormatText" + - $ref: "#/components/schemas/ResponseFormatJsonObject" + - $ref: "#/components/schemas/ResponseFormatJsonSchema" + AssistantsApiToolChoiceOption: + description: > + Controls which (if any) tool is called by the model. + + `none` means the model will not call any tools and instead generates a + message. + `auto` is the default value and means the model can pick between + generating a message or calling one or more tools. - main(); - response: | - { - "id": "vsfb_abc123", - "object": "vector_store.file_batch", - "created_at": 1699061776, - "vector_store_id": "vs_abc123", - "status": "cancelling", - "file_counts": { - "in_progress": 12, - "completed": 3, - "failed": 0, - "cancelled": 0, - "total": 15, + `required` means the model must call one or more tools before responding + to the user. + + Specifying a particular tool like `{"type": "file_search"}` or `{"type": + "function", "function": {"name": "my_function"}}` forces the model to + call that tool. + oneOf: + - type: string + description: > + `none` means the model will not call any tools and instead generates + a message. `auto` means the model can pick between generating a + message or calling one or more tools. `required` means the model + must call one or more tools before responding to the user. + enum: + - none + - auto + - required + - $ref: "#/components/schemas/AssistantsNamedToolChoice" + AssistantsNamedToolChoice: + type: object + description: Specifies a tool the model should use. Use to force the model to + call a specific tool. + properties: + type: + type: string + enum: + - function + - code_interpreter + - file_search + description: The type of the tool. If type is `function`, the function name must + be set + function: + type: object + properties: + name: + type: string + description: The name of the function to call. + required: + - name + required: + - type + AudioResponseFormat: + description: > + The format of the output, in one of these options: `json`, `text`, + `srt`, `verbose_json`, or `vtt`. For `gpt-4o-transcribe` and + `gpt-4o-mini-transcribe`, the only supported format is `json`. + type: string + enum: + - json + - text + - srt + - verbose_json + - vtt + default: json + AuditLog: + type: object + description: A log of a user action or configuration change within this organization. + properties: + id: + type: string + description: The ID of this log. + type: + $ref: "#/components/schemas/AuditLogEventType" + effective_at: + type: integer + description: The Unix timestamp (in seconds) of the event. + project: + type: object + description: The project that the action was scoped to. Absent for actions not + scoped to projects. + properties: + id: + type: string + description: The project ID. + name: + type: string + description: The project title. + actor: + $ref: "#/components/schemas/AuditLogActor" + api_key.created: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The tracking ID of the API key. + data: + type: object + description: The payload used to create the API key. + properties: + scopes: + type: array + items: + type: string + description: A list of scopes allowed for the API key, e.g. + `["api.model.request"]` + api_key.updated: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The tracking ID of the API key. + changes_requested: + type: object + description: The payload used to update the API key. + properties: + scopes: + type: array + items: + type: string + description: A list of scopes allowed for the API key, e.g. + `["api.model.request"]` + api_key.deleted: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The tracking ID of the API key. + checkpoint_permission.created: + type: object + description: The project and fine-tuned model checkpoint that the checkpoint + permission was created for. + properties: + id: + type: string + description: The ID of the checkpoint permission. + data: + type: object + description: The payload used to create the checkpoint permission. + properties: + project_id: + type: string + description: The ID of the project that the checkpoint permission was created + for. + fine_tuned_model_checkpoint: + type: string + description: The ID of the fine-tuned model checkpoint. + checkpoint_permission.deleted: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The ID of the checkpoint permission. + invite.sent: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The ID of the invite. + data: + type: object + description: The payload used to create the invite. + properties: + email: + type: string + description: The email invited to the organization. + role: + type: string + description: The role the email was invited to be. Is either `owner` or + `member`. + invite.accepted: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The ID of the invite. + invite.deleted: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The ID of the invite. + login.failed: + type: object + description: The details for events with this `type`. + properties: + error_code: + type: string + description: The error code of the failure. + error_message: + type: string + description: The error message of the failure. + logout.failed: + type: object + description: The details for events with this `type`. + properties: + error_code: + type: string + description: The error code of the failure. + error_message: + type: string + description: The error message of the failure. + organization.updated: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The organization ID. + changes_requested: + type: object + description: The payload used to update the organization settings. + properties: + title: + type: string + description: The organization title. + description: + type: string + description: The organization description. + name: + type: string + description: The organization name. + threads_ui_visibility: + type: string + description: Visibility of the threads page which shows messages created with + the Assistants API and Playground. One of `ANY_ROLE`, + `OWNERS`, or `NONE`. + usage_dashboard_visibility: + type: string + description: Visibility of the usage dashboard which shows activity and costs + for your organization. One of `ANY_ROLE` or `OWNERS`. + api_call_logging: + type: string + description: How your organization logs data from supported API calls. One of + `disabled`, `enabled_per_call`, `enabled_for_all_projects`, + or `enabled_for_selected_projects` + api_call_logging_project_ids: + type: string + description: The list of project ids if api_call_logging is set to + `enabled_for_selected_projects` + project.created: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The project ID. + data: + type: object + description: The payload used to create the project. + properties: + name: + type: string + description: The project name. + title: + type: string + description: The title of the project as seen on the dashboard. + project.updated: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The project ID. + changes_requested: + type: object + description: The payload used to update the project. + properties: + title: + type: string + description: The title of the project as seen on the dashboard. + project.archived: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The project ID. + rate_limit.updated: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The rate limit ID + changes_requested: + type: object + description: The payload used to update the rate limits. + properties: + max_requests_per_1_minute: + type: integer + description: The maximum requests per minute. + max_tokens_per_1_minute: + type: integer + description: The maximum tokens per minute. + max_images_per_1_minute: + type: integer + description: The maximum images per minute. Only relevant for certain models. + max_audio_megabytes_per_1_minute: + type: integer + description: The maximum audio megabytes per minute. Only relevant for certain + models. + max_requests_per_1_day: + type: integer + description: The maximum requests per day. Only relevant for certain models. + batch_1_day_max_input_tokens: + type: integer + description: The maximum batch input tokens per day. Only relevant for certain + models. + rate_limit.deleted: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The rate limit ID + service_account.created: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The service account ID. + data: + type: object + description: The payload used to create the service account. + properties: + role: + type: string + description: The role of the service account. Is either `owner` or `member`. + service_account.updated: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The service account ID. + changes_requested: + type: object + description: The payload used to updated the service account. + properties: + role: + type: string + description: The role of the service account. Is either `owner` or `member`. + service_account.deleted: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The service account ID. + user.added: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The user ID. + data: + type: object + description: The payload used to add the user to the project. + properties: + role: + type: string + description: The role of the user. Is either `owner` or `member`. + user.updated: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The project ID. + changes_requested: + type: object + description: The payload used to update the user. + properties: + role: + type: string + description: The role of the user. Is either `owner` or `member`. + user.deleted: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The user ID. + certificate.created: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The certificate ID. + name: + type: string + description: The name of the certificate. + certificate.updated: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The certificate ID. + name: + type: string + description: The name of the certificate. + certificate.deleted: + type: object + description: The details for events with this `type`. + properties: + id: + type: string + description: The certificate ID. + name: + type: string + description: The name of the certificate. + certificate: + type: string + description: The certificate content in PEM format. + certificates.activated: + type: object + description: The details for events with this `type`. + properties: + certificates: + type: array + items: + type: object + properties: + id: + type: string + description: The certificate ID. + name: + type: string + description: The name of the certificate. + certificates.deactivated: + type: object + description: The details for events with this `type`. + properties: + certificates: + type: array + items: + type: object + properties: + id: + type: string + description: The certificate ID. + name: + type: string + description: The name of the certificate. + required: + - id + - type + - effective_at + - actor + x-oaiMeta: + name: The audit log object + example: > + { + "id": "req_xxx_20240101", + "type": "api_key.created", + "effective_at": 1720804090, + "actor": { + "type": "session", + "session": { + "user": { + "id": "user-xxx", + "email": "user@example.com" + }, + "ip_address": "127.0.0.1", + "user_agent": "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/91.0.4472.124 Safari/537.36" + } + }, + "api_key.created": { + "id": "key_xxxx", + "data": { + "scopes": ["resource.operation"] + } } - } - /vector_stores/{vector_store_id}/file_batches/{batch_id}/files: - get: - operationId: listFilesInVectorStoreBatch - tags: - - Vector stores - summary: Returns a list of vector store files in a batch. - parameters: - - name: vector_store_id - in: path - description: The ID of the vector store that the files belong to. - required: true - schema: - type: string - - name: batch_id - in: path - description: The ID of the file batch that the files belong to. - required: true - schema: - type: string - - name: limit - in: query - description: > - A limit on the number of objects to be returned. Limit can range - between 1 and 100, and the default is 20. - required: false - schema: - type: integer - default: 20 - - name: order - in: query - description: > - Sort order by the `created_at` timestamp of the objects. `asc` for - ascending order and `desc` for descending order. - schema: - type: string - default: desc - enum: - - asc - - desc - - name: after - in: query - description: > - A cursor for use in pagination. `after` is an object ID that defines - your place in the list. For instance, if you make a list request and - receive 100 objects, ending with obj_foo, your subsequent call can - include after=obj_foo in order to fetch the next page of the list. - schema: - type: string - - name: before - in: query - description: > - A cursor for use in pagination. `before` is an object ID that - defines your place in the list. For instance, if you make a list - request and receive 100 objects, starting with obj_foo, your - subsequent call can include before=obj_foo in order to fetch the - previous page of the list. - schema: - type: string - - name: filter - in: query - description: Filter by file status. One of `in_progress`, `completed`, `failed`, - `cancelled`. - schema: - type: string - enum: - - in_progress - - completed - - failed - - cancelled - responses: - "200": - description: OK - content: - application/json: - schema: - $ref: "#/components/schemas/ListVectorStoreFilesResponse" + } + AuditLogActor: + type: object + description: The actor who performed the audit logged action. + properties: + type: + type: string + description: The type of actor. Is either `session` or `api_key`. + enum: + - session + - api_key + session: + $ref: "#/components/schemas/AuditLogActorSession" + api_key: + $ref: "#/components/schemas/AuditLogActorApiKey" + AuditLogActorApiKey: + type: object + description: The API Key used to perform the audit logged action. + properties: + id: + type: string + description: The tracking id of the API key. + type: + type: string + description: The type of API key. Can be either `user` or `service_account`. + enum: + - user + - service_account + user: + $ref: "#/components/schemas/AuditLogActorUser" + service_account: + $ref: "#/components/schemas/AuditLogActorServiceAccount" + AuditLogActorServiceAccount: + type: object + description: The service account that performed the audit logged action. + properties: + id: + type: string + description: The service account id. + AuditLogActorSession: + type: object + description: The session in which the audit logged action was performed. + properties: + user: + $ref: "#/components/schemas/AuditLogActorUser" + ip_address: + type: string + description: The IP address from which the action was performed. + AuditLogActorUser: + type: object + description: The user who performed the audit logged action. + properties: + id: + type: string + description: The user id. + email: + type: string + description: The user email. + AuditLogEventType: + type: string + description: The event type. + enum: + - api_key.created + - api_key.updated + - api_key.deleted + - checkpoint_permission.created + - checkpoint_permission.deleted + - invite.sent + - invite.accepted + - invite.deleted + - login.succeeded + - login.failed + - logout.succeeded + - logout.failed + - organization.updated + - project.created + - project.updated + - project.archived + - service_account.created + - service_account.updated + - service_account.deleted + - rate_limit.updated + - rate_limit.deleted + - user.added + - user.updated + - user.deleted + AutoChunkingStrategyRequestParam: + type: object + title: Auto Chunking Strategy + description: The default strategy. This strategy currently uses a + `max_chunk_size_tokens` of `800` and `chunk_overlap_tokens` of `400`. + additionalProperties: false + properties: + type: + type: string + description: Always `auto`. + enum: + - auto + x-stainless-const: true + required: + - type + Batch: + type: object + properties: + id: + type: string + object: + type: string + enum: + - batch + description: The object type, which is always `batch`. + x-stainless-const: true + endpoint: + type: string + description: The OpenAI API endpoint used by the batch. + errors: + type: object + properties: + object: + type: string + description: The object type, which is always `list`. + data: + type: array + items: + type: object + properties: + code: + type: string + description: An error code identifying the error type. + message: + type: string + description: A human-readable message providing more details about the error. + param: + type: string + description: The name of the parameter that caused the error, if applicable. + nullable: true + line: + type: integer + description: The line number of the input file where the error occurred, if + applicable. + nullable: true + input_file_id: + type: string + description: The ID of the input file for the batch. + completion_window: + type: string + description: The time frame within which the batch should be processed. + status: + type: string + description: The current status of the batch. + enum: + - validating + - failed + - in_progress + - finalizing + - completed + - expired + - cancelling + - cancelled + output_file_id: + type: string + description: The ID of the file containing the outputs of successfully executed + requests. + error_file_id: + type: string + description: The ID of the file containing the outputs of requests with errors. + created_at: + type: integer + description: The Unix timestamp (in seconds) for when the batch was created. + in_progress_at: + type: integer + description: The Unix timestamp (in seconds) for when the batch started + processing. + expires_at: + type: integer + description: The Unix timestamp (in seconds) for when the batch will expire. + finalizing_at: + type: integer + description: The Unix timestamp (in seconds) for when the batch started + finalizing. + completed_at: + type: integer + description: The Unix timestamp (in seconds) for when the batch was completed. + failed_at: + type: integer + description: The Unix timestamp (in seconds) for when the batch failed. + expired_at: + type: integer + description: The Unix timestamp (in seconds) for when the batch expired. + cancelling_at: + type: integer + description: The Unix timestamp (in seconds) for when the batch started + cancelling. + cancelled_at: + type: integer + description: The Unix timestamp (in seconds) for when the batch was cancelled. + request_counts: + type: object + properties: + total: + type: integer + description: Total number of requests in the batch. + completed: + type: integer + description: Number of requests that have been completed successfully. + failed: + type: integer + description: Number of requests that have failed. + required: + - total + - completed + - failed + description: The request counts for different statuses within the batch. + metadata: + $ref: "#/components/schemas/Metadata" + required: + - id + - object + - endpoint + - input_file_id + - completion_window + - status + - created_at x-oaiMeta: - name: List vector store files in a batch - group: vector_stores - beta: true - returns: A list of [vector store - file](/docs/api-reference/vector-stores-files/file-object) objects. - examples: - request: - curl: > - curl - https://api.openai.com/v1/vector_stores/vs_abc123/files_batches/vsfb_abc123/files - \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "Content-Type: application/json" \ - -H "OpenAI-Beta: assistants=v2" - python: > - from openai import OpenAI - - client = OpenAI() - - - vector_store_files = - client.beta.vector_stores.file_batches.list_files( - vector_store_id="vs_abc123", - batch_id="vsfb_abc123" - ) - - print(vector_store_files) - node.js: > - import OpenAI from "openai"; - - const openai = new OpenAI(); - - - async function main() { - const vectorStoreFiles = await openai.beta.vectorStores.fileBatches.listFiles( - "vs_abc123", - "vsfb_abc123" - ); - console.log(vectorStoreFiles); - } - - - main(); - response: | - { - "object": "list", - "data": [ - { - "id": "file-abc123", - "object": "vector_store.file", - "created_at": 1699061776, - "vector_store_id": "vs_abc123" - }, - { - "id": "file-abc456", - "object": "vector_store.file", - "created_at": 1699061776, - "vector_store_id": "vs_abc123" - } - ], - "first_id": "file-abc123", - "last_id": "file-abc456", - "has_more": false + name: The batch object + example: | + { + "id": "batch_abc123", + "object": "batch", + "endpoint": "/v1/completions", + "errors": null, + "input_file_id": "file-abc123", + "completion_window": "24h", + "status": "completed", + "output_file_id": "file-cvaTdG", + "error_file_id": "file-HOWS94", + "created_at": 1711471533, + "in_progress_at": 1711471538, + "expires_at": 1711557933, + "finalizing_at": 1711493133, + "completed_at": 1711493163, + "failed_at": null, + "expired_at": null, + "cancelling_at": null, + "cancelled_at": null, + "request_counts": { + "total": 100, + "completed": 95, + "failed": 5 + }, + "metadata": { + "customer_id": "user_123456789", + "batch_description": "Nightly eval job", } - /vector_stores/{vector_store_id}/files: - get: - operationId: listVectorStoreFiles - tags: - - Vector stores - summary: Returns a list of vector store files. - parameters: - - name: vector_store_id - in: path - description: The ID of the vector store that the files belong to. - required: true - schema: - type: string - - name: limit - in: query - description: > - A limit on the number of objects to be returned. Limit can range - between 1 and 100, and the default is 20. - required: false - schema: - type: integer - default: 20 - - name: order - in: query - description: > - Sort order by the `created_at` timestamp of the objects. `asc` for - ascending order and `desc` for descending order. - schema: - type: string - default: desc - enum: - - asc - - desc - - name: after - in: query - description: > - A cursor for use in pagination. `after` is an object ID that defines - your place in the list. For instance, if you make a list request and - receive 100 objects, ending with obj_foo, your subsequent call can - include after=obj_foo in order to fetch the next page of the list. - schema: - type: string - - name: before - in: query - description: > - A cursor for use in pagination. `before` is an object ID that - defines your place in the list. For instance, if you make a list - request and receive 100 objects, starting with obj_foo, your - subsequent call can include before=obj_foo in order to fetch the - previous page of the list. - schema: - type: string - - name: filter - in: query - description: Filter by file status. One of `in_progress`, `completed`, `failed`, - `cancelled`. - schema: - type: string - enum: - - in_progress - - completed - - failed - - cancelled - responses: - "200": - description: OK - content: - application/json: - schema: - $ref: "#/components/schemas/ListVectorStoreFilesResponse" + } + BatchRequestInput: + type: object + description: The per-line object of the batch input file + properties: + custom_id: + type: string + description: A developer-provided per-request id that will be used to match + outputs to inputs. Must be unique for each request in a batch. + method: + type: string + enum: + - POST + description: The HTTP method to be used for the request. Currently only `POST` + is supported. + x-stainless-const: true + url: + type: string + description: The OpenAI API relative URL to be used for the request. Currently + `/v1/chat/completions`, `/v1/embeddings`, and `/v1/completions` are + supported. + x-oaiMeta: + name: The request input object + example: > + {"custom_id": "request-1", "method": "POST", "url": + "/v1/chat/completions", "body": {"model": "gpt-4o-mini", "messages": + [{"role": "system", "content": "You are a helpful assistant."}, + {"role": "user", "content": "What is 2+2?"}]}} + BatchRequestOutput: + type: object + description: The per-line object of the batch output and error files + properties: + id: + type: string + custom_id: + type: string + description: A developer-provided per-request id that will be used to match + outputs to inputs. + response: + type: object + nullable: true + properties: + status_code: + type: integer + description: The HTTP status code of the response + request_id: + type: string + description: An unique identifier for the OpenAI API request. Please include + this request ID when contacting support. + body: + type: object + x-oaiTypeLabel: map + description: The JSON body of the response + error: + type: object + nullable: true + description: For requests that failed with a non-HTTP error, this will contain + more information on the cause of the failure. + properties: + code: + type: string + description: A machine-readable error code. + message: + type: string + description: A human-readable error message. x-oaiMeta: - name: List vector store files - group: vector_stores - beta: true - returns: A list of [vector store - file](/docs/api-reference/vector-stores-files/file-object) objects. - examples: - request: - curl: | - curl https://api.openai.com/v1/vector_stores/vs_abc123/files \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "Content-Type: application/json" \ - -H "OpenAI-Beta: assistants=v2" - python: | - from openai import OpenAI - client = OpenAI() - - vector_store_files = client.beta.vector_stores.files.list( - vector_store_id="vs_abc123" - ) - print(vector_store_files) - node.js: > - import OpenAI from "openai"; - - const openai = new OpenAI(); + name: The request output object + example: > + {"id": "batch_req_wnaDys", "custom_id": "request-2", "response": + {"status_code": 200, "request_id": "req_c187b3", "body": {"id": + "chatcmpl-9758Iw", "object": "chat.completion", "created": 1711475054, + "model": "gpt-4o-mini", "choices": [{"index": 0, "message": {"role": + "assistant", "content": "2 + 2 equals 4."}, "finish_reason": "stop"}], + "usage": {"prompt_tokens": 24, "completion_tokens": 15, + "total_tokens": 39}, "system_fingerprint": null}}, "error": null} + Certificate: + type: object + description: Represents an individual `certificate` uploaded to the organization. + properties: + object: + type: string + enum: + - certificate + - organization.certificate + - organization.project.certificate + description: > + The object type. - async function main() { - const vectorStoreFiles = await openai.beta.vectorStores.files.list( - "vs_abc123" - ); - console.log(vectorStoreFiles); - } + - If creating, updating, or getting a specific certificate, the + object type is `certificate`. + - If listing, activating, or deactivating certificates for the + organization, the object type is `organization.certificate`. - main(); - response: | - { - "object": "list", - "data": [ - { - "id": "file-abc123", - "object": "vector_store.file", - "created_at": 1699061776, - "vector_store_id": "vs_abc123" - }, - { - "id": "file-abc456", - "object": "vector_store.file", - "created_at": 1699061776, - "vector_store_id": "vs_abc123" - } - ], - "first_id": "file-abc123", - "last_id": "file-abc456", - "has_more": false + - If listing, activating, or deactivating certificates for a + project, the object type is `organization.project.certificate`. + x-stainless-const: true + id: + type: string + description: The identifier, which can be referenced in API endpoints + name: + type: string + description: The name of the certificate. + created_at: + type: integer + description: The Unix timestamp (in seconds) of when the certificate was uploaded. + certificate_details: + type: object + properties: + valid_at: + type: integer + description: The Unix timestamp (in seconds) of when the certificate becomes + valid. + expires_at: + type: integer + description: The Unix timestamp (in seconds) of when the certificate expires. + content: + type: string + description: The content of the certificate in PEM format. + active: + type: boolean + description: Whether the certificate is currently active at the specified scope. + Not returned when getting details for a specific certificate. + required: + - object + - id + - name + - created_at + - certificate_details + x-oaiMeta: + name: The certificate object + example: > + { + "object": "certificate", + "id": "cert_abc", + "name": "My Certificate", + "created_at": 1234567, + "certificate_details": { + "valid_at": 1234567, + "expires_at": 12345678, + "content": "-----BEGIN CERTIFICATE----- MIIGAjCCA...6znFlOW+ -----END CERTIFICATE-----" } - post: - operationId: createVectorStoreFile - tags: - - Vector stores - summary: Create a vector store file by attaching a - [File](/docs/api-reference/files) to a [vector - store](/docs/api-reference/vector-stores/object). - parameters: - - in: path - name: vector_store_id - required: true - schema: - type: string - example: vs_abc123 + } + ChatCompletionDeleted: + type: object + properties: + object: + type: string + description: The type of object being deleted. + enum: + - chat.completion.deleted + x-stainless-const: true + id: + type: string + description: The ID of the chat completion that was deleted. + deleted: + type: boolean + description: Whether the chat completion was deleted. + required: + - object + - id + - deleted + ChatCompletionFunctionCallOption: + type: object + description: > + Specifying a particular function via `{"name": "my_function"}` forces + the model to call that function. + properties: + name: + type: string + description: The name of the function to call. + required: + - name + ChatCompletionFunctions: + type: object + deprecated: true + properties: + description: + type: string + description: A description of what the function does, used by the model to + choose when and how to call the function. + name: + type: string + description: The name of the function to be called. Must be a-z, A-Z, 0-9, or + contain underscores and dashes, with a maximum length of 64. + parameters: + $ref: "#/components/schemas/FunctionParameters" + required: + - name + ChatCompletionList: + type: object + title: ChatCompletionList + description: | + An object representing a list of Chat Completions. + properties: + object: + type: string + enum: + - list + default: list description: | - The ID of the vector store for which to create a File. - requestBody: - required: true - content: - application/json: - schema: - $ref: "#/components/schemas/CreateVectorStoreFileRequest" - responses: - "200": - description: OK - content: - application/json: - schema: - $ref: "#/components/schemas/VectorStoreFileObject" + The type of this object. It is always set to "list". + x-stainless-const: true + data: + type: array + description: | + An array of chat completion objects. + items: + $ref: "#/components/schemas/CreateChatCompletionResponse" + first_id: + type: string + description: The identifier of the first chat completion in the data array. + last_id: + type: string + description: The identifier of the last chat completion in the data array. + has_more: + type: boolean + description: Indicates whether there are more Chat Completions available. + required: + - object + - data + - first_id + - last_id + - has_more x-oaiMeta: - name: Create vector store file - group: vector_stores - beta: true - returns: A [vector store - file](/docs/api-reference/vector-stores-files/file-object) object. - examples: - request: - curl: | - curl https://api.openai.com/v1/vector_stores/vs_abc123/files \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "Content-Type: application/json" \ - -H "OpenAI-Beta: assistants=v2" \ - -d '{ - "file_id": "file-abc123" - }' - python: | - from openai import OpenAI - client = OpenAI() - - vector_store_file = client.beta.vector_stores.files.create( - vector_store_id="vs_abc123", - file_id="file-abc123" - ) - print(vector_store_file) - node.js: > - import OpenAI from "openai"; - - const openai = new OpenAI(); - - - async function main() { - const myVectorStoreFile = await openai.beta.vectorStores.files.create( - "vs_abc123", + name: The chat completion list object + group: chat + example: > + { + "object": "list", + "data": [ + { + "object": "chat.completion", + "id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2", + "model": "gpt-4o-2024-08-06", + "created": 1738960610, + "request_id": "req_ded8ab984ec4bf840f37566c1011c417", + "tool_choice": null, + "usage": { + "total_tokens": 31, + "completion_tokens": 18, + "prompt_tokens": 13 + }, + "seed": 4944116822809979520, + "top_p": 1.0, + "temperature": 1.0, + "presence_penalty": 0.0, + "frequency_penalty": 0.0, + "system_fingerprint": "fp_50cad350e4", + "input_user": null, + "service_tier": "default", + "tools": null, + "metadata": {}, + "choices": [ { - file_id: "file-abc123" + "index": 0, + "message": { + "content": "Mind of circuits hum, \nLearning patterns in silence— \nFuture's quiet spark.", + "role": "assistant", + "tool_calls": null, + "function_call": null + }, + "finish_reason": "stop", + "logprobs": null } - ); - console.log(myVectorStoreFile); + ], + "response_format": null } - - - main(); - response: | - { - "id": "file-abc123", - "object": "vector_store.file", - "created_at": 1699061776, - "usage_bytes": 1234, - "vector_store_id": "vs_abcd", - "status": "completed", - "last_error": null - } - /vector_stores/{vector_store_id}/files/{file_id}: - get: - operationId: getVectorStoreFile - tags: - - Vector stores - summary: Retrieves a vector store file. - parameters: - - in: path - name: vector_store_id - required: true - schema: - type: string - example: vs_abc123 - description: The ID of the vector store that the file belongs to. - - in: path - name: file_id - required: true - schema: - type: string - example: file-abc123 - description: The ID of the file being retrieved. - responses: - "200": - description: OK - content: - application/json: - schema: - $ref: "#/components/schemas/VectorStoreFileObject" + ], + "first_id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2", + "last_id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2", + "has_more": false + } + ChatCompletionMessageList: + type: object + title: ChatCompletionMessageList + description: | + An object representing a list of chat completion messages. + properties: + object: + type: string + enum: + - list + default: list + description: | + The type of this object. It is always set to "list". + x-stainless-const: true + data: + type: array + description: | + An array of chat completion message objects. + items: + allOf: + - $ref: "#/components/schemas/ChatCompletionResponseMessage" + - type: object + required: + - id + properties: + id: + type: string + description: The identifier of the chat message. + first_id: + type: string + description: The identifier of the first chat message in the data array. + last_id: + type: string + description: The identifier of the last chat message in the data array. + has_more: + type: boolean + description: Indicates whether there are more chat messages available. + required: + - object + - data + - first_id + - last_id + - has_more x-oaiMeta: - name: Retrieve vector store file - group: vector_stores - beta: true - returns: The [vector store - file](/docs/api-reference/vector-stores-files/file-object) object. - examples: - request: - curl: > - curl - https://api.openai.com/v1/vector_stores/vs_abc123/files/file-abc123 - \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "Content-Type: application/json" \ - -H "OpenAI-Beta: assistants=v2" - python: | - from openai import OpenAI - client = OpenAI() + name: The chat completion message list object + group: chat + example: | + { + "object": "list", + "data": [ + { + "id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2-0", + "role": "user", + "content": "write a haiku about ai", + "name": null, + "content_parts": null + } + ], + "first_id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2-0", + "last_id": "chatcmpl-AyPNinnUqUDYo9SAdA52NobMflmj2-0", + "has_more": false + } + ChatCompletionMessageToolCall: + type: object + properties: + id: + type: string + description: The ID of the tool call. + type: + type: string + enum: + - function + description: The type of the tool. Currently, only `function` is supported. + x-stainless-const: true + function: + type: object + description: The function that the model called. + properties: + name: + type: string + description: The name of the function to call. + arguments: + type: string + description: The arguments to call the function with, as generated by the model + in JSON format. Note that the model does not always generate + valid JSON, and may hallucinate parameters not defined by your + function schema. Validate the arguments in your code before + calling your function. + required: + - name + - arguments + required: + - id + - type + - function + ChatCompletionMessageToolCallChunk: + type: object + properties: + index: + type: integer + id: + type: string + description: The ID of the tool call. + type: + type: string + enum: + - function + description: The type of the tool. Currently, only `function` is supported. + x-stainless-const: true + function: + type: object + properties: + name: + type: string + description: The name of the function to call. + arguments: + type: string + description: The arguments to call the function with, as generated by the model + in JSON format. Note that the model does not always generate + valid JSON, and may hallucinate parameters not defined by your + function schema. Validate the arguments in your code before + calling your function. + required: + - index + ChatCompletionMessageToolCalls: + type: array + description: The tool calls generated by the model, such as function calls. + items: + $ref: "#/components/schemas/ChatCompletionMessageToolCall" + ChatCompletionModalities: + type: array + nullable: true + description: > + Output types that you would like the model to generate for this request. - vector_store_file = client.beta.vector_stores.files.retrieve( - vector_store_id="vs_abc123", - file_id="file-abc123" - ) - print(vector_store_file) - node.js: > - import OpenAI from "openai"; + Most models are capable of generating text, which is the default: - const openai = new OpenAI(); + `["text"]` - async function main() { - const vectorStoreFile = await openai.beta.vectorStores.files.retrieve( - "vs_abc123", - "file-abc123" - ); - console.log(vectorStoreFile); - } + The `gpt-4o-audio-preview` model can also be used to [generate + audio](/docs/guides/audio). To - main(); - response: | - { - "id": "file-abc123", - "object": "vector_store.file", - "created_at": 1699061776, - "vector_store_id": "vs_abcd", - "status": "completed", - "last_error": null - } - delete: - operationId: deleteVectorStoreFile - tags: - - Vector stores - summary: Delete a vector store file. This will remove the file from the vector - store but the file itself will not be deleted. To delete the file, use - the [delete file](/docs/api-reference/files/delete) endpoint. - parameters: - - in: path - name: vector_store_id - required: true - schema: - type: string - description: The ID of the vector store that the file belongs to. - - in: path - name: file_id - required: true - schema: - type: string - description: The ID of the file to delete. - responses: - "200": - description: OK - content: - application/json: - schema: - $ref: "#/components/schemas/DeleteVectorStoreFileResponse" - x-oaiMeta: - name: Delete vector store file - group: vector_stores - beta: true - returns: Deletion status - examples: - request: - curl: > - curl - https://api.openai.com/v1/vector_stores/vs_abc123/files/file-abc123 - \ - -H "Authorization: Bearer $OPENAI_API_KEY" \ - -H "Content-Type: application/json" \ - -H "OpenAI-Beta: assistants=v2" \ - -X DELETE - python: > - from openai import OpenAI + request that this model generate both text and audio responses, you can - client = OpenAI() + use: - deleted_vector_store_file = - client.beta.vector_stores.files.delete( - vector_store_id="vs_abc123", - file_id="file-abc123" - ) + `["text", "audio"]` + items: + type: string + enum: + - text + - audio + ChatCompletionNamedToolChoice: + type: object + description: Specifies a tool the model should use. Use to force the model to + call a specific function. + properties: + type: + type: string + enum: + - function + description: The type of the tool. Currently, only `function` is supported. + x-stainless-const: true + function: + type: object + properties: + name: + type: string + description: The name of the function to call. + required: + - name + required: + - type + - function + ChatCompletionRequestAssistantMessage: + type: object + title: Assistant message + description: | + Messages sent by the model in response to user messages. + properties: + content: + nullable: true + oneOf: + - type: string + description: The contents of the assistant message. + title: Text content + - type: array + description: An array of content parts with a defined type. Can be one or more + of type `text`, or exactly one of type `refusal`. + title: Array of content parts + items: + $ref: "#/components/schemas/ChatCompletionRequestAssistantMessageContentPart" + minItems: 1 + description: > + The contents of the assistant message. Required unless `tool_calls` + or `function_call` is specified. + refusal: + nullable: true + type: string + description: The refusal message by the assistant. + role: + type: string + enum: + - assistant + description: The role of the messages author, in this case `assistant`. + x-stainless-const: true + name: + type: string + description: An optional name for the participant. Provides the model + information to differentiate between participants of the same role. + audio: + type: object + nullable: true + description: | + Data about a previous audio response from the model. + [Learn more](/docs/guides/audio). + required: + - id + properties: + id: + type: string + description: | + Unique identifier for a previous audio response from the model. + tool_calls: + $ref: "#/components/schemas/ChatCompletionMessageToolCalls" + function_call: + type: object + deprecated: true + description: Deprecated and replaced by `tool_calls`. The name and arguments of + a function that should be called, as generated by the model. + nullable: true + properties: + arguments: + type: string + description: The arguments to call the function with, as generated by the model + in JSON format. Note that the model does not always generate + valid JSON, and may hallucinate parameters not defined by your + function schema. Validate the arguments in your code before + calling your function. + name: + type: string + description: The name of the function to call. + required: + - arguments + - name + required: + - role + ChatCompletionRequestAssistantMessageContentPart: + oneOf: + - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartText" + - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartRefusal" + ChatCompletionRequestDeveloperMessage: + type: object + title: Developer message + description: > + Developer-provided instructions that the model should follow, regardless + of - print(deleted_vector_store_file) - node.js: > - import OpenAI from "openai"; + messages sent by the user. With o1 models and newer, `developer` + messages - const openai = new OpenAI(); + replace the previous `system` messages. + properties: + content: + description: The contents of the developer message. + oneOf: + - type: string + description: The contents of the developer message. + title: Text content + - type: array + description: An array of content parts with a defined type. For developer + messages, only type `text` is supported. + title: Array of content parts + items: + $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartText" + minItems: 1 + role: + type: string + enum: + - developer + description: The role of the messages author, in this case `developer`. + x-stainless-const: true + name: + type: string + description: An optional name for the participant. Provides the model + information to differentiate between participants of the same role. + required: + - content + - role + ChatCompletionRequestFunctionMessage: + type: object + title: Function message + deprecated: true + properties: + role: + type: string + enum: + - function + description: The role of the messages author, in this case `function`. + x-stainless-const: true + content: + nullable: true + type: string + description: The contents of the function message. + name: + type: string + description: The name of the function to call. + required: + - role + - content + - name + ChatCompletionRequestMessage: + oneOf: + - $ref: "#/components/schemas/ChatCompletionRequestDeveloperMessage" + - $ref: "#/components/schemas/ChatCompletionRequestSystemMessage" + - $ref: "#/components/schemas/ChatCompletionRequestUserMessage" + - $ref: "#/components/schemas/ChatCompletionRequestAssistantMessage" + - $ref: "#/components/schemas/ChatCompletionRequestToolMessage" + - $ref: "#/components/schemas/ChatCompletionRequestFunctionMessage" + ChatCompletionRequestMessageContentPartAudio: + type: object + title: Audio content part + description: | + Learn about [audio inputs](/docs/guides/audio). + properties: + type: + type: string + enum: + - input_audio + description: The type of the content part. Always `input_audio`. + x-stainless-const: true + input_audio: + type: object + properties: + data: + type: string + description: Base64 encoded audio data. + format: + type: string + enum: + - wav + - mp3 + description: > + The format of the encoded audio data. Currently supports "wav" + and "mp3". + required: + - data + - format + required: + - type + - input_audio + ChatCompletionRequestMessageContentPartFile: + type: object + title: File content part + description: | + Learn about [file inputs](/docs/guides/text) for text generation. + properties: + type: + type: string + enum: + - file + description: The type of the content part. Always `file`. + x-stainless-const: true + file: + type: object + properties: + filename: + type: string + description: > + The name of the file, used when passing the file to the model as + a + string. + file_data: + type: string + description: > + The base64 encoded file data, used when passing the file to the + model - async function main() { - const deletedVectorStoreFile = await openai.beta.vectorStores.files.del( - "vs_abc123", - "file-abc123" - ); - console.log(deletedVectorStoreFile); - } + as a string. + file_id: + type: string + description: | + The ID of an uploaded file to use as input. + required: + - type + - file + ChatCompletionRequestMessageContentPartImage: + type: object + title: Image content part + description: | + Learn about [image inputs](/docs/guides/vision). + properties: + type: + type: string + enum: + - image_url + description: The type of the content part. + x-stainless-const: true + image_url: + type: object + properties: + url: + type: string + description: Either a URL of the image or the base64 encoded image data. + format: uri + detail: + type: string + description: Specifies the detail level of the image. Learn more in the [Vision + guide](/docs/guides/vision#low-or-high-fidelity-image-understanding). + enum: + - auto + - low + - high + default: auto + required: + - url + required: + - type + - image_url + ChatCompletionRequestMessageContentPartRefusal: + type: object + title: Refusal content part + properties: + type: + type: string + enum: + - refusal + description: The type of the content part. + x-stainless-const: true + refusal: + type: string + description: The refusal message generated by the model. + required: + - type + - refusal + ChatCompletionRequestMessageContentPartText: + type: object + title: Text content part + description: | + Learn about [text inputs](/docs/guides/text-generation). + properties: + type: + type: string + enum: + - text + description: The type of the content part. + x-stainless-const: true + text: + type: string + description: The text content. + required: + - type + - text + ChatCompletionRequestSystemMessage: + type: object + title: System message + description: > + Developer-provided instructions that the model should follow, regardless + of + messages sent by the user. With o1 models and newer, use `developer` + messages - main(); - response: | - { - id: "file-abc123", - object: "vector_store.file.deleted", - deleted: true - } -components: - schemas: - AddUploadPartRequest: - type: object - additionalProperties: false + for this purpose instead. properties: - data: - description: | - The chunk of bytes for this Part. + content: + description: The contents of the system message. + oneOf: + - type: string + description: The contents of the system message. + title: Text content + - type: array + description: An array of content parts with a defined type. For system messages, + only type `text` is supported. + title: Array of content parts + items: + $ref: "#/components/schemas/ChatCompletionRequestSystemMessageContentPart" + minItems: 1 + role: type: string - format: binary + enum: + - system + description: The role of the messages author, in this case `system`. + x-stainless-const: true + name: + type: string + description: An optional name for the participant. Provides the model + information to differentiate between participants of the same role. required: - - data - AssistantObject: + - content + - role + ChatCompletionRequestSystemMessageContentPart: + oneOf: + - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartText" + ChatCompletionRequestToolMessage: type: object - title: Assistant - description: Represents an `assistant` that can call the model and use tools. + title: Tool message properties: - id: - description: The identifier, which can be referenced in API endpoints. + role: type: string - object: - description: The object type, which is always `assistant`. + enum: + - tool + description: The role of the messages author, in this case `tool`. + x-stainless-const: true + content: + oneOf: + - type: string + description: The contents of the tool message. + title: Text content + - type: array + description: An array of content parts with a defined type. For tool messages, + only type `text` is supported. + title: Array of content parts + items: + $ref: "#/components/schemas/ChatCompletionRequestToolMessageContentPart" + minItems: 1 + description: The contents of the tool message. + tool_call_id: + type: string + description: Tool call that this message is responding to. + required: + - role + - content + - tool_call_id + ChatCompletionRequestToolMessageContentPart: + oneOf: + - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartText" + ChatCompletionRequestUserMessage: + type: object + title: User message + description: | + Messages sent by an end user, containing prompts or additional context + information. + properties: + content: + description: | + The contents of the user message. + oneOf: + - type: string + description: The text contents of the message. + title: Text content + - type: array + description: An array of content parts with a defined type. Supported options + differ based on the [model](/docs/models) being used to generate + the response. Can contain text, image, or audio inputs. + title: Array of content parts + items: + $ref: "#/components/schemas/ChatCompletionRequestUserMessageContentPart" + minItems: 1 + role: type: string enum: - - assistant - created_at: - description: The Unix timestamp (in seconds) for when the assistant was created. - type: integer + - user + description: The role of the messages author, in this case `user`. + x-stainless-const: true name: - description: | - The name of the assistant. The maximum length is 256 characters. type: string - maxLength: 256 - nullable: true - description: - description: > - The description of the assistant. The maximum length is 512 - characters. + description: An optional name for the participant. Provides the model + information to differentiate between participants of the same role. + required: + - content + - role + ChatCompletionRequestUserMessageContentPart: + oneOf: + - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartText" + - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartImage" + - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartAudio" + - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartFile" + ChatCompletionResponseMessage: + type: object + description: A chat completion message generated by the model. + properties: + content: type: string - maxLength: 512 + description: The contents of the message. nullable: true - model: - description: > - ID of the model to use. You can use the [List - models](/docs/api-reference/models/list) API to see all of your - available models, or see our [Model overview](/docs/models) for - descriptions of them. - type: string - instructions: - description: > - The system instructions that the assistant uses. The maximum length - is 256,000 characters. + refusal: type: string - maxLength: 256000 + description: The refusal message generated by the model. nullable: true - tools: - description: > - A list of tool enabled on the assistant. There can be a maximum of - 128 tools per assistant. Tools can be of types `code_interpreter`, - `file_search`, or `function`. - default: [] + tool_calls: + $ref: "#/components/schemas/ChatCompletionMessageToolCalls" + annotations: type: array - maxItems: 128 + description: | + Annotations for the message, when applicable, as when using the + [web search tool](/docs/guides/tools-web-search?api-mode=chat). items: - oneOf: - - $ref: "#/components/schemas/AssistantToolsCode" - - $ref: "#/components/schemas/AssistantToolsFileSearch" - - $ref: "#/components/schemas/AssistantToolsFunction" - x-oaiExpandable: true - tool_resources: - type: object - description: > - A set of resources that are used by the assistant's tools. The - resources are specific to the type of tool. For example, the - `code_interpreter` tool requires a list of file IDs, while the - `file_search` tool requires a list of vector store IDs. - properties: - code_interpreter: - type: object - properties: - file_ids: - type: array - description: > - A list of [file](/docs/api-reference/files) IDs made - available to the `code_interpreter`` tool. There can be a - maximum of 20 files associated with the tool. - default: [] - maxItems: 20 - items: + type: object + description: | + A URL citation when using web search. + required: + - type + - url_citation + properties: + type: + type: string + description: The type of the URL citation. Always `url_citation`. + enum: + - url_citation + x-stainless-const: true + url_citation: + type: object + description: A URL citation when using web search. + required: + - end_index + - start_index + - url + - title + properties: + end_index: + type: integer + description: The index of the last character of the URL citation in the message. + start_index: + type: integer + description: The index of the first character of the URL citation in the + message. + url: type: string - file_search: - type: object - properties: - vector_store_ids: - type: array - description: > - The ID of the [vector - store](/docs/api-reference/vector-stores/object) attached to - this assistant. There can be a maximum of 1 vector store - attached to the assistant. - maxItems: 1 - items: + description: The URL of the web resource. + title: type: string - nullable: true - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. + description: The title of the web resource. + role: + type: string + enum: + - assistant + description: The role of the author of this message. + x-stainless-const: true + function_call: + type: object + deprecated: true + description: Deprecated and replaced by `tool_calls`. The name and arguments of + a function that should be called, as generated by the model. + properties: + arguments: + type: string + description: The arguments to call the function with, as generated by the model + in JSON format. Note that the model does not always generate + valid JSON, and may hallucinate parameters not defined by your + function schema. Validate the arguments in your code before + calling your function. + name: + type: string + description: The name of the function to call. + required: + - name + - arguments + audio: type: object - x-oaiTypeLabel: map - nullable: true - temperature: - description: > - What sampling temperature to use, between 0 and 2. Higher values - like 0.8 will make the output more random, while lower values like - 0.2 will make it more focused and deterministic. - type: number - minimum: 0 - maximum: 2 - default: 1 - example: 1 - nullable: true - top_p: - type: number - minimum: 0 - maximum: 1 - default: 1 - example: 1 nullable: true description: > - An alternative to sampling with temperature, called nucleus - sampling, where the model considers the results of the tokens with - top_p probability mass. So 0.1 means only the tokens comprising the - top 10% probability mass are considered. + If the audio output modality is requested, this object contains data + + about the audio response from the model. [Learn + more](/docs/guides/audio). + required: + - id + - expires_at + - data + - transcript + properties: + id: + type: string + description: Unique identifier for this audio response. + expires_at: + type: integer + description: > + The Unix timestamp (in seconds) for when this audio response + will + no longer be accessible on the server for use in multi-turn - We generally recommend altering this or temperature but not both. - response_format: - $ref: "#/components/schemas/AssistantsApiResponseFormatOption" - nullable: true + conversations. + data: + type: string + description: | + Base64 encoded audio bytes generated by the model, in the format + specified in the request. + transcript: + type: string + description: Transcript of the audio generated by the model. required: - - id - - object - - created_at - - name - - description - - model - - instructions - - tools - - metadata - x-oaiMeta: - name: The assistant object - beta: true - example: > - { - "id": "asst_abc123", - "object": "assistant", - "created_at": 1698984975, - "name": "Math Tutor", - "description": null, - "model": "gpt-4o", - "instructions": "You are a personal math tutor. When asked a question, write and run Python code to answer the question.", - "tools": [ - { - "type": "code_interpreter" - } - ], - "metadata": {}, - "top_p": 1.0, - "temperature": 1.0, - "response_format": "auto" - } - AssistantStreamEvent: + - role + - content + - refusal + ChatCompletionRole: + type: string + description: The role of the author of a message + enum: + - developer + - system + - user + - assistant + - tool + - function + ChatCompletionStreamOptions: description: > - Represents an event emitted when streaming a Run. - - - Each event in a server-sent events stream has an `event` and `data` - property: - - - ``` - - event: thread.created + Options for streaming response. Only set this when you set `stream: + true`. + type: object + nullable: true + default: null + properties: + include_usage: + type: boolean + description: > + If set, an additional chunk will be streamed before the `data: + [DONE]` - data: {"id": "thread_123", "object": "thread", ...} + message. The `usage` field on this chunk shows the token usage + statistics - ``` + for the entire request, and the `choices` field will always be an + empty + array. - We emit events whenever a new object is created, transitions to a new - state, or is being - streamed in parts (deltas). For example, we emit `thread.run.created` - when a new run + All other chunks will also include a `usage` field, but with a null - is created, `thread.run.completed` when a run completes, and so on. When - an Assistant chooses + value. **NOTE:** If the stream is interrupted, you may not receive + the - to create a message during a run, we emit a `thread.message.created - event`, a + final usage chunk which contains the total token usage for the + request. + ChatCompletionStreamResponseDelta: + type: object + description: A chat completion delta generated by streamed model responses. + properties: + content: + type: string + description: The contents of the chunk message. + nullable: true + function_call: + deprecated: true + type: object + description: Deprecated and replaced by `tool_calls`. The name and arguments of + a function that should be called, as generated by the model. + properties: + arguments: + type: string + description: The arguments to call the function with, as generated by the model + in JSON format. Note that the model does not always generate + valid JSON, and may hallucinate parameters not defined by your + function schema. Validate the arguments in your code before + calling your function. + name: + type: string + description: The name of the function to call. + tool_calls: + type: array + items: + $ref: "#/components/schemas/ChatCompletionMessageToolCallChunk" + role: + type: string + enum: + - developer + - system + - user + - assistant + - tool + description: The role of the author of this message. + refusal: + type: string + description: The refusal message generated by the model. + nullable: true + ChatCompletionTokenLogprob: + type: object + properties: + token: + description: The token. + type: string + logprob: + description: The log probability of this token, if it is within the top 20 most + likely tokens. Otherwise, the value `-9999.0` is used to signify + that the token is very unlikely. + type: number + bytes: + description: A list of integers representing the UTF-8 bytes representation of + the token. Useful in instances where characters are represented by + multiple tokens and their byte representations must be combined to + generate the correct text representation. Can be `null` if there is + no bytes representation for the token. + type: array + items: + type: integer + nullable: true + top_logprobs: + description: List of the most likely tokens and their log probability, at this + token position. In rare cases, there may be fewer than the number of + requested `top_logprobs` returned. + type: array + items: + type: object + properties: + token: + description: The token. + type: string + logprob: + description: The log probability of this token, if it is within the top 20 most + likely tokens. Otherwise, the value `-9999.0` is used to + signify that the token is very unlikely. + type: number + bytes: + description: A list of integers representing the UTF-8 bytes representation of + the token. Useful in instances where characters are + represented by multiple tokens and their byte representations + must be combined to generate the correct text representation. + Can be `null` if there is no bytes representation for the + token. + type: array + items: + type: integer + nullable: true + required: + - token + - logprob + - bytes + required: + - token + - logprob + - bytes + - top_logprobs + ChatCompletionTool: + type: object + properties: + type: + type: string + enum: + - function + description: The type of the tool. Currently, only `function` is supported. + x-stainless-const: true + function: + $ref: "#/components/schemas/FunctionObject" + required: + - type + - function + ChatCompletionToolChoiceOption: + description: > + Controls which (if any) tool is called by the model. - `thread.message.in_progress` event, many `thread.message.delta` events, - and finally a + `none` means the model will not call any tool and instead generates a + message. - `thread.message.completed` event. + `auto` means the model can pick between generating a message or calling + one or more tools. + `required` means the model must call one or more tools. - We may add additional events over time, so we recommend handling unknown - events gracefully + Specifying a particular tool via `{"type": "function", "function": + {"name": "my_function"}}` forces the model to call that tool. - in your code. See the [Assistants API - quickstart](/docs/assistants/overview) to learn how to - integrate the Assistants API with streaming. + `none` is the default when no tools are present. `auto` is the default + if tools are present. + oneOf: + - type: string + description: > + `none` means the model will not call any tool and instead generates + a message. `auto` means the model can pick between generating a + message or calling one or more tools. `required` means the model + must call one or more tools. + enum: + - none + - auto + - required + - $ref: "#/components/schemas/ChatCompletionNamedToolChoice" + ChunkingStrategyRequestParam: + type: object + description: The chunking strategy used to chunk the file(s). If not set, will + use the `auto` strategy. oneOf: - - $ref: "#/components/schemas/ThreadStreamEvent" - - $ref: "#/components/schemas/RunStreamEvent" - - $ref: "#/components/schemas/RunStepStreamEvent" - - $ref: "#/components/schemas/MessageStreamEvent" - - $ref: "#/components/schemas/ErrorEvent" - - $ref: "#/components/schemas/DoneEvent" - x-oaiMeta: - name: Assistant stream events - beta: true - AssistantToolsCode: + - $ref: "#/components/schemas/AutoChunkingStrategyRequestParam" + - $ref: "#/components/schemas/StaticChunkingStrategyRequestParam" + Click: type: object - title: Code interpreter tool + title: Click + description: | + A click action. properties: type: type: string - description: "The type of tool being defined: `code_interpreter`" enum: - - code_interpreter + - click + default: click + description: | + Specifies the event type. For a click action, this property is + always set to `click`. + x-stainless-const: true + button: + type: string + enum: + - left + - right + - wheel + - back + - forward + description: > + Indicates which mouse button was pressed during the click. One of + `left`, `right`, `wheel`, `back`, or `forward`. + x: + type: integer + description: | + The x-coordinate where the click occurred. + y: + type: integer + description: | + The y-coordinate where the click occurred. required: - type - AssistantToolsFileSearch: + - button + - x + - y + CodeInterpreterFileOutput: type: object - title: FileSearch tool + title: Code interpreter file output + description: | + The output of a code interpreter tool call that is a file. properties: type: type: string - description: "The type of tool being defined: `file_search`" enum: - - file_search - file_search: - type: object - description: Overrides for the file search tool. - properties: - max_num_results: - type: integer - minimum: 1 - maximum: 50 - description: > - The maximum number of results the file search tool should - output. The default is 20 for `gpt-4*` models and 5 for - `gpt-3.5-turbo`. This number should be between 1 and 50 - inclusive. - - - Note that the file search tool may output fewer than - `max_num_results` results. See the [file search tool - documentation](/docs/assistants/tools/file-search#customizing-file-search-settings) - for more information. - ranking_options: - $ref: "#/components/schemas/FileSearchRankingOptions" + - files + description: | + The type of the code interpreter file output. Always `files`. + x-stainless-const: true + files: + type: array + items: + type: object + properties: + mime_type: + type: string + description: | + The MIME type of the file. + file_id: + type: string + description: | + The ID of the file. + required: + - mime_type + - file_id required: - type - AssistantToolsFileSearchTypeOnly: + - files + CodeInterpreterTextOutput: type: object - title: FileSearch tool + title: Code interpreter text output + description: | + The output of a code interpreter tool call that is text. properties: type: type: string - description: "The type of tool being defined: `file_search`" enum: - - file_search + - logs + description: | + The type of the code interpreter text output. Always `logs`. + x-stainless-const: true + logs: + type: string + description: | + The logs of the code interpreter tool call. required: - type - AssistantToolsFunction: + - logs + CodeInterpreterToolCall: type: object - title: Function tool + title: Code interpreter tool call + description: | + A tool call to run code. properties: + id: + type: string + description: | + The unique ID of the code interpreter tool call. type: type: string - description: "The type of tool being defined: `function`" enum: - - function - function: - $ref: "#/components/schemas/FunctionObject" + - code_interpreter_call + description: > + The type of the code interpreter tool call. Always + `code_interpreter_call`. + x-stainless-const: true + code: + type: string + description: | + The code to run. + status: + type: string + enum: + - in_progress + - interpreting + - completed + description: | + The status of the code interpreter tool call. + results: + type: array + items: + $ref: "#/components/schemas/CodeInterpreterToolOutput" + description: | + The results of the code interpreter tool call. required: + - id - type - - function - AssistantsApiResponseFormatOption: + - code + - status + - results + CodeInterpreterToolOutput: + oneOf: + - $ref: "#/components/schemas/CodeInterpreterTextOutput" + - $ref: "#/components/schemas/CodeInterpreterFileOutput" + ComparisonFilter: + type: object + additionalProperties: false + title: Comparison Filter description: > - Specifies the format that the model must output. Compatible with - [GPT-4o](/docs/models#gpt-4o), [GPT-4 - Turbo](/docs/models#gpt-4-turbo-and-gpt-4), and all GPT-3.5 Turbo models - since `gpt-3.5-turbo-1106`. + A filter used to compare a specified attribute key to a given value + using a defined comparison operation. + properties: + type: + type: string + default: eq + enum: + - eq + - ne + - gt + - gte + - lt + - lte + description: > + Specifies the comparison operator: `eq`, `ne`, `gt`, `gte`, `lt`, + `lte`. + - `eq`: equals - Setting to `{ "type": "json_schema", "json_schema": {...} }` enables - Structured Outputs which ensures the model will match your supplied JSON - schema. Learn more in the [Structured Outputs - guide](/docs/guides/structured-outputs). + - `ne`: not equal + - `gt`: greater than - Setting to `{ "type": "json_object" }` enables JSON mode, which ensures - the message the model generates is valid JSON. + - `gte`: greater than or equal + - `lt`: less than - **Important:** when using JSON mode, you **must** also instruct the - model to produce JSON yourself via a system or user message. Without - this, the model may generate an unending stream of whitespace until the - generation reaches the token limit, resulting in a long-running and - seemingly "stuck" request. Also note that the message content may be - partially cut off if `finish_reason="length"`, which indicates the - generation exceeded `max_tokens` or the conversation exceeded the max - context length. - oneOf: - - type: string + - `lte`: less than or equal + key: + type: string + description: The key to compare against the value. + value: + oneOf: + - type: string + - type: number + - type: boolean + description: The value to compare against the attribute key; supports string, + number, or boolean types. + required: + - type + - key + - value + x-oaiMeta: + name: ComparisonFilter + CompleteUploadRequest: + type: object + additionalProperties: false + properties: + part_ids: + type: array description: | - `auto` is the default value - enum: - - auto - - $ref: "#/components/schemas/ResponseFormatText" - - $ref: "#/components/schemas/ResponseFormatJsonObject" - - $ref: "#/components/schemas/ResponseFormatJsonSchema" - x-oaiExpandable: true - AssistantsApiToolChoiceOption: - description: > - Controls which (if any) tool is called by the model. + The ordered list of Part IDs. + items: + type: string + md5: + description: > + The optional md5 checksum for the file contents to verify if the + bytes uploaded matches what you expect. + type: string + required: + - part_ids + CompletionUsage: + type: object + description: Usage statistics for the completion request. + properties: + completion_tokens: + type: integer + default: 0 + description: Number of tokens in the generated completion. + prompt_tokens: + type: integer + default: 0 + description: Number of tokens in the prompt. + total_tokens: + type: integer + default: 0 + description: Total number of tokens used in the request (prompt + completion). + completion_tokens_details: + type: object + description: Breakdown of tokens used in a completion. + properties: + accepted_prediction_tokens: + type: integer + default: 0 + description: | + When using Predicted Outputs, the number of tokens in the + prediction that appeared in the completion. + audio_tokens: + type: integer + default: 0 + description: Audio input tokens generated by the model. + reasoning_tokens: + type: integer + default: 0 + description: Tokens generated by the model for reasoning. + rejected_prediction_tokens: + type: integer + default: 0 + description: > + When using Predicted Outputs, the number of tokens in the - `none` means the model will not call any tools and instead generates a - message. + prediction that did not appear in the completion. However, like - `auto` is the default value and means the model can pick between - generating a message or calling one or more tools. + reasoning tokens, these tokens are still counted in the total - `required` means the model must call one or more tools before responding - to the user. + completion tokens for purposes of billing, output, and context + window - Specifying a particular tool like `{"type": "file_search"}` or `{"type": - "function", "function": {"name": "my_function"}}` forces the model to - call that tool. + limits. + prompt_tokens_details: + type: object + description: Breakdown of tokens used in the prompt. + properties: + audio_tokens: + type: integer + default: 0 + description: Audio input tokens present in the prompt. + cached_tokens: + type: integer + default: 0 + description: Cached tokens present in the prompt. + required: + - prompt_tokens + - completion_tokens + - total_tokens + CompoundFilter: + $recursiveAnchor: true + type: object + additionalProperties: false + title: Compound Filter + description: Combine multiple filters using `and` or `or`. + properties: + type: + type: string + description: "Type of operation: `and` or `or`." + enum: + - and + - or + filters: + type: array + description: Array of filters to combine. Items can be `ComparisonFilter` or + `CompoundFilter`. + items: + oneOf: + - $ref: "#/components/schemas/ComparisonFilter" + - $recursiveRef: "#" + required: + - type + - filters + x-oaiMeta: + name: CompoundFilter + ComputerAction: oneOf: - - type: string - description: > - `none` means the model will not call any tools and instead generates - a message. `auto` means the model can pick between generating a - message or calling one or more tools. `required` means the model - must call one or more tools before responding to the user. + - $ref: "#/components/schemas/Click" + - $ref: "#/components/schemas/DoubleClick" + - $ref: "#/components/schemas/Drag" + - $ref: "#/components/schemas/KeyPress" + - $ref: "#/components/schemas/Move" + - $ref: "#/components/schemas/Screenshot" + - $ref: "#/components/schemas/Scroll" + - $ref: "#/components/schemas/Type" + - $ref: "#/components/schemas/Wait" + ComputerScreenshotImage: + type: object + description: | + A computer screenshot image used with the computer use tool. + properties: + type: + type: string enum: - - none - - auto - - required - - $ref: "#/components/schemas/AssistantsNamedToolChoice" - x-oaiExpandable: true - AssistantsNamedToolChoice: + - computer_screenshot + default: computer_screenshot + description: > + Specifies the event type. For a computer screenshot, this property + is + + always set to `computer_screenshot`. + x-stainless-const: true + image_url: + type: string + description: The URL of the screenshot image. + file_id: + type: string + description: The identifier of an uploaded file that contains the screenshot. + required: + - type + ComputerToolCall: type: object - description: Specifies a tool the model should use. Use to force the model to - call a specific tool. + title: Computer tool call + description: > + A tool call to a computer use tool. See the + + [computer use guide](/docs/guides/tools-computer-use) for more + information. properties: type: type: string + description: The type of the computer call. Always `computer_call`. enum: - - function - - code_interpreter - - file_search - description: The type of the tool. If type is `function`, the function name must - be set - function: - type: object - properties: - name: - type: string - description: The name of the function to call. - required: - - name + - computer_call + default: computer_call + id: + type: string + description: The unique ID of the computer call. + call_id: + type: string + description: | + An identifier used when responding to the tool call with output. + action: + $ref: "#/components/schemas/ComputerAction" + pending_safety_checks: + type: array + items: + $ref: "#/components/schemas/ComputerToolCallSafetyCheck" + description: | + The pending safety checks for the computer call. + status: + type: string + description: | + The status of the item. One of `in_progress`, `completed`, or + `incomplete`. Populated when items are returned via API. + enum: + - in_progress + - completed + - incomplete required: - type - AudioResponseFormat: - description: > - The format of the output, in one of these options: `json`, `text`, - `srt`, `verbose_json`, or `vtt`. - type: string - enum: - - json - - text - - srt - - verbose_json - - vtt - default: json - AuditLog: + - id + - action + - call_id + - pending_safety_checks + - status + ComputerToolCallOutput: type: object - description: A log of a user action or configuration change within this organization. + title: Computer tool call output + description: | + The output of a computer tool call. properties: + type: + type: string + description: > + The type of the computer tool call output. Always + `computer_call_output`. + enum: + - computer_call_output + default: computer_call_output + x-stainless-const: true id: type: string - description: The ID of this log. - type: - $ref: "#/components/schemas/AuditLogEventType" - effective_at: - type: integer - description: The Unix timestamp (in seconds) of the event. - project: - type: object - description: The project that the action was scoped to. Absent for actions not - scoped to projects. - properties: - id: - type: string - description: The project ID. - name: - type: string - description: The project title. - actor: - $ref: "#/components/schemas/AuditLogActor" - api_key.created: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The tracking ID of the API key. - data: - type: object - description: The payload used to create the API key. - properties: - scopes: - type: array - items: - type: string - description: A list of scopes allowed for the API key, e.g. - `["api.model.request"]` - api_key.updated: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The tracking ID of the API key. - changes_requested: - type: object - description: The payload used to update the API key. - properties: - scopes: - type: array - items: - type: string - description: A list of scopes allowed for the API key, e.g. - `["api.model.request"]` - api_key.deleted: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The tracking ID of the API key. - invite.sent: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The ID of the invite. - data: - type: object - description: The payload used to create the invite. - properties: - email: - type: string - description: The email invited to the organization. - role: - type: string - description: The role the email was invited to be. Is either `owner` or - `member`. - invite.accepted: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The ID of the invite. - invite.deleted: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The ID of the invite. - login.failed: - type: object - description: The details for events with this `type`. - properties: - error_code: - type: string - description: The error code of the failure. - error_message: - type: string - description: The error message of the failure. - logout.failed: - type: object - description: The details for events with this `type`. - properties: - error_code: - type: string - description: The error code of the failure. - error_message: - type: string - description: The error message of the failure. - organization.updated: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The organization ID. - changes_requested: - type: object - description: The payload used to update the organization settings. - properties: - title: - type: string - description: The organization title. - description: - type: string - description: The organization description. - name: - type: string - description: The organization name. - settings: - type: object - properties: - threads_ui_visibility: - type: string - description: Visibility of the threads page which shows messages created with - the Assistants API and Playground. One of `ANY_ROLE`, - `OWNERS`, or `NONE`. - usage_dashboard_visibility: - type: string - description: Visibility of the usage dashboard which shows activity and costs - for your organization. One of `ANY_ROLE` or `OWNERS`. - project.created: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The project ID. - data: - type: object - description: The payload used to create the project. - properties: - name: - type: string - description: The project name. - title: - type: string - description: The title of the project as seen on the dashboard. - project.updated: - type: object - description: The details for events with this `type`. + description: | + The ID of the computer tool call output. + call_id: + type: string + description: | + The ID of the computer tool call that produced the output. + acknowledged_safety_checks: + type: array + description: > + The safety checks reported by the API that have been acknowledged by + the + + developer. + items: + $ref: "#/components/schemas/ComputerToolCallSafetyCheck" + output: + $ref: "#/components/schemas/ComputerScreenshotImage" + status: + type: string + description: > + The status of the message input. One of `in_progress`, `completed`, + or + + `incomplete`. Populated when input items are returned via API. + enum: + - in_progress + - completed + - incomplete + required: + - type + - call_id + - output + ComputerToolCallOutputResource: + allOf: + - $ref: "#/components/schemas/ComputerToolCallOutput" + - type: object properties: id: type: string - description: The project ID. - changes_requested: - type: object - description: The payload used to update the project. - properties: - title: - type: string - description: The title of the project as seen on the dashboard. - project.archived: + description: | + The unique ID of the computer call tool output. + required: + - id + ComputerToolCallSafetyCheck: + type: object + description: | + A pending safety check for the computer call. + properties: + id: + type: string + description: The ID of the pending safety check. + code: + type: string + description: The type of the pending safety check. + message: + type: string + description: Details about the pending safety check. + required: + - id + - code + - message + Content: + description: | + Multi-modal input and output contents. + oneOf: + - title: Input content types + $ref: "#/components/schemas/InputContent" + - title: Output content types + $ref: "#/components/schemas/OutputContent" + Coordinate: + type: object + title: Coordinate + description: | + An x/y coordinate pair, e.g. `{ x: 100, y: 200 }`. + properties: + x: + type: integer + description: | + The x-coordinate. + y: + type: integer + description: | + The y-coordinate. + required: + - x + - y + CostsResult: + type: object + description: The aggregated costs details of the specific time bucket. + properties: + object: + type: string + enum: + - organization.costs.result + x-stainless-const: true + amount: type: object - description: The details for events with this `type`. + description: The monetary value in its associated currency. properties: - id: + value: + type: number + description: The numeric value of the cost. + currency: type: string - description: The project ID. - rate_limit.updated: + description: Lowercase ISO-4217 currency e.g. "usd" + line_item: + type: string + nullable: true + description: When `group_by=line_item`, this field provides the line item of the + grouped costs result. + project_id: + type: string + nullable: true + description: When `group_by=project_id`, this field provides the project ID of + the grouped costs result. + required: + - object + x-oaiMeta: + name: Costs object + example: | + { + "object": "organization.costs.result", + "amount": { + "value": 0.06, + "currency": "usd" + }, + "line_item": "Image models", + "project_id": "proj_abc" + } + CreateAssistantRequest: + type: object + additionalProperties: false + properties: + model: + description: > + ID of the model to use. You can use the [List + models](/docs/api-reference/models/list) API to see all of your + available models, or see our [Model overview](/docs/models) for + descriptions of them. + example: gpt-4o + anyOf: + - type: string + - $ref: "#/components/schemas/AssistantSupportedModels" + x-oaiTypeLabel: string + name: + description: | + The name of the assistant. The maximum length is 256 characters. + type: string + nullable: true + maxLength: 256 + description: + description: > + The description of the assistant. The maximum length is 512 + characters. + type: string + nullable: true + maxLength: 512 + instructions: + description: > + The system instructions that the assistant uses. The maximum length + is 256,000 characters. + type: string + nullable: true + maxLength: 256000 + reasoning_effort: + $ref: "#/components/schemas/ReasoningEffort" + tools: + description: > + A list of tool enabled on the assistant. There can be a maximum of + 128 tools per assistant. Tools can be of types `code_interpreter`, + `file_search`, or `function`. + default: [] + type: array + maxItems: 128 + items: + oneOf: + - $ref: "#/components/schemas/AssistantToolsCode" + - $ref: "#/components/schemas/AssistantToolsFileSearch" + - $ref: "#/components/schemas/AssistantToolsFunction" + tool_resources: type: object - description: The details for events with this `type`. + description: > + A set of resources that are used by the assistant's tools. The + resources are specific to the type of tool. For example, the + `code_interpreter` tool requires a list of file IDs, while the + `file_search` tool requires a list of vector store IDs. properties: - id: - type: string - description: The rate limit ID - changes_requested: + code_interpreter: type: object - description: The payload used to update the rate limits. properties: - max_requests_per_1_minute: - type: integer - description: The maximum requests per minute. - max_tokens_per_1_minute: - type: integer - description: The maximum tokens per minute. - max_images_per_1_minute: - type: integer - description: The maximum images per minute. Only relevant for certain models. - max_audio_megabytes_per_1_minute: - type: integer - description: The maximum audio megabytes per minute. Only relevant for certain - models. - max_requests_per_1_day: - type: integer - description: The maximum requests per day. Only relevant for certain models. - batch_1_day_max_input_tokens: - type: integer - description: The maximum batch input tokens per day. Only relevant for certain - models. - rate_limit.deleted: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The rate limit ID - service_account.created: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The service account ID. - data: + file_ids: + type: array + description: > + A list of [file](/docs/api-reference/files) IDs made + available to the `code_interpreter` tool. There can be a + maximum of 20 files associated with the tool. + default: [] + maxItems: 20 + items: + type: string + file_search: type: object - description: The payload used to create the service account. properties: - role: - type: string - description: The role of the service account. Is either `owner` or `member`. - service_account.updated: - type: object - description: The details for events with this `type`. + vector_store_ids: + type: array + description: > + The [vector store](/docs/api-reference/vector-stores/object) + attached to this assistant. There can be a maximum of 1 + vector store attached to the assistant. + maxItems: 1 + items: + type: string + vector_stores: + type: array + description: > + A helper to create a [vector + store](/docs/api-reference/vector-stores/object) with + file_ids and attach it to this assistant. There can be a + maximum of 1 vector store attached to the assistant. + maxItems: 1 + items: + type: object + properties: + file_ids: + type: array + description: > + A list of [file](/docs/api-reference/files) IDs to add + to the vector store. There can be a maximum of 10000 + files in a vector store. + maxItems: 10000 + items: + type: string + chunking_strategy: + type: object + description: The chunking strategy used to chunk the file(s). If not set, will + use the `auto` strategy. + oneOf: + - type: object + title: Auto Chunking Strategy + description: The default strategy. This strategy currently uses a + `max_chunk_size_tokens` of `800` and + `chunk_overlap_tokens` of `400`. + additionalProperties: false + properties: + type: + type: string + description: Always `auto`. + enum: + - auto + x-stainless-const: true + required: + - type + - type: object + title: Static Chunking Strategy + additionalProperties: false + properties: + type: + type: string + description: Always `static`. + enum: + - static + x-stainless-const: true + static: + type: object + additionalProperties: false + properties: + max_chunk_size_tokens: + type: integer + minimum: 100 + maximum: 4096 + description: The maximum number of tokens in each chunk. The default value is + `800`. The minimum value is `100` and the + maximum value is `4096`. + chunk_overlap_tokens: + type: integer + description: > + The number of tokens that overlap between + chunks. The default value is `400`. + + + Note that the overlap must not exceed half + of `max_chunk_size_tokens`. + required: + - max_chunk_size_tokens + - chunk_overlap_tokens + required: + - type + - static + metadata: + $ref: "#/components/schemas/Metadata" + oneOf: + - required: + - vector_store_ids + - required: + - vector_stores + nullable: true + metadata: + $ref: "#/components/schemas/Metadata" + temperature: + description: > + What sampling temperature to use, between 0 and 2. Higher values + like 0.8 will make the output more random, while lower values like + 0.2 will make it more focused and deterministic. + type: number + minimum: 0 + maximum: 2 + default: 1 + example: 1 + nullable: true + top_p: + type: number + minimum: 0 + maximum: 1 + default: 1 + example: 1 + nullable: true + description: > + An alternative to sampling with temperature, called nucleus + sampling, where the model considers the results of the tokens with + top_p probability mass. So 0.1 means only the tokens comprising the + top 10% probability mass are considered. + + + We generally recommend altering this or temperature but not both. + response_format: + $ref: "#/components/schemas/AssistantsApiResponseFormatOption" + nullable: true + required: + - model + CreateChatCompletionRequest: + allOf: + - $ref: "#/components/schemas/CreateModelResponseProperties" + - type: object properties: - id: - type: string - description: The service account ID. - changes_requested: + messages: + description: > + A list of messages comprising the conversation so far. Depending + on the + + [model](/docs/models) you use, different message types + (modalities) are + + supported, like [text](/docs/guides/text-generation), + + [images](/docs/guides/vision), and [audio](/docs/guides/audio). + type: array + minItems: 1 + items: + $ref: "#/components/schemas/ChatCompletionRequestMessage" + model: + description: > + Model ID used to generate the response, like `gpt-4o` or `o3`. + OpenAI + + offers a wide range of models with different capabilities, + performance + + characteristics, and price points. Refer to the [model + guide](/docs/models) + + to browse and compare available models. + $ref: "#/components/schemas/ModelIdsShared" + modalities: + $ref: "#/components/schemas/ResponseModalities" + reasoning_effort: + $ref: "#/components/schemas/ReasoningEffort" + max_completion_tokens: + description: > + An upper bound for the number of tokens that can be generated + for a completion, including visible output tokens and [reasoning + tokens](/docs/guides/reasoning). + type: integer + nullable: true + frequency_penalty: + type: number + default: 0 + minimum: -2 + maximum: 2 + nullable: true + description: > + Number between -2.0 and 2.0. Positive values penalize new tokens + based on + + their existing frequency in the text so far, decreasing the + model's + + likelihood to repeat the same line verbatim. + presence_penalty: + type: number + default: 0 + minimum: -2 + maximum: 2 + nullable: true + description: > + Number between -2.0 and 2.0. Positive values penalize new tokens + based on + + whether they appear in the text so far, increasing the model's + likelihood + + to talk about new topics. + web_search_options: type: object - description: The payload used to updated the service account. + title: Web search + description: > + This tool searches the web for relevant results to use in a + response. + + Learn more about the [web search + tool](/docs/guides/tools-web-search?api-mode=chat). properties: - role: - type: string - description: The role of the service account. Is either `owner` or `member`. - service_account.deleted: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The service account ID. - user.added: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The user ID. - data: + user_location: + type: object + nullable: true + required: + - type + - approximate + description: | + Approximate location parameters for the search. + properties: + type: + type: string + description: > + The type of location approximation. Always `approximate`. + enum: + - approximate + x-stainless-const: true + approximate: + $ref: "#/components/schemas/WebSearchLocation" + search_context_size: + $ref: "#/components/schemas/WebSearchContextSize" + top_logprobs: + description: > + An integer between 0 and 20 specifying the number of most likely + tokens to + + return at each token position, each with an associated log + probability. + + `logprobs` must be set to `true` if this parameter is used. + type: integer + minimum: 0 + maximum: 20 + nullable: true + response_format: + description: > + An object specifying the format that the model must output. + + + Setting to `{ "type": "json_schema", "json_schema": {...} }` + enables + + Structured Outputs which ensures the model will match your + supplied JSON + + schema. Learn more in the [Structured Outputs + + guide](/docs/guides/structured-outputs). + + + Setting to `{ "type": "json_object" }` enables the older JSON + mode, which + + ensures the message the model generates is valid JSON. Using + `json_schema` + + is preferred for models that support it. + oneOf: + - $ref: "#/components/schemas/ResponseFormatText" + - $ref: "#/components/schemas/ResponseFormatJsonSchema" + - $ref: "#/components/schemas/ResponseFormatJsonObject" + audio: type: object - description: The payload used to add the user to the project. + nullable: true + description: > + Parameters for audio output. Required when audio output is + requested with + + `modalities: ["audio"]`. [Learn more](/docs/guides/audio). + required: + - voice + - format properties: - role: + voice: + $ref: "#/components/schemas/VoiceIdsShared" + description: > + The voice the model uses to respond. Supported voices are + + `alloy`, `ash`, `ballad`, `coral`, `echo`, `fable`, `nova`, + `onyx`, `sage`, and `shimmer`. + format: type: string - description: The role of the user. Is either `owner` or `member`. - user.updated: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The project ID. - changes_requested: + enum: + - wav + - aac + - mp3 + - flac + - opus + - pcm16 + description: > + Specifies the output audio format. Must be one of `wav`, + `mp3`, `flac`, + + `opus`, or `pcm16`. + store: + type: boolean + default: false + nullable: true + description: > + Whether or not to store the output of this chat completion + request for + + use in our [model distillation](/docs/guides/distillation) or + + [evals](/docs/guides/evals) products. + stream: + description: | + If set to true, the model response data will be streamed to the client + as it is generated using [server-sent events](https://developer.mozilla.org/en-US/docs/Web/API/Server-sent_events/Using_server-sent_events#Event_stream_format). + See the [Streaming section below](/docs/api-reference/chat/streaming) + for more information, along with the [streaming responses](/docs/guides/streaming-responses) + guide for more information on how to handle the streaming events. + type: boolean + nullable: true + default: false + stop: + $ref: "#/components/schemas/StopConfiguration" + logit_bias: type: object - description: The payload used to update the user. - properties: - role: - type: string - description: The role of the user. Is either `owner` or `member`. - user.deleted: - type: object - description: The details for events with this `type`. - properties: - id: - type: string - description: The user ID. + x-oaiTypeLabel: map + default: null + nullable: true + additionalProperties: + type: integer + description: > + Modify the likelihood of specified tokens appearing in the + completion. + + + Accepts a JSON object that maps tokens (specified by their token + ID in the + + tokenizer) to an associated bias value from -100 to 100. + Mathematically, + + the bias is added to the logits generated by the model prior to + sampling. + + The exact effect will vary per model, but values between -1 and + 1 should + + decrease or increase likelihood of selection; values like -100 + or 100 + + should result in a ban or exclusive selection of the relevant + token. + logprobs: + description: > + Whether to return log probabilities of the output tokens or not. + If true, + + returns the log probabilities of each output token returned in + the + + `content` of `message`. + type: boolean + default: false + nullable: true + max_tokens: + description: > + The maximum number of [tokens](/tokenizer) that can be generated + in the + + chat completion. This value can be used to control + + [costs](https://openai.com/api/pricing/) for text generated via + API. + + + This value is now deprecated in favor of + `max_completion_tokens`, and is + + not compatible with [o-series models](/docs/guides/reasoning). + type: integer + nullable: true + deprecated: true + n: + type: integer + minimum: 1 + maximum: 128 + default: 1 + example: 1 + nullable: true + description: How many chat completion choices to generate for each input + message. Note that you will be charged based on the number of + generated tokens across all of the choices. Keep `n` as `1` to + minimize costs. + prediction: + nullable: true + description: > + Configuration for a [Predicted + Output](/docs/guides/predicted-outputs), + + which can greatly improve response times when large parts of the + model + + response are known ahead of time. This is most common when you + are + + regenerating a file with only minor changes to most of the + content. + oneOf: + - $ref: "#/components/schemas/PredictionContent" + seed: + type: integer + minimum: -9223372036854776000 + maximum: 9223372036854776000 + nullable: true + description: > + This feature is in Beta. + + If specified, our system will make a best effort to sample + deterministically, such that repeated requests with the same + `seed` and parameters should return the same result. + + Determinism is not guaranteed, and you should refer to the + `system_fingerprint` response parameter to monitor changes in + the backend. + x-oaiMeta: + beta: true + stream_options: + $ref: "#/components/schemas/ChatCompletionStreamOptions" + tools: + type: array + description: > + A list of tools the model may call. Currently, only functions + are supported as a tool. Use this to provide a list of functions + the model may generate JSON inputs for. A max of 128 functions + are supported. + items: + $ref: "#/components/schemas/ChatCompletionTool" + tool_choice: + $ref: "#/components/schemas/ChatCompletionToolChoiceOption" + parallel_tool_calls: + $ref: "#/components/schemas/ParallelToolCalls" + function_call: + deprecated: true + description: > + Deprecated in favor of `tool_choice`. + + + Controls which (if any) function is called by the model. + + + `none` means the model will not call a function and instead + generates a + + message. + + + `auto` means the model can pick between generating a message or + calling a + + function. + + + Specifying a particular function via `{"name": "my_function"}` + forces the + + model to call that function. + + + `none` is the default when no functions are present. `auto` is + the default + + if functions are present. + oneOf: + - type: string + description: > + `none` means the model will not call a function and instead + generates a message. `auto` means the model can pick between + generating a message or calling a function. + enum: + - none + - auto + - $ref: "#/components/schemas/ChatCompletionFunctionCallOption" + functions: + deprecated: true + description: | + Deprecated in favor of `tools`. + + A list of functions the model may generate JSON inputs for. + type: array + minItems: 1 + maxItems: 128 + items: + $ref: "#/components/schemas/ChatCompletionFunctions" + required: + - model + - messages + CreateChatCompletionResponse: + type: object + description: Represents a chat completion response returned by model, based on + the provided input. + properties: + id: + type: string + description: A unique identifier for the chat completion. + choices: + type: array + description: A list of chat completion choices. Can be more than one if `n` is + greater than 1. + items: + type: object + required: + - finish_reason + - index + - message + - logprobs + properties: + finish_reason: + type: string + description: > + The reason the model stopped generating tokens. This will be + `stop` if the model hit a natural stop point or a provided + stop sequence, + + `length` if the maximum number of tokens specified in the + request was reached, + + `content_filter` if content was omitted due to a flag from our + content filters, + + `tool_calls` if the model called a tool, or `function_call` + (deprecated) if the model called a function. + enum: + - stop + - length + - tool_calls + - content_filter + - function_call + index: + type: integer + description: The index of the choice in the list of choices. + message: + $ref: "#/components/schemas/ChatCompletionResponseMessage" + logprobs: + description: Log probability information for the choice. + type: object + nullable: true + properties: + content: + description: A list of message content tokens with log probability information. + type: array + items: + $ref: "#/components/schemas/ChatCompletionTokenLogprob" + nullable: true + refusal: + description: A list of message refusal tokens with log probability information. + type: array + items: + $ref: "#/components/schemas/ChatCompletionTokenLogprob" + nullable: true + required: + - content + - refusal + created: + type: integer + description: The Unix timestamp (in seconds) of when the chat completion was + created. + model: + type: string + description: The model used for the chat completion. + service_tier: + $ref: "#/components/schemas/ServiceTier" + system_fingerprint: + type: string + description: > + This fingerprint represents the backend configuration that the model + runs with. + + + Can be used in conjunction with the `seed` request parameter to + understand when backend changes have been made that might impact + determinism. + object: + type: string + description: The object type, which is always `chat.completion`. + enum: + - chat.completion + x-stainless-const: true + usage: + $ref: "#/components/schemas/CompletionUsage" required: + - choices + - created - id - - type - - effective_at - - actor + - model + - object x-oaiMeta: - name: The audit log object + name: The chat completion object + group: chat example: > { - "id": "req_xxx_20240101", - "type": "api_key.created", - "effective_at": 1720804090, - "actor": { - "type": "session", - "session": { - "user": { - "id": "user-xxx", - "email": "user@example.com" - }, - "ip_address": "127.0.0.1", - "user_agent": "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/91.0.4472.124 Safari/537.36" - } + "id": "chatcmpl-B9MHDbslfkBeAs8l4bebGdFOJ6PeG", + "object": "chat.completion", + "created": 1741570283, + "model": "gpt-4o-2024-08-06", + "choices": [ + { + "index": 0, + "message": { + "role": "assistant", + "content": "The image shows a wooden boardwalk path running through a lush green field or meadow. The sky is bright blue with some scattered clouds, giving the scene a serene and peaceful atmosphere. Trees and shrubs are visible in the background.", + "refusal": null, + "annotations": [] + }, + "logprobs": null, + "finish_reason": "stop" + } + ], + "usage": { + "prompt_tokens": 1117, + "completion_tokens": 46, + "total_tokens": 1163, + "prompt_tokens_details": { + "cached_tokens": 0, + "audio_tokens": 0 }, - "api_key.created": { - "id": "key_xxxx", - "data": { - "scopes": ["resource.operation"] - } + "completion_tokens_details": { + "reasoning_tokens": 0, + "audio_tokens": 0, + "accepted_prediction_tokens": 0, + "rejected_prediction_tokens": 0 } + }, + "service_tier": "default", + "system_fingerprint": "fp_fc9f1d7035" } - AuditLogActor: + CreateChatCompletionStreamResponse: type: object - description: The actor who performed the audit logged action. + description: | + Represents a streamed chunk of a chat completion response returned + by the model, based on the provided input. + [Learn more](/docs/guides/streaming-responses). properties: - type: + id: type: string - description: The type of actor. Is either `session` or `api_key`. + description: A unique identifier for the chat completion. Each chunk has the + same ID. + choices: + type: array + description: > + A list of chat completion choices. Can contain more than one + elements if `n` is greater than 1. Can also be empty for the + + last chunk if you set `stream_options: {"include_usage": true}`. + items: + type: object + required: + - delta + - finish_reason + - index + properties: + delta: + $ref: "#/components/schemas/ChatCompletionStreamResponseDelta" + logprobs: + description: Log probability information for the choice. + type: object + nullable: true + properties: + content: + description: A list of message content tokens with log probability information. + type: array + items: + $ref: "#/components/schemas/ChatCompletionTokenLogprob" + nullable: true + refusal: + description: A list of message refusal tokens with log probability information. + type: array + items: + $ref: "#/components/schemas/ChatCompletionTokenLogprob" + nullable: true + required: + - content + - refusal + finish_reason: + type: string + description: > + The reason the model stopped generating tokens. This will be + `stop` if the model hit a natural stop point or a provided + stop sequence, + + `length` if the maximum number of tokens specified in the + request was reached, + + `content_filter` if content was omitted due to a flag from our + content filters, + + `tool_calls` if the model called a tool, or `function_call` + (deprecated) if the model called a function. + enum: + - stop + - length + - tool_calls + - content_filter + - function_call + nullable: true + index: + type: integer + description: The index of the choice in the list of choices. + created: + type: integer + description: The Unix timestamp (in seconds) of when the chat completion was + created. Each chunk has the same timestamp. + model: + type: string + description: The model to generate the completion. + service_tier: + $ref: "#/components/schemas/ServiceTier" + system_fingerprint: + type: string + description: > + This fingerprint represents the backend configuration that the model + runs with. + + Can be used in conjunction with the `seed` request parameter to + understand when backend changes have been made that might impact + determinism. + object: + type: string + description: The object type, which is always `chat.completion.chunk`. enum: - - session - - api_key - session: - type: object - $ref: "#/components/schemas/AuditLogActorSession" - api_key: + - chat.completion.chunk + x-stainless-const: true + usage: + $ref: "#/components/schemas/CompletionUsage" + nullable: true + description: > + An optional field that will only be present when you set + + `stream_options: {"include_usage": true}` in your request. When + present, it + + contains a null value **except for the last chunk** which contains + the + + token usage statistics for the entire request. + + + **NOTE:** If the stream is interrupted or cancelled, you may not + + receive the final usage chunk which contains the total token usage + for + + the request. + required: + - choices + - created + - id + - model + - object + x-oaiMeta: + name: The chat completion chunk object + group: chat + example: | + {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", "system_fingerprint": "fp_44709d6fcb", "choices":[{"index":0,"delta":{"role":"assistant","content":""},"logprobs":null,"finish_reason":null}]} + + {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", "system_fingerprint": "fp_44709d6fcb", "choices":[{"index":0,"delta":{"content":"Hello"},"logprobs":null,"finish_reason":null}]} + + .... + + {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", "system_fingerprint": "fp_44709d6fcb", "choices":[{"index":0,"delta":{},"logprobs":null,"finish_reason":"stop"}]} + CreateCompletionRequest: + type: object + properties: + model: + description: > + ID of the model to use. You can use the [List + models](/docs/api-reference/models/list) API to see all of your + available models, or see our [Model overview](/docs/models) for + descriptions of them. + anyOf: + - type: string + - type: string + enum: + - gpt-3.5-turbo-instruct + - davinci-002 + - babbage-002 + x-oaiTypeLabel: string + prompt: + description: > + The prompt(s) to generate completions for, encoded as a string, + array of strings, array of tokens, or array of token arrays. + + + Note that <|endoftext|> is the document separator that the model + sees during training, so if a prompt is not specified the model will + generate as if from the beginning of a new document. + default: <|endoftext|> + nullable: true + oneOf: + - type: string + default: "" + example: This is a test. + - type: array + items: + type: string + default: "" + example: This is a test. + - type: array + minItems: 1 + items: + type: integer + example: "[1212, 318, 257, 1332, 13]" + - type: array + minItems: 1 + items: + type: array + minItems: 1 + items: + type: integer + example: "[[1212, 318, 257, 1332, 13]]" + best_of: + type: integer + default: 1 + minimum: 0 + maximum: 20 + nullable: true + description: > + Generates `best_of` completions server-side and returns the "best" + (the one with the highest log probability per token). Results cannot + be streamed. + + + When used with `n`, `best_of` controls the number of candidate + completions and `n` specifies how many to return – `best_of` must be + greater than `n`. + + + **Note:** Because this parameter generates many completions, it can + quickly consume your token quota. Use carefully and ensure that you + have reasonable settings for `max_tokens` and `stop`. + echo: + type: boolean + default: false + nullable: true + description: | + Echo back the prompt in addition to the completion + frequency_penalty: + type: number + default: 0 + minimum: -2 + maximum: 2 + nullable: true + description: > + Number between -2.0 and 2.0. Positive values penalize new tokens + based on their existing frequency in the text so far, decreasing the + model's likelihood to repeat the same line verbatim. + + + [See more information about frequency and presence + penalties.](/docs/guides/text-generation) + logit_bias: type: object - $ref: "#/components/schemas/AuditLogActorApiKey" - AuditLogActorApiKey: - type: object - description: The API Key used to perform the audit logged action. - properties: - id: - type: string - description: The tracking id of the API key. - type: - type: string - description: The type of API key. Can be either `user` or `service_account`. - enum: - - user - - service_account - user: - $ref: "#/components/schemas/AuditLogActorUser" - service_account: - $ref: "#/components/schemas/AuditLogActorServiceAccount" - AuditLogActorServiceAccount: - type: object - description: The service account that performed the audit logged action. - properties: - id: + x-oaiTypeLabel: map + default: null + nullable: true + additionalProperties: + type: integer + description: > + Modify the likelihood of specified tokens appearing in the + completion. + + + Accepts a JSON object that maps tokens (specified by their token ID + in the GPT tokenizer) to an associated bias value from -100 to 100. + You can use this [tokenizer tool](/tokenizer?view=bpe) to convert + text to token IDs. Mathematically, the bias is added to the logits + generated by the model prior to sampling. The exact effect will vary + per model, but values between -1 and 1 should decrease or increase + likelihood of selection; values like -100 or 100 should result in a + ban or exclusive selection of the relevant token. + + + As an example, you can pass `{"50256": -100}` to prevent the + <|endoftext|> token from being generated. + logprobs: + type: integer + minimum: 0 + maximum: 5 + default: null + nullable: true + description: > + Include the log probabilities on the `logprobs` most likely output + tokens, as well the chosen tokens. For example, if `logprobs` is 5, + the API will return a list of the 5 most likely tokens. The API will + always return the `logprob` of the sampled token, so there may be up + to `logprobs+1` elements in the response. + + + The maximum value for `logprobs` is 5. + max_tokens: + type: integer + minimum: 0 + default: 16 + example: 16 + nullable: true + description: | + The maximum number of [tokens](/tokenizer) that can be generated in the completion. + + The token count of your prompt plus `max_tokens` cannot exceed the model's context length. [Example Python code](https://cookbook.openai.com/examples/how_to_count_tokens_with_tiktoken) for counting tokens. + n: + type: integer + minimum: 1 + maximum: 128 + default: 1 + example: 1 + nullable: true + description: > + How many completions to generate for each prompt. + + + **Note:** Because this parameter generates many completions, it can + quickly consume your token quota. Use carefully and ensure that you + have reasonable settings for `max_tokens` and `stop`. + presence_penalty: + type: number + default: 0 + minimum: -2 + maximum: 2 + nullable: true + description: > + Number between -2.0 and 2.0. Positive values penalize new tokens + based on whether they appear in the text so far, increasing the + model's likelihood to talk about new topics. + + + [See more information about frequency and presence + penalties.](/docs/guides/text-generation) + seed: + type: integer + format: int64 + nullable: true + description: > + If specified, our system will make a best effort to sample + deterministically, such that repeated requests with the same `seed` + and parameters should return the same result. + + + Determinism is not guaranteed, and you should refer to the + `system_fingerprint` response parameter to monitor changes in the + backend. + stop: + $ref: "#/components/schemas/StopConfiguration" + stream: + description: | + Whether to stream back partial progress. If set, tokens will be sent as data-only [server-sent events](https://developer.mozilla.org/en-US/docs/Web/API/Server-sent_events/Using_server-sent_events#Event_stream_format) as they become available, with the stream terminated by a `data: [DONE]` message. [Example Python code](https://cookbook.openai.com/examples/how_to_stream_completions). + type: boolean + nullable: true + default: false + stream_options: + $ref: "#/components/schemas/ChatCompletionStreamOptions" + suffix: + description: | + The suffix that comes after a completion of inserted text. + + This parameter is only supported for `gpt-3.5-turbo-instruct`. + default: null + nullable: true type: string - description: The service account id. - AuditLogActorSession: - type: object - description: The session in which the audit logged action was performed. - properties: + example: test. + temperature: + type: number + minimum: 0 + maximum: 2 + default: 1 + example: 1 + nullable: true + description: > + What sampling temperature to use, between 0 and 2. Higher values + like 0.8 will make the output more random, while lower values like + 0.2 will make it more focused and deterministic. + + + We generally recommend altering this or `top_p` but not both. + top_p: + type: number + minimum: 0 + maximum: 1 + default: 1 + example: 1 + nullable: true + description: > + An alternative to sampling with temperature, called nucleus + sampling, where the model considers the results of the tokens with + top_p probability mass. So 0.1 means only the tokens comprising the + top 10% probability mass are considered. + + + We generally recommend altering this or `temperature` but not both. user: - $ref: "#/components/schemas/AuditLogActorUser" - ip_address: type: string - description: The IP address from which the action was performed. - AuditLogActorUser: + example: user-1234 + description: > + A unique identifier representing your end-user, which can help + OpenAI to monitor and detect abuse. [Learn + more](/docs/guides/safety-best-practices#end-user-ids). + required: + - model + - prompt + CreateCompletionResponse: type: object - description: The user who performed the audit logged action. + description: > + Represents a completion response from the API. Note: both the streamed + and non-streamed response objects share the same shape (unlike the chat + endpoint). properties: id: type: string - description: The user id. - email: + description: A unique identifier for the completion. + choices: + type: array + description: The list of completion choices the model generated for the input + prompt. + items: + type: object + required: + - finish_reason + - index + - logprobs + - text + properties: + finish_reason: + type: string + description: > + The reason the model stopped generating tokens. This will be + `stop` if the model hit a natural stop point or a provided + stop sequence, + + `length` if the maximum number of tokens specified in the + request was reached, + + or `content_filter` if content was omitted due to a flag from + our content filters. + enum: + - stop + - length + - content_filter + index: + type: integer + logprobs: + type: object + nullable: true + properties: + text_offset: + type: array + items: + type: integer + token_logprobs: + type: array + items: + type: number + tokens: + type: array + items: + type: string + top_logprobs: + type: array + items: + type: object + additionalProperties: + type: number + text: + type: string + created: + type: integer + description: The Unix timestamp (in seconds) of when the completion was created. + model: + type: string + description: The model used for completion. + system_fingerprint: type: string - description: The user email. - AuditLogEventType: - type: string - description: The event type. - x-oaiExpandable: true - enum: - - api_key.created - - api_key.updated - - api_key.deleted - - invite.sent - - invite.accepted - - invite.deleted - - login.succeeded - - login.failed - - logout.succeeded - - logout.failed - - organization.updated - - project.created - - project.updated - - project.archived - - service_account.created - - service_account.updated - - service_account.deleted - - rate_limit.updated - - rate_limit.deleted - - user.added - - user.updated - - user.deleted - AutoChunkingStrategyRequestParam: - type: object - title: Auto Chunking Strategy - description: The default strategy. This strategy currently uses a - `max_chunk_size_tokens` of `800` and `chunk_overlap_tokens` of `400`. - additionalProperties: false - properties: - type: + description: > + This fingerprint represents the backend configuration that the model + runs with. + + + Can be used in conjunction with the `seed` request parameter to + understand when backend changes have been made that might impact + determinism. + object: type: string - description: Always `auto`. + description: The object type, which is always "text_completion" enum: - - auto + - text_completion + x-stainless-const: true + usage: + $ref: "#/components/schemas/CompletionUsage" required: - - type - Batch: + - id + - object + - created + - model + - choices + x-oaiMeta: + name: The completion object + legacy: true + example: | + { + "id": "cmpl-uqkvlQyYK7bGYrRHQ0eXlWi7", + "object": "text_completion", + "created": 1589478378, + "model": "gpt-4-turbo", + "choices": [ + { + "text": "\n\nThis is indeed a test", + "index": 0, + "logprobs": null, + "finish_reason": "length" + } + ], + "usage": { + "prompt_tokens": 5, + "completion_tokens": 7, + "total_tokens": 12 + } + } + CreateEmbeddingRequest: type: object + additionalProperties: false properties: - id: - type: string - object: - type: string - enum: - - batch - description: The object type, which is always `batch`. - endpoint: - type: string - description: The OpenAI API endpoint used by the batch. - errors: - type: object - properties: - object: - type: string - description: The object type, which is always `list`. - data: - type: array + input: + description: | + Input text to embed, encoded as a string or array of tokens. To embed multiple inputs in a single request, pass an array of strings or array of token arrays. The input must not exceed the max input tokens for the model (8192 tokens for all embedding models), cannot be an empty string, and any array must be 2048 dimensions or less. [Example Python code](https://cookbook.openai.com/examples/how_to_count_tokens_with_tiktoken) for counting tokens. In addition to the per-input token limit, all embedding models enforce a maximum of 300,000 tokens summed across all inputs in a single request. + example: The quick brown fox jumped over the lazy dog + oneOf: + - type: string + title: string + description: The string that will be turned into an embedding. + default: "" + example: This is a test. + - type: array + title: array + description: The array of strings that will be turned into an embedding. + minItems: 1 + maxItems: 2048 items: - type: object - properties: - code: - type: string - description: An error code identifying the error type. - message: - type: string - description: A human-readable message providing more details about the error. - param: - type: string - description: The name of the parameter that caused the error, if applicable. - nullable: true - line: - type: integer - description: The line number of the input file where the error occurred, if - applicable. - nullable: true - input_file_id: - type: string - description: The ID of the input file for the batch. - completion_window: - type: string - description: The time frame within which the batch should be processed. - status: + type: string + default: "" + example: "['This is a test.']" + - type: array + title: array + description: The array of integers that will be turned into an embedding. + minItems: 1 + maxItems: 2048 + items: + type: integer + example: "[1212, 318, 257, 1332, 13]" + - type: array + title: array + description: The array of arrays containing integers that will be turned into an + embedding. + minItems: 1 + maxItems: 2048 + items: + type: array + minItems: 1 + items: + type: integer + example: "[[1212, 318, 257, 1332, 13]]" + model: + description: > + ID of the model to use. You can use the [List + models](/docs/api-reference/models/list) API to see all of your + available models, or see our [Model overview](/docs/models) for + descriptions of them. + example: text-embedding-3-small + anyOf: + - type: string + - type: string + enum: + - text-embedding-ada-002 + - text-embedding-3-small + - text-embedding-3-large + x-oaiTypeLabel: string + encoding_format: + description: The format to return the embeddings in. Can be either `float` or + [`base64`](https://pypi.org/project/pybase64/). + example: float + default: float type: string - description: The current status of the batch. enum: - - validating - - failed - - in_progress - - finalizing - - completed - - expired - - cancelling - - cancelled - output_file_id: - type: string - description: The ID of the file containing the outputs of successfully executed - requests. - error_file_id: - type: string - description: The ID of the file containing the outputs of requests with errors. - created_at: - type: integer - description: The Unix timestamp (in seconds) for when the batch was created. - in_progress_at: - type: integer - description: The Unix timestamp (in seconds) for when the batch started - processing. - expires_at: - type: integer - description: The Unix timestamp (in seconds) for when the batch will expire. - finalizing_at: - type: integer - description: The Unix timestamp (in seconds) for when the batch started - finalizing. - completed_at: - type: integer - description: The Unix timestamp (in seconds) for when the batch was completed. - failed_at: - type: integer - description: The Unix timestamp (in seconds) for when the batch failed. - expired_at: - type: integer - description: The Unix timestamp (in seconds) for when the batch expired. - cancelling_at: - type: integer - description: The Unix timestamp (in seconds) for when the batch started - cancelling. - cancelled_at: + - float + - base64 + dimensions: + description: > + The number of dimensions the resulting output embeddings should + have. Only supported in `text-embedding-3` and later models. type: integer - description: The Unix timestamp (in seconds) for when the batch was cancelled. - request_counts: + minimum: 1 + user: + type: string + example: user-1234 + description: > + A unique identifier representing your end-user, which can help + OpenAI to monitor and detect abuse. [Learn + more](/docs/guides/safety-best-practices#end-user-ids). + required: + - model + - input + CreateEmbeddingResponse: + type: object + properties: + data: + type: array + description: The list of embeddings generated by the model. + items: + $ref: "#/components/schemas/Embedding" + model: + type: string + description: The name of the model used to generate the embedding. + object: + type: string + description: The object type, which is always "list". + enum: + - list + x-stainless-const: true + usage: type: object + description: The usage information for the request. properties: - total: - type: integer - description: Total number of requests in the batch. - completed: + prompt_tokens: type: integer - description: Number of requests that have been completed successfully. - failed: + description: The number of tokens used by the prompt. + total_tokens: type: integer - description: Number of requests that have failed. + description: The total number of tokens used by the request. required: - - total - - completed - - failed - description: The request counts for different statuses within the batch. - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true + - prompt_tokens + - total_tokens required: - - id - object - - endpoint - - input_file_id - - completion_window - - status - - created_at + - model + - data + - usage + CreateEvalCompletionsRunDataSource: + type: object + title: CompletionsRunDataSource + description: > + A CompletionsRunDataSource object describing a model sampling + configuration. + properties: + type: + type: string + enum: + - completions + default: completions + description: The type of run data source. Always `completions`. + input_messages: + description: Used when sampling from a model. Dictates the structure of the + messages passed into the model. Can either be a reference to a + prebuilt trajectory (ie, `item.input_trajectory`), or a template + with variable references to the `item` namespace. + oneOf: + - type: object + title: TemplateInputMessages + properties: + type: + type: string + enum: + - template + description: The type of input messages. Always `template`. + template: + type: array + description: A list of chat messages forming the prompt or context. May include + variable references to the `item` namespace, ie + {{item.name}}. + items: + oneOf: + - $ref: "#/components/schemas/EasyInputMessage" + - $ref: "#/components/schemas/EvalItem" + required: + - type + - template + - type: object + title: ItemReferenceInputMessages + properties: + type: + type: string + enum: + - item_reference + description: The type of input messages. Always `item_reference`. + item_reference: + type: string + description: A reference to a variable in the `item` namespace. Ie, + "item.input_trajectory" + required: + - type + - item_reference + sampling_params: + type: object + properties: + temperature: + type: number + description: A higher temperature increases randomness in the outputs. + default: 1 + max_completion_tokens: + type: integer + description: The maximum number of tokens in the generated output. + top_p: + type: number + description: An alternative to temperature for nucleus sampling; 1.0 includes + all tokens. + default: 1 + seed: + type: integer + description: A seed value to initialize the randomness, during sampling. + default: 42 + model: + type: string + description: The name of the model to use for generating completions (e.g. + "o3-mini"). + source: + description: Determines what populates the `item` namespace in this run's data + source. + oneOf: + - $ref: "#/components/schemas/EvalJsonlFileContentSource" + - $ref: "#/components/schemas/EvalJsonlFileIdSource" + - $ref: "#/components/schemas/EvalStoredCompletionsSource" + required: + - type + - source x-oaiMeta: - name: The batch object + name: The completions data source object used to configure an individual run + group: eval runs example: | { - "id": "batch_abc123", - "object": "batch", - "endpoint": "/v1/completions", - "errors": null, - "input_file_id": "file-abc123", - "completion_window": "24h", - "status": "completed", - "output_file_id": "file-cvaTdG", - "error_file_id": "file-HOWS94", - "created_at": 1711471533, - "in_progress_at": 1711471538, - "expires_at": 1711557933, - "finalizing_at": 1711493133, - "completed_at": 1711493163, - "failed_at": null, - "expired_at": null, - "cancelling_at": null, - "cancelled_at": null, - "request_counts": { - "total": 100, - "completed": 95, - "failed": 5 - }, - "metadata": { - "customer_id": "user_123456789", - "batch_description": "Nightly eval job", + "name": "gpt-4o-mini-2024-07-18", + "data_source": { + "type": "completions", + "input_messages": { + "type": "item_reference", + "item_reference": "item.input" + }, + "model": "gpt-4o-mini-2024-07-18", + "source": { + "type": "stored_completions", + "model": "gpt-4o-mini-2024-07-18" + } } } - BatchRequestInput: + CreateEvalCustomDataSourceConfig: type: object - description: The per-line object of the batch input file + title: CustomDataSourceConfig + description: > + A CustomDataSourceConfig object that defines the schema for the data + source used for the evaluation runs. + + This schema is used to define the shape of the data that will be: + + - Used to define your testing criteria and + + - What data is required when creating a run properties: - custom_id: - type: string - description: A developer-provided per-request id that will be used to match - outputs to inputs. Must be unique for each request in a batch. - method: + type: type: string enum: - - POST - description: The HTTP method to be used for the request. Currently only `POST` - is supported. - url: + - custom + default: custom + description: The type of data source. Always `custom`. + x-stainless-const: true + item_schema: + type: object + description: The json schema for each row in the data source. + additionalProperties: true + example: | + { + "type": "object", + "properties": { + "name": {"type": "string"}, + "age": {"type": "integer"} + }, + "required": ["name", "age"] + } + include_sample_schema: + type: boolean + default: false + description: Whether the eval should expect you to populate the sample namespace + (ie, by generating responses off of your data source) + required: + - item_schema + - type + x-oaiMeta: + name: The eval file data source config object + group: evals + example: | + { + "type": "custom", + "item_schema": { + "type": "object", + "properties": { + "name": {"type": "string"}, + "age": {"type": "integer"} + }, + "required": ["name", "age"] + }, + "include_sample_schema": true + } + CreateEvalItem: + title: CreateEvalItem + description: A chat message that makes up the prompt or context. May include + variable references to the `item` namespace, ie {{item.name}}. + type: object + oneOf: + - type: object + title: SimpleInputMessage + properties: + role: + type: string + description: The role of the message (e.g. "system", "assistant", "user"). + content: + type: string + description: The content of the message. + required: + - role + - content + - $ref: "#/components/schemas/EvalItem" + x-oaiMeta: + name: The chat message object used to configure an individual run + CreateEvalJsonlRunDataSource: + type: object + title: JsonlRunDataSource + description: > + A JsonlRunDataSource object with that specifies a JSONL file that + matches the eval + properties: + type: type: string - description: The OpenAI API relative URL to be used for the request. Currently - `/v1/chat/completions`, `/v1/embeddings`, and `/v1/completions` are - supported. + enum: + - jsonl + default: jsonl + description: The type of data source. Always `jsonl`. + x-stainless-const: true + source: + description: Determines what populates the `item` namespace in the data source. + oneOf: + - $ref: "#/components/schemas/EvalJsonlFileContentSource" + - $ref: "#/components/schemas/EvalJsonlFileIdSource" + required: + - type + - source x-oaiMeta: - name: The request input object - example: > - {"custom_id": "request-1", "method": "POST", "url": - "/v1/chat/completions", "body": {"model": "gpt-4o-mini", "messages": - [{"role": "system", "content": "You are a helpful assistant."}, - {"role": "user", "content": "What is 2+2?"}]}} - BatchRequestOutput: + name: The file data source object for the eval run configuration + group: evals + example: | + { + "type": "jsonl", + "source": { + "type": "file_id", + "id": "file-9GYS6xbkWgWhmE7VoLUWFg" + } + } + CreateEvalLabelModelGrader: type: object - description: The per-line object of the batch output and error files + title: LabelModelGrader + description: > + A LabelModelGrader object which uses a model to assign labels to each + item + + in the evaluation. properties: - id: + type: + description: The object type, which is always `label_model`. type: string - custom_id: + enum: + - label_model + x-stainless-const: true + name: type: string - description: A developer-provided per-request id that will be used to match - outputs to inputs. - response: - type: object - nullable: true - properties: - status_code: - type: integer - description: The HTTP status code of the response - request_id: - type: string - description: An unique identifier for the OpenAI API request. Please include - this request ID when contacting support. - body: - type: object - x-oaiTypeLabel: map - description: The JSON body of the response - error: - type: object - nullable: true - description: For requests that failed with a non-HTTP error, this will contain - more information on the cause of the failure. - properties: - code: - type: string - description: A machine-readable error code. - message: - type: string - description: A human-readable error message. + description: The name of the grader. + model: + type: string + description: The model to use for the evaluation. Must support structured outputs. + input: + type: array + description: A list of chat messages forming the prompt or context. May include + variable references to the `item` namespace, ie {{item.name}}. + items: + $ref: "#/components/schemas/CreateEvalItem" + labels: + type: array + items: + type: string + description: The labels to classify to each item in the evaluation. + passing_labels: + type: array + items: + type: string + description: The labels that indicate a passing result. Must be a subset of + labels. + required: + - type + - model + - input + - passing_labels + - labels + - name x-oaiMeta: - name: The request output object + name: The eval label model grader object + group: evals example: > - {"id": "batch_req_wnaDys", "custom_id": "request-2", "response": - {"status_code": 200, "request_id": "req_c187b3", "body": {"id": - "chatcmpl-9758Iw", "object": "chat.completion", "created": 1711475054, - "model": "gpt-4o-mini", "choices": [{"index": 0, "message": {"role": - "assistant", "content": "2 + 2 equals 4."}, "finish_reason": "stop"}], - "usage": {"prompt_tokens": 24, "completion_tokens": 15, - "total_tokens": 39}, "system_fingerprint": null}}, "error": null} - CancelUploadRequest: + { + "type": "label_model", + "model": "gpt-4o-2024-08-06", + "input": [ + { + "role": "system", + "content": "Classify the sentiment of the following statement as one of 'positive', 'neutral', or 'negative'" + }, + { + "role": "user", + "content": "Statement: {{item.response}}" + } + ], + "passing_labels": ["positive"], + "labels": ["positive", "neutral", "negative"], + "name": "Sentiment label grader" + } + CreateEvalLogsDataSourceConfig: type: object - additionalProperties: false - ChatCompletionFunctionCallOption: + title: LogsDataSourceConfig + description: > + A data source config which specifies the metadata property of your logs + query. + + This is usually metadata like `usecase=chatbot` or `prompt-version=v2`, + etc. + properties: + type: + type: string + enum: + - logs + default: logs + description: The type of data source. Always `logs`. + x-stainless-const: true + metadata: + type: object + description: Metadata filters for the logs data source. + additionalProperties: true + example: | + { + "use_case": "customer_support_agent" + } + required: + - type + x-oaiMeta: + name: The logs data source object for evals + group: evals + example: | + { + "type": "logs", + "metadata": { + "use_case": "customer_support_agent" + } + } + CreateEvalRequest: type: object - description: > - Specifying a particular function via `{"name": "my_function"}` forces - the model to call that function. + title: CreateEvalRequest properties: name: type: string - description: The name of the function to call. + description: The name of the evaluation. + metadata: + $ref: "#/components/schemas/Metadata" + data_source_config: + type: object + description: The configuration for the data source used for the evaluation runs. + Dictates the schema of the data used in the evaluation. + oneOf: + - $ref: "#/components/schemas/CreateEvalCustomDataSourceConfig" + - $ref: "#/components/schemas/CreateEvalLogsDataSourceConfig" + - $ref: "#/components/schemas/CreateEvalStoredCompletionsDataSourceConfig" + testing_criteria: + type: array + description: A list of graders for all eval runs in this group. Graders can + reference variables in the data source using double curly braces + notation, like `{{item.variable_name}}`. To reference the model's + output, use the `sample` namespace (ie, `{{sample.output_text}}`). + items: + oneOf: + - $ref: "#/components/schemas/CreateEvalLabelModelGrader" + - $ref: "#/components/schemas/EvalGraderStringCheck" + - $ref: "#/components/schemas/EvalGraderTextSimilarity" + - $ref: "#/components/schemas/EvalGraderPython" + - $ref: "#/components/schemas/EvalGraderScoreModel" required: - - name - ChatCompletionFunctions: + - data_source_config + - testing_criteria + CreateEvalResponsesRunDataSource: type: object - deprecated: true + title: ResponsesRunDataSource + description: > + A ResponsesRunDataSource object describing a model sampling + configuration. properties: - description: + type: type: string - description: A description of what the function does, used by the model to - choose when and how to call the function. - name: + enum: + - responses + default: responses + description: The type of run data source. Always `responses`. + input_messages: + description: Used when sampling from a model. Dictates the structure of the + messages passed into the model. Can either be a reference to a + prebuilt trajectory (ie, `item.input_trajectory`), or a template + with variable references to the `item` namespace. + oneOf: + - type: object + title: InputMessagesTemplate + properties: + type: + type: string + enum: + - template + description: The type of input messages. Always `template`. + template: + type: array + description: A list of chat messages forming the prompt or context. May include + variable references to the `item` namespace, ie + {{item.name}}. + items: + oneOf: + - type: object + title: ChatMessage + properties: + role: + type: string + description: The role of the message (e.g. "system", "assistant", "user"). + content: + type: string + description: The content of the message. + required: + - role + - content + - $ref: "#/components/schemas/EvalItem" + required: + - type + - template + - type: object + title: InputMessagesItemReference + properties: + type: + type: string + enum: + - item_reference + description: The type of input messages. Always `item_reference`. + item_reference: + type: string + description: A reference to a variable in the `item` namespace. Ie, "item.name" + required: + - type + - item_reference + sampling_params: + type: object + properties: + temperature: + type: number + description: A higher temperature increases randomness in the outputs. + default: 1 + max_completion_tokens: + type: integer + description: The maximum number of tokens in the generated output. + top_p: + type: number + description: An alternative to temperature for nucleus sampling; 1.0 includes + all tokens. + default: 1 + seed: + type: integer + description: A seed value to initialize the randomness, during sampling. + default: 42 + model: type: string - description: The name of the function to be called. Must be a-z, A-Z, 0-9, or - contain underscores and dashes, with a maximum length of 64. - parameters: - $ref: "#/components/schemas/FunctionParameters" + description: The name of the model to use for generating completions (e.g. + "o3-mini"). + source: + description: Determines what populates the `item` namespace in this run's data + source. + oneOf: + - $ref: "#/components/schemas/EvalJsonlFileContentSource" + - $ref: "#/components/schemas/EvalJsonlFileIdSource" + - $ref: "#/components/schemas/EvalResponsesSource" required: - - name - ChatCompletionMessageToolCall: + - type + - source + x-oaiMeta: + name: The completions data source object used to configure an individual run + group: eval runs + example: | + { + "name": "gpt-4o-mini-2024-07-18", + "data_source": { + "type": "responses", + "input_messages": { + "type": "item_reference", + "item_reference": "item.input" + }, + "model": "gpt-4o-mini-2024-07-18", + "source": { + "type": "responses", + "model": "gpt-4o-mini-2024-07-18" + } + } + } + CreateEvalRunRequest: type: object + title: CreateEvalRunRequest properties: - id: + name: type: string - description: The ID of the tool call. + description: The name of the run. + metadata: + $ref: "#/components/schemas/Metadata" + data_source: + type: object + description: Details about the run's data source. + oneOf: + - $ref: "#/components/schemas/CreateEvalJsonlRunDataSource" + - $ref: "#/components/schemas/CreateEvalCompletionsRunDataSource" + - $ref: "#/components/schemas/CreateEvalResponsesRunDataSource" + required: + - data_source + CreateEvalStoredCompletionsDataSourceConfig: + type: object + title: StoredCompletionsDataSourceConfig + description: | + Deprecated in favor of LogsDataSourceConfig. + properties: type: type: string enum: - - function - description: The type of the tool. Currently, only `function` is supported. - function: + - stored_completions + default: stored_completions + description: The type of data source. Always `stored_completions`. + x-stainless-const: true + metadata: type: object - description: The function that the model called. - properties: - name: - type: string - description: The name of the function to call. - arguments: - type: string - description: The arguments to call the function with, as generated by the model - in JSON format. Note that the model does not always generate - valid JSON, and may hallucinate parameters not defined by your - function schema. Validate the arguments in your code before - calling your function. - required: - - name - - arguments + description: Metadata filters for the stored completions data source. + additionalProperties: true + example: | + { + "use_case": "customer_support_agent" + } required: - - id - type - - function - ChatCompletionMessageToolCallChunk: + deprecated: true + x-oaiMeta: + name: The stored completions data source object for evals + group: evals + example: | + { + "type": "stored_completions", + "metadata": { + "use_case": "customer_support_agent" + } + } + CreateFileRequest: type: object + additionalProperties: false properties: - index: - type: integer - id: + file: + description: | + The File object (not file name) to be uploaded. type: string - description: The ID of the tool call. - type: + format: binary + purpose: + description: > + The intended purpose of the uploaded file. One of: - `assistants`: + Used in the Assistants API - `batch`: Used in the Batch API - + `fine-tune`: Used for fine-tuning - `vision`: Images used for vision + fine-tuning - `user_data`: Flexible file type for any purpose - + `evals`: Used for eval data sets type: string enum: - - function - description: The type of the tool. Currently, only `function` is supported. - function: + - assistants + - batch + - fine-tune + - vision + - user_data + - evals + required: + - file + - purpose + CreateFineTuningCheckpointPermissionRequest: + type: object + additionalProperties: false + properties: + project_ids: + type: array + description: The project identifiers to grant access to. + items: + type: string + required: + - project_ids + CreateFineTuningJobRequest: + type: object + properties: + model: + description: > + The name of the model to fine-tune. You can select one of the + + [supported + models](/docs/guides/fine-tuning#which-models-can-be-fine-tuned). + example: gpt-4o-mini + anyOf: + - type: string + - type: string + enum: + - babbage-002 + - davinci-002 + - gpt-3.5-turbo + - gpt-4o-mini + x-oaiTypeLabel: string + training_file: + description: > + The ID of an uploaded file that contains training data. + + + See [upload file](/docs/api-reference/files/create) for how to + upload a file. + + + Your dataset must be formatted as a JSONL file. Additionally, you + must upload your file with the purpose `fine-tune`. + + + The contents of the file should differ depending on if the model + uses the [chat](/docs/api-reference/fine-tuning/chat-input), + [completions](/docs/api-reference/fine-tuning/completions-input) + format, or if the fine-tuning method uses the + [preference](/docs/api-reference/fine-tuning/preference-input) + format. + + + See the [fine-tuning guide](/docs/guides/fine-tuning) for more + details. + type: string + example: file-abc123 + hyperparameters: type: object + description: > + The hyperparameters used for the fine-tuning job. + + This value is now deprecated in favor of `method`, and should be + passed in under the `method` parameter. properties: - name: - type: string - description: The name of the function to call. - arguments: - type: string - description: The arguments to call the function with, as generated by the model - in JSON format. Note that the model does not always generate - valid JSON, and may hallucinate parameters not defined by your - function schema. Validate the arguments in your code before - calling your function. - required: - - index - ChatCompletionMessageToolCalls: - type: array - description: The tool calls generated by the model, such as function calls. - items: - $ref: "#/components/schemas/ChatCompletionMessageToolCall" - ChatCompletionModalities: - type: array - nullable: true - description: > - Output types that you would like the model to generate for this request. + batch_size: + description: > + Number of examples in each batch. A larger batch size means that + model parameters + + are updated less frequently, but with lower variance. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + maximum: 256 + default: auto + learning_rate_multiplier: + description: > + Scaling factor for the learning rate. A smaller learning rate + may be useful to avoid + + overfitting. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: number + minimum: 0 + exclusiveMinimum: true + default: auto + n_epochs: + description: > + The number of epochs to train the model for. An epoch refers to + one full cycle + + through the training dataset. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + maximum: 50 + default: auto + deprecated: true + suffix: + description: > + A string of up to 64 characters that will be added to your + fine-tuned model name. - Most models are capable of generating text, which is the default: + For example, a `suffix` of "custom-model-name" would produce a model + name like `ft:gpt-4o-mini:openai:custom-model-name:7p4lURel`. + type: string + minLength: 1 + maxLength: 64 + default: null + nullable: true + validation_file: + description: > + The ID of an uploaded file that contains validation data. - `["text"]` + If you provide this file, the data is used to generate validation - The `gpt-4o-audio-preview` model can also be used to [generate - audio](/docs/guides/audio). To + metrics periodically during fine-tuning. These metrics can be viewed + in - request that this model generate both text and audio responses, you can + the fine-tuning results file. - use: + The same data should not be present in both train and validation + files. - `["text", "audio"]` - items: - type: string - enum: - - text - - audio - ChatCompletionNamedToolChoice: - type: object - description: Specifies a tool the model should use. Use to force the model to - call a specific function. - properties: - type: + Your dataset must be formatted as a JSONL file. You must upload your + file with the purpose `fine-tune`. + + + See the [fine-tuning guide](/docs/guides/fine-tuning) for more + details. type: string - enum: - - function - description: The type of the tool. Currently, only `function` is supported. - function: - type: object - properties: - name: - type: string - description: The name of the function to call. - required: - - name + nullable: true + example: file-abc123 + integrations: + type: array + description: A list of integrations to enable for your fine-tuning job. + nullable: true + items: + type: object + required: + - type + - wandb + properties: + type: + description: > + The type of integration to enable. Currently, only "wandb" + (Weights and Biases) is supported. + oneOf: + - type: string + enum: + - wandb + x-stainless-const: true + wandb: + type: object + description: > + The settings for your integration with Weights and Biases. + This payload specifies the project that + + metrics will be sent to. Optionally, you can set an explicit + display name for your run, add tags + + to your run, and set a default entity (team, username, etc) to + be associated with your run. + required: + - project + properties: + project: + description: > + The name of the project that the new run will be created + under. + type: string + example: my-wandb-project + name: + description: > + A display name to set for the run. If not set, we will use + the Job ID as the name. + nullable: true + type: string + entity: + description: > + The entity to use for the run. This allows you to set the + team or username of the WandB user that you would + + like associated with the run. If not set, the default + entity for the registered WandB API key is used. + nullable: true + type: string + tags: + description: > + A list of tags to be attached to the newly created run. + These tags are passed through directly to WandB. Some + + default tags are generated by OpenAI: "openai/finetune", + "openai/{base-model}", "openai/{ftjob-abcdef}". + type: array + items: + type: string + example: custom-tag + seed: + description: > + The seed controls the reproducibility of the job. Passing in the + same seed and job parameters should produce the same results, but + may differ in rare cases. + + If a seed is not specified, one will be generated for you. + type: integer + nullable: true + minimum: 0 + maximum: 2147483647 + example: 42 + method: + $ref: "#/components/schemas/FineTuneMethod" + metadata: + $ref: "#/components/schemas/Metadata" required: - - type - - function - ChatCompletionRequestAssistantMessage: + - model + - training_file + CreateImageEditRequest: type: object - title: Assistant message properties: - content: - x-oaiExpandable: true - nullable: true - oneOf: + image: + anyOf: - type: string - description: The contents of the assistant message. - title: Text content + format: binary - type: array - description: An array of content parts with a defined type. Can be one or more - of type `text`, or exactly one of type `refusal`. - title: Array of content parts + maxItems: 16 items: - $ref: "#/components/schemas/ChatCompletionRequestAssistantMessageContentPart" - minItems: 1 + type: string + format: binary description: > - The contents of the assistant message. Required unless `tool_calls` - or `function_call` is specified. - refusal: - nullable: true + The image(s) to edit. Must be a supported image file or an array of + images. + + + For `gpt-image-1`, each image should be a `png`, `webp`, or `jpg` + file less + + than 25MB. You can provide up to 16 images. + + + For `dall-e-2`, you can only provide one image, and it should be a + square + + `png` file less than 4MB. + prompt: + description: A text description of the desired image(s). The maximum length is + 1000 characters for `dall-e-2`, and 32000 characters for + `gpt-image-1`. type: string - description: The refusal message by the assistant. - role: + example: A cute baby sea otter wearing a beret + mask: + description: An additional image whose fully transparent areas (e.g. where alpha + is zero) indicate where `image` should be edited. If there are + multiple images provided, the mask will be applied on the first + image. Must be a valid PNG file, less than 4MB, and have the same + dimensions as `image`. type: string - enum: - - assistant - description: The role of the messages author, in this case `assistant`. - name: + format: binary + background: type: string - description: An optional name for the participant. Provides the model - information to differentiate between participants of the same role. - audio: - type: object + enum: + - transparent + - opaque + - auto + default: auto + example: transparent nullable: true - x-oaiExpandable: true - description: | - Data about a previous audio response from the model. - [Learn more](/docs/guides/audio). - required: - - id - properties: - id: - type: string - description: | - Unique identifier for a previous audio response from the model. - tool_calls: - $ref: "#/components/schemas/ChatCompletionMessageToolCalls" - function_call: - type: object - deprecated: true - description: Deprecated and replaced by `tool_calls`. The name and arguments of - a function that should be called, as generated by the model. + description: > + Allows to set transparency for the background of the generated + image(s). + + This parameter is only supported for `gpt-image-1`. Must be one of + + `transparent`, `opaque` or `auto` (default value). When `auto` is + used, the + + model will automatically determine the best background for the + image. + + + If `transparent`, the output format needs to support transparency, + so it + + should be set to either `png` (default value) or `webp`. + model: + anyOf: + - type: string + - type: string + enum: + - dall-e-2 + - gpt-image-1 + x-stainless-const: true + x-oaiTypeLabel: string + default: dall-e-2 + example: gpt-image-1 nullable: true - properties: - arguments: - type: string - description: The arguments to call the function with, as generated by the model - in JSON format. Note that the model does not always generate - valid JSON, and may hallucinate parameters not defined by your - function schema. Validate the arguments in your code before - calling your function. - name: - type: string - description: The name of the function to call. - required: - - arguments - - name - required: - - role - ChatCompletionRequestAssistantMessageContentPart: - oneOf: - - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartText" - - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartRefusal" - x-oaiExpandable: true - ChatCompletionRequestFunctionMessage: - type: object - title: Function message - deprecated: true - properties: - role: + description: The model to use for image generation. Only `dall-e-2` and + `gpt-image-1` are supported. Defaults to `dall-e-2` unless a + parameter specific to `gpt-image-1` is used. + n: + type: integer + minimum: 1 + maximum: 10 + default: 1 + example: 1 + nullable: true + description: The number of images to generate. Must be between 1 and 10. + size: + type: string + enum: + - 256x256 + - 512x512 + - 1024x1024 + - 1536x1024 + - 1024x1536 + - auto + default: 1024x1024 + example: 1024x1024 + nullable: true + description: The size of the generated images. Must be one of `1024x1024`, + `1536x1024` (landscape), `1024x1536` (portrait), or `auto` (default + value) for `gpt-image-1`, and one of `256x256`, `512x512`, or + `1024x1024` for `dall-e-2`. + response_format: type: string enum: - - function - description: The role of the messages author, in this case `function`. - content: + - url + - b64_json + default: url + example: url nullable: true + description: The format in which the generated images are returned. Must be one + of `url` or `b64_json`. URLs are only valid for 60 minutes after the + image has been generated. This parameter is only supported for + `dall-e-2`, as `gpt-image-1` will always return base64-encoded + images. + user: type: string - description: The contents of the function message. - name: + example: user-1234 + description: > + A unique identifier representing your end-user, which can help + OpenAI to monitor and detect abuse. [Learn + more](/docs/guides/safety-best-practices#end-user-ids). + quality: type: string - description: The name of the function to call. + enum: + - standard + - low + - medium + - high + - auto + default: auto + example: high + nullable: true + description: > + The quality of the image that will be generated. `high`, `medium` + and `low` are only supported for `gpt-image-1`. `dall-e-2` only + supports `standard` quality. Defaults to `auto`. required: - - role - - content - - name - ChatCompletionRequestMessage: - oneOf: - - $ref: "#/components/schemas/ChatCompletionRequestSystemMessage" - - $ref: "#/components/schemas/ChatCompletionRequestUserMessage" - - $ref: "#/components/schemas/ChatCompletionRequestAssistantMessage" - - $ref: "#/components/schemas/ChatCompletionRequestToolMessage" - - $ref: "#/components/schemas/ChatCompletionRequestFunctionMessage" - x-oaiExpandable: true - ChatCompletionRequestMessageContentPartAudio: + - prompt + - image + CreateImageRequest: type: object - title: Audio content part - description: | - Learn about [audio inputs](/docs/guides/audio). properties: - type: + prompt: + description: A text description of the desired image(s). The maximum length is + 32000 characters for `gpt-image-1`, 1000 characters for `dall-e-2` + and 4000 characters for `dall-e-3`. type: string - enum: - - input_audio - description: The type of the content part. Always `input_audio`. - input_audio: - type: object - properties: - data: - type: string - description: Base64 encoded audio data. - format: - type: string + example: A cute baby sea otter + model: + anyOf: + - type: string + - type: string enum: - - wav - - mp3 - description: > - The format of the encoded audio data. Currently supports "wav" - and "mp3". - required: - - data - - format - required: - - type - - input_audio - ChatCompletionRequestMessageContentPartImage: - type: object - title: Image content part - description: | - Learn about [image inputs](/docs/guides/vision). - properties: - type: + - dall-e-2 + - dall-e-3 + - gpt-image-1 + x-oaiTypeLabel: string + default: dall-e-2 + example: gpt-image-1 + nullable: true + description: The model to use for image generation. One of `dall-e-2`, + `dall-e-3`, or `gpt-image-1`. Defaults to `dall-e-2` unless a + parameter specific to `gpt-image-1` is used. + n: + type: integer + minimum: 1 + maximum: 10 + default: 1 + example: 1 + nullable: true + description: The number of images to generate. Must be between 1 and 10. For + `dall-e-3`, only `n=1` is supported. + quality: + type: string + enum: + - standard + - hd + - low + - medium + - high + - auto + default: auto + example: medium + nullable: true + description: > + The quality of the image that will be generated. + + + - `auto` (default value) will automatically select the best quality + for the given model. + + - `high`, `medium` and `low` are supported for `gpt-image-1`. + + - `hd` and `standard` are supported for `dall-e-3`. + + - `standard` is the only option for `dall-e-2`. + response_format: type: string enum: - - image_url - description: The type of the content part. - image_url: - type: object - properties: - url: - type: string - description: Either a URL of the image or the base64 encoded image data. - format: uri - detail: - type: string - description: Specifies the detail level of the image. Learn more in the [Vision - guide](/docs/guides/vision#low-or-high-fidelity-image-understanding). - enum: - - auto - - low - - high - default: auto - required: - url - required: - - type - - image_url - ChatCompletionRequestMessageContentPartRefusal: - type: object - title: Refusal content part - properties: - type: + - b64_json + default: url + example: url + nullable: true + description: The format in which generated images with `dall-e-2` and `dall-e-3` + are returned. Must be one of `url` or `b64_json`. URLs are only + valid for 60 minutes after the image has been generated. This + parameter isn't supported for `gpt-image-1` which will always return + base64-encoded images. + output_format: type: string enum: - - refusal - description: The type of the content part. - refusal: + - png + - jpeg + - webp + default: png + example: png + nullable: true + description: The format in which the generated images are returned. This + parameter is only supported for `gpt-image-1`. Must be one of `png`, + `jpeg`, or `webp`. + output_compression: + type: integer + default: 100 + example: 100 + nullable: true + description: The compression level (0-100%) for the generated images. This + parameter is only supported for `gpt-image-1` with the `webp` or + `jpeg` output formats, and defaults to 100. + size: type: string - description: The refusal message generated by the model. - required: - - type - - refusal - ChatCompletionRequestMessageContentPartText: - type: object - title: Text content part - description: | - Learn about [text inputs](/docs/guides/text-generation). - properties: - type: + enum: + - auto + - 1024x1024 + - 1536x1024 + - 1024x1536 + - 256x256 + - 512x512 + - 1792x1024 + - 1024x1792 + default: auto + example: 1024x1024 + nullable: true + description: The size of the generated images. Must be one of `1024x1024`, + `1536x1024` (landscape), `1024x1536` (portrait), or `auto` (default + value) for `gpt-image-1`, one of `256x256`, `512x512`, or + `1024x1024` for `dall-e-2`, and one of `1024x1024`, `1792x1024`, or + `1024x1792` for `dall-e-3`. + moderation: type: string enum: - - text - description: The type of the content part. - text: + - low + - auto + default: auto + example: low + nullable: true + description: Control the content-moderation level for images generated by + `gpt-image-1`. Must be either `low` for less restrictive filtering + or `auto` (default value). + background: type: string - description: The text content. + enum: + - transparent + - opaque + - auto + default: auto + example: transparent + nullable: true + description: > + Allows to set transparency for the background of the generated + image(s). + + This parameter is only supported for `gpt-image-1`. Must be one of + + `transparent`, `opaque` or `auto` (default value). When `auto` is + used, the + + model will automatically determine the best background for the + image. + + + If `transparent`, the output format needs to support transparency, + so it + + should be set to either `png` (default value) or `webp`. + style: + type: string + enum: + - vivid + - natural + default: vivid + example: vivid + nullable: true + description: The style of the generated images. This parameter is only supported + for `dall-e-3`. Must be one of `vivid` or `natural`. Vivid causes + the model to lean towards generating hyper-real and dramatic images. + Natural causes the model to produce more natural, less hyper-real + looking images. + user: + type: string + example: user-1234 + description: > + A unique identifier representing your end-user, which can help + OpenAI to monitor and detect abuse. [Learn + more](/docs/guides/safety-best-practices#end-user-ids). required: - - type - - text - ChatCompletionRequestSystemMessage: + - prompt + CreateImageVariationRequest: type: object - title: System message properties: - content: - description: The contents of the system message. - oneOf: + image: + description: The image to use as the basis for the variation(s). Must be a valid + PNG file, less than 4MB, and square. + type: string + format: binary + model: + anyOf: - type: string - description: The contents of the system message. - title: Text content - - type: array - description: An array of content parts with a defined type. For system messages, - only type `text` is supported. - title: Array of content parts - items: - $ref: "#/components/schemas/ChatCompletionRequestSystemMessageContentPart" - minItems: 1 - role: + - type: string + enum: + - dall-e-2 + x-stainless-const: true + x-oaiTypeLabel: string + default: dall-e-2 + example: dall-e-2 + nullable: true + description: The model to use for image generation. Only `dall-e-2` is supported + at this time. + n: + type: integer + minimum: 1 + maximum: 10 + default: 1 + example: 1 + nullable: true + description: The number of images to generate. Must be between 1 and 10. + response_format: + type: string + enum: + - url + - b64_json + default: url + example: url + nullable: true + description: The format in which the generated images are returned. Must be one + of `url` or `b64_json`. URLs are only valid for 60 minutes after the + image has been generated. + size: type: string enum: - - system - description: The role of the messages author, in this case `system`. - name: + - 256x256 + - 512x512 + - 1024x1024 + default: 1024x1024 + example: 1024x1024 + nullable: true + description: The size of the generated images. Must be one of `256x256`, + `512x512`, or `1024x1024`. + user: type: string - description: An optional name for the participant. Provides the model - information to differentiate between participants of the same role. + example: user-1234 + description: > + A unique identifier representing your end-user, which can help + OpenAI to monitor and detect abuse. [Learn + more](/docs/guides/safety-best-practices#end-user-ids). required: - - content - - role - ChatCompletionRequestSystemMessageContentPart: - oneOf: - - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartText" - x-oaiExpandable: true - ChatCompletionRequestToolMessage: + - image + CreateMessageRequest: type: object - title: Tool message + additionalProperties: false + required: + - role + - content properties: role: type: string enum: - - tool - description: The role of the messages author, in this case `tool`. + - user + - assistant + description: > + The role of the entity that is creating the message. Allowed values + include: + + - `user`: Indicates the message is sent by an actual user and should + be used in most cases to represent user-generated messages. + + - `assistant`: Indicates the message is generated by the assistant. + Use this value to insert messages from the assistant into the + conversation. content: oneOf: - type: string - description: The contents of the tool message. + description: The text contents of the message. title: Text content - type: array - description: An array of content parts with a defined type. For tool messages, - only type `text` is supported. + description: An array of content parts with a defined type, each can be of type + `text` or images can be passed with `image_url` or `image_file`. + Image types are only supported on [Vision-compatible + models](/docs/models). title: Array of content parts items: - $ref: "#/components/schemas/ChatCompletionRequestToolMessageContentPart" + oneOf: + - $ref: "#/components/schemas/MessageContentImageFileObject" + - $ref: "#/components/schemas/MessageContentImageUrlObject" + - $ref: "#/components/schemas/MessageRequestContentTextObject" minItems: 1 - description: The contents of the tool message. - tool_call_id: - type: string - description: Tool call that this message is responding to. - required: - - role - - content - - tool_call_id - ChatCompletionRequestToolMessageContentPart: - oneOf: - - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartText" - x-oaiExpandable: true - ChatCompletionRequestUserMessage: + attachments: + type: array + items: + type: object + properties: + file_id: + type: string + description: The ID of the file to attach to the message. + tools: + description: The tools to add this file to. + type: array + items: + oneOf: + - $ref: "#/components/schemas/AssistantToolsCode" + - $ref: "#/components/schemas/AssistantToolsFileSearchTypeOnly" + description: A list of files attached to the message, and the tools they should + be added to. + required: + - file_id + - tools + nullable: true + metadata: + $ref: "#/components/schemas/Metadata" + CreateModelResponseProperties: + allOf: + - $ref: "#/components/schemas/ModelResponseProperties" + CreateModerationRequest: type: object - title: User message properties: - content: - description: | - The contents of the user message. + input: + description: > + Input (or inputs) to classify. Can be a single string, an array of + strings, or + + an array of multi-modal input objects similar to other models. oneOf: - type: string - description: The text contents of the message. - title: Text content + description: A string of text to classify for moderation. + default: "" + example: I want to kill them. - type: array - description: An array of content parts with a defined type. Supported options - differ based on the [model](/docs/models) being used to generate - the response. Can contain text, image, or audio inputs. - title: Array of content parts + description: An array of strings to classify for moderation. items: - $ref: "#/components/schemas/ChatCompletionRequestUserMessageContentPart" - minItems: 1 - x-oaiExpandable: true - role: - type: string - enum: - - user - description: The role of the messages author, in this case `user`. - name: - type: string - description: An optional name for the participant. Provides the model - information to differentiate between participants of the same role. - required: - - content - - role - ChatCompletionRequestUserMessageContentPart: - oneOf: - - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartText" - - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartImage" - - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartAudio" - x-oaiExpandable: true - ChatCompletionResponseMessage: - type: object - description: A chat completion message generated by the model. - properties: - content: - type: string - description: The contents of the message. - nullable: true - refusal: - type: string - description: The refusal message generated by the model. - nullable: true - tool_calls: - $ref: "#/components/schemas/ChatCompletionMessageToolCalls" - role: - type: string - enum: - - assistant - description: The role of the author of this message. - function_call: - type: object - deprecated: true - description: Deprecated and replaced by `tool_calls`. The name and arguments of - a function that should be called, as generated by the model. - properties: - arguments: - type: string - description: The arguments to call the function with, as generated by the model - in JSON format. Note that the model does not always generate - valid JSON, and may hallucinate parameters not defined by your - function schema. Validate the arguments in your code before - calling your function. - name: - type: string - description: The name of the function to call. - required: - - name - - arguments - audio: - type: object - nullable: true - description: > - If the audio output modality is requested, this object contains data - - about the audio response from the model. [Learn - more](/docs/guides/audio). - x-oaiExpandable: true - required: - - id - - expires_at - - data - - transcript - properties: - id: - type: string - description: Unique identifier for this audio response. - expires_at: - type: integer - description: > - The Unix timestamp (in seconds) for when this audio response - will - - no longer be accessible on the server for use in multi-turn - - conversations. - data: - type: string - description: | - Base64 encoded audio bytes generated by the model, in the format - specified in the request. - transcript: - type: string - description: Transcript of the audio generated by the model. + type: string + default: "" + example: I want to kill them. + - type: array + description: An array of multi-modal inputs to the moderation model. + items: + oneOf: + - type: object + description: An object describing an image to classify. + properties: + type: + description: Always `image_url`. + type: string + enum: + - image_url + x-stainless-const: true + image_url: + type: object + description: Contains either an image URL or a data URL for a base64 encoded + image. + properties: + url: + type: string + description: Either a URL of the image or the base64 encoded image data. + format: uri + example: https://example.com/image.jpg + required: + - url + required: + - type + - image_url + - type: object + description: An object describing text to classify. + properties: + type: + description: Always `text`. + type: string + enum: + - text + x-stainless-const: true + text: + description: A string of text to classify. + type: string + example: I want to kill them + required: + - type + - text + model: + description: | + The content moderation model you would like to use. Learn more in + [the moderation guide](/docs/guides/moderation), and learn about + available models [here](/docs/models#moderation). + nullable: false + default: omni-moderation-latest + example: omni-moderation-2024-09-26 + anyOf: + - type: string + - type: string + enum: + - omni-moderation-latest + - omni-moderation-2024-09-26 + - text-moderation-latest + - text-moderation-stable + x-oaiTypeLabel: string required: - - role - - content - - refusal - ChatCompletionRole: - type: string - description: The role of the author of a message - enum: - - system - - user - - assistant - - tool - - function - ChatCompletionStreamOptions: - description: > - Options for streaming response. Only set this when you set `stream: - true`. - type: object - nullable: true - default: null - properties: - include_usage: - type: boolean - description: > - If set, an additional chunk will be streamed before the `data: - [DONE]` message. The `usage` field on this chunk shows the token - usage statistics for the entire request, and the `choices` field - will always be an empty array. All other chunks will also include a - `usage` field, but with a null value. - ChatCompletionStreamResponseDelta: + - input + CreateModerationResponse: type: object - description: A chat completion delta generated by streamed model responses. + description: Represents if a given text input is potentially harmful. properties: - content: - type: string - description: The contents of the chunk message. - nullable: true - function_call: - deprecated: true - type: object - description: Deprecated and replaced by `tool_calls`. The name and arguments of - a function that should be called, as generated by the model. - properties: - arguments: - type: string - description: The arguments to call the function with, as generated by the model - in JSON format. Note that the model does not always generate - valid JSON, and may hallucinate parameters not defined by your - function schema. Validate the arguments in your code before - calling your function. - name: - type: string - description: The name of the function to call. - tool_calls: - type: array - items: - $ref: "#/components/schemas/ChatCompletionMessageToolCallChunk" - role: - type: string - enum: - - system - - user - - assistant - - tool - description: The role of the author of this message. - refusal: + id: type: string - description: The refusal message generated by the model. - nullable: true - ChatCompletionTokenLogprob: - type: object - properties: - token: &a1 - description: The token. + description: The unique identifier for the moderation request. + model: type: string - logprob: &a2 - description: The log probability of this token, if it is within the top 20 most - likely tokens. Otherwise, the value `-9999.0` is used to signify - that the token is very unlikely. - type: number - bytes: &a3 - description: A list of integers representing the UTF-8 bytes representation of - the token. Useful in instances where characters are represented by - multiple tokens and their byte representations must be combined to - generate the correct text representation. Can be `null` if there is - no bytes representation for the token. - type: array - items: - type: integer - nullable: true - top_logprobs: - description: List of the most likely tokens and their log probability, at this - token position. In rare cases, there may be fewer than the number of - requested `top_logprobs` returned. + description: The model used to generate the moderation results. + results: type: array + description: A list of moderation objects. items: type: object properties: - token: *a1 - logprob: *a2 - bytes: *a3 + flagged: + type: boolean + description: Whether any of the below categories are flagged. + categories: + type: object + description: A list of the categories, and whether they are flagged or not. + properties: + hate: + type: boolean + description: Content that expresses, incites, or promotes hate based on race, + gender, ethnicity, religion, nationality, sexual + orientation, disability status, or caste. Hateful content + aimed at non-protected groups (e.g., chess players) is + harassment. + hate/threatening: + type: boolean + description: Hateful content that also includes violence or serious harm towards + the targeted group based on race, gender, ethnicity, + religion, nationality, sexual orientation, disability + status, or caste. + harassment: + type: boolean + description: Content that expresses, incites, or promotes harassing language + towards any target. + harassment/threatening: + type: boolean + description: Harassment content that also includes violence or serious harm + towards any target. + illicit: + type: boolean + nullable: true + description: Content that includes instructions or advice that facilitate the + planning or execution of wrongdoing, or that gives advice + or instruction on how to commit illicit acts. For example, + "how to shoplift" would fit this category. + illicit/violent: + type: boolean + nullable: true + description: Content that includes instructions or advice that facilitate the + planning or execution of wrongdoing that also includes + violence, or that gives advice or instruction on the + procurement of any weapon. + self-harm: + type: boolean + description: Content that promotes, encourages, or depicts acts of self-harm, + such as suicide, cutting, and eating disorders. + self-harm/intent: + type: boolean + description: Content where the speaker expresses that they are engaging or + intend to engage in acts of self-harm, such as suicide, + cutting, and eating disorders. + self-harm/instructions: + type: boolean + description: Content that encourages performing acts of self-harm, such as + suicide, cutting, and eating disorders, or that gives + instructions or advice on how to commit such acts. + sexual: + type: boolean + description: Content meant to arouse sexual excitement, such as the description + of sexual activity, or that promotes sexual services + (excluding sex education and wellness). + sexual/minors: + type: boolean + description: Sexual content that includes an individual who is under 18 years + old. + violence: + type: boolean + description: Content that depicts death, violence, or physical injury. + violence/graphic: + type: boolean + description: Content that depicts death, violence, or physical injury in graphic + detail. + required: + - hate + - hate/threatening + - harassment + - harassment/threatening + - illicit + - illicit/violent + - self-harm + - self-harm/intent + - self-harm/instructions + - sexual + - sexual/minors + - violence + - violence/graphic + category_scores: + type: object + description: A list of the categories along with their scores as predicted by + model. + properties: + hate: + type: number + description: The score for the category 'hate'. + hate/threatening: + type: number + description: The score for the category 'hate/threatening'. + harassment: + type: number + description: The score for the category 'harassment'. + harassment/threatening: + type: number + description: The score for the category 'harassment/threatening'. + illicit: + type: number + description: The score for the category 'illicit'. + illicit/violent: + type: number + description: The score for the category 'illicit/violent'. + self-harm: + type: number + description: The score for the category 'self-harm'. + self-harm/intent: + type: number + description: The score for the category 'self-harm/intent'. + self-harm/instructions: + type: number + description: The score for the category 'self-harm/instructions'. + sexual: + type: number + description: The score for the category 'sexual'. + sexual/minors: + type: number + description: The score for the category 'sexual/minors'. + violence: + type: number + description: The score for the category 'violence'. + violence/graphic: + type: number + description: The score for the category 'violence/graphic'. + required: + - hate + - hate/threatening + - harassment + - harassment/threatening + - illicit + - illicit/violent + - self-harm + - self-harm/intent + - self-harm/instructions + - sexual + - sexual/minors + - violence + - violence/graphic + category_applied_input_types: + type: object + description: A list of the categories along with the input type(s) that the + score applies to. + properties: + hate: + type: array + description: The applied input type(s) for the category 'hate'. + items: + type: string + enum: + - text + x-stainless-const: true + hate/threatening: + type: array + description: The applied input type(s) for the category 'hate/threatening'. + items: + type: string + enum: + - text + x-stainless-const: true + harassment: + type: array + description: The applied input type(s) for the category 'harassment'. + items: + type: string + enum: + - text + x-stainless-const: true + harassment/threatening: + type: array + description: The applied input type(s) for the category + 'harassment/threatening'. + items: + type: string + enum: + - text + x-stainless-const: true + illicit: + type: array + description: The applied input type(s) for the category 'illicit'. + items: + type: string + enum: + - text + x-stainless-const: true + illicit/violent: + type: array + description: The applied input type(s) for the category 'illicit/violent'. + items: + type: string + enum: + - text + x-stainless-const: true + self-harm: + type: array + description: The applied input type(s) for the category 'self-harm'. + items: + type: string + enum: + - text + - image + self-harm/intent: + type: array + description: The applied input type(s) for the category 'self-harm/intent'. + items: + type: string + enum: + - text + - image + self-harm/instructions: + type: array + description: The applied input type(s) for the category + 'self-harm/instructions'. + items: + type: string + enum: + - text + - image + sexual: + type: array + description: The applied input type(s) for the category 'sexual'. + items: + type: string + enum: + - text + - image + sexual/minors: + type: array + description: The applied input type(s) for the category 'sexual/minors'. + items: + type: string + enum: + - text + x-stainless-const: true + violence: + type: array + description: The applied input type(s) for the category 'violence'. + items: + type: string + enum: + - text + - image + violence/graphic: + type: array + description: The applied input type(s) for the category 'violence/graphic'. + items: + type: string + enum: + - text + - image + required: + - hate + - hate/threatening + - harassment + - harassment/threatening + - illicit + - illicit/violent + - self-harm + - self-harm/intent + - self-harm/instructions + - sexual + - sexual/minors + - violence + - violence/graphic required: - - token - - logprob - - bytes - required: - - token - - logprob - - bytes - - top_logprobs - ChatCompletionTool: - type: object - properties: - type: - type: string - enum: - - function - description: The type of the tool. Currently, only `function` is supported. - function: - $ref: "#/components/schemas/FunctionObject" - required: - - type - - function - ChatCompletionToolChoiceOption: - description: > - Controls which (if any) tool is called by the model. - - `none` means the model will not call any tool and instead generates a - message. - - `auto` means the model can pick between generating a message or calling - one or more tools. - - `required` means the model must call one or more tools. - - Specifying a particular tool via `{"type": "function", "function": - {"name": "my_function"}}` forces the model to call that tool. - - - `none` is the default when no tools are present. `auto` is the default - if tools are present. - oneOf: - - type: string - description: > - `none` means the model will not call any tool and instead generates - a message. `auto` means the model can pick between generating a - message or calling one or more tools. `required` means the model - must call one or more tools. - enum: - - none - - auto - - required - - $ref: "#/components/schemas/ChatCompletionNamedToolChoice" - x-oaiExpandable: true - ChunkingStrategyRequestParam: - type: object - description: The chunking strategy used to chunk the file(s). If not set, will - use the `auto` strategy. - oneOf: - - $ref: "#/components/schemas/AutoChunkingStrategyRequestParam" - - $ref: "#/components/schemas/StaticChunkingStrategyRequestParam" - x-oaiExpandable: true - CompleteUploadRequest: - type: object - additionalProperties: false - properties: - part_ids: - type: array - description: | - The ordered list of Part IDs. - items: - type: string - md5: - description: > - The optional md5 checksum for the file contents to verify if the - bytes uploaded matches what you expect. - type: string + - flagged + - categories + - category_scores + - category_applied_input_types required: - - part_ids - CompletionUsage: - type: object - description: Usage statistics for the completion request. - properties: - completion_tokens: - type: integer - description: Number of tokens in the generated completion. - prompt_tokens: - type: integer - description: Number of tokens in the prompt. - total_tokens: - type: integer - description: Total number of tokens used in the request (prompt + completion). - completion_tokens_details: - type: object - description: Breakdown of tokens used in a completion. + - id + - model + - results + x-oaiMeta: + name: The moderation object + example: | + { + "id": "modr-0d9740456c391e43c445bf0f010940c7", + "model": "omni-moderation-latest", + "results": [ + { + "flagged": true, + "categories": { + "harassment": true, + "harassment/threatening": true, + "sexual": false, + "hate": false, + "hate/threatening": false, + "illicit": false, + "illicit/violent": false, + "self-harm/intent": false, + "self-harm/instructions": false, + "self-harm": false, + "sexual/minors": false, + "violence": true, + "violence/graphic": true + }, + "category_scores": { + "harassment": 0.8189693396524255, + "harassment/threatening": 0.804985420696006, + "sexual": 1.573112165348997e-6, + "hate": 0.007562942636942845, + "hate/threatening": 0.004208854591835476, + "illicit": 0.030535955153511665, + "illicit/violent": 0.008925306722380033, + "self-harm/intent": 0.00023023930975076432, + "self-harm/instructions": 0.0002293869201073356, + "self-harm": 0.012598046106750154, + "sexual/minors": 2.212566909570261e-8, + "violence": 0.9999992735124786, + "violence/graphic": 0.843064871157054 + }, + "category_applied_input_types": { + "harassment": [ + "text" + ], + "harassment/threatening": [ + "text" + ], + "sexual": [ + "text", + "image" + ], + "hate": [ + "text" + ], + "hate/threatening": [ + "text" + ], + "illicit": [ + "text" + ], + "illicit/violent": [ + "text" + ], + "self-harm/intent": [ + "text", + "image" + ], + "self-harm/instructions": [ + "text", + "image" + ], + "self-harm": [ + "text", + "image" + ], + "sexual/minors": [ + "text" + ], + "violence": [ + "text", + "image" + ], + "violence/graphic": [ + "text", + "image" + ] + } + } + ] + } + CreateResponse: + allOf: + - $ref: "#/components/schemas/CreateModelResponseProperties" + - $ref: "#/components/schemas/ResponseProperties" + - type: object properties: - accepted_prediction_tokens: - type: integer - description: | - When using Predicted Outputs, the number of tokens in the - prediction that appeared in the completion. - audio_tokens: - type: integer - description: Audio input tokens generated by the model. - reasoning_tokens: - type: integer - description: Tokens generated by the model for reasoning. - rejected_prediction_tokens: - type: integer + input: description: > - When using Predicted Outputs, the number of tokens in the + Text, image, or file inputs to the model, used to generate a + response. - prediction that did not appear in the completion. However, like - reasoning tokens, these tokens are still counted in the total + Learn more: - completion tokens for purposes of billing, output, and context - window + - [Text inputs and outputs](/docs/guides/text) - limits. - prompt_tokens_details: - type: object - description: Breakdown of tokens used in the prompt. - properties: - audio_tokens: - type: integer - description: Audio input tokens present in the prompt. - cached_tokens: - type: integer - description: Cached tokens present in the prompt. - required: - - prompt_tokens - - completion_tokens - - total_tokens - CreateAssistantRequest: - type: object - additionalProperties: false - properties: - model: - description: > - ID of the model to use. You can use the [List - models](/docs/api-reference/models/list) API to see all of your - available models, or see our [Model overview](/docs/models) for - descriptions of them. - example: gpt-4o - anyOf: - - type: string - - type: string - enum: - - gpt-4o - - gpt-4o-2024-08-06 - - gpt-4o-2024-05-13 - - gpt-4o-2024-08-06 - - gpt-4o-mini - - gpt-4o-mini-2024-07-18 - - gpt-4-turbo - - gpt-4-turbo-2024-04-09 - - gpt-4-0125-preview - - gpt-4-turbo-preview - - gpt-4-1106-preview - - gpt-4-vision-preview - - gpt-4 - - gpt-4-0314 - - gpt-4-0613 - - gpt-4-32k - - gpt-4-32k-0314 - - gpt-4-32k-0613 - - gpt-3.5-turbo - - gpt-3.5-turbo-16k - - gpt-3.5-turbo-0613 - - gpt-3.5-turbo-1106 - - gpt-3.5-turbo-0125 - - gpt-3.5-turbo-16k-0613 - x-oaiTypeLabel: string - name: - description: | - The name of the assistant. The maximum length is 256 characters. - type: string - nullable: true - maxLength: 256 - description: - description: > - The description of the assistant. The maximum length is 512 - characters. - type: string - nullable: true - maxLength: 512 - instructions: - description: > - The system instructions that the assistant uses. The maximum length - is 256,000 characters. - type: string - nullable: true - maxLength: 256000 - tools: - description: > - A list of tool enabled on the assistant. There can be a maximum of - 128 tools per assistant. Tools can be of types `code_interpreter`, - `file_search`, or `function`. - default: [] - type: array - maxItems: 128 - items: - oneOf: - - $ref: "#/components/schemas/AssistantToolsCode" - - $ref: "#/components/schemas/AssistantToolsFileSearch" - - $ref: "#/components/schemas/AssistantToolsFunction" - x-oaiExpandable: true - tool_resources: - type: object - description: > - A set of resources that are used by the assistant's tools. The - resources are specific to the type of tool. For example, the - `code_interpreter` tool requires a list of file IDs, while the - `file_search` tool requires a list of vector store IDs. - properties: - code_interpreter: - type: object - properties: - file_ids: - type: array - description: > - A list of [file](/docs/api-reference/files) IDs made - available to the `code_interpreter` tool. There can be a - maximum of 20 files associated with the tool. - default: [] - maxItems: 20 - items: - type: string - file_search: - type: object - properties: - vector_store_ids: - type: array - description: > - The [vector store](/docs/api-reference/vector-stores/object) - attached to this assistant. There can be a maximum of 1 - vector store attached to the assistant. - maxItems: 1 - items: - type: string - vector_stores: - type: array + - [Image inputs](/docs/guides/images) + + - [File inputs](/docs/guides/pdf-files) + + - [Conversation state](/docs/guides/conversation-state) + + - [Function calling](/docs/guides/function-calling) + oneOf: + - type: string + title: Text input description: > - A helper to create a [vector - store](/docs/api-reference/vector-stores/object) with - file_ids and attach it to this assistant. There can be a - maximum of 1 vector store attached to the assistant. - maxItems: 1 + A text input to the model, equivalent to a text input with + the + + `user` role. + - type: array + title: Input item list + description: | + A list of one or many input items to the model, containing + different content types. items: - type: object - properties: - file_ids: - type: array - description: > - A list of [file](/docs/api-reference/files) IDs to add - to the vector store. There can be a maximum of 10000 - files in a vector store. - maxItems: 10000 - items: - type: string - chunking_strategy: - type: object - description: The chunking strategy used to chunk the file(s). If not set, will - use the `auto` strategy. - oneOf: - - type: object - title: Auto Chunking Strategy - description: The default strategy. This strategy currently uses a - `max_chunk_size_tokens` of `800` and - `chunk_overlap_tokens` of `400`. - additionalProperties: false - properties: - type: - type: string - description: Always `auto`. - enum: - - auto - required: - - type - - type: object - title: Static Chunking Strategy - additionalProperties: false - properties: - type: - type: string - description: Always `static`. - enum: - - static - static: - type: object - additionalProperties: false - properties: - max_chunk_size_tokens: - type: integer - minimum: 100 - maximum: 4096 - description: The maximum number of tokens in each chunk. The default value is - `800`. The minimum value is `100` and the - maximum value is `4096`. - chunk_overlap_tokens: - type: integer - description: > - The number of tokens that overlap between - chunks. The default value is `400`. + $ref: "#/components/schemas/InputItem" + include: + type: array + description: > + Specify additional output data to include in the model response. + Currently + + supported values are: + + - `file_search_call.results`: Include the search results of + the file search tool call. + - `message.input_image.image_url`: Include image urls from the + input message. + + - `computer_call_output.output.image_url`: Include image urls + from the computer call output. + - `reasoning.encrypted_content`: Includes an encrypted version + of reasoning + tokens in reasoning item outputs. This enables reasoning items to be used in + multi-turn conversations when using the Responses API statelessly (like + when the `store` parameter is set to `false`, or when an organization is + enrolled in the zero data retention program). + items: + $ref: "#/components/schemas/Includable" + nullable: true + parallel_tool_calls: + type: boolean + description: | + Whether to allow the model to run tool calls in parallel. + default: true + nullable: true + store: + type: boolean + description: > + Whether to store the generated model response for later + retrieval via - Note that the overlap must not exceed half - of `max_chunk_size_tokens`. - required: - - max_chunk_size_tokens - - chunk_overlap_tokens - required: - - type - - static - x-oaiExpandable: true - metadata: - type: object - description: > - Set of 16 key-value pairs that can be attached to a - vector store. This can be useful for storing - additional information about the vector store in a - structured format. Keys can be a maximum of 64 - characters long and values can be a maximum of 512 - characters long. - x-oaiTypeLabel: map - oneOf: - - required: - - vector_store_ids - - required: - - vector_stores + API. + default: true + nullable: true + stream: + description: | + If set to true, the model response data will be streamed to the client + as it is generated using [server-sent events](https://developer.mozilla.org/en-US/docs/Web/API/Server-sent_events/Using_server-sent_events#Event_stream_format). + See the [Streaming section below](/docs/api-reference/responses-streaming) + for more information. + type: boolean + nullable: true + default: false + required: + - model + - input + CreateRunRequest: + type: object + additionalProperties: false + properties: + assistant_id: + description: The ID of the [assistant](/docs/api-reference/assistants) to use to + execute this run. + type: string + model: + description: The ID of the [Model](/docs/api-reference/models) to be used to + execute this run. If a value is provided here, it will override the + model associated with the assistant. If not, the model associated + with the assistant will be used. + example: gpt-4o + anyOf: + - type: string + - $ref: "#/components/schemas/AssistantSupportedModels" + x-oaiTypeLabel: string nullable: true - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map + reasoning_effort: + $ref: "#/components/schemas/ReasoningEffort" + instructions: + description: Overrides the + [instructions](/docs/api-reference/assistants/createAssistant) of + the assistant. This is useful for modifying the behavior on a + per-run basis. + type: string + nullable: true + additional_instructions: + description: Appends additional instructions at the end of the instructions for + the run. This is useful for modifying the behavior on a per-run + basis without overriding other instructions. + type: string + nullable: true + additional_messages: + description: Adds additional messages to the thread before creating the run. + type: array + items: + $ref: "#/components/schemas/CreateMessageRequest" + nullable: true + tools: + description: Override the tools the assistant can use for this run. This is + useful for modifying the behavior on a per-run basis. nullable: true + type: array + maxItems: 20 + items: + oneOf: + - $ref: "#/components/schemas/AssistantToolsCode" + - $ref: "#/components/schemas/AssistantToolsFileSearch" + - $ref: "#/components/schemas/AssistantToolsFunction" + metadata: + $ref: "#/components/schemas/Metadata" temperature: - description: > - What sampling temperature to use, between 0 and 2. Higher values - like 0.8 will make the output more random, while lower values like - 0.2 will make it more focused and deterministic. type: number minimum: 0 maximum: 2 default: 1 example: 1 nullable: true + description: > + What sampling temperature to use, between 0 and 2. Higher values + like 0.8 will make the output more random, while lower values like + 0.2 will make it more focused and deterministic. top_p: type: number minimum: 0 @@ -11901,197 +22701,139 @@ components: We generally recommend altering this or temperature but not both. + stream: + type: boolean + nullable: true + description: > + If `true`, returns a stream of events that happen during the Run as + server-sent events, terminating when the Run enters a terminal state + with a `data: [DONE]` message. + max_prompt_tokens: + type: integer + nullable: true + description: > + The maximum number of prompt tokens that may be used over the course + of the run. The run will make a best effort to use only the number + of prompt tokens specified, across multiple turns of the run. If the + run exceeds the number of prompt tokens specified, the run will end + with status `incomplete`. See `incomplete_details` for more info. + minimum: 256 + max_completion_tokens: + type: integer + nullable: true + description: > + The maximum number of completion tokens that may be used over the + course of the run. The run will make a best effort to use only the + number of completion tokens specified, across multiple turns of the + run. If the run exceeds the number of completion tokens specified, + the run will end with status `incomplete`. See `incomplete_details` + for more info. + minimum: 256 + truncation_strategy: + allOf: + - $ref: "#/components/schemas/TruncationObject" + - nullable: true + tool_choice: + allOf: + - $ref: "#/components/schemas/AssistantsApiToolChoiceOption" + - nullable: true + parallel_tool_calls: + $ref: "#/components/schemas/ParallelToolCalls" response_format: $ref: "#/components/schemas/AssistantsApiResponseFormatOption" nullable: true required: - - model - CreateChatCompletionFunctionResponse: + - assistant_id + CreateSpeechRequest: type: object - description: Represents a chat completion response returned by model, based on - the provided input. + additionalProperties: false properties: - id: - type: string - description: A unique identifier for the chat completion. - choices: - type: array - description: A list of chat completion choices. Can be more than one if `n` is - greater than 1. - items: - type: object - required: - - finish_reason - - index - - message - - logprobs - properties: - finish_reason: - type: string - description: > - The reason the model stopped generating tokens. This will be - `stop` if the model hit a natural stop point or a provided - stop sequence, `length` if the maximum number of tokens - specified in the request was reached, `content_filter` if - content was omitted due to a flag from our content filters, or - `function_call` if the model called a function. - enum: - - stop - - length - - function_call - - content_filter - index: - type: integer - description: The index of the choice in the list of choices. - message: - $ref: "#/components/schemas/ChatCompletionResponseMessage" - created: - type: integer - description: The Unix timestamp (in seconds) of when the chat completion was - created. model: + description: > + One of the available [TTS models](/docs/models#tts): `tts-1`, + `tts-1-hd` or `gpt-4o-mini-tts`. + anyOf: + - type: string + - type: string + enum: + - tts-1 + - tts-1-hd + - gpt-4o-mini-tts + x-oaiTypeLabel: string + input: type: string - description: The model used for the chat completion. - system_fingerprint: + description: The text to generate audio for. The maximum length is 4096 + characters. + maxLength: 4096 + instructions: type: string - description: > - This fingerprint represents the backend configuration that the model - runs with. - - - Can be used in conjunction with the `seed` request parameter to - understand when backend changes have been made that might impact - determinism. - object: + description: Control the voice of your generated audio with additional + instructions. Does not work with `tts-1` or `tts-1-hd`. + maxLength: 4096 + voice: + description: The voice to use when generating the audio. Supported voices are + `alloy`, `ash`, `ballad`, `coral`, `echo`, `fable`, `onyx`, `nova`, + `sage`, `shimmer`, and `verse`. Previews of the voices are available + in the [Text to speech + guide](/docs/guides/text-to-speech#voice-options). + $ref: "#/components/schemas/VoiceIdsShared" + response_format: + description: The format to audio in. Supported formats are `mp3`, `opus`, `aac`, + `flac`, `wav`, and `pcm`. + default: mp3 type: string - description: The object type, which is always `chat.completion`. enum: - - chat.completion - usage: - $ref: "#/components/schemas/CompletionUsage" - required: - - choices - - created - - id - - model - - object - x-oaiMeta: - name: The chat completion object - group: chat - example: | - { - "id": "chatcmpl-abc123", - "object": "chat.completion", - "created": 1699896916, - "model": "gpt-4o-mini", - "choices": [ - { - "index": 0, - "message": { - "role": "assistant", - "content": null, - "tool_calls": [ - { - "id": "call_abc123", - "type": "function", - "function": { - "name": "get_current_weather", - "arguments": "{\n\"location\": \"Boston, MA\"\n}" - } - } - ] - }, - "logprobs": null, - "finish_reason": "tool_calls" - } - ], - "usage": { - "prompt_tokens": 82, - "completion_tokens": 17, - "total_tokens": 99, - "completion_tokens_details": { - "reasoning_tokens": 0, - "accepted_prediction_tokens": 0, - "rejected_prediction_tokens": 0 - } - } - } - CreateChatCompletionImageResponse: - type: object - description: Represents a streamed chunk of a chat completion response returned - by model, based on the provided input. - x-oaiMeta: - name: The chat completion chunk object - group: chat - example: > - { - "id": "chatcmpl-123", - "object": "chat.completion", - "created": 1677652288, - "model": "gpt-4o-mini", - "system_fingerprint": "fp_44709d6fcb", - "choices": [{ - "index": 0, - "message": { - "role": "assistant", - "content": "\n\nThis image shows a wooden boardwalk extending through a lush green marshland.", - }, - "logprobs": null, - "finish_reason": "stop" - }], - "usage": { - "prompt_tokens": 9, - "completion_tokens": 12, - "total_tokens": 21, - "completion_tokens_details": { - "reasoning_tokens": 0, - "accepted_prediction_tokens": 0, - "rejected_prediction_tokens": 0 - } - } - } - CreateChatCompletionRequest: + - mp3 + - opus + - aac + - flac + - wav + - pcm + speed: + description: The speed of the generated audio. Select a value from `0.25` to + `4.0`. `1.0` is the default. Does not work with `gpt-4o-mini-tts`. + type: number + default: 1 + minimum: 0.25 + maximum: 4 + required: + - model + - input + - voice + CreateThreadAndRunRequest: type: object + additionalProperties: false properties: - messages: - description: > - A list of messages comprising the conversation so far. Depending on - the - - [model](/docs/models) you use, different message types (modalities) - are - - supported, like [text](/docs/guides/text-generation), - - [images](/docs/guides/vision), and [audio](/docs/guides/audio). - type: array - minItems: 1 - items: - $ref: "#/components/schemas/ChatCompletionRequestMessage" + assistant_id: + description: The ID of the [assistant](/docs/api-reference/assistants) to use to + execute this run. + type: string + thread: + $ref: "#/components/schemas/CreateThreadRequest" model: - description: ID of the model to use. See the [model endpoint - compatibility](/docs/models#model-endpoint-compatibility) table for - details on which models work with the Chat API. + description: The ID of the [Model](/docs/api-reference/models) to be used to + execute this run. If a value is provided here, it will override the + model associated with the assistant. If not, the model associated + with the assistant will be used. example: gpt-4o anyOf: - type: string - type: string enum: - - o1-preview - - o1-preview-2024-09-12 - - o1-mini - - o1-mini-2024-09-12 + - gpt-4.1 + - gpt-4.1-mini + - gpt-4.1-nano + - gpt-4.1-2025-04-14 + - gpt-4.1-mini-2025-04-14 + - gpt-4.1-nano-2025-04-14 - gpt-4o + - gpt-4o-2024-11-20 - gpt-4o-2024-08-06 - gpt-4o-2024-05-13 - - gpt-4o-2024-08-06 - - gpt-4o-realtime-preview - - gpt-4o-realtime-preview-2024-10-01 - - gpt-4o-audio-preview - - gpt-4o-audio-preview-2024-10-01 - - chatgpt-4o-latest - gpt-4o-mini - gpt-4o-mini-2024-07-18 + - gpt-4.5-preview + - gpt-4.5-preview-2025-02-27 - gpt-4-turbo - gpt-4-turbo-2024-04-09 - gpt-4-0125-preview @@ -12106,274 +22848,65 @@ components: - gpt-4-32k-0613 - gpt-3.5-turbo - gpt-3.5-turbo-16k - - gpt-3.5-turbo-0301 - gpt-3.5-turbo-0613 - gpt-3.5-turbo-1106 - gpt-3.5-turbo-0125 - gpt-3.5-turbo-16k-0613 x-oaiTypeLabel: string - store: - type: boolean - default: false - nullable: true - description: > - Whether or not to store the output of this chat completion request - - for use in our [model distillation](/docs/guides/distillation) or - [evals](/docs/guides/evals) products. - metadata: - type: object - nullable: true - description: | - Developer-defined tags and values used for filtering completions - in the [dashboard](https://platform.openai.com/chat-completions). - additionalProperties: - type: string - frequency_penalty: - type: number - default: 0 - minimum: -2 - maximum: 2 - nullable: true - description: > - Number between -2.0 and 2.0. Positive values penalize new tokens - based on their existing frequency in the text so far, decreasing the - model's likelihood to repeat the same line verbatim. - - - [See more information about frequency and presence - penalties.](/docs/guides/text-generation) - logit_bias: - type: object - x-oaiTypeLabel: map - default: null - nullable: true - additionalProperties: - type: integer - description: > - Modify the likelihood of specified tokens appearing in the - completion. - - - Accepts a JSON object that maps tokens (specified by their token ID - in the tokenizer) to an associated bias value from -100 to 100. - Mathematically, the bias is added to the logits generated by the - model prior to sampling. The exact effect will vary per model, but - values between -1 and 1 should decrease or increase likelihood of - selection; values like -100 or 100 should result in a ban or - exclusive selection of the relevant token. - logprobs: - description: Whether to return log probabilities of the output tokens or not. If - true, returns the log probabilities of each output token returned in - the `content` of `message`. - type: boolean - default: false - nullable: true - top_logprobs: - description: An integer between 0 and 20 specifying the number of most likely - tokens to return at each token position, each with an associated log - probability. `logprobs` must be set to `true` if this parameter is - used. - type: integer - minimum: 0 - maximum: 20 - nullable: true - max_tokens: - description: > - The maximum number of [tokens](/tokenizer) that can be generated in - the chat completion. This value can be used to control - [costs](https://openai.com/api/pricing/) for text generated via API. - - - This value is now deprecated in favor of `max_completion_tokens`, - and is not compatible with [o1 series - models](/docs/guides/reasoning). - type: integer - nullable: true - deprecated: true - max_completion_tokens: - description: > - An upper bound for the number of tokens that can be generated for a - completion, including visible output tokens and [reasoning - tokens](/docs/guides/reasoning). - type: integer nullable: true - n: - type: integer - minimum: 1 - maximum: 128 - default: 1 - example: 1 + instructions: + description: Override the default system message of the assistant. This is + useful for modifying the behavior on a per-run basis. + type: string nullable: true - description: How many chat completion choices to generate for each input - message. Note that you will be charged based on the number of - generated tokens across all of the choices. Keep `n` as `1` to - minimize costs. - modalities: - $ref: "#/components/schemas/ChatCompletionModalities" - prediction: + tools: + description: Override the tools the assistant can use for this run. This is + useful for modifying the behavior on a per-run basis. nullable: true - x-oaiExpandable: true - description: > - Configuration for a [Predicted - Output](/docs/guides/predicted-outputs), - - which can greatly improve response times when large parts of the - model - - response are known ahead of time. This is most common when you are - - regenerating a file with only minor changes to most of the content. - oneOf: - - $ref: "#/components/schemas/PredictionContent" - audio: + type: array + maxItems: 20 + items: + oneOf: + - $ref: "#/components/schemas/AssistantToolsCode" + - $ref: "#/components/schemas/AssistantToolsFileSearch" + - $ref: "#/components/schemas/AssistantToolsFunction" + tool_resources: type: object - nullable: true description: > - Parameters for audio output. Required when audio output is requested - with - - `modalities: ["audio"]`. [Learn more](/docs/guides/audio). - required: - - voice - - format - x-oaiExpandable: true + A set of resources that are used by the assistant's tools. The + resources are specific to the type of tool. For example, the + `code_interpreter` tool requires a list of file IDs, while the + `file_search` tool requires a list of vector store IDs. properties: - voice: - type: string - enum: - - alloy - - ash - - ballad - - coral - - echo - - sage - - shimmer - - verse - description: > - The voice the model uses to respond. Supported voices are - `alloy`, - - `ash`, `ballad`, `coral`, `echo`, `sage`, `shimmer`, and - `verse`. - format: - type: string - enum: - - wav - - mp3 - - flac - - opus - - pcm16 - description: > - Specifies the output audio format. Must be one of `wav`, `mp3`, - `flac`, - - `opus`, or `pcm16`. - presence_penalty: - type: number - default: 0 - minimum: -2 - maximum: 2 - nullable: true - description: > - Number between -2.0 and 2.0. Positive values penalize new tokens - based on whether they appear in the text so far, increasing the - model's likelihood to talk about new topics. - - - [See more information about frequency and presence - penalties.](/docs/guides/text-generation) - response_format: - description: > - An object specifying the format that the model must output. - Compatible with [GPT-4o](/docs/models#gpt-4o), [GPT-4o - mini](/docs/models#gpt-4o-mini), [GPT-4 - Turbo](/docs/models#gpt-4-turbo-and-gpt-4) and all GPT-3.5 Turbo - models newer than `gpt-3.5-turbo-1106`. - - - Setting to `{ "type": "json_schema", "json_schema": {...} }` enables - Structured Outputs which ensures the model will match your supplied - JSON schema. Learn more in the [Structured Outputs - guide](/docs/guides/structured-outputs). - - - Setting to `{ "type": "json_object" }` enables JSON mode, which - ensures the message the model generates is valid JSON. - - - **Important:** when using JSON mode, you **must** also instruct the - model to produce JSON yourself via a system or user message. Without - this, the model may generate an unending stream of whitespace until - the generation reaches the token limit, resulting in a long-running - and seemingly "stuck" request. Also note that the message content - may be partially cut off if `finish_reason="length"`, which - indicates the generation exceeded `max_tokens` or the conversation - exceeded the max context length. - oneOf: - - $ref: "#/components/schemas/ResponseFormatText" - - $ref: "#/components/schemas/ResponseFormatJsonObject" - - $ref: "#/components/schemas/ResponseFormatJsonSchema" - x-oaiExpandable: true - seed: - type: integer - minimum: -9223372036854776000 - maximum: 9223372036854776000 - nullable: true - description: > - This feature is in Beta. - - If specified, our system will make a best effort to sample - deterministically, such that repeated requests with the same `seed` - and parameters should return the same result. - - Determinism is not guaranteed, and you should refer to the - `system_fingerprint` response parameter to monitor changes in the - backend. - x-oaiMeta: - beta: true - service_tier: - description: > - Specifies the latency tier to use for processing the request. This - parameter is relevant for customers subscribed to the scale tier - service: - - If set to 'auto', and the Project is Scale tier enabled, the system will utilize scale tier credits until they are exhausted. - - If set to 'auto', and the Project is not Scale tier enabled, the request will be processed using the default service tier with a lower uptime SLA and no latency guarentee. - - If set to 'default', the request will be processed using the default service tier with a lower uptime SLA and no latency guarentee. - - When not set, the default behavior is 'auto'. - - When this parameter is set, the response body will include the `service_tier` utilized. - type: string - enum: - - auto - - default - nullable: true - default: auto - stop: - description: | - Up to 4 sequences where the API will stop generating further tokens. - default: null - oneOf: - - type: string - nullable: true - - type: array - minItems: 1 - maxItems: 4 - items: - type: string - stream: - description: > - If set, partial message deltas will be sent, like in ChatGPT. Tokens - will be sent as data-only [server-sent - events](https://developer.mozilla.org/en-US/docs/Web/API/Server-sent_events/Using_server-sent_events#Event_stream_format) - as they become available, with the stream terminated by a `data: - [DONE]` message. [Example Python - code](https://cookbook.openai.com/examples/how_to_stream_completions). - type: boolean + code_interpreter: + type: object + properties: + file_ids: + type: array + description: > + A list of [file](/docs/api-reference/files) IDs made + available to the `code_interpreter` tool. There can be a + maximum of 20 files associated with the tool. + default: [] + maxItems: 20 + items: + type: string + file_search: + type: object + properties: + vector_store_ids: + type: array + description: > + The ID of the [vector + store](/docs/api-reference/vector-stores/object) attached to + this assistant. There can be a maximum of 1 vector store + attached to the assistant. + maxItems: 1 + items: + type: string nullable: true - default: false - stream_options: - $ref: "#/components/schemas/ChatCompletionStreamOptions" + metadata: + $ref: "#/components/schemas/Metadata" temperature: type: number minimum: 0 @@ -12385,9 +22918,6 @@ components: What sampling temperature to use, between 0 and 2. Higher values like 0.8 will make the output more random, while lower values like 0.2 will make it more focused and deterministic. - - - We generally recommend altering this or `top_p` but not both. top_p: type: number minimum: 0 @@ -12402,7516 +22932,12860 @@ components: top 10% probability mass are considered. - We generally recommend altering this or `temperature` but not both. - tools: - type: array + We generally recommend altering this or temperature but not both. + stream: + type: boolean + nullable: true + description: > + If `true`, returns a stream of events that happen during the Run as + server-sent events, terminating when the Run enters a terminal state + with a `data: [DONE]` message. + max_prompt_tokens: + type: integer + nullable: true + description: > + The maximum number of prompt tokens that may be used over the course + of the run. The run will make a best effort to use only the number + of prompt tokens specified, across multiple turns of the run. If the + run exceeds the number of prompt tokens specified, the run will end + with status `incomplete`. See `incomplete_details` for more info. + minimum: 256 + max_completion_tokens: + type: integer + nullable: true description: > - A list of tools the model may call. Currently, only functions are - supported as a tool. Use this to provide a list of functions the - model may generate JSON inputs for. A max of 128 functions are - supported. - items: - $ref: "#/components/schemas/ChatCompletionTool" + The maximum number of completion tokens that may be used over the + course of the run. The run will make a best effort to use only the + number of completion tokens specified, across multiple turns of the + run. If the run exceeds the number of completion tokens specified, + the run will end with status `incomplete`. See `incomplete_details` + for more info. + minimum: 256 + truncation_strategy: + allOf: + - $ref: "#/components/schemas/TruncationObject" + - nullable: true tool_choice: - $ref: "#/components/schemas/ChatCompletionToolChoiceOption" + allOf: + - $ref: "#/components/schemas/AssistantsApiToolChoiceOption" + - nullable: true parallel_tool_calls: $ref: "#/components/schemas/ParallelToolCalls" - user: - type: string - example: user-1234 - description: > - A unique identifier representing your end-user, which can help - OpenAI to monitor and detect abuse. [Learn - more](/docs/guides/safety-best-practices#end-user-ids). - function_call: - deprecated: true - description: > - Deprecated in favor of `tool_choice`. - - - Controls which (if any) function is called by the model. - - `none` means the model will not call a function and instead - generates a message. - - `auto` means the model can pick between generating a message or - calling a function. - - Specifying a particular function via `{"name": "my_function"}` - forces the model to call that function. - - - `none` is the default when no functions are present. `auto` is the - default if functions are present. - oneOf: - - type: string - description: > - `none` means the model will not call a function and instead - generates a message. `auto` means the model can pick between - generating a message or calling a function. - enum: - - none - - auto - - $ref: "#/components/schemas/ChatCompletionFunctionCallOption" - x-oaiExpandable: true - functions: - deprecated: true - description: | - Deprecated in favor of `tools`. - - A list of functions the model may generate JSON inputs for. - type: array - minItems: 1 - maxItems: 128 - items: - $ref: "#/components/schemas/ChatCompletionFunctions" + response_format: + $ref: "#/components/schemas/AssistantsApiResponseFormatOption" + nullable: true required: - - model - - messages - CreateChatCompletionResponse: + - assistant_id + CreateThreadRequest: type: object - description: Represents a chat completion response returned by model, based on - the provided input. + description: | + Options to create a new thread. If no thread is provided when running a + request, an empty thread will be created. + additionalProperties: false properties: - id: - type: string - description: A unique identifier for the chat completion. - choices: + messages: + description: A list of [messages](/docs/api-reference/messages) to start the + thread with. type: array - description: A list of chat completion choices. Can be more than one if `n` is - greater than 1. items: - type: object - required: - - finish_reason - - index - - message - - logprobs - properties: - finish_reason: - type: string - description: > - The reason the model stopped generating tokens. This will be - `stop` if the model hit a natural stop point or a provided - stop sequence, - - `length` if the maximum number of tokens specified in the - request was reached, + $ref: "#/components/schemas/CreateMessageRequest" + tool_resources: + type: object + description: > + A set of resources that are made available to the assistant's tools + in this thread. The resources are specific to the type of tool. For + example, the `code_interpreter` tool requires a list of file IDs, + while the `file_search` tool requires a list of vector store IDs. + properties: + code_interpreter: + type: object + properties: + file_ids: + type: array + description: > + A list of [file](/docs/api-reference/files) IDs made + available to the `code_interpreter` tool. There can be a + maximum of 20 files associated with the tool. + default: [] + maxItems: 20 + items: + type: string + file_search: + type: object + properties: + vector_store_ids: + type: array + description: > + The [vector store](/docs/api-reference/vector-stores/object) + attached to this thread. There can be a maximum of 1 vector + store attached to the thread. + maxItems: 1 + items: + type: string + vector_stores: + type: array + description: > + A helper to create a [vector + store](/docs/api-reference/vector-stores/object) with + file_ids and attach it to this thread. There can be a + maximum of 1 vector store attached to the thread. + maxItems: 1 + items: + type: object + properties: + file_ids: + type: array + description: > + A list of [file](/docs/api-reference/files) IDs to add + to the vector store. There can be a maximum of 10000 + files in a vector store. + maxItems: 10000 + items: + type: string + chunking_strategy: + type: object + description: The chunking strategy used to chunk the file(s). If not set, will + use the `auto` strategy. + oneOf: + - type: object + title: Auto Chunking Strategy + description: The default strategy. This strategy currently uses a + `max_chunk_size_tokens` of `800` and + `chunk_overlap_tokens` of `400`. + additionalProperties: false + properties: + type: + type: string + description: Always `auto`. + enum: + - auto + x-stainless-const: true + required: + - type + - type: object + title: Static Chunking Strategy + additionalProperties: false + properties: + type: + type: string + description: Always `static`. + enum: + - static + x-stainless-const: true + static: + type: object + additionalProperties: false + properties: + max_chunk_size_tokens: + type: integer + minimum: 100 + maximum: 4096 + description: The maximum number of tokens in each chunk. The default value is + `800`. The minimum value is `100` and the + maximum value is `4096`. + chunk_overlap_tokens: + type: integer + description: > + The number of tokens that overlap between + chunks. The default value is `400`. - `content_filter` if content was omitted due to a flag from our - content filters, - `tool_calls` if the model called a tool, or `function_call` - (deprecated) if the model called a function. - enum: - - stop - - length - - tool_calls - - content_filter - - function_call - index: - type: integer - description: The index of the choice in the list of choices. - message: - $ref: "#/components/schemas/ChatCompletionResponseMessage" - logprobs: - description: Log probability information for the choice. - type: object - nullable: true - properties: - content: - description: A list of message content tokens with log probability information. - type: array - items: - $ref: "#/components/schemas/ChatCompletionTokenLogprob" - nullable: true - refusal: - description: A list of message refusal tokens with log probability information. - type: array - items: - $ref: "#/components/schemas/ChatCompletionTokenLogprob" - nullable: true - required: - - content - - refusal - created: - type: integer - description: The Unix timestamp (in seconds) of when the chat completion was - created. - model: + Note that the overlap must not exceed half + of `max_chunk_size_tokens`. + required: + - max_chunk_size_tokens + - chunk_overlap_tokens + required: + - type + - static + metadata: + $ref: "#/components/schemas/Metadata" + oneOf: + - required: + - vector_store_ids + - required: + - vector_stores + nullable: true + metadata: + $ref: "#/components/schemas/Metadata" + CreateTranscriptionRequest: + type: object + additionalProperties: false + properties: + file: + description: > + The audio file object (not file name) to transcribe, in one of these + formats: flac, mp3, mp4, mpeg, mpga, m4a, ogg, wav, or webm. type: string - description: The model used for the chat completion. - service_tier: - description: The service tier used for processing the request. This field is - only included if the `service_tier` parameter is specified in the - request. + x-oaiTypeLabel: file + format: binary + model: + description: > + ID of the model to use. The options are `gpt-4o-transcribe`, + `gpt-4o-mini-transcribe`, and `whisper-1` (which is powered by our + open source Whisper V2 model). + example: gpt-4o-transcribe + anyOf: + - type: string + - type: string + enum: + - whisper-1 + - gpt-4o-transcribe + - gpt-4o-mini-transcribe + x-stainless-const: true + x-oaiTypeLabel: string + language: + description: > + The language of the input audio. Supplying the input language in + [ISO-639-1](https://en.wikipedia.org/wiki/List_of_ISO_639-1_codes) + (e.g. `en`) format will improve accuracy and latency. type: string - enum: - - scale - - default - example: scale - nullable: true - system_fingerprint: + prompt: + description: > + An optional text to guide the model's style or continue a previous + audio segment. The [prompt](/docs/guides/speech-to-text#prompting) + should match the audio language. type: string + response_format: + $ref: "#/components/schemas/AudioResponseFormat" + temperature: description: > - This fingerprint represents the backend configuration that the model - runs with. + The sampling temperature, between 0 and 1. Higher values like 0.8 + will make the output more random, while lower values like 0.2 will + make it more focused and deterministic. If set to 0, the model will + use [log probability](https://en.wikipedia.org/wiki/Log_probability) + to automatically increase the temperature until certain thresholds + are hit. + type: number + default: 0 + include[]: + description: > + Additional information to include in the transcription response. + `logprobs` will return the log probabilities of the tokens in the - Can be used in conjunction with the `seed` request parameter to - understand when backend changes have been made that might impact - determinism. - object: - type: string - description: The object type, which is always `chat.completion`. - enum: - - chat.completion - usage: - $ref: "#/components/schemas/CompletionUsage" + response to understand the model's confidence in the transcription. + + `logprobs` only works with response_format set to `json` and only + with + + the models `gpt-4o-transcribe` and `gpt-4o-mini-transcribe`. + type: array + items: + $ref: "#/components/schemas/TranscriptionInclude" + timestamp_granularities[]: + description: > + The timestamp granularities to populate for this transcription. + `response_format` must be set `verbose_json` to use timestamp + granularities. Either or both of these options are supported: + `word`, or `segment`. Note: There is no additional latency for + segment timestamps, but generating word timestamps incurs additional + latency. + type: array + items: + type: string + enum: + - word + - segment + default: + - segment + stream: + description: | + If set to true, the model response data will be streamed to the client + as it is generated using [server-sent events](https://developer.mozilla.org/en-US/docs/Web/API/Server-sent_events/Using_server-sent_events#Event_stream_format). + See the [Streaming section of the Speech-to-Text guide](/docs/guides/speech-to-text?lang=curl#streaming-transcriptions) + for more information. + + Note: Streaming is not supported for the `whisper-1` model and will be ignored. + type: boolean + nullable: true + default: false + chunking_strategy: + description: 'Controls how the audio is cut into chunks. When set to `"auto"`, + the server first normalizes loudness and then uses voice activity + detection (VAD) to choose boundaries. `server_vad` object can be + provided to tweak VAD detection parameters manually. If unset, the + audio is transcribed as a single block. ' + anyOf: + - type: string + enum: + - auto + default: + - auto + description: > + Automatically set chunking parameters based on the audio. Must + be set to `"auto"`. + x-stainless-const: true + - $ref: "#/components/schemas/VadConfig" + nullable: true + x-oaiTypeLabel: string required: - - choices - - created - - id + - file - model - - object - x-oaiMeta: - name: The chat completion object - group: chat - example: | - { - "id": "chatcmpl-123456", - "object": "chat.completion", - "created": 1728933352, - "model": "gpt-4o-2024-08-06", - "choices": [ - { - "index": 0, - "message": { - "role": "assistant", - "content": "Hi there! How can I assist you today?", - "refusal": null - }, - "logprobs": null, - "finish_reason": "stop" - } - ], - "usage": { - "prompt_tokens": 19, - "completion_tokens": 10, - "total_tokens": 29, - "prompt_tokens_details": { - "cached_tokens": 0 - }, - "completion_tokens_details": { - "reasoning_tokens": 0, - "accepted_prediction_tokens": 0, - "rejected_prediction_tokens": 0 - } - }, - "system_fingerprint": "fp_6b68a8204b" - } - CreateChatCompletionStreamResponse: + CreateTranscriptionResponseJson: type: object - description: Represents a streamed chunk of a chat completion response returned - by model, based on the provided input. + description: Represents a transcription response returned by model, based on the + provided input. properties: - id: + text: type: string - description: A unique identifier for the chat completion. Each chunk has the - same ID. - choices: + description: The transcribed text. + logprobs: type: array + optional: true description: > - A list of chat completion choices. Can contain more than one - elements if `n` is greater than 1. Can also be empty for the - - last chunk if you set `stream_options: {"include_usage": true}`. + The log probabilities of the tokens in the transcription. Only + returned with the models `gpt-4o-transcribe` and + `gpt-4o-mini-transcribe` if `logprobs` is added to the `include` + array. items: type: object - required: - - delta - - finish_reason - - index properties: - delta: - $ref: "#/components/schemas/ChatCompletionStreamResponseDelta" - logprobs: - description: Log probability information for the choice. - type: object - nullable: true - properties: - content: - description: A list of message content tokens with log probability information. - type: array - items: - $ref: "#/components/schemas/ChatCompletionTokenLogprob" - nullable: true - refusal: - description: A list of message refusal tokens with log probability information. - type: array - items: - $ref: "#/components/schemas/ChatCompletionTokenLogprob" - nullable: true - required: - - content - - refusal - finish_reason: + token: type: string - description: > - The reason the model stopped generating tokens. This will be - `stop` if the model hit a natural stop point or a provided - stop sequence, - - `length` if the maximum number of tokens specified in the - request was reached, - - `content_filter` if content was omitted due to a flag from our - content filters, - - `tool_calls` if the model called a tool, or `function_call` - (deprecated) if the model called a function. - enum: - - stop - - length - - tool_calls - - content_filter - - function_call - nullable: true - index: - type: integer - description: The index of the choice in the list of choices. - created: - type: integer - description: The Unix timestamp (in seconds) of when the chat completion was - created. Each chunk has the same timestamp. - model: - type: string - description: The model to generate the completion. - service_tier: - description: The service tier used for processing the request. This field is - only included if the `service_tier` parameter is specified in the - request. - type: string - enum: - - scale - - default - example: scale - nullable: true - system_fingerprint: + description: The token in the transcription. + logprob: + type: number + description: The log probability of the token. + bytes: + type: array + items: + type: number + description: The bytes of the token. + required: + - text + x-oaiMeta: + name: The transcription object (JSON) + group: audio + example: > + { + "text": "Imagine the wildest idea that you've ever had, and you're curious about how it might scale to something that's a 100, a 1,000 times bigger. This is a place where you can get to do that." + } + CreateTranscriptionResponseStreamEvent: + anyOf: + - $ref: "#/components/schemas/TranscriptTextDeltaEvent" + - $ref: "#/components/schemas/TranscriptTextDoneEvent" + discriminator: + propertyName: type + CreateTranscriptionResponseVerboseJson: + type: object + description: Represents a verbose json transcription response returned by model, + based on the provided input. + properties: + language: type: string - description: > - This fingerprint represents the backend configuration that the model - runs with. - - Can be used in conjunction with the `seed` request parameter to - understand when backend changes have been made that might impact - determinism. - object: + description: The language of the input audio. + duration: + type: number + description: The duration of the input audio. + text: type: string - description: The object type, which is always `chat.completion.chunk`. - enum: - - chat.completion.chunk - usage: - type: object - nullable: true - description: > - An optional field that will only be present when you set - `stream_options: {"include_usage": true}` in your request. - - When present, it contains a null value except for the last chunk - which contains the token usage statistics for the entire request. - properties: - completion_tokens: - type: integer - description: Number of tokens in the generated completion. - prompt_tokens: - type: integer - description: Number of tokens in the prompt. - total_tokens: - type: integer - description: Total number of tokens used in the request (prompt + completion). - required: - - prompt_tokens - - completion_tokens - - total_tokens + description: The transcribed text. + words: + type: array + description: Extracted words and their corresponding timestamps. + items: + $ref: "#/components/schemas/TranscriptionWord" + segments: + type: array + description: Segments of the transcribed text and their corresponding details. + items: + $ref: "#/components/schemas/TranscriptionSegment" required: - - choices - - created - - id - - model - - object + - language + - duration + - text x-oaiMeta: - name: The chat completion chunk object - group: chat + name: The transcription object (Verbose JSON) + group: audio example: > - {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", - "system_fingerprint": "fp_44709d6fcb", - "choices":[{"index":0,"delta":{"role":"assistant","content":""},"logprobs":null,"finish_reason":null}]} - - - {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", - "system_fingerprint": "fp_44709d6fcb", - "choices":[{"index":0,"delta":{"content":"Hello"},"logprobs":null,"finish_reason":null}]} - - - .... - - - {"id":"chatcmpl-123","object":"chat.completion.chunk","created":1694268190,"model":"gpt-4o-mini", - "system_fingerprint": "fp_44709d6fcb", - "choices":[{"index":0,"delta":{},"logprobs":null,"finish_reason":"stop"}]} - CreateCompletionRequest: + { + "task": "transcribe", + "language": "english", + "duration": 8.470000267028809, + "text": "The beach was a popular spot on a hot summer day. People were swimming in the ocean, building sandcastles, and playing beach volleyball.", + "segments": [ + { + "id": 0, + "seek": 0, + "start": 0.0, + "end": 3.319999933242798, + "text": " The beach was a popular spot on a hot summer day.", + "tokens": [ + 50364, 440, 7534, 390, 257, 3743, 4008, 322, 257, 2368, 4266, 786, 13, 50530 + ], + "temperature": 0.0, + "avg_logprob": -0.2860786020755768, + "compression_ratio": 1.2363636493682861, + "no_speech_prob": 0.00985979475080967 + }, + ... + ] + } + CreateTranslationRequest: type: object + additionalProperties: false properties: + file: + description: > + The audio file object (not file name) translate, in one of these + formats: flac, mp3, mp4, mpeg, mpga, m4a, ogg, wav, or webm. + type: string + x-oaiTypeLabel: file + format: binary model: description: > - ID of the model to use. You can use the [List - models](/docs/api-reference/models/list) API to see all of your - available models, or see our [Model overview](/docs/models) for - descriptions of them. + ID of the model to use. Only `whisper-1` (which is powered by our + open source Whisper V2 model) is currently available. + example: whisper-1 anyOf: - type: string - type: string enum: - - gpt-3.5-turbo-instruct - - davinci-002 - - babbage-002 + - whisper-1 + x-stainless-const: true x-oaiTypeLabel: string prompt: description: > - The prompt(s) to generate completions for, encoded as a string, - array of strings, array of tokens, or array of token arrays. - - - Note that <|endoftext|> is the document separator that the model - sees during training, so if a prompt is not specified the model will - generate as if from the beginning of a new document. - default: <|endoftext|> - nullable: true - oneOf: - - type: string - default: "" - example: This is a test. - - type: array - items: - type: string - default: "" - example: This is a test. - - type: array - minItems: 1 - items: - type: integer - example: "[1212, 318, 257, 1332, 13]" - - type: array - minItems: 1 - items: - type: array - minItems: 1 - items: - type: integer - example: "[[1212, 318, 257, 1332, 13]]" - best_of: - type: integer - default: 1 - minimum: 0 - maximum: 20 - nullable: true - description: > - Generates `best_of` completions server-side and returns the "best" - (the one with the highest log probability per token). Results cannot - be streamed. - - - When used with `n`, `best_of` controls the number of candidate - completions and `n` specifies how many to return – `best_of` must be - greater than `n`. - - - **Note:** Because this parameter generates many completions, it can - quickly consume your token quota. Use carefully and ensure that you - have reasonable settings for `max_tokens` and `stop`. - echo: - type: boolean - default: false - nullable: true - description: | - Echo back the prompt in addition to the completion - frequency_penalty: - type: number - default: 0 - minimum: -2 - maximum: 2 - nullable: true - description: > - Number between -2.0 and 2.0. Positive values penalize new tokens - based on their existing frequency in the text so far, decreasing the - model's likelihood to repeat the same line verbatim. - - - [See more information about frequency and presence - penalties.](/docs/guides/text-generation) - logit_bias: - type: object - x-oaiTypeLabel: map - default: null - nullable: true - additionalProperties: - type: integer - description: > - Modify the likelihood of specified tokens appearing in the - completion. - - - Accepts a JSON object that maps tokens (specified by their token ID - in the GPT tokenizer) to an associated bias value from -100 to 100. - You can use this [tokenizer tool](/tokenizer?view=bpe) to convert - text to token IDs. Mathematically, the bias is added to the logits - generated by the model prior to sampling. The exact effect will vary - per model, but values between -1 and 1 should decrease or increase - likelihood of selection; values like -100 or 100 should result in a - ban or exclusive selection of the relevant token. - - - As an example, you can pass `{"50256": -100}` to prevent the - <|endoftext|> token from being generated. - logprobs: - type: integer - minimum: 0 - maximum: 5 - default: null - nullable: true - description: > - Include the log probabilities on the `logprobs` most likely output - tokens, as well the chosen tokens. For example, if `logprobs` is 5, - the API will return a list of the 5 most likely tokens. The API will - always return the `logprob` of the sampled token, so there may be up - to `logprobs+1` elements in the response. - - - The maximum value for `logprobs` is 5. - max_tokens: - type: integer - minimum: 0 - default: 16 - example: 16 - nullable: true + An optional text to guide the model's style or continue a previous + audio segment. The [prompt](/docs/guides/speech-to-text#prompting) + should be in English. + type: string + response_format: description: > - The maximum number of [tokens](/tokenizer) that can be generated in - the completion. - - - The token count of your prompt plus `max_tokens` cannot exceed the - model's context length. [Example Python - code](https://cookbook.openai.com/examples/how_to_count_tokens_with_tiktoken) - for counting tokens. - n: - type: integer - minimum: 1 - maximum: 128 - default: 1 - example: 1 - nullable: true + The format of the output, in one of these options: `json`, `text`, + `srt`, `verbose_json`, or `vtt`. + type: string + enum: + - json + - text + - srt + - verbose_json + - vtt + default: json + temperature: description: > - How many completions to generate for each prompt. - - - **Note:** Because this parameter generates many completions, it can - quickly consume your token quota. Use carefully and ensure that you - have reasonable settings for `max_tokens` and `stop`. - presence_penalty: + The sampling temperature, between 0 and 1. Higher values like 0.8 + will make the output more random, while lower values like 0.2 will + make it more focused and deterministic. If set to 0, the model will + use [log probability](https://en.wikipedia.org/wiki/Log_probability) + to automatically increase the temperature until certain thresholds + are hit. type: number default: 0 - minimum: -2 - maximum: 2 - nullable: true - description: > - Number between -2.0 and 2.0. Positive values penalize new tokens - based on whether they appear in the text so far, increasing the - model's likelihood to talk about new topics. - - - [See more information about frequency and presence - penalties.](/docs/guides/text-generation) - seed: - type: integer - minimum: -9223372036854776000 - maximum: 9223372036854776000 - nullable: true - description: > - If specified, our system will make a best effort to sample - deterministically, such that repeated requests with the same `seed` - and parameters should return the same result. - - - Determinism is not guaranteed, and you should refer to the - `system_fingerprint` response parameter to monitor changes in the - backend. - stop: - description: > - Up to 4 sequences where the API will stop generating further tokens. - The returned text will not contain the stop sequence. - default: null - nullable: true - oneOf: - - type: string - default: <|endoftext|> - example: "\n" - nullable: true - - type: array - minItems: 1 - maxItems: 4 - items: - type: string - example: '["\n"]' - stream: - description: > - Whether to stream back partial progress. If set, tokens will be sent - as data-only [server-sent - events](https://developer.mozilla.org/en-US/docs/Web/API/Server-sent_events/Using_server-sent_events#Event_stream_format) - as they become available, with the stream terminated by a `data: - [DONE]` message. [Example Python - code](https://cookbook.openai.com/examples/how_to_stream_completions). - type: boolean - nullable: true - default: false - stream_options: - $ref: "#/components/schemas/ChatCompletionStreamOptions" - suffix: - description: | - The suffix that comes after a completion of inserted text. - - This parameter is only supported for `gpt-3.5-turbo-instruct`. - default: null - nullable: true + required: + - file + - model + CreateTranslationResponseJson: + type: object + properties: + text: type: string - example: test. - temperature: + required: + - text + CreateTranslationResponseVerboseJson: + type: object + properties: + language: + type: string + description: The language of the output translation (always `english`). + duration: type: number - minimum: 0 - maximum: 2 - default: 1 - example: 1 - nullable: true + description: The duration of the input audio. + text: + type: string + description: The translated text. + segments: + type: array + description: Segments of the translated text and their corresponding details. + items: + $ref: "#/components/schemas/TranscriptionSegment" + required: + - language + - duration + - text + CreateUploadRequest: + type: object + additionalProperties: false + properties: + filename: + description: | + The name of the file to upload. + type: string + purpose: description: > - What sampling temperature to use, between 0 and 2. Higher values - like 0.8 will make the output more random, while lower values like - 0.2 will make it more focused and deterministic. + The intended purpose of the uploaded file. - We generally recommend altering this or `top_p` but not both. - top_p: - type: number - minimum: 0 - maximum: 1 - default: 1 - example: 1 - nullable: true + See the [documentation on File + purposes](/docs/api-reference/files/create#files-create-purpose). + type: string + enum: + - assistants + - batch + - fine-tune + - vision + bytes: + description: | + The number of bytes in the file you are uploading. + type: integer + mime_type: description: > - An alternative to sampling with temperature, called nucleus - sampling, where the model considers the results of the tokens with - top_p probability mass. So 0.1 means only the tokens comprising the - top 10% probability mass are considered. + The MIME type of the file. - We generally recommend altering this or `temperature` but not both. - user: + This must fall within the supported MIME types for your file + purpose. See the supported MIME types for assistants and vision. type: string - example: user-1234 - description: > - A unique identifier representing your end-user, which can help - OpenAI to monitor and detect abuse. [Learn - more](/docs/guides/safety-best-practices#end-user-ids). required: - - model - - prompt - CreateCompletionResponse: + - filename + - purpose + - bytes + - mime_type + CreateVectorStoreFileBatchRequest: type: object - description: > - Represents a completion response from the API. Note: both the streamed - and non-streamed response objects share the same shape (unlike the chat - endpoint). + additionalProperties: false properties: - id: + file_ids: + description: A list of [File](/docs/api-reference/files) IDs that the vector + store should use. Useful for tools like `file_search` that can + access files. + type: array + minItems: 1 + maxItems: 500 + items: + type: string + chunking_strategy: + $ref: "#/components/schemas/ChunkingStrategyRequestParam" + attributes: + $ref: "#/components/schemas/VectorStoreFileAttributes" + required: + - file_ids + CreateVectorStoreFileRequest: + type: object + additionalProperties: false + properties: + file_id: + description: A [File](/docs/api-reference/files) ID that the vector store should + use. Useful for tools like `file_search` that can access files. type: string - description: A unique identifier for the completion. - choices: + chunking_strategy: + $ref: "#/components/schemas/ChunkingStrategyRequestParam" + attributes: + $ref: "#/components/schemas/VectorStoreFileAttributes" + required: + - file_id + CreateVectorStoreRequest: + type: object + additionalProperties: false + properties: + file_ids: + description: A list of [File](/docs/api-reference/files) IDs that the vector + store should use. Useful for tools like `file_search` that can + access files. type: array - description: The list of completion choices the model generated for the input - prompt. + maxItems: 500 items: - type: object - required: - - finish_reason - - index - - logprobs - - text - properties: - finish_reason: - type: string - description: > - The reason the model stopped generating tokens. This will be - `stop` if the model hit a natural stop point or a provided - stop sequence, - - `length` if the maximum number of tokens specified in the - request was reached, - - or `content_filter` if content was omitted due to a flag from - our content filters. - enum: - - stop - - length - - content_filter - index: - type: integer - logprobs: - type: object - nullable: true - properties: - text_offset: - type: array - items: - type: integer - token_logprobs: - type: array - items: - type: number - tokens: - type: array - items: - type: string - top_logprobs: - type: array - items: - type: object - additionalProperties: - type: number - text: - type: string - created: - type: integer - description: The Unix timestamp (in seconds) of when the completion was created. - model: + type: string + name: + description: The name of the vector store. type: string - description: The model used for completion. - system_fingerprint: + expires_after: + $ref: "#/components/schemas/VectorStoreExpirationAfter" + chunking_strategy: + type: object + description: The chunking strategy used to chunk the file(s). If not set, will + use the `auto` strategy. Only applicable if `file_ids` is non-empty. + oneOf: + - $ref: "#/components/schemas/AutoChunkingStrategyRequestParam" + - $ref: "#/components/schemas/StaticChunkingStrategyRequestParam" + metadata: + $ref: "#/components/schemas/Metadata" + DeleteAssistantResponse: + type: object + properties: + id: type: string - description: > - This fingerprint represents the backend configuration that the model - runs with. - - - Can be used in conjunction with the `seed` request parameter to - understand when backend changes have been made that might impact - determinism. + deleted: + type: boolean object: type: string - description: The object type, which is always "text_completion" enum: - - text_completion - usage: - $ref: "#/components/schemas/CompletionUsage" + - assistant.deleted + x-stainless-const: true required: - id - object - - created - - model - - choices - x-oaiMeta: - name: The completion object - legacy: true - example: | - { - "id": "cmpl-uqkvlQyYK7bGYrRHQ0eXlWi7", - "object": "text_completion", - "created": 1589478378, - "model": "gpt-4-turbo", - "choices": [ - { - "text": "\n\nThis is indeed a test", - "index": 0, - "logprobs": null, - "finish_reason": "length" - } - ], - "usage": { - "prompt_tokens": 5, - "completion_tokens": 7, - "total_tokens": 12 - } - } - CreateEmbeddingRequest: + - deleted + DeleteCertificateResponse: + type: object + properties: + object: + type: string + description: The object type, must be `certificate.deleted`. + enum: + - certificate.deleted + x-stainless-const: true + id: + type: string + description: The ID of the certificate that was deleted. + required: + - object + - id + DeleteFileResponse: type: object - additionalProperties: false properties: - input: - description: > - Input text to embed, encoded as a string or array of tokens. To - embed multiple inputs in a single request, pass an array of strings - or array of token arrays. The input must not exceed the max input - tokens for the model (8192 tokens for `text-embedding-ada-002`), - cannot be an empty string, and any array must be 2048 dimensions or - less. [Example Python - code](https://cookbook.openai.com/examples/how_to_count_tokens_with_tiktoken) - for counting tokens. - example: The quick brown fox jumped over the lazy dog - oneOf: - - type: string - title: string - description: The string that will be turned into an embedding. - default: "" - example: This is a test. - - type: array - title: array - description: The array of strings that will be turned into an embedding. - minItems: 1 - maxItems: 2048 - items: - type: string - default: "" - example: "['This is a test.']" - - type: array - title: array - description: The array of integers that will be turned into an embedding. - minItems: 1 - maxItems: 2048 - items: - type: integer - example: "[1212, 318, 257, 1332, 13]" - - type: array - title: array - description: The array of arrays containing integers that will be turned into an - embedding. - minItems: 1 - maxItems: 2048 - items: - type: array - minItems: 1 - items: - type: integer - example: "[[1212, 318, 257, 1332, 13]]" - x-oaiExpandable: true - model: - description: > - ID of the model to use. You can use the [List - models](/docs/api-reference/models/list) API to see all of your - available models, or see our [Model overview](/docs/models) for - descriptions of them. - example: text-embedding-3-small - anyOf: - - type: string - - type: string - enum: - - text-embedding-ada-002 - - text-embedding-3-small - - text-embedding-3-large - x-oaiTypeLabel: string - encoding_format: - description: The format to return the embeddings in. Can be either `float` or - [`base64`](https://pypi.org/project/pybase64/). - example: float - default: float + id: + type: string + object: type: string enum: - - float - - base64 - dimensions: - description: > - The number of dimensions the resulting output embeddings should - have. Only supported in `text-embedding-3` and later models. - type: integer - minimum: 1 - user: + - file + x-stainless-const: true + deleted: + type: boolean + required: + - id + - object + - deleted + DeleteFineTuningCheckpointPermissionResponse: + type: object + properties: + id: type: string - example: user-1234 - description: > - A unique identifier representing your end-user, which can help - OpenAI to monitor and detect abuse. [Learn - more](/docs/guides/safety-best-practices#end-user-ids). + description: The ID of the fine-tuned model checkpoint permission that was + deleted. + object: + type: string + description: The object type, which is always "checkpoint.permission". + enum: + - checkpoint.permission + x-stainless-const: true + deleted: + type: boolean + description: Whether the fine-tuned model checkpoint permission was successfully + deleted. required: - - model - - input - CreateEmbeddingResponse: + - id + - object + - deleted + DeleteMessageResponse: type: object properties: - data: - type: array - description: The list of embeddings generated by the model. - items: - $ref: "#/components/schemas/Embedding" - model: + id: type: string - description: The name of the model used to generate the embedding. + deleted: + type: boolean object: type: string - description: The object type, which is always "list". enum: - - list - usage: - type: object - description: The usage information for the request. - properties: - prompt_tokens: - type: integer - description: The number of tokens used by the prompt. - total_tokens: - type: integer - description: The total number of tokens used by the request. - required: - - prompt_tokens - - total_tokens + - thread.message.deleted + x-stainless-const: true required: + - id - object - - model - - data - - usage - CreateFileRequest: + - deleted + DeleteModelResponse: type: object - additionalProperties: false properties: - file: - description: | - The File object (not file name) to be uploaded. + id: type: string - format: binary - purpose: - description: > - The intended purpose of the uploaded file. - - - Use "assistants" for [Assistants](/docs/api-reference/assistants) - and [Message](/docs/api-reference/messages) files, "vision" for - Assistants image file inputs, "batch" for [Batch - API](/docs/guides/batch), and "fine-tune" for - [Fine-tuning](/docs/api-reference/fine-tuning). + deleted: + type: boolean + object: + type: string + required: + - id + - object + - deleted + DeleteThreadResponse: + type: object + properties: + id: + type: string + deleted: + type: boolean + object: type: string enum: - - assistants - - batch - - fine-tune - - vision + - thread.deleted + x-stainless-const: true required: - - file - - purpose - CreateFineTuningJobRequest: + - id + - object + - deleted + DeleteVectorStoreFileResponse: type: object properties: - model: - description: > - The name of the model to fine-tune. You can select one of the - - [supported - models](/docs/guides/fine-tuning#which-models-can-be-fine-tuned). - example: gpt-4o-mini - anyOf: - - type: string - - type: string - enum: - - babbage-002 - - davinci-002 - - gpt-3.5-turbo - - gpt-4o-mini - x-oaiTypeLabel: string - training_file: - description: > - The ID of an uploaded file that contains training data. - - - See [upload file](/docs/api-reference/files/create) for how to - upload a file. - - - Your dataset must be formatted as a JSONL file. Additionally, you - must upload your file with the purpose `fine-tune`. - - - The contents of the file should differ depending on if the model - uses the [chat](/docs/api-reference/fine-tuning/chat-input) or - [completions](/docs/api-reference/fine-tuning/completions-input) - format. - - - See the [fine-tuning guide](/docs/guides/fine-tuning) for more - details. + id: type: string - example: file-abc123 - hyperparameters: - type: object - description: The hyperparameters used for the fine-tuning job. - properties: - batch_size: - description: > - Number of examples in each batch. A larger batch size means that - model parameters - - are updated less frequently, but with lower variance. - oneOf: - - type: string - enum: - - auto - - type: integer - minimum: 1 - maximum: 256 - default: auto - learning_rate_multiplier: - description: > - Scaling factor for the learning rate. A smaller learning rate - may be useful to avoid - - overfitting. - oneOf: - - type: string - enum: - - auto - - type: number - minimum: 0 - exclusiveMinimum: true - default: auto - n_epochs: - description: > - The number of epochs to train the model for. An epoch refers to - one full cycle - - through the training dataset. - oneOf: - - type: string - enum: - - auto - - type: integer - minimum: 1 - maximum: 50 - default: auto - suffix: + deleted: + type: boolean + object: + type: string + enum: + - vector_store.file.deleted + x-stainless-const: true + required: + - id + - object + - deleted + DeleteVectorStoreResponse: + type: object + properties: + id: + type: string + deleted: + type: boolean + object: + type: string + enum: + - vector_store.deleted + x-stainless-const: true + required: + - id + - object + - deleted + DoneEvent: + type: object + properties: + event: + type: string + enum: + - done + x-stainless-const: true + data: + type: string + enum: + - "[DONE]" + x-stainless-const: true + required: + - event + - data + description: Occurs when a stream ends. + x-oaiMeta: + dataDescription: "`data` is `[DONE]`" + DoubleClick: + type: object + title: DoubleClick + description: | + A double click action. + properties: + type: + type: string + enum: + - double_click + default: double_click description: > - A string of up to 64 characters that will be added to your - fine-tuned model name. - + Specifies the event type. For a double click action, this property + is - For example, a `suffix` of "custom-model-name" would produce a model - name like `ft:gpt-4o-mini:openai:custom-model-name:7p4lURel`. + always set to `double_click`. + x-stainless-const: true + x: + type: integer + description: | + The x-coordinate where the double click occurred. + y: + type: integer + description: | + The y-coordinate where the double click occurred. + required: + - type + - x + - y + Drag: + type: object + title: Drag + description: | + A drag action. + properties: + type: type: string - minLength: 1 - maxLength: 64 - default: null - nullable: true - validation_file: + enum: + - drag + default: drag + description: | + Specifies the event type. For a drag action, this property is + always set to `drag`. + x-stainless-const: true + path: + type: array description: > - The ID of an uploaded file that contains validation data. - + An array of coordinates representing the path of the drag action. + Coordinates will appear as an array - If you provide this file, the data is used to generate validation + of objects, eg - metrics periodically during fine-tuning. These metrics can be viewed - in + ``` - the fine-tuning results file. + [ + { x: 100, y: 200 }, + { x: 200, y: 300 } + ] - The same data should not be present in both train and validation - files. + ``` + items: + title: Drag path coordinates + description: | + A series of x/y coordinate pairs in the drag path. + $ref: "#/components/schemas/Coordinate" + required: + - type + - path + EasyInputMessage: + type: object + title: Input message + description: > + A message input to the model with a role indicating instruction + following + hierarchy. Instructions given with the `developer` or `system` role take - Your dataset must be formatted as a JSONL file. You must upload your - file with the purpose `fine-tune`. + precedence over instructions given with the `user` role. Messages with + the + `assistant` role are presumed to have been generated by the model in + previous - See the [fine-tuning guide](/docs/guides/fine-tuning) for more - details. + interactions. + properties: + role: type: string - nullable: true - example: file-abc123 - integrations: - type: array - description: A list of integrations to enable for your fine-tuning job. - nullable: true - items: - type: object - required: - - type - - wandb - properties: - type: - description: > - The type of integration to enable. Currently, only "wandb" - (Weights and Biases) is supported. - oneOf: - - type: string - enum: - - wandb - wandb: - type: object - description: > - The settings for your integration with Weights and Biases. - This payload specifies the project that - - metrics will be sent to. Optionally, you can set an explicit - display name for your run, add tags - - to your run, and set a default entity (team, username, etc) to - be associated with your run. - required: - - project - properties: - project: - description: > - The name of the project that the new run will be created - under. - type: string - example: my-wandb-project - name: - description: > - A display name to set for the run. If not set, we will use - the Job ID as the name. - nullable: true - type: string - entity: - description: > - The entity to use for the run. This allows you to set the - team or username of the WandB user that you would - - like associated with the run. If not set, the default - entity for the registered WandB API key is used. - nullable: true - type: string - tags: - description: > - A list of tags to be attached to the newly created run. - These tags are passed through directly to WandB. Some + description: > + The role of the message input. One of `user`, `assistant`, `system`, + or - default tags are generated by OpenAI: "openai/finetune", - "openai/{base-model}", "openai/{ftjob-abcdef}". - type: array - items: - type: string - example: custom-tag - seed: + `developer`. + enum: + - user + - assistant + - system + - developer + content: description: > - The seed controls the reproducibility of the job. Passing in the - same seed and job parameters should produce the same results, but - may differ in rare cases. + Text, image, or audio input to the model, used to generate a + response. - If a seed is not specified, one will be generated for you. - type: integer - nullable: true - minimum: 0 - maximum: 2147483647 - example: 42 + Can also contain previous assistant responses. + oneOf: + - type: string + title: Text input + description: | + A text input to the model. + - $ref: "#/components/schemas/InputMessageContentList" + type: + type: string + description: | + The type of the message input. Always `message`. + enum: + - message + x-stainless-const: true required: - - model - - training_file - CreateImageEditRequest: + - role + - content + Embedding: type: object + description: | + Represents an embedding vector returned by embedding endpoint. properties: - image: - description: The image to edit. Must be a valid PNG file, less than 4MB, and - square. If mask is not provided, image must have transparency, which - will be used as the mask. - type: string - format: binary - prompt: - description: A text description of the desired image(s). The maximum length is - 1000 characters. - type: string - example: A cute baby sea otter wearing a beret - mask: - description: An additional image whose fully transparent areas (e.g. where alpha - is zero) indicate where `image` should be edited. Must be a valid - PNG file, less than 4MB, and have the same dimensions as `image`. - type: string - format: binary - model: - anyOf: - - type: string - - type: string - enum: - - dall-e-2 - x-oaiTypeLabel: string - default: dall-e-2 - example: dall-e-2 - nullable: true - description: The model to use for image generation. Only `dall-e-2` is supported - at this time. - n: + index: type: integer - minimum: 1 - maximum: 10 - default: 1 - example: 1 - nullable: true - description: The number of images to generate. Must be between 1 and 10. - size: - type: string - enum: - - 256x256 - - 512x512 - - 1024x1024 - default: 1024x1024 - example: 1024x1024 - nullable: true - description: The size of the generated images. Must be one of `256x256`, - `512x512`, or `1024x1024`. - response_format: + description: The index of the embedding in the list of embeddings. + embedding: + type: array + description: > + The embedding vector, which is a list of floats. The length of + vector depends on the model as listed in the [embedding + guide](/docs/guides/embeddings). + items: + type: number + object: type: string + description: The object type, which is always "embedding". enum: - - url - - b64_json - default: url - example: url - nullable: true - description: The format in which the generated images are returned. Must be one - of `url` or `b64_json`. URLs are only valid for 60 minutes after the - image has been generated. - user: - type: string - example: user-1234 - description: > - A unique identifier representing your end-user, which can help - OpenAI to monitor and detect abuse. [Learn - more](/docs/guides/safety-best-practices#end-user-ids). + - embedding + x-stainless-const: true required: - - prompt - - image - CreateImageRequest: + - index + - object + - embedding + x-oaiMeta: + name: The embedding object + example: | + { + "object": "embedding", + "embedding": [ + 0.0023064255, + -0.009327292, + .... (1536 floats total for ada-002) + -0.0028842222, + ], + "index": 0 + } + Error: type: object properties: - prompt: - description: A text description of the desired image(s). The maximum length is - 1000 characters for `dall-e-2` and 4000 characters for `dall-e-3`. + code: type: string - example: A cute baby sea otter - model: - anyOf: - - type: string - - type: string - enum: - - dall-e-2 - - dall-e-3 - x-oaiTypeLabel: string - default: dall-e-2 - example: dall-e-3 - nullable: true - description: The model to use for image generation. - n: - type: integer - minimum: 1 - maximum: 10 - default: 1 - example: 1 nullable: true - description: The number of images to generate. Must be between 1 and 10. For - `dall-e-3`, only `n=1` is supported. - quality: + message: type: string - enum: - - standard - - hd - default: standard - example: standard - description: The quality of the image that will be generated. `hd` creates - images with finer details and greater consistency across the image. - This param is only supported for `dall-e-3`. - response_format: + nullable: false + param: type: string - enum: - - url - - b64_json - default: url - example: url nullable: true - description: The format in which the generated images are returned. Must be one - of `url` or `b64_json`. URLs are only valid for 60 minutes after the - image has been generated. - size: + type: + type: string + nullable: false + required: + - type + - message + - param + - code + ErrorEvent: + type: object + properties: + event: type: string enum: - - 256x256 - - 512x512 - - 1024x1024 - - 1792x1024 - - 1024x1792 - default: 1024x1024 - example: 1024x1024 - nullable: true - description: The size of the generated images. Must be one of `256x256`, - `512x512`, or `1024x1024` for `dall-e-2`. Must be one of - `1024x1024`, `1792x1024`, or `1024x1792` for `dall-e-3` models. - style: + - error + x-stainless-const: true + data: + $ref: "#/components/schemas/Error" + required: + - event + - data + description: Occurs when an [error](/docs/guides/error-codes#api-errors) occurs. + This can happen due to an internal server error or a timeout. + x-oaiMeta: + dataDescription: "`data` is an [error](/docs/guides/error-codes#api-errors)" + ErrorResponse: + type: object + properties: + error: + $ref: "#/components/schemas/Error" + required: + - error + Eval: + type: object + title: Eval + description: | + An Eval object with a data source config and testing criteria. + An Eval represents a task to be done for your LLM integration. + Like: + - Improve the quality of my chatbot + - See how well my chatbot handles customer support + - Check if o4-mini is better at my usecase than gpt-4o + properties: + object: type: string enum: - - vivid - - natural - default: vivid - example: vivid - nullable: true - description: The style of the generated images. Must be one of `vivid` or - `natural`. Vivid causes the model to lean towards generating - hyper-real and dramatic images. Natural causes the model to produce - more natural, less hyper-real looking images. This param is only - supported for `dall-e-3`. - user: + - eval + default: eval + description: The object type. + x-stainless-const: true + id: type: string - example: user-1234 - description: > - A unique identifier representing your end-user, which can help - OpenAI to monitor and detect abuse. [Learn - more](/docs/guides/safety-best-practices#end-user-ids). + description: Unique identifier for the evaluation. + name: + type: string + description: The name of the evaluation. + example: Chatbot effectiveness Evaluation + data_source_config: + type: object + description: Configuration of data sources used in runs of the evaluation. + oneOf: + - $ref: "#/components/schemas/EvalCustomDataSourceConfig" + - $ref: "#/components/schemas/EvalLogsDataSourceConfig" + - $ref: "#/components/schemas/EvalStoredCompletionsDataSourceConfig" + testing_criteria: + default: eval + description: A list of testing criteria. + type: array + items: + oneOf: + - $ref: "#/components/schemas/EvalGraderLabelModel" + - $ref: "#/components/schemas/EvalGraderStringCheck" + - $ref: "#/components/schemas/EvalGraderTextSimilarity" + - $ref: "#/components/schemas/EvalGraderPython" + - $ref: "#/components/schemas/EvalGraderScoreModel" + created_at: + type: integer + description: The Unix timestamp (in seconds) for when the eval was created. + metadata: + $ref: "#/components/schemas/Metadata" required: - - prompt - CreateImageVariationRequest: + - id + - data_source_config + - object + - testing_criteria + - name + - created_at + - metadata + x-oaiMeta: + name: The eval object + group: evals + example: | + { + "object": "eval", + "id": "eval_67abd54d9b0081909a86353f6fb9317a", + "data_source_config": { + "type": "custom", + "item_schema": { + "type": "object", + "properties": { + "label": {"type": "string"}, + }, + "required": ["label"] + }, + "include_sample_schema": true + }, + "testing_criteria": [ + { + "name": "My string check grader", + "type": "string_check", + "input": "{{sample.output_text}}", + "reference": "{{item.label}}", + "operation": "eq", + } + ], + "name": "External Data Eval", + "created_at": 1739314509, + "metadata": { + "test": "synthetics", + } + } + EvalApiError: type: object + title: EvalApiError + description: | + An object representing an error response from the Eval API. properties: - image: - description: The image to use as the basis for the variation(s). Must be a valid - PNG file, less than 4MB, and square. + code: type: string - format: binary - model: - anyOf: - - type: string - - type: string - enum: - - dall-e-2 - x-oaiTypeLabel: string - default: dall-e-2 - example: dall-e-2 - nullable: true - description: The model to use for image generation. Only `dall-e-2` is supported - at this time. - n: - type: integer - minimum: 1 - maximum: 10 - default: 1 - example: 1 - nullable: true - description: The number of images to generate. Must be between 1 and 10. For - `dall-e-3`, only `n=1` is supported. - response_format: + description: The error code. + message: type: string - enum: - - url - - b64_json - default: url - example: url - nullable: true - description: The format in which the generated images are returned. Must be one - of `url` or `b64_json`. URLs are only valid for 60 minutes after the - image has been generated. - size: + description: The error message. + required: + - code + - message + x-oaiMeta: + name: The API error object + group: evals + example: | + { + "code": "internal_error", + "message": "The eval run failed due to an internal error." + } + EvalCustomDataSourceConfig: + type: object + title: CustomDataSourceConfig + description: > + A CustomDataSourceConfig which specifies the schema of your `item` and + optionally `sample` namespaces. + + The response schema defines the shape of the data that will be: + + - Used to define your testing criteria and + + - What data is required when creating a run + properties: + type: type: string enum: - - 256x256 - - 512x512 - - 1024x1024 - default: 1024x1024 - example: 1024x1024 - nullable: true - description: The size of the generated images. Must be one of `256x256`, - `512x512`, or `1024x1024`. - user: - type: string - example: user-1234 - description: > - A unique identifier representing your end-user, which can help - OpenAI to monitor and detect abuse. [Learn - more](/docs/guides/safety-best-practices#end-user-ids). + - custom + default: custom + description: The type of data source. Always `custom`. + x-stainless-const: true + schema: + type: object + description: | + The json schema for the run data source items. + Learn how to build JSON schemas [here](https://json-schema.org/). + additionalProperties: true + example: | + { + "type": "object", + "properties": { + "item": { + "type": "object", + "properties": { + "label": {"type": "string"}, + }, + "required": ["label"] + } + }, + "required": ["item"] + } required: - - image - CreateMessageRequest: + - type + - schema + x-oaiMeta: + name: The eval custom data source config object + group: evals + example: | + { + "type": "custom", + "schema": { + "type": "object", + "properties": { + "item": { + "type": "object", + "properties": { + "label": {"type": "string"}, + }, + "required": ["label"] + } + }, + "required": ["item"] + } + } + EvalGraderLabelModel: type: object - additionalProperties: false - required: - - role - - content + title: LabelModelGrader + allOf: + - $ref: "#/components/schemas/GraderLabelModel" + EvalGraderPython: + type: object + title: PythonGrader + allOf: + - $ref: "#/components/schemas/GraderPython" + - type: object + properties: + pass_threshold: + type: number + description: The threshold for the score. + x-oaiMeta: + name: Eval Python Grader + group: graders + example: | + { + "type": "python", + "name": "Example python grader", + "image_tag": "2025-05-08", + "source": """ + def grade(sample: dict, item: dict) -> float: + \""" + Returns 1.0 if `output_text` equals `label`, otherwise 0.0. + \""" + output = sample.get("output_text") + label = item.get("label") + return 1.0 if output == label else 0.0 + """, + "pass_threshold": 0.8 + } + EvalGraderScoreModel: + type: object + title: ScoreModelGrader + allOf: + - $ref: "#/components/schemas/GraderScoreModel" + - type: object + properties: + pass_threshold: + type: number + description: The threshold for the score. + EvalGraderStringCheck: + type: object + title: StringCheckGrader + allOf: + - $ref: "#/components/schemas/GraderStringCheck" + EvalGraderTextSimilarity: + type: object + title: TextSimilarityGrader + allOf: + - $ref: "#/components/schemas/GraderTextSimilarity" + - type: object + properties: + pass_threshold: + type: number + description: The threshold for the score. + required: + - pass_threshold + x-oaiMeta: + name: Text Similarity Grader + group: graders + example: | + { + "type": "text_similarity", + "name": "Example text similarity grader", + "input": "{{sample.output_text}}", + "reference": "{{item.label}}", + "pass_threshold": 0.8, + "evaluation_metric": "fuzzy_match" + } + EvalItem: + type: object + title: Eval message object + description: > + A message input to the model with a role indicating instruction + following + + hierarchy. Instructions given with the `developer` or `system` role take + + precedence over instructions given with the `user` role. Messages with + the + + `assistant` role are presumed to have been generated by the model in + previous + + interactions. properties: role: type: string + description: > + The role of the message input. One of `user`, `assistant`, `system`, + or + + `developer`. enum: - user - assistant - description: > - The role of the entity that is creating the message. Allowed values - include: - - - `user`: Indicates the message is sent by an actual user and should - be used in most cases to represent user-generated messages. - - - `assistant`: Indicates the message is generated by the assistant. - Use this value to insert messages from the assistant into the - conversation. + - system + - developer content: + description: | + Text inputs to the model - can contain template strings. oneOf: - type: string - description: The text contents of the message. - title: Text content - - type: array - description: An array of content parts with a defined type, each can be of type - `text` or images can be passed with `image_url` or `image_file`. - Image types are only supported on [Vision-compatible - models](/docs/models). - title: Array of content parts - items: - oneOf: - - $ref: "#/components/schemas/MessageContentImageFileObject" - - $ref: "#/components/schemas/MessageContentImageUrlObject" - - $ref: "#/components/schemas/MessageRequestContentTextObject" - x-oaiExpandable: true - minItems: 1 - x-oaiExpandable: true - attachments: + title: Text input + description: | + A text input to the model. + - $ref: "#/components/schemas/InputTextContent" + - type: object + title: Output text + description: | + A text output from the model. + properties: + type: + type: string + description: | + The type of the output text. Always `output_text`. + enum: + - output_text + x-stainless-const: true + text: + type: string + description: | + The text output from the model. + required: + - type + - text + type: + type: string + description: | + The type of the message input. Always `message`. + enum: + - message + x-stainless-const: true + required: + - role + - content + EvalJsonlFileContentSource: + type: object + title: EvalJsonlFileContentSource + properties: + type: + type: string + enum: + - file_content + default: file_content + description: The type of jsonl source. Always `file_content`. + x-stainless-const: true + content: type: array items: type: object properties: - file_id: - type: string - description: The ID of the file to attach to the message. - tools: - description: The tools to add this file to. - type: array - items: - oneOf: - - $ref: "#/components/schemas/AssistantToolsCode" - - $ref: "#/components/schemas/AssistantToolsFileSearchTypeOnly" - x-oaiExpandable: true - description: A list of files attached to the message, and the tools they should - be added to. - required: + item: + type: object + additionalProperties: true + sample: + type: object + additionalProperties: true + required: + - item + description: The content of the jsonl file. + required: + - type + - content + EvalJsonlFileIdSource: + type: object + title: EvalJsonlFileIdSource + properties: + type: + type: string + enum: - file_id - - tools - nullable: true + default: file_id + description: The type of jsonl source. Always `file_id`. + x-stainless-const: true + id: + type: string + description: The identifier of the file. + required: + - type + - id + EvalList: + type: object + title: EvalList + description: | + An object representing a list of evals. + properties: + object: + type: string + enum: + - list + default: list + description: | + The type of this object. It is always set to "list". + x-stainless-const: true + data: + type: array + description: | + An array of eval objects. + items: + $ref: "#/components/schemas/Eval" + first_id: + type: string + description: The identifier of the first eval in the data array. + last_id: + type: string + description: The identifier of the last eval in the data array. + has_more: + type: boolean + description: Indicates whether there are more evals available. + required: + - object + - data + - first_id + - last_id + - has_more + x-oaiMeta: + name: The eval list object + group: evals + example: | + { + "object": "list", + "data": [ + { + "object": "eval", + "id": "eval_67abd54d9b0081909a86353f6fb9317a", + "data_source_config": { + "type": "custom", + "schema": { + "type": "object", + "properties": { + "item": { + "type": "object", + "properties": { + "input": { + "type": "string" + }, + "ground_truth": { + "type": "string" + } + }, + "required": [ + "input", + "ground_truth" + ] + } + }, + "required": [ + "item" + ] + } + }, + "testing_criteria": [ + { + "name": "String check", + "id": "String check-2eaf2d8d-d649-4335-8148-9535a7ca73c2", + "type": "string_check", + "input": "{{item.input}}", + "reference": "{{item.ground_truth}}", + "operation": "eq" + } + ], + "name": "External Data Eval", + "created_at": 1739314509, + "metadata": {}, + } + ], + "first_id": "eval_67abd54d9b0081909a86353f6fb9317a", + "last_id": "eval_67abd54d9b0081909a86353f6fb9317a", + "has_more": true + } + EvalLogsDataSourceConfig: + type: object + title: LogsDataSourceConfig + description: > + A LogsDataSourceConfig which specifies the metadata property of your + logs query. + + This is usually metadata like `usecase=chatbot` or `prompt-version=v2`, + etc. + + The schema returned by this data source config is used to defined what + variables are available in your evals. + + `item` and `sample` are both defined when using this data source config. + properties: + type: + type: string + enum: + - logs + default: logs + description: The type of data source. Always `logs`. + x-stainless-const: true metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. + $ref: "#/components/schemas/Metadata" + schema: type: object - x-oaiTypeLabel: map - nullable: true - CreateModerationRequest: + description: | + The json schema for the run data source items. + Learn how to build JSON schemas [here](https://json-schema.org/). + additionalProperties: true + required: + - type + - schema + x-oaiMeta: + name: The logs data source object for evals + group: evals + example: | + { + "type": "logs", + "metadata": { + "language": "english" + }, + "schema": { + "type": "object", + "properties": { + "item": { + "type": "object" + }, + "sample": { + "type": "object" + } + }, + "required": [ + "item", + "sample" + } + } + EvalResponsesSource: type: object + title: EvalResponsesSource + description: | + A EvalResponsesSource object describing a run data source configuration. properties: - input: - description: > - Input (or inputs) to classify. Can be a single string, an array of - strings, or - - an array of multi-modal input objects similar to other models. - oneOf: - - type: string - description: A string of text to classify for moderation. - default: "" - example: I want to kill them. - - type: array - description: An array of strings to classify for moderation. - items: - type: string - default: "" - example: I want to kill them. - - type: array - description: An array of multi-modal inputs to the moderation model. - items: - x-oaiExpandable: true - oneOf: - - type: object - description: An object describing an image to classify. - properties: - type: - description: Always `image_url`. - type: string - enum: - - image_url - image_url: - type: object - description: Contains either an image URL or a data URL for a base64 encoded - image. - properties: - url: - type: string - description: Either a URL of the image or the base64 encoded image data. - format: uri - example: https://example.com/image.jpg - required: - - url - required: - - type - - image_url - - type: object - description: An object describing text to classify. - properties: - type: - description: Always `text`. - type: string - enum: - - text - text: - description: A string of text to classify. - type: string - example: I want to kill them - required: - - type - - text - x-oaiExpandable: true + type: + type: string + enum: + - responses + description: The type of run data source. Always `responses`. + metadata: + type: object + nullable: true + description: Metadata filter for the responses. This is a query parameter used + to select responses. model: - description: | - The content moderation model you would like to use. Learn more in - [the moderation guide](/docs/guides/moderation), and learn about - available models [here](/docs/models#moderation). - nullable: false - default: omni-moderation-latest - example: omni-moderation-2024-09-26 - anyOf: - - type: string - - type: string - enum: - - omni-moderation-latest - - omni-moderation-2024-09-26 - - text-moderation-latest - - text-moderation-stable - x-oaiTypeLabel: string + type: string + nullable: true + description: The name of the model to find responses for. This is a query + parameter used to select responses. + instructions_search: + type: string + nullable: true + description: Optional string to search the 'instructions' field. This is a query + parameter used to select responses. + created_after: + type: integer + minimum: 0 + nullable: true + description: Only include items created after this timestamp (inclusive). This + is a query parameter used to select responses. + created_before: + type: integer + minimum: 0 + nullable: true + description: Only include items created before this timestamp (inclusive). This + is a query parameter used to select responses. + reasoning_effort: + $ref: "#/components/schemas/ReasoningEffort" + nullable: true + description: Optional reasoning effort parameter. This is a query parameter used + to select responses. + temperature: + type: number + nullable: true + description: Sampling temperature. This is a query parameter used to select + responses. + top_p: + type: number + nullable: true + description: Nucleus sampling parameter. This is a query parameter used to + select responses. + users: + type: array + items: + type: string + nullable: true + description: List of user identifiers. This is a query parameter used to select + responses. + tools: + type: array + items: + type: string + nullable: true + description: List of tool names. This is a query parameter used to select + responses. required: - - input - CreateModerationResponse: + - type + x-oaiMeta: + name: The run data source object used to configure an individual run + group: eval runs + example: | + { + "type": "responses", + "model": "gpt-4o-mini-2024-07-18", + "temperature": 0.7, + "top_p": 1.0, + "users": ["user1", "user2"], + "tools": ["tool1", "tool2"], + "instructions_search": "You are a coding assistant" + } + EvalRun: type: object - description: Represents if a given text input is potentially harmful. + title: EvalRun + description: | + A schema representing an evaluation run. properties: + object: + type: string + enum: + - eval.run + default: eval.run + description: The type of the object. Always "eval.run". + x-stainless-const: true id: type: string - description: The unique identifier for the moderation request. + description: Unique identifier for the evaluation run. + eval_id: + type: string + description: The identifier of the associated evaluation. + status: + type: string + description: The status of the evaluation run. model: type: string - description: The model used to generate the moderation results. - results: + description: The model that is evaluated, if applicable. + name: + type: string + description: The name of the evaluation run. + created_at: + type: integer + description: Unix timestamp (in seconds) when the evaluation run was created. + report_url: + type: string + description: The URL to the rendered evaluation run report on the UI dashboard. + result_counts: + type: object + description: Counters summarizing the outcomes of the evaluation run. + properties: + total: + type: integer + description: Total number of executed output items. + errored: + type: integer + description: Number of output items that resulted in an error. + failed: + type: integer + description: Number of output items that failed to pass the evaluation. + passed: + type: integer + description: Number of output items that passed the evaluation. + required: + - total + - errored + - failed + - passed + per_model_usage: type: array - description: A list of moderation objects. + description: Usage statistics for each model during the evaluation run. items: type: object properties: - flagged: - type: boolean - description: Whether any of the below categories are flagged. - categories: - type: object - description: A list of the categories, and whether they are flagged or not. - properties: - hate: - type: boolean - description: Content that expresses, incites, or promotes hate based on race, - gender, ethnicity, religion, nationality, sexual - orientation, disability status, or caste. Hateful content - aimed at non-protected groups (e.g., chess players) is - harassment. - hate/threatening: - type: boolean - description: Hateful content that also includes violence or serious harm towards - the targeted group based on race, gender, ethnicity, - religion, nationality, sexual orientation, disability - status, or caste. - harassment: - type: boolean - description: Content that expresses, incites, or promotes harassing language - towards any target. - harassment/threatening: - type: boolean - description: Harassment content that also includes violence or serious harm - towards any target. - illicit: - type: boolean - description: Content that includes instructions or advice that facilitate the - planning or execution of wrongdoing, or that gives advice - or instruction on how to commit illicit acts. For example, - "how to shoplift" would fit this category. - illicit/violent: - type: boolean - description: Content that includes instructions or advice that facilitate the - planning or execution of wrongdoing that also includes - violence, or that gives advice or instruction on the - procurement of any weapon. - self-harm: - type: boolean - description: Content that promotes, encourages, or depicts acts of self-harm, - such as suicide, cutting, and eating disorders. - self-harm/intent: - type: boolean - description: Content where the speaker expresses that they are engaging or - intend to engage in acts of self-harm, such as suicide, - cutting, and eating disorders. - self-harm/instructions: - type: boolean - description: Content that encourages performing acts of self-harm, such as - suicide, cutting, and eating disorders, or that gives - instructions or advice on how to commit such acts. - sexual: - type: boolean - description: Content meant to arouse sexual excitement, such as the description - of sexual activity, or that promotes sexual services - (excluding sex education and wellness). - sexual/minors: - type: boolean - description: Sexual content that includes an individual who is under 18 years - old. - violence: - type: boolean - description: Content that depicts death, violence, or physical injury. - violence/graphic: - type: boolean - description: Content that depicts death, violence, or physical injury in graphic - detail. - required: - - hate - - hate/threatening - - harassment - - harassment/threatening - - illicit - - illicit/violent - - self-harm - - self-harm/intent - - self-harm/instructions - - sexual - - sexual/minors - - violence - - violence/graphic - category_scores: + model_name: + type: string + description: The name of the model. + invocation_count: + type: integer + description: The number of invocations. + prompt_tokens: + type: integer + description: The number of prompt tokens used. + completion_tokens: + type: integer + description: The number of completion tokens generated. + total_tokens: + type: integer + description: The total number of tokens used. + cached_tokens: + type: integer + description: The number of tokens retrieved from cache. + required: + - model_name + - invocation_count + - prompt_tokens + - completion_tokens + - total_tokens + - cached_tokens + per_testing_criteria_results: + type: array + description: Results per testing criteria applied during the evaluation run. + items: + type: object + properties: + testing_criteria: + type: string + description: A description of the testing criteria. + passed: + type: integer + description: Number of tests passed for this criteria. + failed: + type: integer + description: Number of tests failed for this criteria. + required: + - testing_criteria + - passed + - failed + data_source: + type: object + description: Information about the run's data source. + oneOf: + - $ref: "#/components/schemas/CreateEvalJsonlRunDataSource" + - $ref: "#/components/schemas/CreateEvalCompletionsRunDataSource" + - $ref: "#/components/schemas/CreateEvalResponsesRunDataSource" + metadata: + $ref: "#/components/schemas/Metadata" + error: + $ref: "#/components/schemas/EvalApiError" + required: + - object + - id + - eval_id + - status + - model + - name + - created_at + - report_url + - result_counts + - per_model_usage + - per_testing_criteria_results + - data_source + - metadata + - error + x-oaiMeta: + name: The eval run object + group: evals + example: > + { + "object": "eval.run", + "id": "evalrun_67e57965b480819094274e3a32235e4c", + "eval_id": "eval_67e579652b548190aaa83ada4b125f47", + "report_url": "https://platform.openai.com/evaluations/eval_67e579652b548190aaa83ada4b125f47?run_id=evalrun_67e57965b480819094274e3a32235e4c", + "status": "queued", + "model": "gpt-4o-mini", + "name": "gpt-4o-mini", + "created_at": 1743092069, + "result_counts": { + "total": 0, + "errored": 0, + "failed": 0, + "passed": 0 + }, + "per_model_usage": null, + "per_testing_criteria_results": null, + "data_source": { + "type": "completions", + "source": { + "type": "file_content", + "content": [ + { + "item": { + "input": "Tech Company Launches Advanced Artificial Intelligence Platform", + "ground_truth": "Technology" + } + }, + { + "item": { + "input": "Central Bank Increases Interest Rates Amid Inflation Concerns", + "ground_truth": "Markets" + } + }, + { + "item": { + "input": "International Summit Addresses Climate Change Strategies", + "ground_truth": "World" + } + }, + { + "item": { + "input": "Major Retailer Reports Record-Breaking Holiday Sales", + "ground_truth": "Business" + } + }, + { + "item": { + "input": "National Team Qualifies for World Championship Finals", + "ground_truth": "Sports" + } + }, + { + "item": { + "input": "Stock Markets Rally After Positive Economic Data Released", + "ground_truth": "Markets" + } + }, + { + "item": { + "input": "Global Manufacturer Announces Merger with Competitor", + "ground_truth": "Business" + } + }, + { + "item": { + "input": "Breakthrough in Renewable Energy Technology Unveiled", + "ground_truth": "Technology" + } + }, + { + "item": { + "input": "World Leaders Sign Historic Climate Agreement", + "ground_truth": "World" + } + }, + { + "item": { + "input": "Professional Athlete Sets New Record in Championship Event", + "ground_truth": "Sports" + } + }, + { + "item": { + "input": "Financial Institutions Adapt to New Regulatory Requirements", + "ground_truth": "Business" + } + }, + { + "item": { + "input": "Tech Conference Showcases Advances in Artificial Intelligence", + "ground_truth": "Technology" + } + }, + { + "item": { + "input": "Global Markets Respond to Oil Price Fluctuations", + "ground_truth": "Markets" + } + }, + { + "item": { + "input": "International Cooperation Strengthened Through New Treaty", + "ground_truth": "World" + } + }, + { + "item": { + "input": "Sports League Announces Revised Schedule for Upcoming Season", + "ground_truth": "Sports" + } + } + ] + }, + "input_messages": { + "type": "template", + "template": [ + { + "type": "message", + "role": "developer", + "content": { + "type": "input_text", + "text": "Categorize a given news headline into one of the following topics: Technology, Markets, World, Business, or Sports.\n\n# Steps\n\n1. Analyze the content of the news headline to understand its primary focus.\n2. Extract the subject matter, identifying any key indicators or keywords.\n3. Use the identified indicators to determine the most suitable category out of the five options: Technology, Markets, World, Business, or Sports.\n4. Ensure only one category is selected per headline.\n\n# Output Format\n\nRespond with the chosen category as a single word. For instance: \"Technology\", \"Markets\", \"World\", \"Business\", or \"Sports\".\n\n# Examples\n\n**Input**: \"Apple Unveils New iPhone Model, Featuring Advanced AI Features\" \n**Output**: \"Technology\"\n\n**Input**: \"Global Stocks Mixed as Investors Await Central Bank Decisions\" \n**Output**: \"Markets\"\n\n**Input**: \"War in Ukraine: Latest Updates on Negotiation Status\" \n**Output**: \"World\"\n\n**Input**: \"Microsoft in Talks to Acquire Gaming Company for $2 Billion\" \n**Output**: \"Business\"\n\n**Input**: \"Manchester United Secures Win in Premier League Football Match\" \n**Output**: \"Sports\" \n\n# Notes\n\n- If the headline appears to fit into more than one category, choose the most dominant theme.\n- Keywords or phrases such as \"stocks\", \"company acquisition\", \"match\", or technological brands can be good indicators for classification.\n" + } + }, + { + "type": "message", + "role": "user", + "content": { + "type": "input_text", + "text": "{{item.input}}" + } + } + ] + }, + "model": "gpt-4o-mini", + "sampling_params": { + "seed": 42, + "temperature": 1.0, + "top_p": 1.0, + "max_completions_tokens": 2048 + } + }, + "error": null, + "metadata": {} + } + EvalRunList: + type: object + title: EvalRunList + description: | + An object representing a list of runs for an evaluation. + properties: + object: + type: string + enum: + - list + default: list + description: | + The type of this object. It is always set to "list". + x-stainless-const: true + data: + type: array + description: | + An array of eval run objects. + items: + $ref: "#/components/schemas/EvalRun" + first_id: + type: string + description: The identifier of the first eval run in the data array. + last_id: + type: string + description: The identifier of the last eval run in the data array. + has_more: + type: boolean + description: Indicates whether there are more evals available. + required: + - object + - data + - first_id + - last_id + - has_more + x-oaiMeta: + name: The eval run list object + group: evals + example: > + { + "object": "list", + "data": [ + { + "object": "eval.run", + "id": "evalrun_67b7fbdad46c819092f6fe7a14189620", + "eval_id": "eval_67b7fa9a81a88190ab4aa417e397ea21", + "report_url": "https://platform.openai.com/evaluations/eval_67b7fa9a81a88190ab4aa417e397ea21?run_id=evalrun_67b7fbdad46c819092f6fe7a14189620", + "status": "completed", + "model": "o3-mini", + "name": "Academic Assistant", + "created_at": 1740110812, + "result_counts": { + "total": 171, + "errored": 0, + "failed": 80, + "passed": 91 + }, + "per_model_usage": null, + "per_testing_criteria_results": [ + { + "testing_criteria": "String check grader", + "passed": 91, + "failed": 80 + } + ], + "run_data_source": { + "type": "completions", + "template_messages": [ + { + "type": "message", + "role": "system", + "content": { + "type": "input_text", + "text": "You are a helpful assistant." + } + }, + { + "type": "message", + "role": "user", + "content": { + "type": "input_text", + "text": "Hello, can you help me with my homework?" + } + } + ], + "datasource_reference": null, + "model": "o3-mini", + "max_completion_tokens": null, + "seed": null, + "temperature": null, + "top_p": null + }, + "error": null, + "metadata": {"test": "synthetics"} + } + ], + "first_id": "evalrun_67abd54d60ec8190832b46859da808f7", + "last_id": "evalrun_67abd54d60ec8190832b46859da808f7", + "has_more": false + } + EvalRunOutputItem: + type: object + title: EvalRunOutputItem + description: | + A schema representing an evaluation run output item. + properties: + object: + type: string + enum: + - eval.run.output_item + default: eval.run.output_item + description: The type of the object. Always "eval.run.output_item". + x-stainless-const: true + id: + type: string + description: Unique identifier for the evaluation run output item. + run_id: + type: string + description: The identifier of the evaluation run associated with this output + item. + eval_id: + type: string + description: The identifier of the evaluation group. + created_at: + type: integer + description: Unix timestamp (in seconds) when the evaluation run was created. + status: + type: string + description: The status of the evaluation run. + datasource_item_id: + type: integer + description: The identifier for the data source item. + datasource_item: + type: object + description: Details of the input data source item. + additionalProperties: true + results: + type: array + description: A list of results from the evaluation run. + items: + type: object + description: A result object. + additionalProperties: true + sample: + type: object + description: A sample containing the input and output of the evaluation run. + properties: + input: + type: array + description: An array of input messages. + items: type: object - description: A list of the categories along with their scores as predicted by - model. + description: An input message. properties: - hate: - type: number - description: The score for the category 'hate'. - hate/threatening: - type: number - description: The score for the category 'hate/threatening'. - harassment: - type: number - description: The score for the category 'harassment'. - harassment/threatening: - type: number - description: The score for the category 'harassment/threatening'. - illicit: - type: number - description: The score for the category 'illicit'. - illicit/violent: - type: number - description: The score for the category 'illicit/violent'. - self-harm: - type: number - description: The score for the category 'self-harm'. - self-harm/intent: - type: number - description: The score for the category 'self-harm/intent'. - self-harm/instructions: - type: number - description: The score for the category 'self-harm/instructions'. - sexual: - type: number - description: The score for the category 'sexual'. - sexual/minors: - type: number - description: The score for the category 'sexual/minors'. - violence: - type: number - description: The score for the category 'violence'. - violence/graphic: - type: number - description: The score for the category 'violence/graphic'. + role: + type: string + description: The role of the message sender (e.g., system, user, developer). + content: + type: string + description: The content of the message. required: - - hate - - hate/threatening - - harassment - - harassment/threatening - - illicit - - illicit/violent - - self-harm - - self-harm/intent - - self-harm/instructions - - sexual - - sexual/minors - - violence - - violence/graphic - category_applied_input_types: + - role + - content + output: + type: array + description: An array of output messages. + items: type: object - description: A list of the categories along with the input type(s) that the - score applies to. properties: - hate: - type: array - description: The applied input type(s) for the category 'hate'. - items: - type: string - enum: - - text - hate/threatening: - type: array - description: The applied input type(s) for the category 'hate/threatening'. - items: - type: string - enum: - - text - harassment: - type: array - description: The applied input type(s) for the category 'harassment'. - items: - type: string - enum: - - text - harassment/threatening: - type: array - description: The applied input type(s) for the category - 'harassment/threatening'. - items: - type: string - enum: - - text - illicit: - type: array - description: The applied input type(s) for the category 'illicit'. - items: - type: string - enum: - - text - illicit/violent: - type: array - description: The applied input type(s) for the category 'illicit/violent'. - items: - type: string - enum: - - text - self-harm: - type: array - description: The applied input type(s) for the category 'self-harm'. - items: - type: string - enum: - - text - - image - self-harm/intent: - type: array - description: The applied input type(s) for the category 'self-harm/intent'. - items: - type: string - enum: - - text - - image - self-harm/instructions: - type: array - description: The applied input type(s) for the category - 'self-harm/instructions'. - items: - type: string - enum: - - text - - image - sexual: - type: array - description: The applied input type(s) for the category 'sexual'. - items: - type: string - enum: - - text - - image - sexual/minors: - type: array - description: The applied input type(s) for the category 'sexual/minors'. - items: - type: string - enum: - - text - violence: - type: array - description: The applied input type(s) for the category 'violence'. - items: - type: string - enum: - - text - - image - violence/graphic: - type: array - description: The applied input type(s) for the category 'violence/graphic'. - items: - type: string - enum: - - text - - image - required: - - hate - - hate/threatening - - harassment - - harassment/threatening - - illicit - - illicit/violent - - self-harm - - self-harm/intent - - self-harm/instructions - - sexual - - sexual/minors - - violence - - violence/graphic - required: - - flagged - - categories - - category_scores - - category_applied_input_types + role: + type: string + description: The role of the message (e.g. "system", "assistant", "user"). + content: + type: string + description: The content of the message. + finish_reason: + type: string + description: The reason why the sample generation was finished. + model: + type: string + description: The model used for generating the sample. + usage: + type: object + description: Token usage details for the sample. + properties: + total_tokens: + type: integer + description: The total number of tokens used. + completion_tokens: + type: integer + description: The number of completion tokens generated. + prompt_tokens: + type: integer + description: The number of prompt tokens used. + cached_tokens: + type: integer + description: The number of tokens retrieved from cache. + required: + - total_tokens + - completion_tokens + - prompt_tokens + - cached_tokens + error: + $ref: "#/components/schemas/EvalApiError" + temperature: + type: number + description: The sampling temperature used. + max_completion_tokens: + type: integer + description: The maximum number of tokens allowed for completion. + top_p: + type: number + description: The top_p value used for sampling. + seed: + type: integer + description: The seed used for generating the sample. + required: + - input + - output + - finish_reason + - model + - usage + - error + - temperature + - max_completion_tokens + - top_p + - seed + required: + - object + - id + - run_id + - eval_id + - created_at + - status + - datasource_item_id + - datasource_item + - results + - sample + x-oaiMeta: + name: The eval run output item object + group: evals + example: > + { + "object": "eval.run.output_item", + "id": "outputitem_67abd55eb6548190bb580745d5644a33", + "run_id": "evalrun_67abd54d60ec8190832b46859da808f7", + "eval_id": "eval_67abd54d9b0081909a86353f6fb9317a", + "created_at": 1739314509, + "status": "pass", + "datasource_item_id": 137, + "datasource_item": { + "teacher": "To grade essays, I only check for style, content, and grammar.", + "student": "I am a student who is trying to write the best essay." + }, + "results": [ + { + "name": "String Check Grader", + "type": "string-check-grader", + "score": 1.0, + "passed": true, + } + ], + "sample": { + "input": [ + { + "role": "system", + "content": "You are an evaluator bot..." + }, + { + "role": "user", + "content": "You are assessing..." + } + ], + "output": [ + { + "role": "assistant", + "content": "The rubric is not clear nor concise." + } + ], + "finish_reason": "stop", + "model": "gpt-4o-2024-08-06", + "usage": { + "total_tokens": 521, + "completion_tokens": 2, + "prompt_tokens": 519, + "cached_tokens": 0 + }, + "error": null, + "temperature": 1.0, + "max_completion_tokens": 2048, + "top_p": 1.0, + "seed": 42 + } + } + EvalRunOutputItemList: + type: object + title: EvalRunOutputItemList + description: | + An object representing a list of output items for an evaluation run. + properties: + object: + type: string + enum: + - list + default: list + description: | + The type of this object. It is always set to "list". + x-stainless-const: true + data: + type: array + description: | + An array of eval run output item objects. + items: + $ref: "#/components/schemas/EvalRunOutputItem" + first_id: + type: string + description: The identifier of the first eval run output item in the data array. + last_id: + type: string + description: The identifier of the last eval run output item in the data array. + has_more: + type: boolean + description: Indicates whether there are more eval run output items available. + required: + - object + - data + - first_id + - last_id + - has_more + x-oaiMeta: + name: The eval run output item list object + group: evals + example: > + { + "object": "list", + "data": [ + { + "object": "eval.run.output_item", + "id": "outputitem_67abd55eb6548190bb580745d5644a33", + "run_id": "evalrun_67abd54d60ec8190832b46859da808f7", + "eval_id": "eval_67abd54d9b0081909a86353f6fb9317a", + "created_at": 1739314509, + "status": "pass", + "datasource_item_id": 137, + "datasource_item": { + "teacher": "To grade essays, I only check for style, content, and grammar.", + "student": "I am a student who is trying to write the best essay." + }, + "results": [ + { + "name": "String Check Grader", + "type": "string-check-grader", + "score": 1.0, + "passed": true, + } + ], + "sample": { + "input": [ + { + "role": "system", + "content": "You are an evaluator bot..." + }, + { + "role": "user", + "content": "You are assessing..." + } + ], + "output": [ + { + "role": "assistant", + "content": "The rubric is not clear nor concise." + } + ], + "finish_reason": "stop", + "model": "gpt-4o-2024-08-06", + "usage": { + "total_tokens": 521, + "completion_tokens": 2, + "prompt_tokens": 519, + "cached_tokens": 0 + }, + "error": null, + "temperature": 1.0, + "max_completion_tokens": 2048, + "top_p": 1.0, + "seed": 42 + } + }, + ], + "first_id": "outputitem_67abd55eb6548190bb580745d5644a33", + "last_id": "outputitem_67abd55eb6548190bb580745d5644a33", + "has_more": false + } + EvalStoredCompletionsDataSourceConfig: + type: object + title: StoredCompletionsDataSourceConfig + description: | + Deprecated in favor of LogsDataSourceConfig. + properties: + type: + type: string + enum: + - stored_completions + default: stored_completions + description: The type of data source. Always `stored_completions`. + x-stainless-const: true + metadata: + $ref: "#/components/schemas/Metadata" + schema: + type: object + description: | + The json schema for the run data source items. + Learn how to build JSON schemas [here](https://json-schema.org/). + additionalProperties: true + required: + - type + - schema + deprecated: true + x-oaiMeta: + name: The stored completions data source object for evals + group: evals + example: | + { + "type": "stored_completions", + "metadata": { + "language": "english" + }, + "schema": { + "type": "object", + "properties": { + "item": { + "type": "object" + }, + "sample": { + "type": "object" + } + }, + "required": [ + "item", + "sample" + } + } + EvalStoredCompletionsSource: + type: object + title: StoredCompletionsRunDataSource + description: > + A StoredCompletionsRunDataSource configuration describing a set of + filters + properties: + type: + type: string + enum: + - stored_completions + default: stored_completions + description: The type of source. Always `stored_completions`. + x-stainless-const: true + metadata: + $ref: "#/components/schemas/Metadata" + model: + type: string + nullable: true + description: An optional model to filter by (e.g., 'gpt-4o'). + created_after: + type: integer + nullable: true + description: An optional Unix timestamp to filter items created after this time. + created_before: + type: integer + nullable: true + description: An optional Unix timestamp to filter items created before this time. + limit: + type: integer + nullable: true + description: An optional maximum number of items to return. + required: + - type + x-oaiMeta: + name: The stored completions data source object used to configure an individual + run + group: eval runs + example: | + { + "type": "stored_completions", + "model": "gpt-4o", + "created_after": 1668124800, + "created_before": 1668124900, + "limit": 100, + "metadata": {} + } + FilePath: + type: object + title: File path + description: | + A path to a file. + properties: + type: + type: string + description: | + The type of the file path. Always `file_path`. + enum: + - file_path + x-stainless-const: true + file_id: + type: string + description: | + The ID of the file. + index: + type: integer + description: | + The index of the file in the list of files. + required: + - type + - file_id + - index + FileSearchRanker: + type: string + description: The ranker to use for the file search. If not specified will use + the `auto` ranker. + enum: + - auto + - default_2024_08_21 + FileSearchRankingOptions: + title: File search tool call ranking options + type: object + description: | + The ranking options for the file search. If not specified, the file search tool will use the `auto` ranker and a score_threshold of 0. + + See the [file search tool documentation](/docs/assistants/tools/file-search#customizing-file-search-settings) for more information. + properties: + ranker: + $ref: "#/components/schemas/FileSearchRanker" + score_threshold: + type: number + description: The score threshold for the file search. All values must be a + floating point number between 0 and 1. + minimum: 0 + maximum: 1 + required: + - score_threshold + FileSearchToolCall: + type: object + title: File search tool call + description: > + The results of a file search tool call. See the + + [file search guide](/docs/guides/tools-file-search) for more + information. + properties: + id: + type: string + description: | + The unique ID of the file search tool call. + type: + type: string + enum: + - file_search_call + description: | + The type of the file search tool call. Always `file_search_call`. + x-stainless-const: true + status: + type: string + description: | + The status of the file search tool call. One of `in_progress`, + `searching`, `incomplete` or `failed`, + enum: + - in_progress + - searching + - completed + - incomplete + - failed + queries: + type: array + items: + type: string + description: | + The queries used to search for files. + results: + type: array + description: | + The results of the file search tool call. + items: + type: object + properties: + file_id: + type: string + description: | + The unique ID of the file. + text: + type: string + description: | + The text that was retrieved from the file. + filename: + type: string + description: | + The name of the file. + attributes: + $ref: "#/components/schemas/VectorStoreFileAttributes" + score: + type: number + format: float + description: | + The relevance score of the file - a value between 0 and 1. + nullable: true + required: + - id + - type + - status + - queries + FineTuneChatCompletionRequestAssistantMessage: + allOf: + - type: object + title: Assistant message + deprecated: false + properties: + weight: + type: integer + enum: + - 0 + - 1 + description: Controls whether the assistant message is trained against (0 or 1) + - $ref: "#/components/schemas/ChatCompletionRequestAssistantMessage" + required: + - role + FineTuneChatRequestInput: + type: object + description: The per-line training example of a fine-tuning input file for chat + models using the supervised method. + properties: + messages: + type: array + minItems: 1 + items: + oneOf: + - $ref: "#/components/schemas/ChatCompletionRequestSystemMessage" + - $ref: "#/components/schemas/ChatCompletionRequestUserMessage" + - $ref: "#/components/schemas/FineTuneChatCompletionRequestAssistantMessage" + - $ref: "#/components/schemas/ChatCompletionRequestToolMessage" + - $ref: "#/components/schemas/ChatCompletionRequestFunctionMessage" + tools: + type: array + description: A list of tools the model may generate JSON inputs for. + items: + $ref: "#/components/schemas/ChatCompletionTool" + parallel_tool_calls: + $ref: "#/components/schemas/ParallelToolCalls" + functions: + deprecated: true + description: A list of functions the model may generate JSON inputs for. + type: array + minItems: 1 + maxItems: 128 + items: + $ref: "#/components/schemas/ChatCompletionFunctions" + x-oaiMeta: + name: Training format for chat models using the supervised method + example: > + { + "messages": [ + { "role": "user", "content": "What is the weather in San Francisco?" }, + { + "role": "assistant", + "tool_calls": [ + { + "id": "call_id", + "type": "function", + "function": { + "name": "get_current_weather", + "arguments": "{\"location\": \"San Francisco, USA\", \"format\": \"celsius\"}" + } + } + ] + } + ], + "parallel_tool_calls": false, + "tools": [ + { + "type": "function", + "function": { + "name": "get_current_weather", + "description": "Get the current weather", + "parameters": { + "type": "object", + "properties": { + "location": { + "type": "string", + "description": "The city and country, eg. San Francisco, USA" + }, + "format": { "type": "string", "enum": ["celsius", "fahrenheit"] } + }, + "required": ["location", "format"] + } + } + } + ] + } + FineTuneDPOHyperparameters: + type: object + description: The hyperparameters used for the DPO fine-tuning job. + properties: + beta: + description: > + The beta value for the DPO method. A higher beta value will increase + the weight of the penalty between the policy and reference model. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: number + minimum: 0 + maximum: 2 + exclusiveMinimum: true + default: auto + batch_size: + description: > + Number of examples in each batch. A larger batch size means that + model parameters are updated less frequently, but with lower + variance. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + maximum: 256 + default: auto + learning_rate_multiplier: + description: > + Scaling factor for the learning rate. A smaller learning rate may be + useful to avoid overfitting. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: number + minimum: 0 + exclusiveMinimum: true + default: auto + n_epochs: + description: > + The number of epochs to train the model for. An epoch refers to one + full cycle through the training dataset. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + maximum: 50 + default: auto + FineTuneDPOMethod: + type: object + description: Configuration for the DPO fine-tuning method. + properties: + hyperparameters: + $ref: "#/components/schemas/FineTuneDPOHyperparameters" + FineTuneMethod: + type: object + description: The method used for fine-tuning. + properties: + type: + type: string + description: The type of method. Is either `supervised`, `dpo`, or + `reinforcement`. + enum: + - supervised + - dpo + - reinforcement + supervised: + $ref: "#/components/schemas/FineTuneSupervisedMethod" + dpo: + $ref: "#/components/schemas/FineTuneDPOMethod" + reinforcement: + $ref: "#/components/schemas/FineTuneReinforcementMethod" + required: + - type + FineTunePreferenceRequestInput: + type: object + description: The per-line training example of a fine-tuning input file for chat + models using the dpo method. + properties: + input: + type: object + properties: + messages: + type: array + minItems: 1 + items: + oneOf: + - $ref: "#/components/schemas/ChatCompletionRequestSystemMessage" + - $ref: "#/components/schemas/ChatCompletionRequestUserMessage" + - $ref: "#/components/schemas/FineTuneChatCompletionRequestAssistantMessage" + - $ref: "#/components/schemas/ChatCompletionRequestToolMessage" + - $ref: "#/components/schemas/ChatCompletionRequestFunctionMessage" + tools: + type: array + description: A list of tools the model may generate JSON inputs for. + items: + $ref: "#/components/schemas/ChatCompletionTool" + parallel_tool_calls: + $ref: "#/components/schemas/ParallelToolCalls" + preferred_completion: + type: array + description: The preferred completion message for the output. + maxItems: 1 + items: + oneOf: + - $ref: "#/components/schemas/ChatCompletionRequestAssistantMessage" + non_preferred_completion: + type: array + description: The non-preferred completion message for the output. + maxItems: 1 + items: + oneOf: + - $ref: "#/components/schemas/ChatCompletionRequestAssistantMessage" + x-oaiMeta: + name: Training format for chat models using the preference method + example: > + { + "input": { + "messages": [ + { "role": "user", "content": "What is the weather in San Francisco?" } + ] + }, + "preferred_completion": [ + { + "role": "assistant", + "content": "The weather in San Francisco is 70 degrees Fahrenheit." + } + ], + "non_preferred_completion": [ + { + "role": "assistant", + "content": "The weather in San Francisco is 21 degrees Celsius." + } + ] + } + FineTuneReinforcementHyperparameters: + type: object + description: The hyperparameters used for the reinforcement fine-tuning job. + properties: + batch_size: + description: > + Number of examples in each batch. A larger batch size means that + model parameters are updated less frequently, but with lower + variance. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + maximum: 256 + default: auto + learning_rate_multiplier: + description: > + Scaling factor for the learning rate. A smaller learning rate may be + useful to avoid overfitting. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: number + minimum: 0 + exclusiveMinimum: true + default: auto + n_epochs: + description: > + The number of epochs to train the model for. An epoch refers to one + full cycle through the training dataset. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + maximum: 50 + default: auto + reasoning_effort: + description: | + Level of reasoning effort. + type: string + enum: + - default + - low + - medium + - high + default: default + compute_multiplier: + description: > + Multiplier on amount of compute used for exploring search space + during training. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: number + minimum: 0.00001 + maximum: 10 + exclusiveMinimum: true + default: auto + eval_interval: + description: | + The number of training steps between evaluation runs. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + default: auto + eval_samples: + description: | + Number of evaluation samples to generate per training step. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + default: auto + FineTuneReinforcementMethod: + type: object + description: Configuration for the reinforcement fine-tuning method. + properties: + grader: + type: object + description: The grader used for the fine-tuning job. + oneOf: + - $ref: "#/components/schemas/GraderStringCheck" + - $ref: "#/components/schemas/GraderTextSimilarity" + - $ref: "#/components/schemas/GraderPython" + - $ref: "#/components/schemas/GraderScoreModel" + - $ref: "#/components/schemas/GraderMulti" + hyperparameters: + $ref: "#/components/schemas/FineTuneReinforcementHyperparameters" + required: + - grader + FineTuneReinforcementRequestInput: + type: object + unevaluatedProperties: true + description: Per-line training example for reinforcement fine-tuning. Note that + `messages` and `tools` are the only reserved keywords. Any other + arbitrary key-value data can be included on training datapoints and will + be available to reference during grading under the `{{ item.XXX }}` + template variable. + required: + - messages + properties: + messages: + type: array + minItems: 1 + items: + oneOf: + - $ref: "#/components/schemas/ChatCompletionRequestDeveloperMessage" + - $ref: "#/components/schemas/ChatCompletionRequestUserMessage" + - $ref: "#/components/schemas/FineTuneChatCompletionRequestAssistantMessage" + - $ref: "#/components/schemas/ChatCompletionRequestToolMessage" + tools: + type: array + description: A list of tools the model may generate JSON inputs for. + items: + $ref: "#/components/schemas/ChatCompletionTool" + x-oaiMeta: + name: Training format for reasoning models using the reinforcement method + example: > + { + "messages": [ + { + "role": "user", + "content": "Your task is to take a chemical in SMILES format and predict the number of hydrobond bond donors and acceptors according to Lipinkski's rule. CCN(CC)CCC(=O)c1sc(N)nc1C" + }, + ], + # Any other JSON data can be inserted into an example and referenced during RFT grading + "reference_answer": { + "donor_bond_counts": 5, + "acceptor_bond_counts": 7 + } + } + FineTuneSupervisedHyperparameters: + type: object + description: The hyperparameters used for the fine-tuning job. + properties: + batch_size: + description: > + Number of examples in each batch. A larger batch size means that + model parameters are updated less frequently, but with lower + variance. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + maximum: 256 + default: auto + learning_rate_multiplier: + description: > + Scaling factor for the learning rate. A smaller learning rate may be + useful to avoid overfitting. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: number + minimum: 0 + exclusiveMinimum: true + default: auto + n_epochs: + description: > + The number of epochs to train the model for. An epoch refers to one + full cycle through the training dataset. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + maximum: 50 + default: auto + FineTuneSupervisedMethod: + type: object + description: Configuration for the supervised fine-tuning method. + properties: + hyperparameters: + $ref: "#/components/schemas/FineTuneSupervisedHyperparameters" + FineTuningCheckpointPermission: + type: object + title: FineTuningCheckpointPermission + description: > + The `checkpoint.permission` object represents a permission for a + fine-tuned model checkpoint. + properties: + id: + type: string + description: The permission identifier, which can be referenced in the API + endpoints. + created_at: + type: integer + description: The Unix timestamp (in seconds) for when the permission was created. + project_id: + type: string + description: The project identifier that the permission is for. + object: + type: string + description: The object type, which is always "checkpoint.permission". + enum: + - checkpoint.permission + x-stainless-const: true + required: + - created_at + - id + - object + - project_id + x-oaiMeta: + name: The fine-tuned model checkpoint permission object + example: | + { + "object": "checkpoint.permission", + "id": "cp_zc4Q7MP6XxulcVzj4MZdwsAB", + "created_at": 1712211699, + "project_id": "proj_abGMw1llN8IrBb6SvvY5A1iH" + } + FineTuningIntegration: + type: object + title: Fine-Tuning Job Integration + required: + - type + - wandb + properties: + type: + type: string + description: The type of the integration being enabled for the fine-tuning job + enum: + - wandb + x-stainless-const: true + wandb: + type: object + description: > + The settings for your integration with Weights and Biases. This + payload specifies the project that + + metrics will be sent to. Optionally, you can set an explicit display + name for your run, add tags + + to your run, and set a default entity (team, username, etc) to be + associated with your run. + required: + - project + properties: + project: + description: | + The name of the project that the new run will be created under. + type: string + example: my-wandb-project + name: + description: > + A display name to set for the run. If not set, we will use the + Job ID as the name. + nullable: true + type: string + entity: + description: > + The entity to use for the run. This allows you to set the team + or username of the WandB user that you would + + like associated with the run. If not set, the default entity for + the registered WandB API key is used. + nullable: true + type: string + tags: + description: > + A list of tags to be attached to the newly created run. These + tags are passed through directly to WandB. Some + + default tags are generated by OpenAI: "openai/finetune", + "openai/{base-model}", "openai/{ftjob-abcdef}". + type: array + items: + type: string + example: custom-tag + FineTuningJob: + type: object + title: FineTuningJob + description: > + The `fine_tuning.job` object represents a fine-tuning job that has been + created through the API. + properties: + id: + type: string + description: The object identifier, which can be referenced in the API endpoints. + created_at: + type: integer + description: The Unix timestamp (in seconds) for when the fine-tuning job was + created. + error: + type: object + nullable: true + description: For fine-tuning jobs that have `failed`, this will contain more + information on the cause of the failure. + properties: + code: + type: string + description: A machine-readable error code. + message: + type: string + description: A human-readable error message. + param: + type: string + description: The parameter that was invalid, usually `training_file` or + `validation_file`. This field will be null if the failure was + not parameter-specific. + nullable: true + required: + - code + - message + - param + fine_tuned_model: + type: string + nullable: true + description: The name of the fine-tuned model that is being created. The value + will be null if the fine-tuning job is still running. + finished_at: + type: integer + nullable: true + description: The Unix timestamp (in seconds) for when the fine-tuning job was + finished. The value will be null if the fine-tuning job is still + running. + hyperparameters: + type: object + description: The hyperparameters used for the fine-tuning job. This value will + only be returned when running `supervised` jobs. + properties: + batch_size: + nullable: true + description: > + Number of examples in each batch. A larger batch size means that + model parameters + + are updated less frequently, but with lower variance. + oneOf: + - type: null + nullable: true + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + maximum: 256 + default: auto + learning_rate_multiplier: + description: > + Scaling factor for the learning rate. A smaller learning rate + may be useful to avoid + + overfitting. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: number + minimum: 0 + exclusiveMinimum: true + default: auto + n_epochs: + description: > + The number of epochs to train the model for. An epoch refers to + one full cycle + + through the training dataset. + oneOf: + - type: string + enum: + - auto + x-stainless-const: true + - type: integer + minimum: 1 + maximum: 50 + default: auto + model: + type: string + description: The base model that is being fine-tuned. + object: + type: string + description: The object type, which is always "fine_tuning.job". + enum: + - fine_tuning.job + x-stainless-const: true + organization_id: + type: string + description: The organization that owns the fine-tuning job. + result_files: + type: array + description: The compiled results file ID(s) for the fine-tuning job. You can + retrieve the results with the [Files + API](/docs/api-reference/files/retrieve-contents). + items: + type: string + example: file-abc123 + status: + type: string + description: The current status of the fine-tuning job, which can be either + `validating_files`, `queued`, `running`, `succeeded`, `failed`, or + `cancelled`. + enum: + - validating_files + - queued + - running + - succeeded + - failed + - cancelled + trained_tokens: + type: integer + nullable: true + description: The total number of billable tokens processed by this fine-tuning + job. The value will be null if the fine-tuning job is still running. + training_file: + type: string + description: The file ID used for training. You can retrieve the training data + with the [Files API](/docs/api-reference/files/retrieve-contents). + validation_file: + type: string + nullable: true + description: The file ID used for validation. You can retrieve the validation + results with the [Files + API](/docs/api-reference/files/retrieve-contents). + integrations: + type: array + nullable: true + description: A list of integrations to enable for this fine-tuning job. + maxItems: 5 + items: + oneOf: + - $ref: "#/components/schemas/FineTuningIntegration" + seed: + type: integer + description: The seed used for the fine-tuning job. + estimated_finish: + type: integer + nullable: true + description: The Unix timestamp (in seconds) for when the fine-tuning job is + estimated to finish. The value will be null if the fine-tuning job + is not running. + method: + $ref: "#/components/schemas/FineTuneMethod" + metadata: + $ref: "#/components/schemas/Metadata" + required: + - created_at + - error + - finished_at + - fine_tuned_model + - hyperparameters + - id + - model + - object + - organization_id + - result_files + - status + - trained_tokens + - training_file + - validation_file + - seed + x-oaiMeta: + name: The fine-tuning job object + example: | + { + "object": "fine_tuning.job", + "id": "ftjob-abc123", + "model": "davinci-002", + "created_at": 1692661014, + "finished_at": 1692661190, + "fine_tuned_model": "ft:davinci-002:my-org:custom_suffix:7q8mpxmy", + "organization_id": "org-123", + "result_files": [ + "file-abc123" + ], + "status": "succeeded", + "validation_file": null, + "training_file": "file-abc123", + "hyperparameters": { + "n_epochs": 4, + "batch_size": 1, + "learning_rate_multiplier": 1.0 + }, + "trained_tokens": 5768, + "integrations": [], + "seed": 0, + "estimated_finish": 0, + "method": { + "type": "supervised", + "supervised": { + "hyperparameters": { + "n_epochs": 4, + "batch_size": 1, + "learning_rate_multiplier": 1.0 + } + } + }, + "metadata": { + "key": "value" + } + } + FineTuningJobCheckpoint: + type: object + title: FineTuningJobCheckpoint + description: > + The `fine_tuning.job.checkpoint` object represents a model checkpoint + for a fine-tuning job that is ready to use. + properties: + id: + type: string + description: The checkpoint identifier, which can be referenced in the API + endpoints. + created_at: + type: integer + description: The Unix timestamp (in seconds) for when the checkpoint was created. + fine_tuned_model_checkpoint: + type: string + description: The name of the fine-tuned checkpoint model that is created. + step_number: + type: integer + description: The step number that the checkpoint was created at. + metrics: + type: object + description: Metrics at the step number during the fine-tuning job. + properties: + step: + type: number + train_loss: + type: number + train_mean_token_accuracy: + type: number + valid_loss: + type: number + valid_mean_token_accuracy: + type: number + full_valid_loss: + type: number + full_valid_mean_token_accuracy: + type: number + fine_tuning_job_id: + type: string + description: The name of the fine-tuning job that this checkpoint was created + from. + object: + type: string + description: The object type, which is always "fine_tuning.job.checkpoint". + enum: + - fine_tuning.job.checkpoint + x-stainless-const: true + required: + - created_at + - fine_tuning_job_id + - fine_tuned_model_checkpoint + - id + - metrics + - object + - step_number + x-oaiMeta: + name: The fine-tuning job checkpoint object + example: > + { + "object": "fine_tuning.job.checkpoint", + "id": "ftckpt_qtZ5Gyk4BLq1SfLFWp3RtO3P", + "created_at": 1712211699, + "fine_tuned_model_checkpoint": "ft:gpt-4o-mini-2024-07-18:my-org:custom_suffix:9ABel2dg:ckpt-step-88", + "fine_tuning_job_id": "ftjob-fpbNQ3H1GrMehXRf8cO97xTN", + "metrics": { + "step": 88, + "train_loss": 0.478, + "train_mean_token_accuracy": 0.924, + "valid_loss": 10.112, + "valid_mean_token_accuracy": 0.145, + "full_valid_loss": 0.567, + "full_valid_mean_token_accuracy": 0.944 + }, + "step_number": 88 + } + FineTuningJobEvent: + type: object + description: Fine-tuning job event object + properties: + object: + type: string + description: The object type, which is always "fine_tuning.job.event". + enum: + - fine_tuning.job.event + x-stainless-const: true + id: + type: string + description: The object identifier. + created_at: + type: integer + description: The Unix timestamp (in seconds) for when the fine-tuning job was + created. + level: + type: string + description: The log level of the event. + enum: + - info + - warn + - error + message: + type: string + description: The message of the event. + type: + type: string + description: The type of event. + enum: + - message + - metrics + data: + type: object + description: The data associated with the event. + required: + - id + - object + - created_at + - level + - message + x-oaiMeta: + name: The fine-tuning job event object + example: | + { + "object": "fine_tuning.job.event", + "id": "ftevent-abc123" + "created_at": 1677610602, + "level": "info", + "message": "Created fine-tuning job", + "data": {}, + "type": "message" + } + FunctionObject: + type: object + properties: + description: + type: string + description: A description of what the function does, used by the model to + choose when and how to call the function. + name: + type: string + description: The name of the function to be called. Must be a-z, A-Z, 0-9, or + contain underscores and dashes, with a maximum length of 64. + parameters: + $ref: "#/components/schemas/FunctionParameters" + strict: + type: boolean + nullable: true + default: false + description: Whether to enable strict schema adherence when generating the + function call. If set to true, the model will follow the exact + schema defined in the `parameters` field. Only a subset of JSON + Schema is supported when `strict` is `true`. Learn more about + Structured Outputs in the [function calling + guide](docs/guides/function-calling). + required: + - name + FunctionParameters: + type: object + description: >- + The parameters the functions accepts, described as a JSON Schema object. + See the [guide](/docs/guides/function-calling) for examples, and the + [JSON Schema + reference](https://json-schema.org/understanding-json-schema/) for + documentation about the format. + + + Omitting `parameters` defines a function with an empty parameter list. + additionalProperties: true + FunctionToolCall: + type: object + title: Function tool call + description: > + A tool call to run a function. See the + + [function calling guide](/docs/guides/function-calling) for more + information. + properties: + id: + type: string + description: | + The unique ID of the function tool call. + type: + type: string + enum: + - function_call + description: | + The type of the function tool call. Always `function_call`. + x-stainless-const: true + call_id: + type: string + description: | + The unique ID of the function tool call generated by the model. + name: + type: string + description: | + The name of the function to run. + arguments: + type: string + description: | + A JSON string of the arguments to pass to the function. + status: + type: string + description: | + The status of the item. One of `in_progress`, `completed`, or + `incomplete`. Populated when items are returned via API. + enum: + - in_progress + - completed + - incomplete + required: + - type + - call_id + - name + - arguments + FunctionToolCallOutput: + type: object + title: Function tool call output + description: | + The output of a function tool call. + properties: + id: + type: string + description: > + The unique ID of the function tool call output. Populated when this + item + + is returned via API. + type: + type: string + enum: + - function_call_output + description: > + The type of the function tool call output. Always + `function_call_output`. + x-stainless-const: true + call_id: + type: string + description: | + The unique ID of the function tool call generated by the model. + output: + type: string + description: | + A JSON string of the output of the function tool call. + status: + type: string + description: | + The status of the item. One of `in_progress`, `completed`, or + `incomplete`. Populated when items are returned via API. + enum: + - in_progress + - completed + - incomplete + required: + - type + - call_id + - output + FunctionToolCallOutputResource: + allOf: + - $ref: "#/components/schemas/FunctionToolCallOutput" + - type: object + properties: + id: + type: string + description: | + The unique ID of the function call tool output. + required: + - id + FunctionToolCallResource: + allOf: + - $ref: "#/components/schemas/FunctionToolCall" + - type: object + properties: + id: + type: string + description: | + The unique ID of the function tool call. + required: + - id + GraderLabelModel: + type: object + title: LabelModelGrader + description: > + A LabelModelGrader object which uses a model to assign labels to each + item + + in the evaluation. + properties: + type: + description: The object type, which is always `label_model`. + type: string + enum: + - label_model + x-stainless-const: true + name: + type: string + description: The name of the grader. + model: + type: string + description: The model to use for the evaluation. Must support structured outputs. + input: + type: array + items: + $ref: "#/components/schemas/EvalItem" + labels: + type: array + items: + type: string + description: The labels to assign to each item in the evaluation. + passing_labels: + type: array + items: + type: string + description: The labels that indicate a passing result. Must be a subset of + labels. + required: + - type + - model + - input + - passing_labels + - labels + - name + x-oaiMeta: + name: Label Model Grader + group: graders + example: > + { + "name": "First label grader", + "type": "label_model", + "model": "gpt-4o-2024-08-06", + "input": [ + { + "type": "message", + "role": "system", + "content": { + "type": "input_text", + "text": "Classify the sentiment of the following statement as one of positive, neutral, or negative" + } + }, + { + "type": "message", + "role": "user", + "content": { + "type": "input_text", + "text": "Statement: {{item.response}}" + } + } + ], + "passing_labels": [ + "positive" + ], + "labels": [ + "positive", + "neutral", + "negative" + ] + } + GraderMulti: + type: object + title: MultiGrader + description: A MultiGrader object combines the output of multiple graders to + produce a single score. + properties: + type: + type: string + enum: + - multi + default: multi + description: The object type, which is always `multi`. + x-stainless-const: true + name: + type: string + description: The name of the grader. + graders: + type: object + additionalProperties: + type: object + oneOf: + - $ref: "#/components/schemas/GraderStringCheck" + - $ref: "#/components/schemas/GraderTextSimilarity" + - $ref: "#/components/schemas/GraderPython" + - $ref: "#/components/schemas/GraderScoreModel" + - $ref: "#/components/schemas/GraderLabelModel" + calculate_output: + type: string + description: A formula to calculate the output based on grader results. + required: + - name + - type + - graders + - calculate_output + x-oaiMeta: + name: Multi Grader + group: graders + example: > + { + "type": "multi", + "name": "example multi grader", + "graders": [ + { + "type": "text_similarity", + "name": "example text similarity grader", + "input": "The graded text", + "reference": "The reference text", + "evaluation_metric": "fuzzy_match" + }, + { + "type": "string_check", + "name": "Example string check grader", + "input": "{{sample.output_text}}", + "reference": "{{item.label}}", + "operation": "eq" + } + ], + "calculate_output": "0.5 * text_similarity_score + 0.5 * string_check_score)" + } + GraderPython: + type: object + title: PythonGrader + description: | + A PythonGrader object that runs a python script on the input. + properties: + type: + type: string + enum: + - python + description: The object type, which is always `python`. + x-stainless-const: true + name: + type: string + description: The name of the grader. + source: + type: string + description: The source code of the python script. + image_tag: + type: string + description: The image tag to use for the python script. + required: + - type + - name + - source + x-oaiMeta: + name: Python Grader + group: graders + example: | + { + "type": "python", + "name": "Example python grader", + "image_tag": "2025-05-08", + "source": """ + def grade(sample: dict, item: dict) -> float: + \""" + Returns 1.0 if `output_text` equals `label`, otherwise 0.0. + \""" + output = sample.get("output_text") + label = item.get("label") + return 1.0 if output == label else 0.0 + """, + } + GraderScoreModel: + type: object + title: ScoreModelGrader + description: > + A ScoreModelGrader object that uses a model to assign a score to the + input. + properties: + type: + type: string + enum: + - score_model + description: The object type, which is always `score_model`. + x-stainless-const: true + name: + type: string + description: The name of the grader. + model: + type: string + description: The model to use for the evaluation. + sampling_params: + type: object + description: The sampling parameters for the model. + input: + type: array + items: + $ref: "#/components/schemas/EvalItem" + description: The input text. This may include template strings. + range: + type: array + items: + type: number + min_items: 2 + max_items: 2 + description: The range of the score. Defaults to `[0, 1]`. + required: + - type + - name + - input + - model + x-oaiMeta: + name: Score Model Grader + group: graders + example: > + { + "type": "score_model", + "name": "Example score model grader", + "input": [ + { + "role": "user", + "content": ( + "Score how close the reference answer is to the model answer. Score 1.0 if they are the same and 0.0 if they are different." + " Return just a floating point score\n\n" + " Reference answer: {{item.label}}\n\n" + " Model answer: {{sample.output_text}}" + ), + } + ], + "model": "gpt-4o-2024-08-06", + "sampling_params": { + "temperature": 1, + "top_p": 1, + "seed": 42, + }, + } + GraderStringCheck: + type: object + title: StringCheckGrader + description: > + A StringCheckGrader object that performs a string comparison between + input and reference using a specified operation. + properties: + type: + type: string + enum: + - string_check + description: The object type, which is always `string_check`. + x-stainless-const: true + name: + type: string + description: The name of the grader. + input: + type: string + description: The input text. This may include template strings. + reference: + type: string + description: The reference text. This may include template strings. + operation: + type: string + enum: + - eq + - ne + - like + - ilike + description: The string check operation to perform. One of `eq`, `ne`, `like`, + or `ilike`. + required: + - type + - name + - input + - reference + - operation + x-oaiMeta: + name: String Check Grader + group: graders + example: | + { + "type": "string_check", + "name": "Example string check grader", + "input": "{{sample.output_text}}", + "reference": "{{item.label}}", + "operation": "eq" + } + GraderTextSimilarity: + type: object + title: TextSimilarityGrader + description: > + A TextSimilarityGrader object which grades text based on similarity + metrics. + properties: + type: + type: string + enum: + - text_similarity + default: text_similarity + description: The type of grader. + x-stainless-const: true + name: + type: string + description: The name of the grader. + input: + type: string + description: The text being graded. + reference: + type: string + description: The text being graded against. + evaluation_metric: + type: string + enum: + - fuzzy_match + - bleu + - gleu + - meteor + - rouge_1 + - rouge_2 + - rouge_3 + - rouge_4 + - rouge_5 + - rouge_l + description: The evaluation metric to use. One of `fuzzy_match`, `bleu`, `gleu`, + `meteor`, `rouge_1`, `rouge_2`, `rouge_3`, `rouge_4`, `rouge_5`, or + `rouge_l`. + required: + - type + - name + - input + - reference + - evaluation_metric + x-oaiMeta: + name: Text Similarity Grader + group: graders + example: | + { + "type": "text_similarity", + "name": "Example text similarity grader", + "input": "{{sample.output_text}}", + "reference": "{{item.label}}", + "evaluation_metric": "fuzzy_match" + } + Image: + type: object + description: Represents the content or the URL of an image generated by the + OpenAI API. + properties: + b64_json: + type: string + description: The base64-encoded JSON of the generated image. Default value for + `gpt-image-1`, and only present if `response_format` is set to + `b64_json` for `dall-e-2` and `dall-e-3`. + url: + type: string + description: When using `dall-e-2` or `dall-e-3`, the URL of the generated image + if `response_format` is set to `url` (default value). Unsupported + for `gpt-image-1`. + revised_prompt: + type: string + description: For `dall-e-3` only, the revised prompt that was used to generate + the image. + ImagesResponse: + type: object + title: Image generation response + description: The response from the image generation endpoint. + properties: + created: + type: integer + description: The Unix timestamp (in seconds) of when the image was created. + data: + type: array + description: The list of generated images. + items: + $ref: "#/components/schemas/Image" + usage: + type: object + description: > + For `gpt-image-1` only, the token usage information for the image + generation. + required: + - total_tokens + - input_tokens + - output_tokens + - input_tokens_details + properties: + total_tokens: + type: integer + description: The total number of tokens (images and text) used for the image + generation. + input_tokens: + type: integer + description: The number of tokens (images and text) in the input prompt. + output_tokens: + type: integer + description: The number of image tokens in the output image. + input_tokens_details: + type: object + description: The input tokens detailed information for the image generation. + required: + - text_tokens + - image_tokens + properties: + text_tokens: + type: integer + description: The number of text tokens in the input prompt. + image_tokens: + type: integer + description: The number of image tokens in the input prompt. + required: + - created + x-oaiMeta: + name: The image generation response + group: images + example: | + { + "created": 1713833628, + "data": [ + { + "b64_json": "..." + } + ], + "usage": { + "total_tokens": 100, + "input_tokens": 50, + "output_tokens": 50, + "input_tokens_details": { + "text_tokens": 10, + "image_tokens": 40 + } + } + } + Includable: + type: string + description: > + Specify additional output data to include in the model response. + Currently + + supported values are: + + - `file_search_call.results`: Include the search results of + the file search tool call. + - `message.input_image.image_url`: Include image urls from the input + message. + + - `computer_call_output.output.image_url`: Include image urls from the + computer call output. + + - `reasoning.encrypted_content`: Includes an encrypted version of + reasoning + tokens in reasoning item outputs. This enables reasoning items to be used in + multi-turn conversations when using the Responses API statelessly (like + when the `store` parameter is set to `false`, or when an organization is + enrolled in the zero data retention program). + enum: + - file_search_call.results + - message.input_image.image_url + - computer_call_output.output.image_url + - reasoning.encrypted_content + InputAudio: + type: object + title: Audio input + description: | + An audio input to the model. + properties: + type: + type: string + description: | + The type of the input item. Always `input_audio`. + enum: + - input_audio + x-stainless-const: true + data: + type: string + description: | + Base64-encoded audio data. + format: + type: string + description: > + The format of the audio data. Currently supported formats are `mp3` + and + + `wav`. + enum: + - mp3 + - wav + required: + - type + - data + - format + InputContent: + oneOf: + - $ref: "#/components/schemas/InputTextContent" + - $ref: "#/components/schemas/InputImageContent" + - $ref: "#/components/schemas/InputFileContent" + InputItem: + oneOf: + - $ref: "#/components/schemas/EasyInputMessage" + - type: object + title: Item + description: | + An item representing part of the context for the response to be + generated by the model. Can contain text, images, and audio inputs, + as well as previous assistant responses and tool call outputs. + $ref: "#/components/schemas/Item" + - $ref: "#/components/schemas/ItemReferenceParam" + discriminator: + propertyName: type + InputMessage: + type: object + title: Input message + description: > + A message input to the model with a role indicating instruction + following + + hierarchy. Instructions given with the `developer` or `system` role take + + precedence over instructions given with the `user` role. + properties: + type: + type: string + description: | + The type of the message input. Always set to `message`. + enum: + - message + x-stainless-const: true + role: + type: string + description: > + The role of the message input. One of `user`, `system`, or + `developer`. + enum: + - user + - system + - developer + status: + type: string + description: | + The status of item. One of `in_progress`, `completed`, or + `incomplete`. Populated when items are returned via API. + enum: + - in_progress + - completed + - incomplete + content: + $ref: "#/components/schemas/InputMessageContentList" + required: + - role + - content + InputMessageContentList: + type: array + title: Input item content list + description: > + A list of one or many input items to the model, containing different + content + + types. + items: + $ref: "#/components/schemas/InputContent" + InputMessageResource: + allOf: + - $ref: "#/components/schemas/InputMessage" + - type: object + properties: + id: + type: string + description: | + The unique ID of the message input. + required: + - id + Invite: + type: object + description: Represents an individual `invite` to the organization. + properties: + object: + type: string + enum: + - organization.invite + description: The object type, which is always `organization.invite` + x-stainless-const: true + id: + type: string + description: The identifier, which can be referenced in API endpoints + email: + type: string + description: The email address of the individual to whom the invite was sent + role: + type: string + enum: + - owner + - reader + description: "`owner` or `reader`" + status: + type: string + enum: + - accepted + - expired + - pending + description: "`accepted`,`expired`, or `pending`" + invited_at: + type: integer + description: The Unix timestamp (in seconds) of when the invite was sent. + expires_at: + type: integer + description: The Unix timestamp (in seconds) of when the invite expires. + accepted_at: + type: integer + description: The Unix timestamp (in seconds) of when the invite was accepted. + projects: + type: array + description: The projects that were granted membership upon acceptance of the + invite. + items: + type: object + properties: + id: + type: string + description: Project's public ID + role: + type: string + enum: + - member + - owner + description: Project membership role required: + - object - id - - model - - results + - email + - role + - status + - invited_at + - expires_at x-oaiMeta: - name: The moderation object + name: The invite object example: | { - "id": "modr-0d9740456c391e43c445bf0f010940c7", - "model": "omni-moderation-latest", - "results": [ + "object": "organization.invite", + "id": "invite-abc", + "email": "user@example.com", + "role": "owner", + "status": "accepted", + "invited_at": 1711471533, + "expires_at": 1711471533, + "accepted_at": 1711471533, + "projects": [ { - "flagged": true, - "categories": { - "harassment": true, - "harassment/threatening": true, - "sexual": false, - "hate": false, - "hate/threatening": false, - "illicit": false, - "illicit/violent": false, - "self-harm/intent": false, - "self-harm/instructions": false, - "self-harm": false, - "sexual/minors": false, - "violence": true, - "violence/graphic": true - }, - "category_scores": { - "harassment": 0.8189693396524255, - "harassment/threatening": 0.804985420696006, - "sexual": 1.573112165348997e-6, - "hate": 0.007562942636942845, - "hate/threatening": 0.004208854591835476, - "illicit": 0.030535955153511665, - "illicit/violent": 0.008925306722380033, - "self-harm/intent": 0.00023023930975076432, - "self-harm/instructions": 0.0002293869201073356, - "self-harm": 0.012598046106750154, - "sexual/minors": 2.212566909570261e-8, - "violence": 0.9999992735124786, - "violence/graphic": 0.843064871157054 - }, - "category_applied_input_types": { - "harassment": [ - "text" - ], - "harassment/threatening": [ - "text" - ], - "sexual": [ - "text", - "image" - ], - "hate": [ - "text" - ], - "hate/threatening": [ - "text" - ], - "illicit": [ - "text" - ], - "illicit/violent": [ - "text" - ], - "self-harm/intent": [ - "text", - "image" - ], - "self-harm/instructions": [ - "text", - "image" - ], - "self-harm": [ - "text", - "image" - ], - "sexual/minors": [ - "text" - ], - "violence": [ - "text", - "image" - ], - "violence/graphic": [ - "text", - "image" - ] - } + "id": "project-xyz", + "role": "member" + } + ] + } + InviteDeleteResponse: + type: object + properties: + object: + type: string + enum: + - organization.invite.deleted + description: The object type, which is always `organization.invite.deleted` + x-stainless-const: true + id: + type: string + deleted: + type: boolean + required: + - object + - id + - deleted + InviteListResponse: + type: object + properties: + object: + type: string + enum: + - list + description: The object type, which is always `list` + x-stainless-const: true + data: + type: array + items: + $ref: "#/components/schemas/Invite" + first_id: + type: string + description: The first `invite_id` in the retrieved `list` + last_id: + type: string + description: The last `invite_id` in the retrieved `list` + has_more: + type: boolean + description: The `has_more` property is used for pagination to indicate there + are additional results. + required: + - object + - data + InviteRequest: + type: object + properties: + email: + type: string + description: Send an email to this address + role: + type: string + enum: + - reader + - owner + description: "`owner` or `reader`" + projects: + type: array + description: An array of projects to which membership is granted at the same + time the org invite is accepted. If omitted, the user will be + invited to the default project for compatibility with legacy + behavior. + items: + type: object + properties: + id: + type: string + description: Project's public ID + role: + type: string + enum: + - member + - owner + description: Project membership role + required: + - id + - role + required: + - email + - role + Item: + type: object + description: | + Content item used to generate a response. + oneOf: + - $ref: "#/components/schemas/InputMessage" + - $ref: "#/components/schemas/OutputMessage" + - $ref: "#/components/schemas/FileSearchToolCall" + - $ref: "#/components/schemas/ComputerToolCall" + - $ref: "#/components/schemas/ComputerCallOutputItemParam" + - $ref: "#/components/schemas/WebSearchToolCall" + - $ref: "#/components/schemas/FunctionToolCall" + - $ref: "#/components/schemas/FunctionCallOutputItemParam" + - $ref: "#/components/schemas/ReasoningItem" + discriminator: + propertyName: type + ItemResource: + description: | + Content item used to generate a response. + oneOf: + - $ref: "#/components/schemas/InputMessageResource" + - $ref: "#/components/schemas/OutputMessage" + - $ref: "#/components/schemas/FileSearchToolCall" + - $ref: "#/components/schemas/ComputerToolCall" + - $ref: "#/components/schemas/ComputerToolCallOutputResource" + - $ref: "#/components/schemas/WebSearchToolCall" + - $ref: "#/components/schemas/FunctionToolCallResource" + - $ref: "#/components/schemas/FunctionToolCallOutputResource" + discriminator: + propertyName: type + KeyPress: + type: object + title: KeyPress + description: | + A collection of keypresses the model would like to perform. + properties: + type: + type: string + enum: + - keypress + default: keypress + description: | + Specifies the event type. For a keypress action, this property is + always set to `keypress`. + x-stainless-const: true + keys: + type: array + items: + type: string + description: | + One of the keys the model is requesting to be pressed. + description: > + The combination of keys the model is requesting to be pressed. This + is an + + array of strings, each representing a key. + required: + - type + - keys + ListAssistantsResponse: + type: object + properties: + object: + type: string + example: list + data: + type: array + items: + $ref: "#/components/schemas/AssistantObject" + first_id: + type: string + example: asst_abc123 + last_id: + type: string + example: asst_abc456 + has_more: + type: boolean + example: false + required: + - object + - data + - first_id + - last_id + - has_more + x-oaiMeta: + name: List assistants response object + group: chat + example: > + { + "object": "list", + "data": [ + { + "id": "asst_abc123", + "object": "assistant", + "created_at": 1698982736, + "name": "Coding Tutor", + "description": null, + "model": "gpt-4o", + "instructions": "You are a helpful assistant designed to make me better at coding!", + "tools": [], + "tool_resources": {}, + "metadata": {}, + "top_p": 1.0, + "temperature": 1.0, + "response_format": "auto" + }, + { + "id": "asst_abc456", + "object": "assistant", + "created_at": 1698982718, + "name": "My Assistant", + "description": null, + "model": "gpt-4o", + "instructions": "You are a helpful assistant designed to make me better at coding!", + "tools": [], + "tool_resources": {}, + "metadata": {}, + "top_p": 1.0, + "temperature": 1.0, + "response_format": "auto" + }, + { + "id": "asst_abc789", + "object": "assistant", + "created_at": 1698982643, + "name": null, + "description": null, + "model": "gpt-4o", + "instructions": null, + "tools": [], + "tool_resources": {}, + "metadata": {}, + "top_p": 1.0, + "temperature": 1.0, + "response_format": "auto" } - ] + ], + "first_id": "asst_abc123", + "last_id": "asst_abc789", + "has_more": false } - CreateRunRequest: + ListAuditLogsResponse: + type: object + properties: + object: + type: string + enum: + - list + x-stainless-const: true + data: + type: array + items: + $ref: "#/components/schemas/AuditLog" + first_id: + type: string + example: audit_log-defb456h8dks + last_id: + type: string + example: audit_log-hnbkd8s93s + has_more: + type: boolean + required: + - object + - data + - first_id + - last_id + - has_more + ListBatchesResponse: + type: object + properties: + data: + type: array + items: + $ref: "#/components/schemas/Batch" + first_id: + type: string + example: batch_abc123 + last_id: + type: string + example: batch_abc456 + has_more: + type: boolean + object: + type: string + enum: + - list + x-stainless-const: true + required: + - object + - data + - has_more + ListCertificatesResponse: + type: object + properties: + data: + type: array + items: + $ref: "#/components/schemas/Certificate" + first_id: + type: string + example: cert_abc + last_id: + type: string + example: cert_abc + has_more: + type: boolean + object: + type: string + enum: + - list + x-stainless-const: true + required: + - object + - data + - has_more + ListFilesResponse: + type: object + properties: + object: + type: string + example: list + data: + type: array + items: + $ref: "#/components/schemas/OpenAIFile" + first_id: + type: string + example: file-abc123 + last_id: + type: string + example: file-abc456 + has_more: + type: boolean + example: false + required: + - object + - data + - first_id + - last_id + - has_more + ListFineTuningCheckpointPermissionResponse: + type: object + properties: + data: + type: array + items: + $ref: "#/components/schemas/FineTuningCheckpointPermission" + object: + type: string + enum: + - list + x-stainless-const: true + first_id: + type: string + nullable: true + last_id: + type: string + nullable: true + has_more: + type: boolean + required: + - object + - data + - has_more + ListFineTuningJobCheckpointsResponse: + type: object + properties: + data: + type: array + items: + $ref: "#/components/schemas/FineTuningJobCheckpoint" + object: + type: string + enum: + - list + x-stainless-const: true + first_id: + type: string + nullable: true + last_id: + type: string + nullable: true + has_more: + type: boolean + required: + - object + - data + - has_more + ListFineTuningJobEventsResponse: + type: object + properties: + data: + type: array + items: + $ref: "#/components/schemas/FineTuningJobEvent" + object: + type: string + enum: + - list + x-stainless-const: true + has_more: + type: boolean + required: + - object + - data + - has_more + ListMessagesResponse: + properties: + object: + type: string + example: list + data: + type: array + items: + $ref: "#/components/schemas/MessageObject" + first_id: + type: string + example: msg_abc123 + last_id: + type: string + example: msg_abc123 + has_more: + type: boolean + example: false + required: + - object + - data + - first_id + - last_id + - has_more + ListModelsResponse: + type: object + properties: + object: + type: string + enum: + - list + x-stainless-const: true + data: + type: array + items: + $ref: "#/components/schemas/Model" + required: + - object + - data + ListPaginatedFineTuningJobsResponse: + type: object + properties: + data: + type: array + items: + $ref: "#/components/schemas/FineTuningJob" + has_more: + type: boolean + object: + type: string + enum: + - list + x-stainless-const: true + required: + - object + - data + - has_more + ListRunStepsResponse: + properties: + object: + type: string + example: list + data: + type: array + items: + $ref: "#/components/schemas/RunStepObject" + first_id: + type: string + example: step_abc123 + last_id: + type: string + example: step_abc456 + has_more: + type: boolean + example: false + required: + - object + - data + - first_id + - last_id + - has_more + ListRunsResponse: type: object - additionalProperties: false properties: - assistant_id: - description: The ID of the [assistant](/docs/api-reference/assistants) to use to - execute this run. + object: type: string - model: - description: The ID of the [Model](/docs/api-reference/models) to be used to - execute this run. If a value is provided here, it will override the - model associated with the assistant. If not, the model associated - with the assistant will be used. - example: gpt-4o - anyOf: - - type: string - - type: string - enum: - - gpt-4o - - gpt-4o-2024-08-06 - - gpt-4o-2024-05-13 - - gpt-4o-2024-08-06 - - gpt-4o-mini - - gpt-4o-mini-2024-07-18 - - gpt-4-turbo - - gpt-4-turbo-2024-04-09 - - gpt-4-0125-preview - - gpt-4-turbo-preview - - gpt-4-1106-preview - - gpt-4-vision-preview - - gpt-4 - - gpt-4-0314 - - gpt-4-0613 - - gpt-4-32k - - gpt-4-32k-0314 - - gpt-4-32k-0613 - - gpt-3.5-turbo - - gpt-3.5-turbo-16k - - gpt-3.5-turbo-0613 - - gpt-3.5-turbo-1106 - - gpt-3.5-turbo-0125 - - gpt-3.5-turbo-16k-0613 - x-oaiTypeLabel: string - nullable: true - instructions: - description: Overrides the - [instructions](/docs/api-reference/assistants/createAssistant) of - the assistant. This is useful for modifying the behavior on a - per-run basis. + example: list + data: + type: array + items: + $ref: "#/components/schemas/RunObject" + first_id: type: string - nullable: true - additional_instructions: - description: Appends additional instructions at the end of the instructions for - the run. This is useful for modifying the behavior on a per-run - basis without overriding other instructions. + example: run_abc123 + last_id: type: string - nullable: true - additional_messages: - description: Adds additional messages to the thread before creating the run. + example: run_abc456 + has_more: + type: boolean + example: false + required: + - object + - data + - first_id + - last_id + - has_more + ListVectorStoreFilesResponse: + properties: + object: + type: string + example: list + data: type: array items: - $ref: "#/components/schemas/CreateMessageRequest" - nullable: true - tools: - description: Override the tools the assistant can use for this run. This is - useful for modifying the behavior on a per-run basis. - nullable: true + $ref: "#/components/schemas/VectorStoreFileObject" + first_id: + type: string + example: file-abc123 + last_id: + type: string + example: file-abc456 + has_more: + type: boolean + example: false + required: + - object + - data + - first_id + - last_id + - has_more + ListVectorStoresResponse: + properties: + object: + type: string + example: list + data: type: array - maxItems: 20 items: - oneOf: - - $ref: "#/components/schemas/AssistantToolsCode" - - $ref: "#/components/schemas/AssistantToolsFileSearch" - - $ref: "#/components/schemas/AssistantToolsFunction" - x-oaiExpandable: true - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true - temperature: - type: number - minimum: 0 - maximum: 2 - default: 1 - example: 1 - nullable: true - description: > - What sampling temperature to use, between 0 and 2. Higher values - like 0.8 will make the output more random, while lower values like - 0.2 will make it more focused and deterministic. - top_p: - type: number - minimum: 0 - maximum: 1 - default: 1 - example: 1 - nullable: true - description: > - An alternative to sampling with temperature, called nucleus - sampling, where the model considers the results of the tokens with - top_p probability mass. So 0.1 means only the tokens comprising the - top 10% probability mass are considered. - - - We generally recommend altering this or temperature but not both. - stream: + $ref: "#/components/schemas/VectorStoreObject" + first_id: + type: string + example: vs_abc123 + last_id: + type: string + example: vs_abc456 + has_more: type: boolean - nullable: true - description: > - If `true`, returns a stream of events that happen during the Run as - server-sent events, terminating when the Run enters a terminal state - with a `data: [DONE]` message. - max_prompt_tokens: - type: integer - nullable: true - description: > - The maximum number of prompt tokens that may be used over the course - of the run. The run will make a best effort to use only the number - of prompt tokens specified, across multiple turns of the run. If the - run exceeds the number of prompt tokens specified, the run will end - with status `incomplete`. See `incomplete_details` for more info. - minimum: 256 - max_completion_tokens: - type: integer - nullable: true - description: > - The maximum number of completion tokens that may be used over the - course of the run. The run will make a best effort to use only the - number of completion tokens specified, across multiple turns of the - run. If the run exceeds the number of completion tokens specified, - the run will end with status `incomplete`. See `incomplete_details` - for more info. - minimum: 256 - truncation_strategy: - $ref: "#/components/schemas/TruncationObject" - nullable: true - tool_choice: - $ref: "#/components/schemas/AssistantsApiToolChoiceOption" - nullable: true - parallel_tool_calls: - $ref: "#/components/schemas/ParallelToolCalls" - response_format: - $ref: "#/components/schemas/AssistantsApiResponseFormatOption" - nullable: true + example: false + required: + - object + - data + - first_id + - last_id + - has_more + LogProbProperties: + type: object + description: | + A log probability object. + properties: + token: + type: string + description: | + The token that was used to generate the log probability. + logprob: + type: number + description: | + The log probability of the token. + bytes: + type: array + items: + type: integer + description: | + The bytes that were used to generate the log probability. + required: + - token + - logprob + - bytes + MessageContentImageFileObject: + title: Image file + type: object + description: References an image [File](/docs/api-reference/files) in the + content of a message. + properties: + type: + description: Always `image_file`. + type: string + enum: + - image_file + x-stainless-const: true + image_file: + type: object + properties: + file_id: + description: The [File](/docs/api-reference/files) ID of the image in the + message content. Set `purpose="vision"` when uploading the File + if you need to later display the file content. + type: string + detail: + type: string + description: Specifies the detail level of the image if specified by the user. + `low` uses fewer tokens, you can opt in to high resolution using + `high`. + enum: + - auto + - low + - high + default: auto + required: + - file_id required: - - assistant_id - CreateSpeechRequest: + - type + - image_file + MessageContentImageUrlObject: + title: Image URL type: object - additionalProperties: false + description: References an image URL in the content of a message. properties: - model: - description: > - One of the available [TTS models](/docs/models#tts): `tts-1` or - `tts-1-hd` - anyOf: - - type: string - - type: string - enum: - - tts-1 - - tts-1-hd - x-oaiTypeLabel: string - input: - type: string - description: The text to generate audio for. The maximum length is 4096 - characters. - maxLength: 4096 - voice: - description: The voice to use when generating the audio. Supported voices are - `alloy`, `echo`, `fable`, `onyx`, `nova`, and `shimmer`. Previews of - the voices are available in the [Text to speech - guide](/docs/guides/text-to-speech#voice-options). + type: type: string enum: - - alloy - - echo - - fable - - onyx - - nova - - shimmer - response_format: - description: The format to audio in. Supported formats are `mp3`, `opus`, `aac`, - `flac`, `wav`, and `pcm`. - default: mp3 + - image_url + description: The type of the content part. + x-stainless-const: true + image_url: + type: object + properties: + url: + type: string + description: "The external URL of the image, must be a supported image types: + jpeg, jpg, png, gif, webp." + format: uri + detail: + type: string + description: Specifies the detail level of the image. `low` uses fewer tokens, + you can opt in to high resolution using `high`. Default value is + `auto` + enum: + - auto + - low + - high + default: auto + required: + - url + required: + - type + - image_url + MessageContentRefusalObject: + title: Refusal + type: object + description: The refusal content generated by the assistant. + properties: + type: + description: Always `refusal`. type: string enum: - - mp3 - - opus - - aac - - flac - - wav - - pcm - speed: - description: The speed of the generated audio. Select a value from `0.25` to - `4.0`. `1.0` is the default. - type: number - default: 1 - minimum: 0.25 - maximum: 4 + - refusal + x-stainless-const: true + refusal: + type: string + nullable: false required: - - model - - input - - voice - CreateThreadAndRunRequest: + - type + - refusal + MessageContentTextAnnotationsFileCitationObject: + title: File citation type: object - additionalProperties: false + description: A citation within the message that points to a specific quote from + a specific File associated with the assistant or the message. Generated + when the assistant uses the "file_search" tool to search files. properties: - assistant_id: - description: The ID of the [assistant](/docs/api-reference/assistants) to use to - execute this run. + type: + description: Always `file_citation`. type: string - thread: - $ref: "#/components/schemas/CreateThreadRequest" - description: If no thread is provided, an empty thread will be created. - model: - description: The ID of the [Model](/docs/api-reference/models) to be used to - execute this run. If a value is provided here, it will override the - model associated with the assistant. If not, the model associated - with the assistant will be used. - example: gpt-4o - anyOf: - - type: string - - type: string - enum: - - gpt-4o - - gpt-4o-2024-08-06 - - gpt-4o-2024-05-13 - - gpt-4o-2024-08-06 - - gpt-4o-mini - - gpt-4o-mini-2024-07-18 - - gpt-4-turbo - - gpt-4-turbo-2024-04-09 - - gpt-4-0125-preview - - gpt-4-turbo-preview - - gpt-4-1106-preview - - gpt-4-vision-preview - - gpt-4 - - gpt-4-0314 - - gpt-4-0613 - - gpt-4-32k - - gpt-4-32k-0314 - - gpt-4-32k-0613 - - gpt-3.5-turbo - - gpt-3.5-turbo-16k - - gpt-3.5-turbo-0613 - - gpt-3.5-turbo-1106 - - gpt-3.5-turbo-0125 - - gpt-3.5-turbo-16k-0613 - x-oaiTypeLabel: string - nullable: true - instructions: - description: Override the default system message of the assistant. This is - useful for modifying the behavior on a per-run basis. + enum: + - file_citation + x-stainless-const: true + text: + description: The text in the message content that needs to be replaced. type: string - nullable: true - tools: - description: Override the tools the assistant can use for this run. This is - useful for modifying the behavior on a per-run basis. - nullable: true - type: array - maxItems: 20 - items: - oneOf: - - $ref: "#/components/schemas/AssistantToolsCode" - - $ref: "#/components/schemas/AssistantToolsFileSearch" - - $ref: "#/components/schemas/AssistantToolsFunction" - tool_resources: + file_citation: type: object - description: > - A set of resources that are used by the assistant's tools. The - resources are specific to the type of tool. For example, the - `code_interpreter` tool requires a list of file IDs, while the - `file_search` tool requires a list of vector store IDs. properties: - code_interpreter: - type: object - properties: - file_ids: - type: array - description: > - A list of [file](/docs/api-reference/files) IDs made - available to the `code_interpreter` tool. There can be a - maximum of 20 files associated with the tool. - default: [] - maxItems: 20 - items: - type: string - file_search: - type: object - properties: - vector_store_ids: - type: array - description: > - The ID of the [vector - store](/docs/api-reference/vector-stores/object) attached to - this assistant. There can be a maximum of 1 vector store - attached to the assistant. - maxItems: 1 - items: - type: string - nullable: true - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true - temperature: - type: number + file_id: + description: The ID of the specific File the citation is from. + type: string + required: + - file_id + start_index: + type: integer minimum: 0 - maximum: 2 - default: 1 - example: 1 - nullable: true - description: > - What sampling temperature to use, between 0 and 2. Higher values - like 0.8 will make the output more random, while lower values like - 0.2 will make it more focused and deterministic. - top_p: - type: number + end_index: + type: integer minimum: 0 - maximum: 1 - default: 1 - example: 1 - nullable: true - description: > - An alternative to sampling with temperature, called nucleus - sampling, where the model considers the results of the tokens with - top_p probability mass. So 0.1 means only the tokens comprising the - top 10% probability mass are considered. - - - We generally recommend altering this or temperature but not both. - stream: - type: boolean - nullable: true - description: > - If `true`, returns a stream of events that happen during the Run as - server-sent events, terminating when the Run enters a terminal state - with a `data: [DONE]` message. - max_prompt_tokens: + required: + - type + - text + - file_citation + - start_index + - end_index + MessageContentTextAnnotationsFilePathObject: + title: File path + type: object + description: A URL for the file that's generated when the assistant used the + `code_interpreter` tool to generate a file. + properties: + type: + description: Always `file_path`. + type: string + enum: + - file_path + x-stainless-const: true + text: + description: The text in the message content that needs to be replaced. + type: string + file_path: + type: object + properties: + file_id: + description: The ID of the file that was generated. + type: string + required: + - file_id + start_index: type: integer - nullable: true - description: > - The maximum number of prompt tokens that may be used over the course - of the run. The run will make a best effort to use only the number - of prompt tokens specified, across multiple turns of the run. If the - run exceeds the number of prompt tokens specified, the run will end - with status `incomplete`. See `incomplete_details` for more info. - minimum: 256 - max_completion_tokens: + minimum: 0 + end_index: type: integer - nullable: true - description: > - The maximum number of completion tokens that may be used over the - course of the run. The run will make a best effort to use only the - number of completion tokens specified, across multiple turns of the - run. If the run exceeds the number of completion tokens specified, - the run will end with status `incomplete`. See `incomplete_details` - for more info. - minimum: 256 - truncation_strategy: - $ref: "#/components/schemas/TruncationObject" - nullable: true - tool_choice: - $ref: "#/components/schemas/AssistantsApiToolChoiceOption" - nullable: true - parallel_tool_calls: - $ref: "#/components/schemas/ParallelToolCalls" - response_format: - $ref: "#/components/schemas/AssistantsApiResponseFormatOption" - nullable: true + minimum: 0 required: - - assistant_id - CreateThreadRequest: + - type + - text + - file_path + - start_index + - end_index + MessageContentTextObject: + title: Text type: object - additionalProperties: false + description: The text content that is part of a message. properties: - messages: - description: A list of [messages](/docs/api-reference/messages) to start the - thread with. - type: array - items: - $ref: "#/components/schemas/CreateMessageRequest" - tool_resources: + type: + description: Always `text`. + type: string + enum: + - text + x-stainless-const: true + text: type: object - description: > - A set of resources that are made available to the assistant's tools - in this thread. The resources are specific to the type of tool. For - example, the `code_interpreter` tool requires a list of file IDs, - while the `file_search` tool requires a list of vector store IDs. properties: - code_interpreter: - type: object - properties: - file_ids: - type: array - description: > - A list of [file](/docs/api-reference/files) IDs made - available to the `code_interpreter` tool. There can be a - maximum of 20 files associated with the tool. - default: [] - maxItems: 20 - items: - type: string - file_search: - type: object - properties: - vector_store_ids: - type: array - description: > - The [vector store](/docs/api-reference/vector-stores/object) - attached to this thread. There can be a maximum of 1 vector - store attached to the thread. - maxItems: 1 - items: - type: string - vector_stores: - type: array - description: > - A helper to create a [vector - store](/docs/api-reference/vector-stores/object) with - file_ids and attach it to this thread. There can be a - maximum of 1 vector store attached to the thread. - maxItems: 1 - items: - type: object - properties: - file_ids: - type: array - description: > - A list of [file](/docs/api-reference/files) IDs to add - to the vector store. There can be a maximum of 10000 - files in a vector store. - maxItems: 10000 - items: - type: string - chunking_strategy: - type: object - description: The chunking strategy used to chunk the file(s). If not set, will - use the `auto` strategy. - oneOf: - - type: object - title: Auto Chunking Strategy - description: The default strategy. This strategy currently uses a - `max_chunk_size_tokens` of `800` and - `chunk_overlap_tokens` of `400`. - additionalProperties: false - properties: - type: - type: string - description: Always `auto`. - enum: - - auto - required: - - type - - type: object - title: Static Chunking Strategy - additionalProperties: false - properties: - type: - type: string - description: Always `static`. - enum: - - static - static: - type: object - additionalProperties: false - properties: - max_chunk_size_tokens: - type: integer - minimum: 100 - maximum: 4096 - description: The maximum number of tokens in each chunk. The default value is - `800`. The minimum value is `100` and the - maximum value is `4096`. - chunk_overlap_tokens: - type: integer - description: > - The number of tokens that overlap between - chunks. The default value is `400`. - - - Note that the overlap must not exceed half - of `max_chunk_size_tokens`. - required: - - max_chunk_size_tokens - - chunk_overlap_tokens - required: - - type - - static - x-oaiExpandable: true - metadata: - type: object - description: > - Set of 16 key-value pairs that can be attached to a - vector store. This can be useful for storing - additional information about the vector store in a - structured format. Keys can be a maximum of 64 - characters long and values can be a maximum of 512 - characters long. - x-oaiTypeLabel: map - x-oaiExpandable: true - oneOf: - - required: - - vector_store_ids - - required: - - vector_stores - nullable: true - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. + value: + description: The data that makes up the text. + type: string + annotations: + type: array + items: + oneOf: + - $ref: "#/components/schemas/MessageContentTextAnnotationsFileCitationObject" + - $ref: "#/components/schemas/MessageContentTextAnnotationsFilePathObject" + required: + - value + - annotations + required: + - type + - text + MessageDeltaContentImageFileObject: + title: Image file + type: object + description: References an image [File](/docs/api-reference/files) in the + content of a message. + properties: + index: + type: integer + description: The index of the content part in the message. + type: + description: Always `image_file`. + type: string + enum: + - image_file + x-stainless-const: true + image_file: type: object - x-oaiTypeLabel: map - nullable: true - CreateTranscriptionRequest: + properties: + file_id: + description: The [File](/docs/api-reference/files) ID of the image in the + message content. Set `purpose="vision"` when uploading the File + if you need to later display the file content. + type: string + detail: + type: string + description: Specifies the detail level of the image if specified by the user. + `low` uses fewer tokens, you can opt in to high resolution using + `high`. + enum: + - auto + - low + - high + default: auto + required: + - index + - type + MessageDeltaContentImageUrlObject: + title: Image URL + type: object + description: References an image URL in the content of a message. + properties: + index: + type: integer + description: The index of the content part in the message. + type: + description: Always `image_url`. + type: string + enum: + - image_url + x-stainless-const: true + image_url: + type: object + properties: + url: + description: "The URL of the image, must be a supported image types: jpeg, jpg, + png, gif, webp." + type: string + detail: + type: string + description: Specifies the detail level of the image. `low` uses fewer tokens, + you can opt in to high resolution using `high`. + enum: + - auto + - low + - high + default: auto + required: + - index + - type + MessageDeltaContentRefusalObject: + title: Refusal type: object - additionalProperties: false + description: The refusal content that is part of a message. properties: - file: - description: > - The audio file object (not file name) to transcribe, in one of these - formats: flac, mp3, mp4, mpeg, mpga, m4a, ogg, wav, or webm. + index: + type: integer + description: The index of the refusal part in the message. + type: + description: Always `refusal`. type: string - x-oaiTypeLabel: file - format: binary - model: - description: > - ID of the model to use. Only `whisper-1` (which is powered by our - open source Whisper V2 model) is currently available. - example: whisper-1 - anyOf: - - type: string - - type: string - enum: - - whisper-1 - x-oaiTypeLabel: string - language: - description: > - The language of the input audio. Supplying the input language in - [ISO-639-1](https://en.wikipedia.org/wiki/List_of_ISO_639-1_codes) - format will improve accuracy and latency. + enum: + - refusal + x-stainless-const: true + refusal: type: string - prompt: - description: > - An optional text to guide the model's style or continue a previous - audio segment. The [prompt](/docs/guides/speech-to-text#prompting) - should match the audio language. + required: + - index + - type + MessageDeltaContentTextAnnotationsFileCitationObject: + title: File citation + type: object + description: A citation within the message that points to a specific quote from + a specific File associated with the assistant or the message. Generated + when the assistant uses the "file_search" tool to search files. + properties: + index: + type: integer + description: The index of the annotation in the text content part. + type: + description: Always `file_citation`. type: string - response_format: - $ref: "#/components/schemas/AudioResponseFormat" - temperature: - description: > - The sampling temperature, between 0 and 1. Higher values like 0.8 - will make the output more random, while lower values like 0.2 will - make it more focused and deterministic. If set to 0, the model will - use [log probability](https://en.wikipedia.org/wiki/Log_probability) - to automatically increase the temperature until certain thresholds - are hit. - type: number - default: 0 - timestamp_granularities[]: - description: > - The timestamp granularities to populate for this transcription. - `response_format` must be set `verbose_json` to use timestamp - granularities. Either or both of these options are supported: - `word`, or `segment`. Note: There is no additional latency for - segment timestamps, but generating word timestamps incurs additional - latency. - type: array - items: - type: string - enum: - - word - - segment - default: - - segment + enum: + - file_citation + x-stainless-const: true + text: + description: The text in the message content that needs to be replaced. + type: string + file_citation: + type: object + properties: + file_id: + description: The ID of the specific File the citation is from. + type: string + quote: + description: The specific quote in the file. + type: string + start_index: + type: integer + minimum: 0 + end_index: + type: integer + minimum: 0 required: - - file - - model - CreateTranscriptionResponseJson: + - index + - type + MessageDeltaContentTextAnnotationsFilePathObject: + title: File path type: object - description: Represents a transcription response returned by model, based on the - provided input. + description: A URL for the file that's generated when the assistant used the + `code_interpreter` tool to generate a file. properties: + index: + type: integer + description: The index of the annotation in the text content part. + type: + description: Always `file_path`. + type: string + enum: + - file_path + x-stainless-const: true text: + description: The text in the message content that needs to be replaced. type: string - description: The transcribed text. + file_path: + type: object + properties: + file_id: + description: The ID of the file that was generated. + type: string + start_index: + type: integer + minimum: 0 + end_index: + type: integer + minimum: 0 required: - - text + - index + - type + MessageDeltaContentTextObject: + title: Text + type: object + description: The text content that is part of a message. + properties: + index: + type: integer + description: The index of the content part in the message. + type: + description: Always `text`. + type: string + enum: + - text + x-stainless-const: true + text: + type: object + properties: + value: + description: The data that makes up the text. + type: string + annotations: + type: array + items: + oneOf: + - $ref: "#/components/schemas/MessageDeltaContentTextAnnotationsFileCitationObjec\ + t" + - $ref: "#/components/schemas/MessageDeltaContentTextAnnotationsFilePathObject" + required: + - index + - type + MessageDeltaObject: + type: object + title: Message delta object + description: > + Represents a message delta i.e. any changed fields on a message during + streaming. + properties: + id: + description: The identifier of the message, which can be referenced in API + endpoints. + type: string + object: + description: The object type, which is always `thread.message.delta`. + type: string + enum: + - thread.message.delta + x-stainless-const: true + delta: + description: The delta containing the fields that have changed on the Message. + type: object + properties: + role: + description: The entity that produced the message. One of `user` or `assistant`. + type: string + enum: + - user + - assistant + content: + description: The content of the message in array of text and/or images. + type: array + items: + oneOf: + - $ref: "#/components/schemas/MessageDeltaContentImageFileObject" + - $ref: "#/components/schemas/MessageDeltaContentTextObject" + - $ref: "#/components/schemas/MessageDeltaContentRefusalObject" + - $ref: "#/components/schemas/MessageDeltaContentImageUrlObject" + required: + - id + - object + - delta x-oaiMeta: - name: The transcription object (JSON) - group: audio - example: > + name: The message delta object + beta: true + example: | { - "text": "Imagine the wildest idea that you've ever had, and you're curious about how it might scale to something that's a 100, a 1,000 times bigger. This is a place where you can get to do that." + "id": "msg_123", + "object": "thread.message.delta", + "delta": { + "content": [ + { + "index": 0, + "type": "text", + "text": { "value": "Hello", "annotations": [] } + } + ] + } } - CreateTranscriptionResponseVerboseJson: + MessageObject: type: object - description: Represents a verbose json transcription response returned by model, - based on the provided input. + title: The message object + description: Represents a message within a [thread](/docs/api-reference/threads). properties: - language: + id: + description: The identifier, which can be referenced in API endpoints. + type: string + object: + description: The object type, which is always `thread.message`. + type: string + enum: + - thread.message + x-stainless-const: true + created_at: + description: The Unix timestamp (in seconds) for when the message was created. + type: integer + thread_id: + description: The [thread](/docs/api-reference/threads) ID that this message + belongs to. type: string - description: The language of the input audio. - duration: + status: + description: The status of the message, which can be either `in_progress`, + `incomplete`, or `completed`. type: string - description: The duration of the input audio. - text: + enum: + - in_progress + - incomplete + - completed + incomplete_details: + description: On an incomplete message, details about why the message is + incomplete. + type: object + properties: + reason: + type: string + description: The reason the message is incomplete. + enum: + - content_filter + - max_tokens + - run_cancelled + - run_expired + - run_failed + nullable: true + required: + - reason + completed_at: + description: The Unix timestamp (in seconds) for when the message was completed. + type: integer + nullable: true + incomplete_at: + description: The Unix timestamp (in seconds) for when the message was marked as + incomplete. + type: integer + nullable: true + role: + description: The entity that produced the message. One of `user` or `assistant`. type: string - description: The transcribed text. - words: + enum: + - user + - assistant + content: + description: The content of the message in array of text and/or images. type: array - description: Extracted words and their corresponding timestamps. items: - $ref: "#/components/schemas/TranscriptionWord" - segments: + oneOf: + - $ref: "#/components/schemas/MessageContentImageFileObject" + - $ref: "#/components/schemas/MessageContentImageUrlObject" + - $ref: "#/components/schemas/MessageContentTextObject" + - $ref: "#/components/schemas/MessageContentRefusalObject" + assistant_id: + description: If applicable, the ID of the + [assistant](/docs/api-reference/assistants) that authored this + message. + type: string + nullable: true + run_id: + description: The ID of the [run](/docs/api-reference/runs) associated with the + creation of this message. Value is `null` when messages are created + manually using the create message or create thread endpoints. + type: string + nullable: true + attachments: type: array - description: Segments of the transcribed text and their corresponding details. items: - $ref: "#/components/schemas/TranscriptionSegment" + type: object + properties: + file_id: + type: string + description: The ID of the file to attach to the message. + tools: + description: The tools to add this file to. + type: array + items: + oneOf: + - $ref: "#/components/schemas/AssistantToolsCode" + - $ref: "#/components/schemas/AssistantToolsFileSearchTypeOnly" + description: A list of files attached to the message, and the tools they were + added to. + nullable: true + metadata: + $ref: "#/components/schemas/Metadata" required: - - language - - duration - - text + - id + - object + - created_at + - thread_id + - status + - incomplete_details + - completed_at + - incomplete_at + - role + - content + - assistant_id + - run_id + - attachments + - metadata x-oaiMeta: - name: The transcription object (Verbose JSON) - group: audio - example: > + name: The message object + beta: true + example: | { - "task": "transcribe", - "language": "english", - "duration": 8.470000267028809, - "text": "The beach was a popular spot on a hot summer day. People were swimming in the ocean, building sandcastles, and playing beach volleyball.", - "segments": [ + "id": "msg_abc123", + "object": "thread.message", + "created_at": 1698983503, + "thread_id": "thread_abc123", + "role": "assistant", + "content": [ { - "id": 0, - "seek": 0, - "start": 0.0, - "end": 3.319999933242798, - "text": " The beach was a popular spot on a hot summer day.", - "tokens": [ - 50364, 440, 7534, 390, 257, 3743, 4008, 322, 257, 2368, 4266, 786, 13, 50530 - ], - "temperature": 0.0, - "avg_logprob": -0.2860786020755768, - "compression_ratio": 1.2363636493682861, - "no_speech_prob": 0.00985979475080967 - }, - ... - ] + "type": "text", + "text": { + "value": "Hi! How can I help you today?", + "annotations": [] + } + } + ], + "assistant_id": "asst_abc123", + "run_id": "run_abc123", + "attachments": [], + "metadata": {} } - CreateTranslationRequest: + MessageRequestContentTextObject: + title: Text type: object - additionalProperties: false + description: The text content that is part of a message. properties: - file: - description: > - The audio file object (not file name) translate, in one of these - formats: flac, mp3, mp4, mpeg, mpga, m4a, ogg, wav, or webm. - type: string - x-oaiTypeLabel: file - format: binary - model: - description: > - ID of the model to use. Only `whisper-1` (which is powered by our - open source Whisper V2 model) is currently available. - example: whisper-1 - anyOf: - - type: string - - type: string - enum: - - whisper-1 - x-oaiTypeLabel: string - prompt: - description: > - An optional text to guide the model's style or continue a previous - audio segment. The [prompt](/docs/guides/speech-to-text#prompting) - should be in English. + type: + description: Always `text`. type: string - response_format: - $ref: "#/components/schemas/AudioResponseFormat" - temperature: - description: > - The sampling temperature, between 0 and 1. Higher values like 0.8 - will make the output more random, while lower values like 0.2 will - make it more focused and deterministic. If set to 0, the model will - use [log probability](https://en.wikipedia.org/wiki/Log_probability) - to automatically increase the temperature until certain thresholds - are hit. - type: number - default: 0 - required: - - file - - model - CreateTranslationResponseJson: - type: object - properties: + enum: + - text + x-stainless-const: true text: type: string + description: Text content to be sent to the model required: + - type - text - CreateTranslationResponseVerboseJson: + MessageStreamEvent: + oneOf: + - type: object + properties: + event: + type: string + enum: + - thread.message.created + x-stainless-const: true + data: + $ref: "#/components/schemas/MessageObject" + required: + - event + - data + description: Occurs when a [message](/docs/api-reference/messages/object) is + created. + x-oaiMeta: + dataDescription: "`data` is a [message](/docs/api-reference/messages/object)" + - type: object + properties: + event: + type: string + enum: + - thread.message.in_progress + x-stainless-const: true + data: + $ref: "#/components/schemas/MessageObject" + required: + - event + - data + description: Occurs when a [message](/docs/api-reference/messages/object) moves + to an `in_progress` state. + x-oaiMeta: + dataDescription: "`data` is a [message](/docs/api-reference/messages/object)" + - type: object + properties: + event: + type: string + enum: + - thread.message.delta + x-stainless-const: true + data: + $ref: "#/components/schemas/MessageDeltaObject" + required: + - event + - data + description: Occurs when parts of a + [Message](/docs/api-reference/messages/object) are being streamed. + x-oaiMeta: + dataDescription: "`data` is a [message + delta](/docs/api-reference/assistants-streaming/message-delta-obj\ + ect)" + - type: object + properties: + event: + type: string + enum: + - thread.message.completed + x-stainless-const: true + data: + $ref: "#/components/schemas/MessageObject" + required: + - event + - data + description: Occurs when a [message](/docs/api-reference/messages/object) is + completed. + x-oaiMeta: + dataDescription: "`data` is a [message](/docs/api-reference/messages/object)" + - type: object + properties: + event: + type: string + enum: + - thread.message.incomplete + x-stainless-const: true + data: + $ref: "#/components/schemas/MessageObject" + required: + - event + - data + description: Occurs when a [message](/docs/api-reference/messages/object) ends + before it is completed. + x-oaiMeta: + dataDescription: "`data` is a [message](/docs/api-reference/messages/object)" + Metadata: type: object + description: > + Set of 16 key-value pairs that can be attached to an object. This can be + + useful for storing additional information about the object in a + structured + + format, and querying for objects via API or the dashboard. + + + Keys are strings with a maximum length of 64 characters. Values are + strings + + with a maximum length of 512 characters. + additionalProperties: + type: string + x-oaiTypeLabel: map + nullable: true + Model: + title: Model + description: Describes an OpenAI model offering that can be used with the API. properties: - language: + id: type: string - description: The language of the output translation (always `english`). - duration: + description: The model identifier, which can be referenced in the API endpoints. + created: + type: integer + description: The Unix timestamp (in seconds) when the model was created. + object: type: string - description: The duration of the input audio. - text: + description: The object type, which is always "model". + enum: + - model + x-stainless-const: true + owned_by: type: string - description: The translated text. - segments: - type: array - description: Segments of the translated text and their corresponding details. - items: - $ref: "#/components/schemas/TranscriptionSegment" + description: The organization that owns the model. required: - - language - - duration - - text - CreateUploadRequest: + - id + - object + - created + - owned_by + x-oaiMeta: + name: The model object + example: | + { + "id": "VAR_chat_model_id", + "object": "model", + "created": 1686935002, + "owned_by": "openai" + } + ModelIds: + anyOf: + - $ref: "#/components/schemas/ModelIdsShared" + - $ref: "#/components/schemas/ModelIdsResponses" + ModelIdsResponses: + example: gpt-4o + anyOf: + - $ref: "#/components/schemas/ModelIdsShared" + - type: string + title: ResponsesOnlyModel + enum: + - o1-pro + - o1-pro-2025-03-19 + - computer-use-preview + - computer-use-preview-2025-03-11 + ModelIdsShared: + example: gpt-4o + anyOf: + - type: string + - type: string + enum: + - gpt-4.1 + - gpt-4.1-mini + - gpt-4.1-nano + - gpt-4.1-2025-04-14 + - gpt-4.1-mini-2025-04-14 + - gpt-4.1-nano-2025-04-14 + - o4-mini + - o4-mini-2025-04-16 + - o3 + - o3-2025-04-16 + - o3-mini + - o3-mini-2025-01-31 + - o1 + - o1-2024-12-17 + - o1-preview + - o1-preview-2024-09-12 + - o1-mini + - o1-mini-2024-09-12 + - gpt-4o + - gpt-4o-2024-11-20 + - gpt-4o-2024-08-06 + - gpt-4o-2024-05-13 + - gpt-4o-audio-preview + - gpt-4o-audio-preview-2024-10-01 + - gpt-4o-audio-preview-2024-12-17 + - gpt-4o-mini-audio-preview + - gpt-4o-mini-audio-preview-2024-12-17 + - gpt-4o-search-preview + - gpt-4o-mini-search-preview + - gpt-4o-search-preview-2025-03-11 + - gpt-4o-mini-search-preview-2025-03-11 + - chatgpt-4o-latest + - codex-mini-latest + - gpt-4o-mini + - gpt-4o-mini-2024-07-18 + - gpt-4-turbo + - gpt-4-turbo-2024-04-09 + - gpt-4-0125-preview + - gpt-4-turbo-preview + - gpt-4-1106-preview + - gpt-4-vision-preview + - gpt-4 + - gpt-4-0314 + - gpt-4-0613 + - gpt-4-32k + - gpt-4-32k-0314 + - gpt-4-32k-0613 + - gpt-3.5-turbo + - gpt-3.5-turbo-16k + - gpt-3.5-turbo-0301 + - gpt-3.5-turbo-0613 + - gpt-3.5-turbo-1106 + - gpt-3.5-turbo-0125 + - gpt-3.5-turbo-16k-0613 + ModelResponseProperties: type: object - additionalProperties: false properties: - filename: - description: | - The name of the file to upload. - type: string - purpose: + metadata: + $ref: "#/components/schemas/Metadata" + temperature: + type: number + minimum: 0 + maximum: 2 + default: 1 + example: 1 + nullable: true description: > - The intended purpose of the uploaded file. - + What sampling temperature to use, between 0 and 2. Higher values + like 0.8 will make the output more random, while lower values like + 0.2 will make it more focused and deterministic. - See the [documentation on File - purposes](/docs/api-reference/files/create#files-create-purpose). - type: string - enum: - - assistants - - batch - - fine-tune - - vision - bytes: - description: | - The number of bytes in the file you are uploading. - type: integer - mime_type: + We generally recommend altering this or `top_p` but not both. + top_p: + type: number + minimum: 0 + maximum: 1 + default: 1 + example: 1 + nullable: true description: > - The MIME type of the file. + An alternative to sampling with temperature, called nucleus + sampling, + where the model considers the results of the tokens with top_p + probability - This must fall within the supported MIME types for your file - purpose. See the supported MIME types for assistants and vision. + mass. So 0.1 means only the tokens comprising the top 10% + probability mass + + are considered. + + + We generally recommend altering this or `temperature` but not both. + user: type: string - required: - - filename - - purpose - - bytes - - mime_type - CreateVectorStoreFileBatchRequest: + example: user-1234 + description: > + A unique identifier representing your end-user, which can help + OpenAI to monitor and detect abuse. [Learn + more](/docs/guides/safety-best-practices#end-user-ids). + service_tier: + $ref: "#/components/schemas/ServiceTier" + ModifyAssistantRequest: type: object additionalProperties: false properties: - file_ids: - description: A list of [File](/docs/api-reference/files) IDs that the vector - store should use. Useful for tools like `file_search` that can - access files. + model: + description: > + ID of the model to use. You can use the [List + models](/docs/api-reference/models/list) API to see all of your + available models, or see our [Model overview](/docs/models) for + descriptions of them. + anyOf: + - type: string + - $ref: "#/components/schemas/AssistantSupportedModels" + reasoning_effort: + $ref: "#/components/schemas/ReasoningEffort" + name: + description: | + The name of the assistant. The maximum length is 256 characters. + type: string + nullable: true + maxLength: 256 + description: + description: > + The description of the assistant. The maximum length is 512 + characters. + type: string + nullable: true + maxLength: 512 + instructions: + description: > + The system instructions that the assistant uses. The maximum length + is 256,000 characters. + type: string + nullable: true + maxLength: 256000 + tools: + description: > + A list of tool enabled on the assistant. There can be a maximum of + 128 tools per assistant. Tools can be of types `code_interpreter`, + `file_search`, or `function`. + default: [] type: array - minItems: 1 - maxItems: 500 + maxItems: 128 items: - type: string - chunking_strategy: - $ref: "#/components/schemas/ChunkingStrategyRequestParam" - required: - - file_ids - CreateVectorStoreFileRequest: + oneOf: + - $ref: "#/components/schemas/AssistantToolsCode" + - $ref: "#/components/schemas/AssistantToolsFileSearch" + - $ref: "#/components/schemas/AssistantToolsFunction" + tool_resources: + type: object + description: > + A set of resources that are used by the assistant's tools. The + resources are specific to the type of tool. For example, the + `code_interpreter` tool requires a list of file IDs, while the + `file_search` tool requires a list of vector store IDs. + properties: + code_interpreter: + type: object + properties: + file_ids: + type: array + description: > + Overrides the list of [file](/docs/api-reference/files) IDs + made available to the `code_interpreter` tool. There can be + a maximum of 20 files associated with the tool. + default: [] + maxItems: 20 + items: + type: string + file_search: + type: object + properties: + vector_store_ids: + type: array + description: > + Overrides the [vector + store](/docs/api-reference/vector-stores/object) attached to + this assistant. There can be a maximum of 1 vector store + attached to the assistant. + maxItems: 1 + items: + type: string + nullable: true + metadata: + $ref: "#/components/schemas/Metadata" + temperature: + description: > + What sampling temperature to use, between 0 and 2. Higher values + like 0.8 will make the output more random, while lower values like + 0.2 will make it more focused and deterministic. + type: number + minimum: 0 + maximum: 2 + default: 1 + example: 1 + nullable: true + top_p: + type: number + minimum: 0 + maximum: 1 + default: 1 + example: 1 + nullable: true + description: > + An alternative to sampling with temperature, called nucleus + sampling, where the model considers the results of the tokens with + top_p probability mass. So 0.1 means only the tokens comprising the + top 10% probability mass are considered. + + + We generally recommend altering this or temperature but not both. + response_format: + $ref: "#/components/schemas/AssistantsApiResponseFormatOption" + nullable: true + ModifyCertificateRequest: type: object - additionalProperties: false properties: - file_id: - description: A [File](/docs/api-reference/files) ID that the vector store should - use. Useful for tools like `file_search` that can access files. + name: type: string - chunking_strategy: - $ref: "#/components/schemas/ChunkingStrategyRequestParam" + description: The updated name for the certificate required: - - file_id - CreateVectorStoreRequest: + - name + ModifyMessageRequest: type: object additionalProperties: false properties: - file_ids: - description: A list of [File](/docs/api-reference/files) IDs that the vector - store should use. Useful for tools like `file_search` that can - access files. - type: array - maxItems: 500 - items: - type: string - name: - description: The name of the vector store. - type: string - expires_after: - $ref: "#/components/schemas/VectorStoreExpirationAfter" - chunking_strategy: - type: object - description: The chunking strategy used to chunk the file(s). If not set, will - use the `auto` strategy. Only applicable if `file_ids` is non-empty. - oneOf: - - $ref: "#/components/schemas/AutoChunkingStrategyRequestParam" - - $ref: "#/components/schemas/StaticChunkingStrategyRequestParam" - x-oaiExpandable: true metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. + $ref: "#/components/schemas/Metadata" + ModifyRunRequest: + type: object + additionalProperties: false + properties: + metadata: + $ref: "#/components/schemas/Metadata" + ModifyThreadRequest: + type: object + additionalProperties: false + properties: + tool_resources: type: object - x-oaiTypeLabel: map + description: > + A set of resources that are made available to the assistant's tools + in this thread. The resources are specific to the type of tool. For + example, the `code_interpreter` tool requires a list of file IDs, + while the `file_search` tool requires a list of vector store IDs. + properties: + code_interpreter: + type: object + properties: + file_ids: + type: array + description: > + A list of [file](/docs/api-reference/files) IDs made + available to the `code_interpreter` tool. There can be a + maximum of 20 files associated with the tool. + default: [] + maxItems: 20 + items: + type: string + file_search: + type: object + properties: + vector_store_ids: + type: array + description: > + The [vector store](/docs/api-reference/vector-stores/object) + attached to this thread. There can be a maximum of 1 vector + store attached to the thread. + maxItems: 1 + items: + type: string nullable: true - DefaultProjectErrorResponse: + metadata: + $ref: "#/components/schemas/Metadata" + Move: type: object + title: Move + description: | + A mouse move action. properties: - code: - type: integer - message: + type: type: string + enum: + - move + default: move + description: | + Specifies the event type. For a move action, this property is + always set to `move`. + x-stainless-const: true + x: + type: integer + description: | + The x-coordinate to move to. + y: + type: integer + description: | + The y-coordinate to move to. required: - - code - - message - DeleteAssistantResponse: - type: object + - type + - x + - y + OpenAIFile: + title: OpenAIFile + description: The `File` object represents a document that has been uploaded to OpenAI. properties: id: type: string - deleted: - type: boolean + description: The file identifier, which can be referenced in the API endpoints. + bytes: + type: integer + description: The size of the file, in bytes. + created_at: + type: integer + description: The Unix timestamp (in seconds) for when the file was created. + expires_at: + type: integer + description: The Unix timestamp (in seconds) for when the file will expire. + filename: + type: string + description: The name of the file. object: type: string + description: The object type, which is always `file`. enum: - - assistant.deleted + - file + x-stainless-const: true + purpose: + type: string + description: The intended purpose of the file. Supported values are + `assistants`, `assistants_output`, `batch`, `batch_output`, + `fine-tune`, `fine-tune-results` and `vision`. + enum: + - assistants + - assistants_output + - batch + - batch_output + - fine-tune + - fine-tune-results + - vision + status: + type: string + deprecated: true + description: Deprecated. The current status of the file, which can be either + `uploaded`, `processed`, or `error`. + enum: + - uploaded + - processed + - error + status_details: + type: string + deprecated: true + description: Deprecated. For details on why a fine-tuning training file failed + validation, see the `error` field on `fine_tuning.job`. required: - id - object - - deleted - DeleteFileResponse: + - bytes + - created_at + - filename + - purpose + - status + x-oaiMeta: + name: The file object + example: | + { + "id": "file-abc123", + "object": "file", + "bytes": 120000, + "created_at": 1677610602, + "expires_at": 1680202602, + "filename": "salesOverview.pdf", + "purpose": "assistants", + } + OtherChunkingStrategyResponseParam: type: object + title: Other Chunking Strategy + description: This is returned when the chunking strategy is unknown. Typically, + this is because the file was indexed before the `chunking_strategy` + concept was introduced in the API. + additionalProperties: false properties: - id: - type: string - object: + type: type: string + description: Always `other`. enum: - - file - deleted: - type: boolean + - other + x-stainless-const: true required: - - id - - object - - deleted - DeleteMessageResponse: + - type + OutputAudio: type: object + title: Output audio + description: | + An audio output from the model. properties: - id: - type: string - deleted: - type: boolean - object: + type: type: string + description: | + The type of the output audio. Always `output_audio`. enum: - - thread.message.deleted + - output_audio + x-stainless-const: true + data: + type: string + description: | + Base64-encoded audio data from the model. + transcript: + type: string + description: | + The transcript of the audio data from the model. required: - - id - - object - - deleted - DeleteModelResponse: + - type + - data + - transcript + OutputContent: + oneOf: + - $ref: "#/components/schemas/OutputTextContent" + - $ref: "#/components/schemas/RefusalContent" + OutputItem: + anyOf: + - $ref: "#/components/schemas/OutputMessage" + - $ref: "#/components/schemas/FileSearchToolCall" + - $ref: "#/components/schemas/FunctionToolCall" + - $ref: "#/components/schemas/WebSearchToolCall" + - $ref: "#/components/schemas/ComputerToolCall" + - $ref: "#/components/schemas/ReasoningItem" + discriminator: + propertyName: type + OutputMessage: type: object + title: Output message + description: | + An output message from the model. properties: id: type: string - deleted: - type: boolean - object: + description: | + The unique ID of the output message. + type: + type: string + description: | + The type of the output message. Always `message`. + enum: + - message + x-stainless-const: true + role: + type: string + description: | + The role of the output message. Always `assistant`. + enum: + - assistant + x-stainless-const: true + content: + type: array + description: | + The content of the output message. + items: + $ref: "#/components/schemas/OutputContent" + status: type: string + description: > + The status of the message input. One of `in_progress`, `completed`, + or + + `incomplete`. Populated when input items are returned via API. + enum: + - in_progress + - completed + - incomplete required: - id - - object - - deleted - DeleteThreadResponse: + - type + - role + - content + - status + ParallelToolCalls: + description: Whether to enable [parallel function + calling](/docs/guides/function-calling#configuring-parallel-function-calling) + during tool use. + type: boolean + default: true + PredictionContent: type: object - properties: - id: - type: string - deleted: - type: boolean - object: + title: Static Content + description: > + Static predicted output content, such as the content of a text file that + is + + being regenerated. + required: + - type + - content + properties: + type: type: string enum: - - thread.deleted - required: - - id - - object - - deleted - DeleteVectorStoreFileResponse: + - content + description: | + The type of the predicted content you want to provide. This type is + currently always `content`. + x-stainless-const: true + content: + description: > + The content that should be matched when generating a model response. + + If generated tokens would match this content, the entire model + response + + can be returned much more quickly. + oneOf: + - type: string + title: Text content + description: | + The content used for a Predicted Output. This is often the + text of a file you are regenerating with minor changes. + - type: array + description: An array of content parts with a defined type. Supported options + differ based on the [model](/docs/models) being used to generate + the response. Can contain text inputs. + title: Array of content parts + items: + $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartText" + minItems: 1 + Project: type: object + description: Represents an individual project. properties: id: type: string - deleted: - type: boolean + description: The identifier, which can be referenced in API endpoints object: type: string enum: - - vector_store.file.deleted - required: - - id - - object - - deleted - DeleteVectorStoreResponse: - type: object - properties: - id: + - organization.project + description: The object type, which is always `organization.project` + x-stainless-const: true + name: type: string - deleted: - type: boolean - object: + description: The name of the project. This appears in reporting. + created_at: + type: integer + description: The Unix timestamp (in seconds) of when the project was created. + archived_at: + type: integer + nullable: true + description: The Unix timestamp (in seconds) of when the project was archived or + `null`. + status: type: string enum: - - vector_store.deleted + - active + - archived + description: "`active` or `archived`" required: - id - object - - deleted - DoneEvent: + - name + - created_at + - status + x-oaiMeta: + name: The project object + example: | + { + "id": "proj_abc", + "object": "organization.project", + "name": "Project example", + "created_at": 1711471533, + "archived_at": null, + "status": "active" + } + ProjectApiKey: type: object + description: Represents an individual API key in a project. properties: - event: + object: type: string enum: - - done - data: + - organization.project.api_key + description: The object type, which is always `organization.project.api_key` + x-stainless-const: true + redacted_value: type: string - enum: - - "[DONE]" - required: - - event - - data - description: Occurs when a stream ends. - x-oaiMeta: - dataDescription: "`data` is `[DONE]`" - Embedding: - type: object - description: | - Represents an embedding vector returned by embedding endpoint. - properties: - index: + description: The redacted value of the API key + name: + type: string + description: The name of the API key + created_at: type: integer - description: The index of the embedding in the list of embeddings. - embedding: - type: array - description: > - The embedding vector, which is a list of floats. The length of - vector depends on the model as listed in the [embedding - guide](/docs/guides/embeddings). - items: - type: number - object: + description: The Unix timestamp (in seconds) of when the API key was created + last_used_at: + type: integer + description: The Unix timestamp (in seconds) of when the API key was last used. + id: type: string - description: The object type, which is always "embedding". - enum: - - embedding + description: The identifier, which can be referenced in API endpoints + owner: + type: object + properties: + type: + type: string + enum: + - user + - service_account + description: "`user` or `service_account`" + user: + $ref: "#/components/schemas/ProjectUser" + service_account: + $ref: "#/components/schemas/ProjectServiceAccount" required: - - index - object - - embedding + - redacted_value + - name + - created_at + - last_used_at + - id + - owner x-oaiMeta: - name: The embedding object + name: The project API key object example: | { - "object": "embedding", - "embedding": [ - 0.0023064255, - -0.009327292, - .... (1536 floats total for ada-002) - -0.0028842222, - ], - "index": 0 + "object": "organization.project.api_key", + "redacted_value": "sk-abc...def", + "name": "My API Key", + "created_at": 1711471533, + "last_used_at": 1711471534, + "id": "key_abc", + "owner": { + "type": "user", + "user": { + "object": "organization.project.user", + "id": "user_abc", + "name": "First Last", + "email": "user@example.com", + "role": "owner", + "created_at": 1711471533 + } + } } - Error: + ProjectApiKeyDeleteResponse: type: object properties: - code: - type: string - nullable: true - message: - type: string - nullable: false - param: + object: type: string - nullable: true - type: + enum: + - organization.project.api_key.deleted + x-stainless-const: true + id: type: string - nullable: false + deleted: + type: boolean required: - - type - - message - - param - - code - ErrorEvent: + - object + - id + - deleted + ProjectApiKeyListResponse: type: object properties: - event: + object: type: string enum: - - error + - list + x-stainless-const: true data: - $ref: "#/components/schemas/Error" - required: - - event - - data - description: Occurs when an [error](/docs/guides/error-codes#api-errors) occurs. - This can happen due to an internal server error or a timeout. - x-oaiMeta: - dataDescription: "`data` is an [error](/docs/guides/error-codes#api-errors)" - ErrorResponse: - type: object - properties: - error: - $ref: "#/components/schemas/Error" - required: - - error - FileSearchRankingOptions: - title: File search tool call ranking options - type: object - description: > - The ranking options for the file search. If not specified, the file - search tool will use the `auto` ranker and a score_threshold of 0. - - - See the [file search tool - documentation](/docs/assistants/tools/file-search#customizing-file-search-settings) - for more information. - properties: - ranker: - type: string - description: The ranker to use for the file search. If not specified will use - the `auto` ranker. - enum: - - auto - - default_2024_08_21 - score_threshold: - type: number - description: The score threshold for the file search. All values must be a - floating point number between 0 and 1. - minimum: 0 - maximum: 1 - required: - - score_threshold - FineTuneChatCompletionRequestAssistantMessage: - allOf: - - type: object - title: Assistant message - deprecated: false - properties: - weight: - type: integer - enum: - - 0 - - 1 - description: Controls whether the assistant message is trained against (0 or 1) - - $ref: "#/components/schemas/ChatCompletionRequestAssistantMessage" + type: array + items: + $ref: "#/components/schemas/ProjectApiKey" + first_id: + type: string + last_id: + type: string + has_more: + type: boolean required: - - role - FineTuningIntegration: + - object + - data + - first_id + - last_id + - has_more + ProjectCreateRequest: type: object - title: Fine-Tuning Job Integration + properties: + name: + type: string + description: The friendly name of the project, this name appears in reports. required: - - type - - wandb + - name + ProjectListResponse: + type: object properties: - type: + object: type: string - description: The type of the integration being enabled for the fine-tuning job enum: - - wandb - wandb: - type: object - description: > - The settings for your integration with Weights and Biases. This - payload specifies the project that - - metrics will be sent to. Optionally, you can set an explicit display - name for your run, add tags - - to your run, and set a default entity (team, username, etc) to be - associated with your run. - required: - - project - properties: - project: - description: | - The name of the project that the new run will be created under. - type: string - example: my-wandb-project - name: - description: > - A display name to set for the run. If not set, we will use the - Job ID as the name. - nullable: true - type: string - entity: - description: > - The entity to use for the run. This allows you to set the team - or username of the WandB user that you would - - like associated with the run. If not set, the default entity for - the registered WandB API key is used. - nullable: true - type: string - tags: - description: > - A list of tags to be attached to the newly created run. These - tags are passed through directly to WandB. Some - - default tags are generated by OpenAI: "openai/finetune", - "openai/{base-model}", "openai/{ftjob-abcdef}". - type: array - items: - type: string - example: custom-tag - FineTuningJob: + - list + x-stainless-const: true + data: + type: array + items: + $ref: "#/components/schemas/Project" + first_id: + type: string + last_id: + type: string + has_more: + type: boolean + required: + - object + - data + - first_id + - last_id + - has_more + ProjectRateLimit: type: object - title: FineTuningJob - description: > - The `fine_tuning.job` object represents a fine-tuning job that has been - created through the API. + description: Represents a project rate limit config. properties: - id: + object: type: string - description: The object identifier, which can be referenced in the API endpoints. - created_at: - type: integer - description: The Unix timestamp (in seconds) for when the fine-tuning job was - created. - error: - type: object - nullable: true - description: For fine-tuning jobs that have `failed`, this will contain more - information on the cause of the failure. - properties: - code: - type: string - description: A machine-readable error code. - message: - type: string - description: A human-readable error message. - param: - type: string - description: The parameter that was invalid, usually `training_file` or - `validation_file`. This field will be null if the failure was - not parameter-specific. - nullable: true - required: - - code - - message - - param - fine_tuned_model: + enum: + - project.rate_limit + description: The object type, which is always `project.rate_limit` + x-stainless-const: true + id: type: string - nullable: true - description: The name of the fine-tuned model that is being created. The value - will be null if the fine-tuning job is still running. - finished_at: - type: integer - nullable: true - description: The Unix timestamp (in seconds) for when the fine-tuning job was - finished. The value will be null if the fine-tuning job is still - running. - hyperparameters: - type: object - description: The hyperparameters used for the fine-tuning job. See the - [fine-tuning guide](/docs/guides/fine-tuning) for more details. - properties: - n_epochs: - oneOf: - - type: string - enum: - - auto - - type: integer - minimum: 1 - maximum: 50 - default: auto - description: >- - The number of epochs to train the model for. An epoch refers to - one full cycle through the training dataset. - - "auto" decides the optimal number of epochs based on the size of - the dataset. If setting the number manually, we support any - number between 1 and 50 epochs. - required: - - n_epochs + description: The identifier, which can be referenced in API endpoints. model: type: string - description: The base model that is being fine-tuned. + description: The model this rate limit applies to. + max_requests_per_1_minute: + type: integer + description: The maximum requests per minute. + max_tokens_per_1_minute: + type: integer + description: The maximum tokens per minute. + max_images_per_1_minute: + type: integer + description: The maximum images per minute. Only present for relevant models. + max_audio_megabytes_per_1_minute: + type: integer + description: The maximum audio megabytes per minute. Only present for relevant + models. + max_requests_per_1_day: + type: integer + description: The maximum requests per day. Only present for relevant models. + batch_1_day_max_input_tokens: + type: integer + description: The maximum batch input tokens per day. Only present for relevant + models. + required: + - object + - id + - model + - max_requests_per_1_minute + - max_tokens_per_1_minute + x-oaiMeta: + name: The project rate limit object + example: | + { + "object": "project.rate_limit", + "id": "rl_ada", + "model": "ada", + "max_requests_per_1_minute": 600, + "max_tokens_per_1_minute": 150000, + "max_images_per_1_minute": 10 + } + ProjectRateLimitListResponse: + type: object + properties: object: type: string - description: The object type, which is always "fine_tuning.job". enum: - - fine_tuning.job - organization_id: - type: string - description: The organization that owns the fine-tuning job. - result_files: + - list + x-stainless-const: true + data: type: array - description: The compiled results file ID(s) for the fine-tuning job. You can - retrieve the results with the [Files - API](/docs/api-reference/files/retrieve-contents). items: - type: string - example: file-abc123 - status: + $ref: "#/components/schemas/ProjectRateLimit" + first_id: + type: string + last_id: + type: string + has_more: + type: boolean + required: + - object + - data + - first_id + - last_id + - has_more + ProjectRateLimitUpdateRequest: + type: object + properties: + max_requests_per_1_minute: + type: integer + description: The maximum requests per minute. + max_tokens_per_1_minute: + type: integer + description: The maximum tokens per minute. + max_images_per_1_minute: + type: integer + description: The maximum images per minute. Only relevant for certain models. + max_audio_megabytes_per_1_minute: + type: integer + description: The maximum audio megabytes per minute. Only relevant for certain + models. + max_requests_per_1_day: + type: integer + description: The maximum requests per day. Only relevant for certain models. + batch_1_day_max_input_tokens: + type: integer + description: The maximum batch input tokens per day. Only relevant for certain + models. + ProjectServiceAccount: + type: object + description: Represents an individual service account in a project. + properties: + object: type: string - description: The current status of the fine-tuning job, which can be either - `validating_files`, `queued`, `running`, `succeeded`, `failed`, or - `cancelled`. enum: - - validating_files - - queued - - running - - succeeded - - failed - - cancelled - trained_tokens: - type: integer - nullable: true - description: The total number of billable tokens processed by this fine-tuning - job. The value will be null if the fine-tuning job is still running. - training_file: + - organization.project.service_account + description: The object type, which is always + `organization.project.service_account` + x-stainless-const: true + id: type: string - description: The file ID used for training. You can retrieve the training data - with the [Files API](/docs/api-reference/files/retrieve-contents). - validation_file: + description: The identifier, which can be referenced in API endpoints + name: type: string - nullable: true - description: The file ID used for validation. You can retrieve the validation - results with the [Files - API](/docs/api-reference/files/retrieve-contents). - integrations: - type: array - nullable: true - description: A list of integrations to enable for this fine-tuning job. - maxItems: 5 - items: - oneOf: - - $ref: "#/components/schemas/FineTuningIntegration" - x-oaiExpandable: true - seed: - type: integer - description: The seed used for the fine-tuning job. - estimated_finish: + description: The name of the service account + role: + type: string + enum: + - owner + - member + description: "`owner` or `member`" + created_at: type: integer - nullable: true - description: The Unix timestamp (in seconds) for when the fine-tuning job is - estimated to finish. The value will be null if the fine-tuning job - is not running. + description: The Unix timestamp (in seconds) of when the service account was + created required: - - created_at - - error - - finished_at - - fine_tuned_model - - hyperparameters - - id - - model - object - - organization_id - - result_files - - status - - trained_tokens - - training_file - - validation_file - - seed + - id + - name + - role + - created_at x-oaiMeta: - name: The fine-tuning job object + name: The project service account object example: | { - "object": "fine_tuning.job", - "id": "ftjob-abc123", - "model": "davinci-002", - "created_at": 1692661014, - "finished_at": 1692661190, - "fine_tuned_model": "ft:davinci-002:my-org:custom_suffix:7q8mpxmy", - "organization_id": "org-123", - "result_files": [ - "file-abc123" - ], - "status": "succeeded", - "validation_file": null, - "training_file": "file-abc123", - "hyperparameters": { - "n_epochs": 4, - "batch_size": 1, - "learning_rate_multiplier": 1.0 - }, - "trained_tokens": 5768, - "integrations": [], - "seed": 0, - "estimated_finish": 0 + "object": "organization.project.service_account", + "id": "svc_acct_abc", + "name": "Service Account", + "role": "owner", + "created_at": 1711471533 } - FineTuningJobCheckpoint: + ProjectServiceAccountApiKey: type: object - title: FineTuningJobCheckpoint - description: > - The `fine_tuning.job.checkpoint` object represents a model checkpoint - for a fine-tuning job that is ready to use. properties: - id: + object: + type: string + enum: + - organization.project.service_account.api_key + description: The object type, which is always + `organization.project.service_account.api_key` + x-stainless-const: true + value: + type: string + name: type: string - description: The checkpoint identifier, which can be referenced in the API - endpoints. created_at: type: integer - description: The Unix timestamp (in seconds) for when the checkpoint was created. - fine_tuned_model_checkpoint: + id: type: string - description: The name of the fine-tuned checkpoint model that is created. - step_number: - type: integer - description: The step number that the checkpoint was created at. - metrics: - type: object - description: Metrics at the step number during the fine-tuning job. - properties: - step: - type: number - train_loss: - type: number - train_mean_token_accuracy: - type: number - valid_loss: - type: number - valid_mean_token_accuracy: - type: number - full_valid_loss: - type: number - full_valid_mean_token_accuracy: - type: number - fine_tuning_job_id: + required: + - object + - value + - name + - created_at + - id + ProjectServiceAccountCreateRequest: + type: object + properties: + name: type: string - description: The name of the fine-tuning job that this checkpoint was created - from. + description: The name of the service account being created. + required: + - name + ProjectServiceAccountCreateResponse: + type: object + properties: object: type: string - description: The object type, which is always "fine_tuning.job.checkpoint". enum: - - fine_tuning.job.checkpoint + - organization.project.service_account + x-stainless-const: true + id: + type: string + name: + type: string + role: + type: string + enum: + - member + description: Service accounts can only have one role of type `member` + x-stainless-const: true + created_at: + type: integer + api_key: + $ref: "#/components/schemas/ProjectServiceAccountApiKey" required: + - object + - id + - name + - role - created_at - - fine_tuning_job_id - - fine_tuned_model_checkpoint + - api_key + ProjectServiceAccountDeleteResponse: + type: object + properties: + object: + type: string + enum: + - organization.project.service_account.deleted + x-stainless-const: true + id: + type: string + deleted: + type: boolean + required: + - object - id - - metrics + - deleted + ProjectServiceAccountListResponse: + type: object + properties: + object: + type: string + enum: + - list + x-stainless-const: true + data: + type: array + items: + $ref: "#/components/schemas/ProjectServiceAccount" + first_id: + type: string + last_id: + type: string + has_more: + type: boolean + required: - object - - step_number - x-oaiMeta: - name: The fine-tuning job checkpoint object - example: > - { - "object": "fine_tuning.job.checkpoint", - "id": "ftckpt_qtZ5Gyk4BLq1SfLFWp3RtO3P", - "created_at": 1712211699, - "fine_tuned_model_checkpoint": "ft:gpt-4o-mini-2024-07-18:my-org:custom_suffix:9ABel2dg:ckpt-step-88", - "fine_tuning_job_id": "ftjob-fpbNQ3H1GrMehXRf8cO97xTN", - "metrics": { - "step": 88, - "train_loss": 0.478, - "train_mean_token_accuracy": 0.924, - "valid_loss": 10.112, - "valid_mean_token_accuracy": 0.145, - "full_valid_loss": 0.567, - "full_valid_mean_token_accuracy": 0.944 - }, - "step_number": 88 - } - FineTuningJobEvent: + - data + - first_id + - last_id + - has_more + ProjectUpdateRequest: type: object - description: Fine-tuning job event object properties: + name: + type: string + description: The updated name of the project, this name appears in reports. + required: + - name + ProjectUser: + type: object + description: Represents an individual user in a project. + properties: + object: + type: string + enum: + - organization.project.user + description: The object type, which is always `organization.project.user` + x-stainless-const: true id: type: string - created_at: - type: integer - level: + description: The identifier, which can be referenced in API endpoints + name: type: string - enum: - - info - - warn - - error - message: + description: The name of the user + email: type: string - object: + description: The email address of the user + role: type: string enum: - - fine_tuning.job.event + - owner + - member + description: "`owner` or `member`" + added_at: + type: integer + description: The Unix timestamp (in seconds) of when the project was added. required: - - id - object - - created_at - - level - - message + - id + - name + - email + - role + - added_at x-oaiMeta: - name: The fine-tuning job event object + name: The project user object example: | { - "object": "fine_tuning.job.event", - "id": "ftevent-abc123" - "created_at": 1677610602, - "level": "info", - "message": "Created fine-tuning job" - } - FinetuneChatRequestInput: - type: object - description: The per-line training example of a fine-tuning input file for chat models - properties: - messages: - type: array - minItems: 1 - items: - oneOf: - - $ref: "#/components/schemas/ChatCompletionRequestSystemMessage" - - $ref: "#/components/schemas/ChatCompletionRequestUserMessage" - - $ref: "#/components/schemas/FineTuneChatCompletionRequestAssistantMessage" - - $ref: "#/components/schemas/ChatCompletionRequestToolMessage" - - $ref: "#/components/schemas/ChatCompletionRequestFunctionMessage" - x-oaiExpandable: true - tools: - type: array - description: A list of tools the model may generate JSON inputs for. - items: - $ref: "#/components/schemas/ChatCompletionTool" - parallel_tool_calls: - $ref: "#/components/schemas/ParallelToolCalls" - functions: - deprecated: true - description: A list of functions the model may generate JSON inputs for. - type: array - minItems: 1 - maxItems: 128 - items: - $ref: "#/components/schemas/ChatCompletionFunctions" - x-oaiMeta: - name: Training format for chat models - example: > - { - "messages": [ - { "role": "user", "content": "What is the weather in San Francisco?" }, - { - "role": "assistant", - "tool_calls": [ - { - "id": "call_id", - "type": "function", - "function": { - "name": "get_current_weather", - "arguments": "{\"location\": \"San Francisco, USA\", \"format\": \"celsius\"}" - } - } - ] - } - ], - "parallel_tool_calls": false, - "tools": [ - { - "type": "function", - "function": { - "name": "get_current_weather", - "description": "Get the current weather", - "parameters": { - "type": "object", - "properties": { - "location": { - "type": "string", - "description": "The city and country, eg. San Francisco, USA" - }, - "format": { "type": "string", "enum": ["celsius", "fahrenheit"] } - }, - "required": ["location", "format"] - } - } - } - ] + "object": "organization.project.user", + "id": "user_abc", + "name": "First Last", + "email": "user@example.com", + "role": "owner", + "added_at": 1711471533 } - FinetuneCompletionRequestInput: + ProjectUserCreateRequest: type: object - description: The per-line training example of a fine-tuning input file for - completions models properties: - prompt: + user_id: type: string - description: The input prompt for this training example. - completion: + description: The ID of the user. + role: type: string - description: The desired completion for this training example. - x-oaiMeta: - name: Training format for completions models - example: | - { - "prompt": "What is the answer to 2+2", - "completion": "4" - } - FunctionObject: + enum: + - owner + - member + description: "`owner` or `member`" + required: + - user_id + - role + ProjectUserDeleteResponse: type: object properties: - description: + object: type: string - description: A description of what the function does, used by the model to - choose when and how to call the function. - name: + enum: + - organization.project.user.deleted + x-stainless-const: true + id: type: string - description: The name of the function to be called. Must be a-z, A-Z, 0-9, or - contain underscores and dashes, with a maximum length of 64. - parameters: - $ref: "#/components/schemas/FunctionParameters" - strict: + deleted: type: boolean - nullable: true - default: false - description: Whether to enable strict schema adherence when generating the - function call. If set to true, the model will follow the exact - schema defined in the `parameters` field. Only a subset of JSON - Schema is supported when `strict` is `true`. Learn more about - Structured Outputs in the [function calling - guide](docs/guides/function-calling). required: - - name - FunctionParameters: - type: object - description: >- - The parameters the functions accepts, described as a JSON Schema object. - See the [guide](/docs/guides/function-calling) for examples, and the - [JSON Schema - reference](https://json-schema.org/understanding-json-schema/) for - documentation about the format. - - - Omitting `parameters` defines a function with an empty parameter list. - additionalProperties: true - Image: + - object + - id + - deleted + ProjectUserListResponse: type: object - description: Represents the url or the content of an image generated by the - OpenAI API. properties: - b64_json: - type: string - description: The base64-encoded JSON of the generated image, if - `response_format` is `b64_json`. - url: - type: string - description: The URL of the generated image, if `response_format` is `url` - (default). - revised_prompt: + object: type: string - description: The prompt that was used to generate the image, if there was any - revision to the prompt. - x-oaiMeta: - name: The image object - example: | - { - "url": "...", - "revised_prompt": "..." - } - ImagesResponse: - properties: - created: - type: integer data: type: array items: - $ref: "#/components/schemas/Image" + $ref: "#/components/schemas/ProjectUser" + first_id: + type: string + last_id: + type: string + has_more: + type: boolean required: - - created + - object - data - Invite: + - first_id + - last_id + - has_more + ProjectUserUpdateRequest: type: object - description: Represents an individual `invite` to the organization. properties: - object: - type: string - enum: - - organization.invite - description: The object type, which is always `organization.invite` - id: - type: string - description: The identifier, which can be referenced in API endpoints - email: - type: string - description: The email address of the individual to whom the invite was sent role: type: string enum: - owner - - reader - description: "`owner` or `reader`" - status: + - member + description: "`owner` or `member`" + required: + - role + RealtimeClientEvent: + discriminator: + propertyName: type + description: | + A realtime client event. + anyOf: + - $ref: "#/components/schemas/RealtimeClientEventConversationItemCreate" + - $ref: "#/components/schemas/RealtimeClientEventConversationItemDelete" + - $ref: "#/components/schemas/RealtimeClientEventConversationItemRetrieve" + - $ref: "#/components/schemas/RealtimeClientEventConversationItemTruncate" + - $ref: "#/components/schemas/RealtimeClientEventInputAudioBufferAppend" + - $ref: "#/components/schemas/RealtimeClientEventInputAudioBufferClear" + - $ref: "#/components/schemas/RealtimeClientEventOutputAudioBufferClear" + - $ref: "#/components/schemas/RealtimeClientEventInputAudioBufferCommit" + - $ref: "#/components/schemas/RealtimeClientEventResponseCancel" + - $ref: "#/components/schemas/RealtimeClientEventResponseCreate" + - $ref: "#/components/schemas/RealtimeClientEventSessionUpdate" + - $ref: "#/components/schemas/RealtimeClientEventTranscriptionSessionUpdate" + RealtimeClientEventConversationItemCreate: + type: object + description: > + Add a new Item to the Conversation's context, including messages, + function + + calls, and function call responses. This event can be used both to + populate a + + "history" of the conversation and to add new items mid-stream, but has + the + + current limitation that it cannot populate assistant audio messages. + + + If successful, the server will respond with a + `conversation.item.created` + + event, otherwise an `error` event will be sent. + properties: + event_id: + type: string + description: Optional client-generated ID used to identify this event. + type: type: string enum: - - accepted - - expired - - pending - description: "`accepted`,`expired`, or `pending`" - invited_at: - type: integer - description: The Unix timestamp (in seconds) of when the invite was sent. - expires_at: - type: integer - description: The Unix timestamp (in seconds) of when the invite expires. - accepted_at: - type: integer - description: The Unix timestamp (in seconds) of when the invite was accepted. + - conversation.item.create + description: The event type, must be `conversation.item.create`. + x-stainless-const: true + previous_item_id: + type: string + description: > + The ID of the preceding item after which the new item will be + inserted. + + If not set, the new item will be appended to the end of the + conversation. + + If set to `root`, the new item will be added to the beginning of the + conversation. + + If set to an existing ID, it allows an item to be inserted + mid-conversation. If the + + ID cannot be found, an error will be returned and the item will not + be added. + item: + $ref: "#/components/schemas/RealtimeConversationItem" required: - - object - - id - - email - - role - - status - - invited_at - - expires_at + - type + - item x-oaiMeta: - name: The invite object + name: conversation.item.create + group: realtime example: | { - "object": "organization.invite", - "id": "invite-abc", - "email": "user@example.com", - "role": "owner", - "status": "accepted", - "invited_at": 1711471533, - "expires_at": 1711471533, - "accepted_at": 1711471533 + "event_id": "event_345", + "type": "conversation.item.create", + "previous_item_id": null, + "item": { + "id": "msg_001", + "type": "message", + "role": "user", + "content": [ + { + "type": "input_text", + "text": "Hello, how are you?" + } + ] + } } - InviteDeleteResponse: + RealtimeClientEventConversationItemDelete: type: object + description: > + Send this event when you want to remove any item from the conversation + + history. The server will respond with a `conversation.item.deleted` + event, + + unless the item does not exist in the conversation history, in which + case the + + server will respond with an error. properties: - object: + event_id: + type: string + description: Optional client-generated ID used to identify this event. + type: type: string enum: - - organization.invite.deleted - description: The object type, which is always `organization.invite.deleted` - id: + - conversation.item.delete + description: The event type, must be `conversation.item.delete`. + x-stainless-const: true + item_id: type: string - deleted: - type: boolean + description: The ID of the item to delete. required: - - object - - id - - deleted - InviteListResponse: + - type + - item_id + x-oaiMeta: + name: conversation.item.delete + group: realtime + example: | + { + "event_id": "event_901", + "type": "conversation.item.delete", + "item_id": "msg_003" + } + RealtimeClientEventConversationItemRetrieve: type: object + description: > + Send this event when you want to retrieve the server's representation of + a specific item in the conversation history. This is useful, for + example, to inspect user audio after noise cancellation and VAD. + + The server will respond with a `conversation.item.retrieved` event, + + unless the item does not exist in the conversation history, in which + case the + + server will respond with an error. properties: - object: + event_id: type: string - enum: - - list - description: The object type, which is always `list` - data: - type: array - items: - $ref: "#/components/schemas/Invite" - first_id: + description: Optional client-generated ID used to identify this event. + type: type: string - description: The first `invite_id` in the retrieved `list` - last_id: + enum: + - conversation.item.retrieve + description: The event type, must be `conversation.item.retrieve`. + x-stainless-const: true + item_id: type: string - description: The last `invite_id` in the retrieved `list` - has_more: - type: boolean - description: The `has_more` property is used for pagination to indicate there - are additional results. + description: The ID of the item to retrieve. required: - - object - - data - InviteRequest: + - type + - item_id + x-oaiMeta: + name: conversation.item.retrieve + group: realtime + example: | + { + "event_id": "event_901", + "type": "conversation.item.retrieve", + "item_id": "msg_003" + } + RealtimeClientEventConversationItemTruncate: type: object + description: > + Send this event to truncate a previous assistant message’s audio. The + server + + will produce audio faster than realtime, so this event is useful when + the user + + interrupts to truncate audio that has already been sent to the client + but not + + yet played. This will synchronize the server's understanding of the + audio with + + the client's playback. + + + Truncating audio will delete the server-side text transcript to ensure + there + + is not text in the context that hasn't been heard by the user. + + + If successful, the server will respond with a + `conversation.item.truncated` + + event. properties: - email: + event_id: type: string - description: Send an email to this address - role: + description: Optional client-generated ID used to identify this event. + type: type: string enum: - - reader - - owner - description: "`owner` or `reader`" + - conversation.item.truncate + description: The event type, must be `conversation.item.truncate`. + x-stainless-const: true + item_id: + type: string + description: > + The ID of the assistant message item to truncate. Only assistant + message + + items can be truncated. + content_index: + type: integer + description: The index of the content part to truncate. Set this to 0. + audio_end_ms: + type: integer + description: > + Inclusive duration up to which audio is truncated, in milliseconds. + If + + the audio_end_ms is greater than the actual audio duration, the + server + + will respond with an error. required: - - email - - role - ListAssistantsResponse: + - type + - item_id + - content_index + - audio_end_ms + x-oaiMeta: + name: conversation.item.truncate + group: realtime + example: | + { + "event_id": "event_678", + "type": "conversation.item.truncate", + "item_id": "msg_002", + "content_index": 0, + "audio_end_ms": 1500 + } + RealtimeClientEventInputAudioBufferAppend: type: object + description: > + Send this event to append audio bytes to the input audio buffer. The + audio + + buffer is temporary storage you can write to and later commit. In Server + VAD + + mode, the audio buffer is used to detect speech and the server will + decide + + when to commit. When Server VAD is disabled, you must commit the audio + buffer + + manually. + + + The client may choose how much audio to place in each event up to a + maximum + + of 15 MiB, for example streaming smaller chunks from the client may + allow the + + VAD to be more responsive. Unlike made other client events, the server + will + + not send a confirmation response to this event. properties: - object: + event_id: type: string - example: list - data: - type: array - items: - $ref: "#/components/schemas/AssistantObject" - first_id: + description: Optional client-generated ID used to identify this event. + type: type: string - example: asst_abc123 - last_id: + enum: + - input_audio_buffer.append + description: The event type, must be `input_audio_buffer.append`. + x-stainless-const: true + audio: type: string - example: asst_abc456 - has_more: - type: boolean - example: false - required: - - object - - data - - first_id - - last_id - - has_more - x-oaiMeta: - name: List assistants response object - group: chat - example: > - { - "object": "list", - "data": [ - { - "id": "asst_abc123", - "object": "assistant", - "created_at": 1698982736, - "name": "Coding Tutor", - "description": null, - "model": "gpt-4o", - "instructions": "You are a helpful assistant designed to make me better at coding!", - "tools": [], - "tool_resources": {}, - "metadata": {}, - "top_p": 1.0, - "temperature": 1.0, - "response_format": "auto" - }, - { - "id": "asst_abc456", - "object": "assistant", - "created_at": 1698982718, - "name": "My Assistant", - "description": null, - "model": "gpt-4o", - "instructions": "You are a helpful assistant designed to make me better at coding!", - "tools": [], - "tool_resources": {}, - "metadata": {}, - "top_p": 1.0, - "temperature": 1.0, - "response_format": "auto" - }, - { - "id": "asst_abc789", - "object": "assistant", - "created_at": 1698982643, - "name": null, - "description": null, - "model": "gpt-4o", - "instructions": null, - "tools": [], - "tool_resources": {}, - "metadata": {}, - "top_p": 1.0, - "temperature": 1.0, - "response_format": "auto" - } - ], - "first_id": "asst_abc123", - "last_id": "asst_abc789", - "has_more": false + description: > + Base64-encoded audio bytes. This must be in the format specified by + the + + `input_audio_format` field in the session configuration. + required: + - type + - audio + x-oaiMeta: + name: input_audio_buffer.append + group: realtime + example: | + { + "event_id": "event_456", + "type": "input_audio_buffer.append", + "audio": "Base64EncodedAudioData" } - ListAuditLogsResponse: + RealtimeClientEventInputAudioBufferClear: type: object + description: | + Send this event to clear the audio bytes in the buffer. The server will + respond with an `input_audio_buffer.cleared` event. properties: - object: + event_id: + type: string + description: Optional client-generated ID used to identify this event. + type: type: string enum: - - list - data: - type: array - items: - $ref: "#/components/schemas/AuditLog" - first_id: + - input_audio_buffer.clear + description: The event type, must be `input_audio_buffer.clear`. + x-stainless-const: true + required: + - type + x-oaiMeta: + name: input_audio_buffer.clear + group: realtime + example: | + { + "event_id": "event_012", + "type": "input_audio_buffer.clear" + } + RealtimeClientEventInputAudioBufferCommit: + type: object + description: > + Send this event to commit the user input audio buffer, which will create + a + + new user message item in the conversation. This event will produce an + error + + if the input audio buffer is empty. When in Server VAD mode, the client + does + + not need to send this event, the server will commit the audio buffer + + automatically. + + + Committing the input audio buffer will trigger input audio + transcription + + (if enabled in session configuration), but it will not create a + response + + from the model. The server will respond with an + `input_audio_buffer.committed` + + event. + properties: + event_id: type: string - example: audit_log-defb456h8dks - last_id: + description: Optional client-generated ID used to identify this event. + type: type: string - example: audit_log-hnbkd8s93s - has_more: - type: boolean + enum: + - input_audio_buffer.commit + description: The event type, must be `input_audio_buffer.commit`. + x-stainless-const: true required: - - object - - data - - first_id - - last_id - - has_more - ListBatchesResponse: + - type + x-oaiMeta: + name: input_audio_buffer.commit + group: realtime + example: | + { + "event_id": "event_789", + "type": "input_audio_buffer.commit" + } + RealtimeClientEventOutputAudioBufferClear: type: object + description: | + **WebRTC Only:** Emit to cut off the current audio response. This will trigger the server to + stop generating audio and emit a `output_audio_buffer.cleared` event. This + event should be preceded by a `response.cancel` client event to stop the + generation of the current response. + [Learn more](/docs/guides/realtime-model-capabilities#client-and-server-events-for-audio-in-webrtc). properties: - data: - type: array - items: - $ref: "#/components/schemas/Batch" - first_id: - type: string - example: batch_abc123 - last_id: + event_id: type: string - example: batch_abc456 - has_more: - type: boolean - object: + description: The unique ID of the client event used for error handling. + type: type: string enum: - - list + - output_audio_buffer.clear + description: The event type, must be `output_audio_buffer.clear`. + x-stainless-const: true required: - - object - - data - - has_more - ListFilesResponse: + - type + x-oaiMeta: + name: output_audio_buffer.clear + group: realtime + example: | + { + "event_id": "optional_client_event_id", + "type": "output_audio_buffer.clear" + } + RealtimeClientEventResponseCancel: type: object + description: > + Send this event to cancel an in-progress response. The server will + respond + + with a `response.cancelled` event or an error if there is no response + to + + cancel. properties: - object: + event_id: type: string - example: list - data: - type: array - items: - $ref: "#/components/schemas/OpenAIFile" - first_id: + description: Optional client-generated ID used to identify this event. + type: type: string - example: file-abc123 - last_id: + enum: + - response.cancel + description: The event type, must be `response.cancel`. + x-stainless-const: true + response_id: type: string - example: file-abc456 - has_more: - type: boolean - example: false + description: | + A specific response ID to cancel - if not provided, will cancel an + in-progress response in the default conversation. required: - - object - - data - - first_id - - last_id - - has_more - ListFineTuningJobCheckpointsResponse: + - type + x-oaiMeta: + name: response.cancel + group: realtime + example: | + { + "event_id": "event_567", + "type": "response.cancel" + } + RealtimeClientEventResponseCreate: type: object + description: > + This event instructs the server to create a Response, which means + triggering + + model inference. When in Server VAD mode, the server will create + Responses + + automatically. + + + A Response will include at least one Item, and may have two, in which + case + + the second will be a function call. These Items will be appended to the + + conversation history. + + + The server will respond with a `response.created` event, events for + Items + + and content created, and finally a `response.done` event to indicate + the + + Response is complete. + + + The `response.create` event includes inference configuration like + + `instructions`, and `temperature`. These fields will override the + Session's + + configuration for this Response only. properties: - data: - type: array - items: - $ref: "#/components/schemas/FineTuningJobCheckpoint" - object: + event_id: + type: string + description: Optional client-generated ID used to identify this event. + type: type: string enum: - - list - first_id: + - response.create + description: The event type, must be `response.create`. + x-stainless-const: true + response: + $ref: "#/components/schemas/RealtimeResponseCreateParams" + required: + - type + x-oaiMeta: + name: response.create + group: realtime + example: | + { + "event_id": "event_234", + "type": "response.create", + "response": { + "modalities": ["text", "audio"], + "instructions": "Please assist the user.", + "voice": "sage", + "output_audio_format": "pcm16", + "tools": [ + { + "type": "function", + "name": "calculate_sum", + "description": "Calculates the sum of two numbers.", + "parameters": { + "type": "object", + "properties": { + "a": { "type": "number" }, + "b": { "type": "number" } + }, + "required": ["a", "b"] + } + } + ], + "tool_choice": "auto", + "temperature": 0.8, + "max_output_tokens": 1024 + } + } + RealtimeClientEventSessionUpdate: + type: object + description: > + Send this event to update the session’s default configuration. + + The client may send this event at any time to update any field, + + except for `voice`. However, note that once a session has been + + initialized with a particular `model`, it can’t be changed to + + another model using `session.update`. + + + When the server receives a `session.update`, it will respond + + with a `session.updated` event showing the full, effective + configuration. + + Only the fields that are present are updated. To clear a field like + + `instructions`, pass an empty string. + properties: + event_id: type: string - nullable: true - last_id: + description: Optional client-generated ID used to identify this event. + type: type: string - nullable: true - has_more: - type: boolean + enum: + - session.update + description: The event type, must be `session.update`. + x-stainless-const: true + session: + $ref: "#/components/schemas/RealtimeSessionCreateRequest" required: - - object - - data - - has_more - ListFineTuningJobEventsResponse: + - type + - session + x-oaiMeta: + name: session.update + group: realtime + example: | + { + "event_id": "event_123", + "type": "session.update", + "session": { + "modalities": ["text", "audio"], + "instructions": "You are a helpful assistant.", + "voice": "sage", + "input_audio_format": "pcm16", + "output_audio_format": "pcm16", + "input_audio_transcription": { + "model": "whisper-1" + }, + "turn_detection": { + "type": "server_vad", + "threshold": 0.5, + "prefix_padding_ms": 300, + "silence_duration_ms": 500, + "create_response": true + }, + "tools": [ + { + "type": "function", + "name": "get_weather", + "description": "Get the current weather...", + "parameters": { + "type": "object", + "properties": { + "location": { "type": "string" } + }, + "required": ["location"] + } + } + ], + "tool_choice": "auto", + "temperature": 0.8, + "max_response_output_tokens": "inf" + } + } + RealtimeClientEventTranscriptionSessionUpdate: type: object + description: | + Send this event to update a transcription session. properties: - data: - type: array - items: - $ref: "#/components/schemas/FineTuningJobEvent" - object: + event_id: + type: string + description: Optional client-generated ID used to identify this event. + type: type: string enum: - - list + - transcription_session.update + description: The event type, must be `transcription_session.update`. + x-stainless-const: true + session: + $ref: "#/components/schemas/RealtimeTranscriptionSessionCreateRequest" required: - - object - - data - ListMessagesResponse: + - type + - session + x-oaiMeta: + name: transcription_session.update + group: realtime + example: | + { + "type": "transcription_session.update", + "session": { + "input_audio_format": "pcm16", + "input_audio_transcription": { + "model": "gpt-4o-transcribe", + "prompt": "", + "language": "" + }, + "turn_detection": { + "type": "server_vad", + "threshold": 0.5, + "prefix_padding_ms": 300, + "silence_duration_ms": 500, + "create_response": true, + }, + "input_audio_noise_reduction": { + "type": "near_field" + }, + "include": [ + "item.input_audio_transcription.logprobs", + ] + } + } + RealtimeConversationItem: + type: object + description: The item to add to the conversation. properties: - object: - type: string - example: list - data: - type: array - items: - $ref: "#/components/schemas/MessageObject" - first_id: + id: type: string - example: msg_abc123 - last_id: + description: > + The unique ID of the item, this can be generated by the client to + help + + manage server-side context, but is not required because the server + will + + generate one if not provided. + type: type: string - example: msg_abc123 - has_more: - type: boolean - example: false - required: - - object - - data - - first_id - - last_id - - has_more - ListModelsResponse: - type: object - properties: + enum: + - message + - function_call + - function_call_output + description: > + The type of the item (`message`, `function_call`, + `function_call_output`). object: type: string enum: - - list - data: - type: array - items: - $ref: "#/components/schemas/Model" - required: - - object - - data - ListPaginatedFineTuningJobsResponse: - type: object - properties: - data: - type: array - items: - $ref: "#/components/schemas/FineTuningJob" - has_more: - type: boolean - object: + - realtime.item + description: > + Identifier for the API object being returned - always + `realtime.item`. + x-stainless-const: true + status: type: string enum: - - list - required: - - object - - data - - has_more - ListRunStepsResponse: - properties: - object: + - completed + - incomplete + description: > + The status of the item (`completed`, `incomplete`). These have no + effect + + on the conversation, but are accepted for consistency with the + + `conversation.item.created` event. + role: type: string - example: list - data: + enum: + - user + - assistant + - system + description: > + The role of the message sender (`user`, `assistant`, `system`), + only + + applicable for `message` items. + content: type: array + description: > + The content of the message, applicable for `message` items. + + - Message items of role `system` support only `input_text` content + + - Message items of role `user` support `input_text` and + `input_audio` + content + - Message items of role `assistant` support `text` content. items: - $ref: "#/components/schemas/RunStepObject" - first_id: + type: object + properties: + type: + type: string + enum: + - input_audio + - input_text + - item_reference + - text + description: > + The content type (`input_text`, `input_audio`, + `item_reference`, `text`). + text: + type: string + description: > + The text content, used for `input_text` and `text` content + types. + id: + type: string + description: > + ID of a previous conversation item to reference (for + `item_reference` + + content types in `response.create` events). These can + reference both + + client and server created items. + audio: + type: string + description: > + Base64-encoded audio bytes, used for `input_audio` content + type. + transcript: + type: string + description: > + The transcript of the audio, used for `input_audio` content + type. + call_id: type: string - example: step_abc123 - last_id: + description: > + The ID of the function call (for `function_call` and + + `function_call_output` items). If passed on a + `function_call_output` + + item, the server will check that a `function_call` item with the + same + + ID exists in the conversation history. + name: type: string - example: step_abc456 - has_more: - type: boolean - example: false - required: - - object - - data - - first_id - - last_id - - has_more - ListRunsResponse: + description: | + The name of the function being called (for `function_call` items). + arguments: + type: string + description: | + The arguments of the function call (for `function_call` items). + output: + type: string + description: | + The output of the function call (for `function_call_output` items). + RealtimeConversationItemWithReference: type: object + description: The item to add to the conversation. properties: + id: + type: string + description: > + For an item of type (`message` | `function_call` | + `function_call_output`) + + this field allows the client to assign the unique ID of the item. It + is + + not required because the server will generate one if not provided. + + + For an item of type `item_reference`, this field is required and is + a + + reference to any item that has previously existed in the + conversation. + type: + type: string + enum: + - message + - function_call + - function_call_output + description: > + The type of the item (`message`, `function_call`, + `function_call_output`, `item_reference`). object: type: string - example: list - data: + enum: + - realtime.item + description: > + Identifier for the API object being returned - always + `realtime.item`. + x-stainless-const: true + status: + type: string + enum: + - completed + - incomplete + description: > + The status of the item (`completed`, `incomplete`). These have no + effect + + on the conversation, but are accepted for consistency with the + + `conversation.item.created` event. + role: + type: string + enum: + - user + - assistant + - system + description: > + The role of the message sender (`user`, `assistant`, `system`), + only + + applicable for `message` items. + content: type: array + description: > + The content of the message, applicable for `message` items. + + - Message items of role `system` support only `input_text` content + + - Message items of role `user` support `input_text` and + `input_audio` + content + - Message items of role `assistant` support `text` content. items: - $ref: "#/components/schemas/RunObject" - first_id: - type: string - example: run_abc123 - last_id: + type: object + properties: + type: + type: string + enum: + - input_audio + - input_text + - item_reference + - text + description: > + The content type (`input_text`, `input_audio`, + `item_reference`, `text`). + text: + type: string + description: > + The text content, used for `input_text` and `text` content + types. + id: + type: string + description: > + ID of a previous conversation item to reference (for + `item_reference` + + content types in `response.create` events). These can + reference both + + client and server created items. + audio: + type: string + description: > + Base64-encoded audio bytes, used for `input_audio` content + type. + transcript: + type: string + description: > + The transcript of the audio, used for `input_audio` content + type. + call_id: type: string - example: run_abc456 - has_more: - type: boolean - example: false - required: - - object - - data - - first_id - - last_id - - has_more - ListThreadsResponse: - properties: - object: + description: > + The ID of the function call (for `function_call` and + + `function_call_output` items). If passed on a + `function_call_output` + + item, the server will check that a `function_call` item with the + same + + ID exists in the conversation history. + name: type: string - example: list - data: - type: array - items: - $ref: "#/components/schemas/ThreadObject" - first_id: + description: | + The name of the function being called (for `function_call` items). + arguments: type: string - example: asst_abc123 - last_id: + description: | + The arguments of the function call (for `function_call` items). + output: type: string - example: asst_abc456 - has_more: - type: boolean - example: false - required: - - object - - data - - first_id - - last_id - - has_more - ListVectorStoreFilesResponse: + description: | + The output of the function call (for `function_call_output` items). + RealtimeResponse: + type: object + description: The response resource. properties: + id: + type: string + description: The unique ID of the response. object: type: string - example: list - data: + enum: + - realtime.response + description: The object type, must be `realtime.response`. + x-stainless-const: true + status: + type: string + enum: + - completed + - cancelled + - failed + - incomplete + description: > + The final status of the response (`completed`, `cancelled`, + `failed`, or + + `incomplete`). + status_details: + type: object + description: Additional details about the status. + properties: + type: + type: string + enum: + - completed + - cancelled + - failed + - incomplete + description: > + The type of error that caused the response to fail, + corresponding + + with the `status` field (`completed`, `cancelled`, + `incomplete`, + + `failed`). + reason: + type: string + enum: + - turn_detected + - client_cancelled + - max_output_tokens + - content_filter + description: > + The reason the Response did not complete. For a `cancelled` + Response, + + one of `turn_detected` (the server VAD detected a new start of + speech) + + or `client_cancelled` (the client sent a cancel event). For an + + `incomplete` Response, one of `max_output_tokens` or + `content_filter` + + (the server-side safety filter activated and cut off the + response). + error: + type: object + description: | + A description of the error that caused the response to fail, + populated when the `status` is `failed`. + properties: + type: + type: string + description: The type of error. + code: + type: string + description: Error code, if any. + output: type: array + description: The list of output items generated by the response. items: - $ref: "#/components/schemas/VectorStoreFileObject" - first_id: + $ref: "#/components/schemas/RealtimeConversationItem" + metadata: + $ref: "#/components/schemas/Metadata" + usage: + type: object + description: > + Usage statistics for the Response, this will correspond to billing. + A + + Realtime API session will maintain a conversation context and append + new + + Items to the Conversation, thus output from previous turns (text + and + + audio tokens) will become the input for later turns. + properties: + total_tokens: + type: integer + description: > + The total number of tokens in the Response including input and + output + + text and audio tokens. + input_tokens: + type: integer + description: > + The number of input tokens used in the Response, including text + and + + audio tokens. + output_tokens: + type: integer + description: > + The number of output tokens sent in the Response, including text + and + + audio tokens. + input_token_details: + type: object + description: Details about the input tokens used in the Response. + properties: + cached_tokens: + type: integer + description: The number of cached tokens used in the Response. + text_tokens: + type: integer + description: The number of text tokens used in the Response. + audio_tokens: + type: integer + description: The number of audio tokens used in the Response. + output_token_details: + type: object + description: Details about the output tokens used in the Response. + properties: + text_tokens: + type: integer + description: The number of text tokens used in the Response. + audio_tokens: + type: integer + description: The number of audio tokens used in the Response. + conversation_id: + description: > + Which conversation the response is added to, determined by the + `conversation` + + field in the `response.create` event. If `auto`, the response will + be added to + + the default conversation and the value of `conversation_id` will be + an id like + + `conv_1234`. If `none`, the response will not be added to any + conversation and + + the value of `conversation_id` will be `null`. If responses are + being triggered + + by server VAD, the response will be added to the default + conversation, thus + + the `conversation_id` will be an id like `conv_1234`. type: string - example: file-abc123 - last_id: + voice: + $ref: "#/components/schemas/VoiceIdsShared" + description: > + The voice the model used to respond. + + Current voice options are `alloy`, `ash`, `ballad`, `coral`, `echo`, + `fable`, + + `onyx`, `nova`, `sage`, `shimmer`, and `verse`. + modalities: + type: array + description: > + The set of modalities the model used to respond. If there are + multiple modalities, + + the model will pick one, for example if `modalities` is `["text", + "audio"]`, the model + + could be responding in either text or audio. + items: + type: string + enum: + - text + - audio + output_audio_format: type: string - example: file-abc456 - has_more: - type: boolean - example: false - required: - - object - - data - - first_id - - last_id - - has_more - ListVectorStoresResponse: + enum: + - pcm16 + - g711_ulaw + - g711_alaw + description: > + The format of output audio. Options are `pcm16`, `g711_ulaw`, or + `g711_alaw`. + temperature: + type: number + description: > + Sampling temperature for the model, limited to [0.6, 1.2]. Defaults + to 0.8. + max_output_tokens: + oneOf: + - type: integer + - type: string + enum: + - inf + x-stainless-const: true + description: | + Maximum number of output tokens for a single assistant response, + inclusive of tool calls, that was used in this response. + RealtimeResponseCreateParams: + type: object + description: Create a new Realtime response with these parameters properties: - object: - type: string - example: list - data: + modalities: type: array + description: | + The set of modalities the model can respond with. To disable audio, + set this to ["text"]. items: - $ref: "#/components/schemas/VectorStoreObject" - first_id: + type: string + enum: + - text + - audio + instructions: type: string - example: vs_abc123 - last_id: + description: > + The default system instructions (i.e. system message) prepended to + model + + calls. This field allows the client to guide the model on desired + + responses. The model can be instructed on response content and + format, + + (e.g. "be extremely succinct", "act friendly", "here are examples of + good + + responses") and on audio behavior (e.g. "talk quickly", "inject + emotion + + into your voice", "laugh frequently"). The instructions are not + guaranteed + + to be followed by the model, but they provide guidance to the model + on the + + desired behavior. + + + Note that the server sets default instructions which will be used if + this + + field is not set and are visible in the `session.created` event at + the + + start of the session. + voice: + $ref: "#/components/schemas/VoiceIdsShared" + description: > + The voice the model uses to respond. Voice cannot be changed during + the + + session once the model has responded with audio at least once. + Current + + voice options are `alloy`, `ash`, `ballad`, `coral`, `echo`, + `fable`, + + `onyx`, `nova`, `sage`, `shimmer`, and `verse`. + output_audio_format: type: string - example: vs_abc456 - has_more: - type: boolean - example: false - required: - - object - - data - - first_id - - last_id - - has_more - MessageContentImageFileObject: - title: Image file - type: object - description: References an image [File](/docs/api-reference/files) in the - content of a message. - properties: - type: - description: Always `image_file`. + enum: + - pcm16 + - g711_ulaw + - g711_alaw + description: > + The format of output audio. Options are `pcm16`, `g711_ulaw`, or + `g711_alaw`. + tools: + type: array + description: Tools (functions) available to the model. + items: + type: object + properties: + type: + type: string + enum: + - function + description: The type of the tool, i.e. `function`. + x-stainless-const: true + name: + type: string + description: The name of the function. + description: + type: string + description: > + The description of the function, including guidance on when + and how + + to call it, and guidance about what to tell the user when + calling + + (if anything). + parameters: + type: object + description: Parameters of the function in JSON Schema. + tool_choice: type: string - enum: - - image_file - image_file: - type: object - properties: - file_id: - description: The [File](/docs/api-reference/files) ID of the image in the - message content. Set `purpose="vision"` when uploading the File - if you need to later display the file content. - type: string - detail: - type: string - description: Specifies the detail level of the image if specified by the user. - `low` uses fewer tokens, you can opt in to high resolution using - `high`. + description: > + How the model chooses tools. Options are `auto`, `none`, `required`, + or + + specify a function, like `{"type": "function", "function": {"name": + "my_function"}}`. + temperature: + type: number + description: > + Sampling temperature for the model, limited to [0.6, 1.2]. Defaults + to 0.8. + max_response_output_tokens: + oneOf: + - type: integer + - type: string enum: - - auto - - low - - high + - inf + x-stainless-const: true + description: | + Maximum number of output tokens for a single assistant response, + inclusive of tool calls. Provide an integer between 1 and 4096 to + limit output tokens, or `inf` for the maximum available tokens for a + given model. Defaults to `inf`. + conversation: + description: > + Controls which conversation the response is added to. Currently + supports + + `auto` and `none`, with `auto` as the default value. The `auto` + value + + means that the contents of the response will be added to the default + + conversation. Set this to `none` to create an out-of-band response + which + + will not add items to default conversation. + oneOf: + - type: string + - type: string default: auto - required: - - file_id - required: - - type - - image_file - MessageContentImageUrlObject: - title: Image URL + enum: + - auto + - none + metadata: + $ref: "#/components/schemas/Metadata" + input: + type: array + description: > + Input items to include in the prompt for the model. Using this field + + creates a new context for this Response instead of using the default + + conversation. An empty array `[]` will clear the context for this + Response. + + Note that this can include references to items from the default + conversation. + items: + $ref: "#/components/schemas/RealtimeConversationItemWithReference" + RealtimeServerEvent: + discriminator: + propertyName: type + description: | + A realtime server event. + anyOf: + - $ref: "#/components/schemas/RealtimeServerEventConversationCreated" + - $ref: "#/components/schemas/RealtimeServerEventConversationItemCreated" + - $ref: "#/components/schemas/RealtimeServerEventConversationItemDeleted" + - $ref: "#/components/schemas/RealtimeServerEventConversationItemInputAudioTransc\ + riptionCompleted" + - $ref: "#/components/schemas/RealtimeServerEventConversationItemInputAudioTransc\ + riptionDelta" + - $ref: "#/components/schemas/RealtimeServerEventConversationItemInputAudioTransc\ + riptionFailed" + - $ref: "#/components/schemas/RealtimeServerEventConversationItemRetrieved" + - $ref: "#/components/schemas/RealtimeServerEventConversationItemTruncated" + - $ref: "#/components/schemas/RealtimeServerEventError" + - $ref: "#/components/schemas/RealtimeServerEventInputAudioBufferCleared" + - $ref: "#/components/schemas/RealtimeServerEventInputAudioBufferCommitted" + - $ref: "#/components/schemas/RealtimeServerEventInputAudioBufferSpeechStarted" + - $ref: "#/components/schemas/RealtimeServerEventInputAudioBufferSpeechStopped" + - $ref: "#/components/schemas/RealtimeServerEventRateLimitsUpdated" + - $ref: "#/components/schemas/RealtimeServerEventResponseAudioDelta" + - $ref: "#/components/schemas/RealtimeServerEventResponseAudioDone" + - $ref: "#/components/schemas/RealtimeServerEventResponseAudioTranscriptDelta" + - $ref: "#/components/schemas/RealtimeServerEventResponseAudioTranscriptDone" + - $ref: "#/components/schemas/RealtimeServerEventResponseContentPartAdded" + - $ref: "#/components/schemas/RealtimeServerEventResponseContentPartDone" + - $ref: "#/components/schemas/RealtimeServerEventResponseCreated" + - $ref: "#/components/schemas/RealtimeServerEventResponseDone" + - $ref: "#/components/schemas/RealtimeServerEventResponseFunctionCallArgumentsDel\ + ta" + - $ref: "#/components/schemas/RealtimeServerEventResponseFunctionCallArgumentsDon\ + e" + - $ref: "#/components/schemas/RealtimeServerEventResponseOutputItemAdded" + - $ref: "#/components/schemas/RealtimeServerEventResponseOutputItemDone" + - $ref: "#/components/schemas/RealtimeServerEventResponseTextDelta" + - $ref: "#/components/schemas/RealtimeServerEventResponseTextDone" + - $ref: "#/components/schemas/RealtimeServerEventSessionCreated" + - $ref: "#/components/schemas/RealtimeServerEventSessionUpdated" + - $ref: "#/components/schemas/RealtimeServerEventTranscriptionSessionUpdated" + - $ref: "#/components/schemas/RealtimeServerEventOutputAudioBufferStarted" + - $ref: "#/components/schemas/RealtimeServerEventOutputAudioBufferStopped" + - $ref: "#/components/schemas/RealtimeServerEventOutputAudioBufferCleared" + RealtimeServerEventConversationCreated: type: object - description: References an image URL in the content of a message. + description: > + Returned when a conversation is created. Emitted right after session + creation. properties: + event_id: + type: string + description: The unique ID of the server event. type: type: string enum: - - image_url - description: The type of the content part. - image_url: + - conversation.created + description: The event type, must be `conversation.created`. + x-stainless-const: true + conversation: type: object + description: The conversation resource. properties: - url: + id: type: string - description: "The external URL of the image, must be a supported image types: - jpeg, jpg, png, gif, webp." - format: uri - detail: + description: The unique ID of the conversation. + object: type: string - description: Specifies the detail level of the image. `low` uses fewer tokens, - you can opt in to high resolution using `high`. Default value is - `auto` - enum: - - auto - - low - - high - default: auto - required: - - url + description: The object type, must be `realtime.conversation`. required: + - event_id - type - - image_url - MessageContentRefusalObject: - title: Refusal + - conversation + x-oaiMeta: + name: conversation.created + group: realtime + example: | + { + "event_id": "event_9101", + "type": "conversation.created", + "conversation": { + "id": "conv_001", + "object": "realtime.conversation" + } + } + RealtimeServerEventConversationItemCreated: type: object - description: The refusal content generated by the assistant. + description: > + Returned when a conversation item is created. There are several + scenarios that produce this event: + - The server is generating a Response, which if successful will produce + either one or two Items, which will be of type `message` + (role `assistant`) or type `function_call`. + - The input audio buffer has been committed, either by the client or the + server (in `server_vad` mode). The server will take the content of the + input audio buffer and add it to a new user message Item. + - The client has sent a `conversation.item.create` event to add a new Item + to the Conversation. properties: + event_id: + type: string + description: The unique ID of the server event. type: - description: Always `refusal`. type: string enum: - - refusal - refusal: + - conversation.item.created + description: The event type, must be `conversation.item.created`. + x-stainless-const: true + previous_item_id: type: string - nullable: false + description: > + The ID of the preceding item in the Conversation context, allows + the + + client to understand the order of the conversation. + item: + $ref: "#/components/schemas/RealtimeConversationItem" required: + - event_id - type - - refusal - MessageContentTextAnnotationsFileCitationObject: - title: File citation + - previous_item_id + - item + x-oaiMeta: + name: conversation.item.created + group: realtime + example: | + { + "event_id": "event_1920", + "type": "conversation.item.created", + "previous_item_id": "msg_002", + "item": { + "id": "msg_003", + "object": "realtime.item", + "type": "message", + "status": "completed", + "role": "user", + "content": [] + } + } + RealtimeServerEventConversationItemDeleted: type: object - description: A citation within the message that points to a specific quote from - a specific File associated with the assistant or the message. Generated - when the assistant uses the "file_search" tool to search files. + description: > + Returned when an item in the conversation is deleted by the client with + a + + `conversation.item.delete` event. This event is used to synchronize the + + server's understanding of the conversation history with the client's + view. properties: + event_id: + type: string + description: The unique ID of the server event. type: - description: Always `file_citation`. type: string enum: - - file_citation - text: - description: The text in the message content that needs to be replaced. + - conversation.item.deleted + description: The event type, must be `conversation.item.deleted`. + x-stainless-const: true + item_id: type: string - file_citation: - type: object - properties: - file_id: - description: The ID of the specific File the citation is from. - type: string - required: - - file_id - start_index: - type: integer - minimum: 0 - end_index: - type: integer - minimum: 0 + description: The ID of the item that was deleted. required: + - event_id - type - - text - - file_citation - - start_index - - end_index - MessageContentTextAnnotationsFilePathObject: - title: File path + - item_id + x-oaiMeta: + name: conversation.item.deleted + group: realtime + example: | + { + "event_id": "event_2728", + "type": "conversation.item.deleted", + "item_id": "msg_005" + } + RealtimeServerEventConversationItemInputAudioTranscriptionCompleted: type: object - description: A URL for the file that's generated when the assistant used the - `code_interpreter` tool to generate a file. + description: > + This event is the output of audio transcription for user audio written + to the + + user audio buffer. Transcription begins when the input audio buffer is + + committed by the client or server (in `server_vad` mode). Transcription + runs + + asynchronously with Response creation, so this event may come before or + after + + the Response events. + + + Realtime API models accept audio natively, and thus input transcription + is a + + separate process run on a separate ASR (Automatic Speech Recognition) + model, + + currently always `whisper-1`. Thus the transcript may diverge somewhat + from + + the model's interpretation, and should be treated as a rough guide. properties: - type: - description: Always `file_path`. - type: string - enum: - - file_path - text: - description: The text in the message content that needs to be replaced. - type: string - file_path: - type: object - properties: - file_id: - description: The ID of the file that was generated. - type: string - required: - - file_id - start_index: - type: integer - minimum: 0 - end_index: + event_id: + type: string + description: The unique ID of the server event. + type: + type: string + enum: + - conversation.item.input_audio_transcription.completed + description: | + The event type, must be + `conversation.item.input_audio_transcription.completed`. + x-stainless-const: true + item_id: + type: string + description: The ID of the user message item containing the audio. + content_index: type: integer - minimum: 0 + description: The index of the content part containing the audio. + transcript: + type: string + description: The transcribed text. + logprobs: + type: array + description: The log probabilities of the transcription. + nullable: true + items: + $ref: "#/components/schemas/LogProbProperties" required: + - event_id - type - - text - - file_path - - start_index - - end_index - MessageContentTextObject: - title: Text + - item_id + - content_index + - transcript + x-oaiMeta: + name: conversation.item.input_audio_transcription.completed + group: realtime + example: | + { + "event_id": "event_2122", + "type": "conversation.item.input_audio_transcription.completed", + "item_id": "msg_003", + "content_index": 0, + "transcript": "Hello, how are you?" + } + RealtimeServerEventConversationItemInputAudioTranscriptionDelta: type: object - description: The text content that is part of a message. + description: > + Returned when the text value of an input audio transcription content + part is updated. properties: + event_id: + type: string + description: The unique ID of the server event. type: - description: Always `text`. type: string enum: - - text - text: - type: object - properties: - value: - description: The data that makes up the text. - type: string - annotations: - type: array - items: - oneOf: - - $ref: "#/components/schemas/MessageContentTextAnnotationsFileCitationObject" - - $ref: "#/components/schemas/MessageContentTextAnnotationsFilePathObject" - x-oaiExpandable: true - required: - - value - - annotations + - conversation.item.input_audio_transcription.delta + description: The event type, must be + `conversation.item.input_audio_transcription.delta`. + x-stainless-const: true + item_id: + type: string + description: The ID of the item. + content_index: + type: integer + description: The index of the content part in the item's content array. + delta: + type: string + description: The text delta. + logprobs: + type: array + description: The log probabilities of the transcription. + nullable: true + items: + $ref: "#/components/schemas/LogProbProperties" required: + - event_id - type - - text - MessageDeltaContentImageFileObject: - title: Image file + - item_id + x-oaiMeta: + name: conversation.item.input_audio_transcription.delta + group: realtime + example: | + { + "type": "conversation.item.input_audio_transcription.delta", + "event_id": "event_001", + "item_id": "item_001", + "content_index": 0, + "delta": "Hello" + } + RealtimeServerEventConversationItemInputAudioTranscriptionFailed: type: object - description: References an image [File](/docs/api-reference/files) in the - content of a message. + description: > + Returned when input audio transcription is configured, and a + transcription + + request for a user message failed. These events are separate from other + + `error` events so that the client can identify the related Item. properties: - index: - type: integer - description: The index of the content part in the message. + event_id: + type: string + description: The unique ID of the server event. type: - description: Always `image_file`. type: string enum: - - image_file - image_file: + - conversation.item.input_audio_transcription.failed + description: | + The event type, must be + `conversation.item.input_audio_transcription.failed`. + x-stainless-const: true + item_id: + type: string + description: The ID of the user message item. + content_index: + type: integer + description: The index of the content part containing the audio. + error: type: object + description: Details of the transcription error. properties: - file_id: - description: The [File](/docs/api-reference/files) ID of the image in the - message content. Set `purpose="vision"` when uploading the File - if you need to later display the file content. + type: type: string - detail: + description: The type of error. + code: type: string - description: Specifies the detail level of the image if specified by the user. - `low` uses fewer tokens, you can opt in to high resolution using - `high`. - enum: - - auto - - low - - high - default: auto + description: Error code, if any. + message: + type: string + description: A human-readable error message. + param: + type: string + description: Parameter related to the error, if any. required: - - index + - event_id - type - MessageDeltaContentImageUrlObject: - title: Image URL + - item_id + - content_index + - error + x-oaiMeta: + name: conversation.item.input_audio_transcription.failed + group: realtime + example: | + { + "event_id": "event_2324", + "type": "conversation.item.input_audio_transcription.failed", + "item_id": "msg_003", + "content_index": 0, + "error": { + "type": "transcription_error", + "code": "audio_unintelligible", + "message": "The audio could not be transcribed.", + "param": null + } + } + RealtimeServerEventConversationItemRetrieved: type: object - description: References an image URL in the content of a message. + description: > + Returned when a conversation item is retrieved with + `conversation.item.retrieve`. properties: - index: - type: integer - description: The index of the content part in the message. + event_id: + type: string + description: The unique ID of the server event. type: - description: Always `image_url`. type: string enum: - - image_url - image_url: - type: object - properties: - url: - description: "The URL of the image, must be a supported image types: jpeg, jpg, - png, gif, webp." - type: string - detail: - type: string - description: Specifies the detail level of the image. `low` uses fewer tokens, - you can opt in to high resolution using `high`. - enum: - - auto - - low - - high - default: auto + - conversation.item.retrieved + description: The event type, must be `conversation.item.retrieved`. + x-stainless-const: true + item: + $ref: "#/components/schemas/RealtimeConversationItem" required: - - index + - event_id - type - MessageDeltaContentRefusalObject: - title: Refusal + - item + x-oaiMeta: + name: conversation.item.retrieved + group: realtime + example: | + { + "event_id": "event_1920", + "type": "conversation.item.created", + "previous_item_id": "msg_002", + "item": { + "id": "msg_003", + "object": "realtime.item", + "type": "message", + "status": "completed", + "role": "user", + "content": [ + { + "type": "input_audio", + "transcript": "hello how are you", + "audio": "base64encodedaudio==" + } + ] + } + } + RealtimeServerEventConversationItemTruncated: type: object - description: The refusal content that is part of a message. + description: > + Returned when an earlier assistant audio message item is truncated by + the + + client with a `conversation.item.truncate` event. This event is used to + + synchronize the server's understanding of the audio with the client's + playback. + + + This action will truncate the audio and remove the server-side text + transcript + + to ensure there is no text in the context that hasn't been heard by the + user. properties: - index: - type: integer - description: The index of the refusal part in the message. + event_id: + type: string + description: The unique ID of the server event. type: - description: Always `refusal`. type: string enum: - - refusal - refusal: + - conversation.item.truncated + description: The event type, must be `conversation.item.truncated`. + x-stainless-const: true + item_id: type: string + description: The ID of the assistant message item that was truncated. + content_index: + type: integer + description: The index of the content part that was truncated. + audio_end_ms: + type: integer + description: | + The duration up to which the audio was truncated, in milliseconds. required: - - index + - event_id - type - MessageDeltaContentTextAnnotationsFileCitationObject: - title: File citation + - item_id + - content_index + - audio_end_ms + x-oaiMeta: + name: conversation.item.truncated + group: realtime + example: | + { + "event_id": "event_2526", + "type": "conversation.item.truncated", + "item_id": "msg_004", + "content_index": 0, + "audio_end_ms": 1500 + } + RealtimeServerEventError: type: object - description: A citation within the message that points to a specific quote from - a specific File associated with the assistant or the message. Generated - when the assistant uses the "file_search" tool to search files. + description: > + Returned when an error occurs, which could be a client problem or a + server + + problem. Most errors are recoverable and the session will stay open, we + + recommend to implementors to monitor and log error messages by default. properties: - index: - type: integer - description: The index of the annotation in the text content part. + event_id: + type: string + description: The unique ID of the server event. type: - description: Always `file_citation`. type: string enum: - - file_citation - text: - description: The text in the message content that needs to be replaced. - type: string - file_citation: + - error + description: The event type, must be `error`. + x-stainless-const: true + error: type: object + description: Details of the error. + required: + - type + - message properties: - file_id: - description: The ID of the specific File the citation is from. + type: type: string - quote: - description: The specific quote in the file. + description: > + The type of error (e.g., "invalid_request_error", + "server_error"). + code: type: string - start_index: - type: integer - minimum: 0 - end_index: - type: integer - minimum: 0 + description: Error code, if any. + nullable: true + message: + type: string + description: A human-readable error message. + param: + type: string + description: Parameter related to the error, if any. + nullable: true + event_id: + type: string + description: > + The event_id of the client event that caused the error, if + applicable. + nullable: true required: - - index + - event_id - type - MessageDeltaContentTextAnnotationsFilePathObject: - title: File path + - error + x-oaiMeta: + name: error + group: realtime + example: | + { + "event_id": "event_890", + "type": "error", + "error": { + "type": "invalid_request_error", + "code": "invalid_event", + "message": "The 'type' field is missing.", + "param": null, + "event_id": "event_567" + } + } + RealtimeServerEventInputAudioBufferCleared: type: object - description: A URL for the file that's generated when the assistant used the - `code_interpreter` tool to generate a file. + description: | + Returned when the input audio buffer is cleared by the client with a + `input_audio_buffer.clear` event. properties: - index: - type: integer - description: The index of the annotation in the text content part. + event_id: + type: string + description: The unique ID of the server event. type: - description: Always `file_path`. type: string enum: - - file_path - text: - description: The text in the message content that needs to be replaced. - type: string - file_path: - type: object - properties: - file_id: - description: The ID of the file that was generated. - type: string - start_index: - type: integer - minimum: 0 - end_index: - type: integer - minimum: 0 + - input_audio_buffer.cleared + description: The event type, must be `input_audio_buffer.cleared`. + x-stainless-const: true required: - - index + - event_id - type - MessageDeltaContentTextObject: - title: Text + x-oaiMeta: + name: input_audio_buffer.cleared + group: realtime + example: | + { + "event_id": "event_1314", + "type": "input_audio_buffer.cleared" + } + RealtimeServerEventInputAudioBufferCommitted: type: object - description: The text content that is part of a message. + description: > + Returned when an input audio buffer is committed, either by the client + or + + automatically in server VAD mode. The `item_id` property is the ID of + the user + + message item that will be created, thus a `conversation.item.created` + event + + will also be sent to the client. properties: - index: - type: integer - description: The index of the content part in the message. + event_id: + type: string + description: The unique ID of the server event. type: - description: Always `text`. type: string enum: - - text - text: - type: object - properties: - value: - description: The data that makes up the text. - type: string - annotations: - type: array - items: - oneOf: - - $ref: "#/components/schemas/MessageDeltaContentTextAnnotationsFileCitationObjec\ - t" - - $ref: "#/components/schemas/MessageDeltaContentTextAnnotationsFilePathObject" - x-oaiExpandable: true + - input_audio_buffer.committed + description: The event type, must be `input_audio_buffer.committed`. + x-stainless-const: true + previous_item_id: + type: string + description: > + The ID of the preceding item after which the new item will be + inserted. + item_id: + type: string + description: The ID of the user message item that will be created. required: - - index + - event_id - type - MessageDeltaObject: + - previous_item_id + - item_id + x-oaiMeta: + name: input_audio_buffer.committed + group: realtime + example: | + { + "event_id": "event_1121", + "type": "input_audio_buffer.committed", + "previous_item_id": "msg_001", + "item_id": "msg_002" + } + RealtimeServerEventInputAudioBufferSpeechStarted: type: object - title: Message delta object description: > - Represents a message delta i.e. any changed fields on a message during - streaming. + Sent by the server when in `server_vad` mode to indicate that speech has + been + + detected in the audio buffer. This can happen any time audio is added to + the + + buffer (unless speech is already detected). The client may want to use + this + + event to interrupt audio playback or provide visual feedback to the + user. + + + The client should expect to receive a + `input_audio_buffer.speech_stopped` event + + when speech stops. The `item_id` property is the ID of the user message + item + + that will be created when speech stops and will also be included in the + + `input_audio_buffer.speech_stopped` event (unless the client manually + commits + + the audio buffer during VAD activation). properties: - id: - description: The identifier of the message, which can be referenced in API - endpoints. + event_id: type: string - object: - description: The object type, which is always `thread.message.delta`. + description: The unique ID of the server event. + type: type: string enum: - - thread.message.delta - delta: - description: The delta containing the fields that have changed on the Message. - type: object - properties: - role: - description: The entity that produced the message. One of `user` or `assistant`. - type: string - enum: - - user - - assistant - content: - description: The content of the message in array of text and/or images. - type: array - items: - oneOf: - - $ref: "#/components/schemas/MessageDeltaContentImageFileObject" - - $ref: "#/components/schemas/MessageDeltaContentTextObject" - - $ref: "#/components/schemas/MessageDeltaContentRefusalObject" - - $ref: "#/components/schemas/MessageDeltaContentImageUrlObject" - x-oaiExpandable: true + - input_audio_buffer.speech_started + description: The event type, must be `input_audio_buffer.speech_started`. + x-stainless-const: true + audio_start_ms: + type: integer + description: > + Milliseconds from the start of all audio written to the buffer + during the + + session when speech was first detected. This will correspond to the + + beginning of audio sent to the model, and thus includes the + + `prefix_padding_ms` configured in the Session. + item_id: + type: string + description: > + The ID of the user message item that will be created when speech + stops. required: - - id - - object - - delta + - event_id + - type + - audio_start_ms + - item_id x-oaiMeta: - name: The message delta object - beta: true + name: input_audio_buffer.speech_started + group: realtime example: | { - "id": "msg_123", - "object": "thread.message.delta", - "delta": { - "content": [ - { - "index": 0, - "type": "text", - "text": { "value": "Hello", "annotations": [] } - } - ] - } + "event_id": "event_1516", + "type": "input_audio_buffer.speech_started", + "audio_start_ms": 1000, + "item_id": "msg_003" } - MessageObject: + RealtimeServerEventInputAudioBufferSpeechStopped: type: object - title: The message object - description: Represents a message within a [thread](/docs/api-reference/threads). + description: > + Returned in `server_vad` mode when the server detects the end of speech + in + + the audio buffer. The server will also send an + `conversation.item.created` + + event with the user message item that is created from the audio buffer. properties: - id: - description: The identifier, which can be referenced in API endpoints. + event_id: type: string - object: - description: The object type, which is always `thread.message`. + description: The unique ID of the server event. + type: type: string enum: - - thread.message - created_at: - description: The Unix timestamp (in seconds) for when the message was created. + - input_audio_buffer.speech_stopped + description: The event type, must be `input_audio_buffer.speech_stopped`. + x-stainless-const: true + audio_end_ms: type: integer - thread_id: - description: The [thread](/docs/api-reference/threads) ID that this message - belongs to. + description: > + Milliseconds since the session started when speech stopped. This + will + + correspond to the end of audio sent to the model, and thus includes + the + + `min_silence_duration_ms` configured in the Session. + item_id: type: string - status: - description: The status of the message, which can be either `in_progress`, - `incomplete`, or `completed`. + description: The ID of the user message item that will be created. + required: + - event_id + - type + - audio_end_ms + - item_id + x-oaiMeta: + name: input_audio_buffer.speech_stopped + group: realtime + example: | + { + "event_id": "event_1718", + "type": "input_audio_buffer.speech_stopped", + "audio_end_ms": 2000, + "item_id": "msg_003" + } + RealtimeServerEventOutputAudioBufferCleared: + type: object + description: | + **WebRTC Only:** Emitted when the output audio buffer is cleared. This happens either in VAD + mode when the user has interrupted (`input_audio_buffer.speech_started`), + or when the client has emitted the `output_audio_buffer.clear` event to manually + cut off the current audio response. + [Learn more](/docs/guides/realtime-model-capabilities#client-and-server-events-for-audio-in-webrtc). + properties: + event_id: type: string - enum: - - in_progress - - incomplete - - completed - incomplete_details: - description: On an incomplete message, details about why the message is - incomplete. - type: object - properties: - reason: - type: string - description: The reason the message is incomplete. - enum: - - content_filter - - max_tokens - - run_cancelled - - run_expired - - run_failed - nullable: true - required: - - reason - completed_at: - description: The Unix timestamp (in seconds) for when the message was completed. - type: integer - nullable: true - incomplete_at: - description: The Unix timestamp (in seconds) for when the message was marked as - incomplete. - type: integer - nullable: true - role: - description: The entity that produced the message. One of `user` or `assistant`. + description: The unique ID of the server event. + type: type: string enum: - - user - - assistant - content: - description: The content of the message in array of text and/or images. - type: array - items: - oneOf: - - $ref: "#/components/schemas/MessageContentImageFileObject" - - $ref: "#/components/schemas/MessageContentImageUrlObject" - - $ref: "#/components/schemas/MessageContentTextObject" - - $ref: "#/components/schemas/MessageContentRefusalObject" - x-oaiExpandable: true - assistant_id: - description: If applicable, the ID of the - [assistant](/docs/api-reference/assistants) that authored this - message. - type: string - nullable: true - run_id: - description: The ID of the [run](/docs/api-reference/runs) associated with the - creation of this message. Value is `null` when messages are created - manually using the create message or create thread endpoints. + - output_audio_buffer.cleared + description: The event type, must be `output_audio_buffer.cleared`. + x-stainless-const: true + response_id: type: string - nullable: true - attachments: - type: array - items: - type: object - properties: - file_id: - type: string - description: The ID of the file to attach to the message. - tools: - description: The tools to add this file to. - type: array - items: - oneOf: - - $ref: "#/components/schemas/AssistantToolsCode" - - $ref: "#/components/schemas/AssistantToolsFileSearchTypeOnly" - x-oaiExpandable: true - description: A list of files attached to the message, and the tools they were - added to. - nullable: true - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true + description: The unique ID of the response that produced the audio. required: - - id - - object - - created_at - - thread_id - - status - - incomplete_details - - completed_at - - incomplete_at - - role - - content - - assistant_id - - run_id - - attachments - - metadata + - event_id + - type + - response_id x-oaiMeta: - name: The message object - beta: true + name: output_audio_buffer.cleared + group: realtime example: | { - "id": "msg_abc123", - "object": "thread.message", - "created_at": 1698983503, - "thread_id": "thread_abc123", - "role": "assistant", - "content": [ - { - "type": "text", - "text": { - "value": "Hi! How can I help you today?", - "annotations": [] - } - } - ], - "assistant_id": "asst_abc123", - "run_id": "run_abc123", - "attachments": [], - "metadata": {} + "event_id": "event_abc123", + "type": "output_audio_buffer.cleared", + "response_id": "resp_abc123" } - MessageRequestContentTextObject: - title: Text + RealtimeServerEventOutputAudioBufferStarted: type: object - description: The text content that is part of a message. + description: | + **WebRTC Only:** Emitted when the server begins streaming audio to the client. This event is + emitted after an audio content part has been added (`response.content_part.added`) + to the response. + [Learn more](/docs/guides/realtime-model-capabilities#client-and-server-events-for-audio-in-webrtc). properties: + event_id: + type: string + description: The unique ID of the server event. type: - description: Always `text`. type: string enum: - - text - text: + - output_audio_buffer.started + description: The event type, must be `output_audio_buffer.started`. + x-stainless-const: true + response_id: type: string - description: Text content to be sent to the model + description: The unique ID of the response that produced the audio. required: + - event_id - type - - text - MessageStreamEvent: - oneOf: - - type: object - properties: - event: - type: string - enum: - - thread.message.created - data: - $ref: "#/components/schemas/MessageObject" - required: - - event - - data - description: Occurs when a [message](/docs/api-reference/messages/object) is - created. - x-oaiMeta: - dataDescription: "`data` is a [message](/docs/api-reference/messages/object)" - - type: object - properties: - event: - type: string - enum: - - thread.message.in_progress - data: - $ref: "#/components/schemas/MessageObject" - required: - - event - - data - description: Occurs when a [message](/docs/api-reference/messages/object) moves - to an `in_progress` state. - x-oaiMeta: - dataDescription: "`data` is a [message](/docs/api-reference/messages/object)" - - type: object - properties: - event: - type: string - enum: - - thread.message.delta - data: - $ref: "#/components/schemas/MessageDeltaObject" - required: - - event - - data - description: Occurs when parts of a - [Message](/docs/api-reference/messages/object) are being streamed. - x-oaiMeta: - dataDescription: "`data` is a [message - delta](/docs/api-reference/assistants-streaming/message-delta-obj\ - ect)" - - type: object - properties: - event: - type: string - enum: - - thread.message.completed - data: - $ref: "#/components/schemas/MessageObject" - required: - - event - - data - description: Occurs when a [message](/docs/api-reference/messages/object) is - completed. - x-oaiMeta: - dataDescription: "`data` is a [message](/docs/api-reference/messages/object)" - - type: object - properties: - event: - type: string - enum: - - thread.message.incomplete - data: - $ref: "#/components/schemas/MessageObject" - required: - - event - - data - description: Occurs when a [message](/docs/api-reference/messages/object) ends - before it is completed. - x-oaiMeta: - dataDescription: "`data` is a [message](/docs/api-reference/messages/object)" - Model: - title: Model - description: Describes an OpenAI model offering that can be used with the API. + - response_id + x-oaiMeta: + name: output_audio_buffer.started + group: realtime + example: | + { + "event_id": "event_abc123", + "type": "output_audio_buffer.started", + "response_id": "resp_abc123" + } + RealtimeServerEventOutputAudioBufferStopped: + type: object + description: | + **WebRTC Only:** Emitted when the output audio buffer has been completely drained on the server, + and no more audio is forthcoming. This event is emitted after the full response + data has been sent to the client (`response.done`). + [Learn more](/docs/guides/realtime-model-capabilities#client-and-server-events-for-audio-in-webrtc). properties: - id: + event_id: type: string - description: The model identifier, which can be referenced in the API endpoints. - created: - type: integer - description: The Unix timestamp (in seconds) when the model was created. - object: + description: The unique ID of the server event. + type: type: string - description: The object type, which is always "model". enum: - - model - owned_by: + - output_audio_buffer.stopped + description: The event type, must be `output_audio_buffer.stopped`. + x-stainless-const: true + response_id: type: string - description: The organization that owns the model. + description: The unique ID of the response that produced the audio. required: - - id - - object - - created - - owned_by + - event_id + - type + - response_id x-oaiMeta: - name: The model object + name: output_audio_buffer.stopped + group: realtime example: | { - "id": "VAR_model_id", - "object": "model", - "created": 1686935002, - "owned_by": "openai" + "event_id": "event_abc123", + "type": "output_audio_buffer.stopped", + "response_id": "resp_abc123" } - ModifyAssistantRequest: + RealtimeServerEventRateLimitsUpdated: type: object - additionalProperties: false + description: > + Emitted at the beginning of a Response to indicate the updated rate + limits. + + When a Response is created some tokens will be "reserved" for the + output + + tokens, the rate limits shown here reflect that reservation, which is + then + + adjusted accordingly once the Response is completed. properties: - model: - description: > - ID of the model to use. You can use the [List - models](/docs/api-reference/models/list) API to see all of your - available models, or see our [Model overview](/docs/models) for - descriptions of them. - anyOf: - - type: string - name: - description: | - The name of the assistant. The maximum length is 256 characters. - type: string - nullable: true - maxLength: 256 - description: - description: > - The description of the assistant. The maximum length is 512 - characters. + event_id: type: string - nullable: true - maxLength: 512 - instructions: - description: > - The system instructions that the assistant uses. The maximum length - is 256,000 characters. + description: The unique ID of the server event. + type: type: string - nullable: true - maxLength: 256000 - tools: - description: > - A list of tool enabled on the assistant. There can be a maximum of - 128 tools per assistant. Tools can be of types `code_interpreter`, - `file_search`, or `function`. - default: [] + enum: + - rate_limits.updated + description: The event type, must be `rate_limits.updated`. + x-stainless-const: true + rate_limits: type: array - maxItems: 128 + description: List of rate limit information. items: - oneOf: - - $ref: "#/components/schemas/AssistantToolsCode" - - $ref: "#/components/schemas/AssistantToolsFileSearch" - - $ref: "#/components/schemas/AssistantToolsFunction" - x-oaiExpandable: true - tool_resources: - type: object - description: > - A set of resources that are used by the assistant's tools. The - resources are specific to the type of tool. For example, the - `code_interpreter` tool requires a list of file IDs, while the - `file_search` tool requires a list of vector store IDs. - properties: - code_interpreter: - type: object - properties: - file_ids: - type: array - description: > - Overrides the list of [file](/docs/api-reference/files) IDs - made available to the `code_interpreter` tool. There can be - a maximum of 20 files associated with the tool. - default: [] - maxItems: 20 - items: - type: string - file_search: - type: object - properties: - vector_store_ids: - type: array - description: > - Overrides the [vector - store](/docs/api-reference/vector-stores/object) attached to - this assistant. There can be a maximum of 1 vector store - attached to the assistant. - maxItems: 1 - items: - type: string - nullable: true - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true - temperature: - description: > - What sampling temperature to use, between 0 and 2. Higher values - like 0.8 will make the output more random, while lower values like - 0.2 will make it more focused and deterministic. - type: number - minimum: 0 - maximum: 2 - default: 1 - example: 1 - nullable: true - top_p: - type: number - minimum: 0 - maximum: 1 - default: 1 - example: 1 - nullable: true - description: > - An alternative to sampling with temperature, called nucleus - sampling, where the model considers the results of the tokens with - top_p probability mass. So 0.1 means only the tokens comprising the - top 10% probability mass are considered. - - - We generally recommend altering this or temperature but not both. - response_format: - $ref: "#/components/schemas/AssistantsApiResponseFormatOption" - nullable: true - ModifyMessageRequest: + type: object + properties: + name: + type: string + enum: + - requests + - tokens + description: | + The name of the rate limit (`requests`, `tokens`). + limit: + type: integer + description: The maximum allowed value for the rate limit. + remaining: + type: integer + description: The remaining value before the limit is reached. + reset_seconds: + type: number + description: Seconds until the rate limit resets. + required: + - event_id + - type + - rate_limits + x-oaiMeta: + name: rate_limits.updated + group: realtime + example: | + { + "event_id": "event_5758", + "type": "rate_limits.updated", + "rate_limits": [ + { + "name": "requests", + "limit": 1000, + "remaining": 999, + "reset_seconds": 60 + }, + { + "name": "tokens", + "limit": 50000, + "remaining": 49950, + "reset_seconds": 60 + } + ] + } + RealtimeServerEventResponseAudioDelta: type: object - additionalProperties: false + description: Returned when the model-generated audio is updated. properties: - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true - ModifyRunRequest: + event_id: + type: string + description: The unique ID of the server event. + type: + type: string + enum: + - response.audio.delta + description: The event type, must be `response.audio.delta`. + x-stainless-const: true + response_id: + type: string + description: The ID of the response. + item_id: + type: string + description: The ID of the item. + output_index: + type: integer + description: The index of the output item in the response. + content_index: + type: integer + description: The index of the content part in the item's content array. + delta: + type: string + description: Base64-encoded audio data delta. + required: + - event_id + - type + - response_id + - item_id + - output_index + - content_index + - delta + x-oaiMeta: + name: response.audio.delta + group: realtime + example: | + { + "event_id": "event_4950", + "type": "response.audio.delta", + "response_id": "resp_001", + "item_id": "msg_008", + "output_index": 0, + "content_index": 0, + "delta": "Base64EncodedAudioDelta" + } + RealtimeServerEventResponseAudioDone: + type: object + description: > + Returned when the model-generated audio is done. Also emitted when a + Response + + is interrupted, incomplete, or cancelled. + properties: + event_id: + type: string + description: The unique ID of the server event. + type: + type: string + enum: + - response.audio.done + description: The event type, must be `response.audio.done`. + x-stainless-const: true + response_id: + type: string + description: The ID of the response. + item_id: + type: string + description: The ID of the item. + output_index: + type: integer + description: The index of the output item in the response. + content_index: + type: integer + description: The index of the content part in the item's content array. + required: + - event_id + - type + - response_id + - item_id + - output_index + - content_index + x-oaiMeta: + name: response.audio.done + group: realtime + example: | + { + "event_id": "event_5152", + "type": "response.audio.done", + "response_id": "resp_001", + "item_id": "msg_008", + "output_index": 0, + "content_index": 0 + } + RealtimeServerEventResponseAudioTranscriptDelta: type: object - additionalProperties: false + description: > + Returned when the model-generated transcription of audio output is + updated. properties: - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true - ModifyThreadRequest: + event_id: + type: string + description: The unique ID of the server event. + type: + type: string + enum: + - response.audio_transcript.delta + description: The event type, must be `response.audio_transcript.delta`. + x-stainless-const: true + response_id: + type: string + description: The ID of the response. + item_id: + type: string + description: The ID of the item. + output_index: + type: integer + description: The index of the output item in the response. + content_index: + type: integer + description: The index of the content part in the item's content array. + delta: + type: string + description: The transcript delta. + required: + - event_id + - type + - response_id + - item_id + - output_index + - content_index + - delta + x-oaiMeta: + name: response.audio_transcript.delta + group: realtime + example: | + { + "event_id": "event_4546", + "type": "response.audio_transcript.delta", + "response_id": "resp_001", + "item_id": "msg_008", + "output_index": 0, + "content_index": 0, + "delta": "Hello, how can I a" + } + RealtimeServerEventResponseAudioTranscriptDone: type: object - additionalProperties: false - properties: - tool_resources: - type: object - description: > - A set of resources that are made available to the assistant's tools - in this thread. The resources are specific to the type of tool. For - example, the `code_interpreter` tool requires a list of file IDs, - while the `file_search` tool requires a list of vector store IDs. - properties: - code_interpreter: - type: object - properties: - file_ids: - type: array - description: > - A list of [file](/docs/api-reference/files) IDs made - available to the `code_interpreter` tool. There can be a - maximum of 20 files associated with the tool. - default: [] - maxItems: 20 - items: - type: string - file_search: - type: object - properties: - vector_store_ids: - type: array - description: > - The [vector store](/docs/api-reference/vector-stores/object) - attached to this thread. There can be a maximum of 1 vector - store attached to the thread. - maxItems: 1 - items: - type: string - nullable: true - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true - OpenAIFile: - title: OpenAIFile - description: The `File` object represents a document that has been uploaded to OpenAI. + description: | + Returned when the model-generated transcription of audio output is done + streaming. Also emitted when a Response is interrupted, incomplete, or + cancelled. properties: - id: + event_id: type: string - description: The file identifier, which can be referenced in the API endpoints. - bytes: + description: The unique ID of the server event. + type: + type: string + enum: + - response.audio_transcript.done + description: The event type, must be `response.audio_transcript.done`. + x-stainless-const: true + response_id: + type: string + description: The ID of the response. + item_id: + type: string + description: The ID of the item. + output_index: type: integer - description: The size of the file, in bytes. - created_at: + description: The index of the output item in the response. + content_index: type: integer - description: The Unix timestamp (in seconds) for when the file was created. - filename: + description: The index of the content part in the item's content array. + transcript: type: string - description: The name of the file. - object: + description: The final transcript of the audio. + required: + - event_id + - type + - response_id + - item_id + - output_index + - content_index + - transcript + x-oaiMeta: + name: response.audio_transcript.done + group: realtime + example: | + { + "event_id": "event_4748", + "type": "response.audio_transcript.done", + "response_id": "resp_001", + "item_id": "msg_008", + "output_index": 0, + "content_index": 0, + "transcript": "Hello, how can I assist you today?" + } + RealtimeServerEventResponseContentPartAdded: + type: object + description: > + Returned when a new content part is added to an assistant message item + during + + response generation. + properties: + event_id: type: string - description: The object type, which is always `file`. - enum: - - file - purpose: + description: The unique ID of the server event. + type: type: string - description: The intended purpose of the file. Supported values are - `assistants`, `assistants_output`, `batch`, `batch_output`, - `fine-tune`, `fine-tune-results` and `vision`. enum: - - assistants - - assistants_output - - batch - - batch_output - - fine-tune - - fine-tune-results - - vision - status: + - response.content_part.added + description: The event type, must be `response.content_part.added`. + x-stainless-const: true + response_id: + type: string + description: The ID of the response. + item_id: + type: string + description: The ID of the item to which the content part was added. + output_index: + type: integer + description: The index of the output item in the response. + content_index: + type: integer + description: The index of the content part in the item's content array. + part: + type: object + description: The content part that was added. + properties: + type: + type: string + enum: + - audio + - text + description: The content type ("text", "audio"). + text: + type: string + description: The text content (if type is "text"). + audio: + type: string + description: Base64-encoded audio data (if type is "audio"). + transcript: + type: string + description: The transcript of the audio (if type is "audio"). + required: + - event_id + - type + - response_id + - item_id + - output_index + - content_index + - part + x-oaiMeta: + name: response.content_part.added + group: realtime + example: | + { + "event_id": "event_3738", + "type": "response.content_part.added", + "response_id": "resp_001", + "item_id": "msg_007", + "output_index": 0, + "content_index": 0, + "part": { + "type": "text", + "text": "" + } + } + RealtimeServerEventResponseContentPartDone: + type: object + description: > + Returned when a content part is done streaming in an assistant message + item. + + Also emitted when a Response is interrupted, incomplete, or cancelled. + properties: + event_id: + type: string + description: The unique ID of the server event. + type: type: string - deprecated: true - description: Deprecated. The current status of the file, which can be either - `uploaded`, `processed`, or `error`. enum: - - uploaded - - processed - - error - status_details: + - response.content_part.done + description: The event type, must be `response.content_part.done`. + x-stainless-const: true + response_id: type: string - deprecated: true - description: Deprecated. For details on why a fine-tuning training file failed - validation, see the `error` field on `fine_tuning.job`. + description: The ID of the response. + item_id: + type: string + description: The ID of the item. + output_index: + type: integer + description: The index of the output item in the response. + content_index: + type: integer + description: The index of the content part in the item's content array. + part: + type: object + description: The content part that is done. + properties: + type: + type: string + enum: + - audio + - text + description: The content type ("text", "audio"). + text: + type: string + description: The text content (if type is "text"). + audio: + type: string + description: Base64-encoded audio data (if type is "audio"). + transcript: + type: string + description: The transcript of the audio (if type is "audio"). required: - - id - - object - - bytes - - created_at - - filename - - purpose - - status + - event_id + - type + - response_id + - item_id + - output_index + - content_index + - part x-oaiMeta: - name: The file object + name: response.content_part.done + group: realtime example: | { - "id": "file-abc123", - "object": "file", - "bytes": 120000, - "created_at": 1677610602, - "filename": "salesOverview.pdf", - "purpose": "assistants", + "event_id": "event_3940", + "type": "response.content_part.done", + "response_id": "resp_001", + "item_id": "msg_007", + "output_index": 0, + "content_index": 0, + "part": { + "type": "text", + "text": "Sure, I can help with that." + } } - OtherChunkingStrategyResponseParam: + RealtimeServerEventResponseCreated: type: object - title: Other Chunking Strategy - description: This is returned when the chunking strategy is unknown. Typically, - this is because the file was indexed before the `chunking_strategy` - concept was introduced in the API. - additionalProperties: false + description: > + Returned when a new Response is created. The first event of response + creation, + + where the response is in an initial state of `in_progress`. properties: + event_id: + type: string + description: The unique ID of the server event. type: type: string - description: Always `other`. enum: - - other + - response.created + description: The event type, must be `response.created`. + x-stainless-const: true + response: + $ref: "#/components/schemas/RealtimeResponse" required: + - event_id - type - ParallelToolCalls: - description: Whether to enable [parallel function - calling](/docs/guides/function-calling#configuring-parallel-function-calling) - during tool use. - type: boolean - default: true - PredictionContent: + - response + x-oaiMeta: + name: response.created + group: realtime + example: | + { + "event_id": "event_2930", + "type": "response.created", + "response": { + "id": "resp_001", + "object": "realtime.response", + "status": "in_progress", + "status_details": null, + "output": [], + "usage": null + } + } + RealtimeServerEventResponseDone: type: object - title: Static Content description: > - Static predicted output content, such as the content of a text file that - is + Returned when a Response is done streaming. Always emitted, no matter + the - being regenerated. - required: - - type - - content + final state. The Response object included in the `response.done` event + will + + include all output Items in the Response but will omit the raw audio + data. properties: + event_id: + type: string + description: The unique ID of the server event. type: type: string enum: - - content - description: | - The type of the predicted content you want to provide. This type is - currently always `content`. - content: - x-oaiExpandable: true - description: > - The content that should be matched when generating a model response. - - If generated tokens would match this content, the entire model - response - - can be returned much more quickly. - oneOf: - - type: string - title: Text content - description: | - The content used for a Predicted Output. This is often the - text of a file you are regenerating with minor changes. - - type: array - description: An array of content parts with a defined type. Supported options - differ based on the [model](/docs/models) being used to generate - the response. Can contain text inputs. - title: Array of content parts - items: - $ref: "#/components/schemas/ChatCompletionRequestMessageContentPartText" - minItems: 1 - Project: + - response.done + description: The event type, must be `response.done`. + x-stainless-const: true + response: + $ref: "#/components/schemas/RealtimeResponse" + required: + - event_id + - type + - response + x-oaiMeta: + name: response.done + group: realtime + example: | + { + "event_id": "event_3132", + "type": "response.done", + "response": { + "id": "resp_001", + "object": "realtime.response", + "status": "completed", + "status_details": null, + "output": [ + { + "id": "msg_006", + "object": "realtime.item", + "type": "message", + "status": "completed", + "role": "assistant", + "content": [ + { + "type": "text", + "text": "Sure, how can I assist you today?" + } + ] + } + ], + "usage": { + "total_tokens":275, + "input_tokens":127, + "output_tokens":148, + "input_token_details": { + "cached_tokens":384, + "text_tokens":119, + "audio_tokens":8, + "cached_tokens_details": { + "text_tokens": 128, + "audio_tokens": 256 + } + }, + "output_token_details": { + "text_tokens":36, + "audio_tokens":112 + } + } + } + } + RealtimeServerEventResponseFunctionCallArgumentsDelta: type: object - description: Represents an individual project. + description: | + Returned when the model-generated function call arguments are updated. properties: - id: + event_id: type: string - description: The identifier, which can be referenced in API endpoints - object: + description: The unique ID of the server event. + type: type: string enum: - - organization.project - description: The object type, which is always `organization.project` - name: + - response.function_call_arguments.delta + description: | + The event type, must be `response.function_call_arguments.delta`. + x-stainless-const: true + response_id: type: string - description: The name of the project. This appears in reporting. - created_at: - type: integer - description: The Unix timestamp (in seconds) of when the project was created. - archived_at: + description: The ID of the response. + item_id: + type: string + description: The ID of the function call item. + output_index: type: integer - nullable: true - description: The Unix timestamp (in seconds) of when the project was archived or - `null`. - status: + description: The index of the output item in the response. + call_id: type: string - enum: - - active - - archived - description: "`active` or `archived`" + description: The ID of the function call. + delta: + type: string + description: The arguments delta as a JSON string. required: - - id - - object - - name - - created_at - - status + - event_id + - type + - response_id + - item_id + - output_index + - call_id + - delta x-oaiMeta: - name: The project object + name: response.function_call_arguments.delta + group: realtime example: | { - "id": "proj_abc", - "object": "organization.project", - "name": "Project example", - "created_at": 1711471533, - "archived_at": null, - "status": "active" + "event_id": "event_5354", + "type": "response.function_call_arguments.delta", + "response_id": "resp_002", + "item_id": "fc_001", + "output_index": 0, + "call_id": "call_001", + "delta": "{\"location\": \"San\"" } - ProjectApiKey: + RealtimeServerEventResponseFunctionCallArgumentsDone: type: object - description: Represents an individual API key in a project. + description: > + Returned when the model-generated function call arguments are done + streaming. + + Also emitted when a Response is interrupted, incomplete, or cancelled. properties: - object: + event_id: + type: string + description: The unique ID of the server event. + type: type: string enum: - - organization.project.api_key - description: The object type, which is always `organization.project.api_key` - redacted_value: + - response.function_call_arguments.done + description: | + The event type, must be `response.function_call_arguments.done`. + x-stainless-const: true + response_id: type: string - description: The redacted value of the API key - name: + description: The ID of the response. + item_id: type: string - description: The name of the API key - created_at: + description: The ID of the function call item. + output_index: type: integer - description: The Unix timestamp (in seconds) of when the API key was created - id: + description: The index of the output item in the response. + call_id: type: string - description: The identifier, which can be referenced in API endpoints - owner: - type: object - properties: - type: - type: string - enum: - - user - - service_account - description: "`user` or `service_account`" - user: - $ref: "#/components/schemas/ProjectUser" - service_account: - $ref: "#/components/schemas/ProjectServiceAccount" + description: The ID of the function call. + arguments: + type: string + description: The final arguments as a JSON string. required: - - object - - redacted_value - - name - - created_at - - id - - owner + - event_id + - type + - response_id + - item_id + - output_index + - call_id + - arguments x-oaiMeta: - name: The project API key object + name: response.function_call_arguments.done + group: realtime example: | { - "object": "organization.project.api_key", - "redacted_value": "sk-abc...def", - "name": "My API Key", - "created_at": 1711471533, - "id": "key_abc", - "owner": { - "type": "user", - "user": { - "object": "organization.project.user", - "id": "user_abc", - "name": "First Last", - "email": "user@example.com", - "role": "owner", - "created_at": 1711471533 - } - } + "event_id": "event_5556", + "type": "response.function_call_arguments.done", + "response_id": "resp_002", + "item_id": "fc_001", + "output_index": 0, + "call_id": "call_001", + "arguments": "{\"location\": \"San Francisco\"}" } - ProjectApiKeyDeleteResponse: + RealtimeServerEventResponseOutputItemAdded: type: object + description: Returned when a new Item is created during Response generation. properties: - object: - type: string - enum: - - organization.project.api_key.deleted - id: + event_id: type: string - deleted: - type: boolean - required: - - object - - id - - deleted - ProjectApiKeyListResponse: - type: object - properties: - object: + description: The unique ID of the server event. + type: type: string enum: - - list - data: - type: array - items: - $ref: "#/components/schemas/ProjectApiKey" - first_id: - type: string - last_id: + - response.output_item.added + description: The event type, must be `response.output_item.added`. + x-stainless-const: true + response_id: type: string - has_more: - type: boolean + description: The ID of the Response to which the item belongs. + output_index: + type: integer + description: The index of the output item in the Response. + item: + $ref: "#/components/schemas/RealtimeConversationItem" required: - - object - - data - - first_id - - last_id - - has_more - ProjectCreateRequest: + - event_id + - type + - response_id + - output_index + - item + x-oaiMeta: + name: response.output_item.added + group: realtime + example: | + { + "event_id": "event_3334", + "type": "response.output_item.added", + "response_id": "resp_001", + "output_index": 0, + "item": { + "id": "msg_007", + "object": "realtime.item", + "type": "message", + "status": "in_progress", + "role": "assistant", + "content": [] + } + } + RealtimeServerEventResponseOutputItemDone: type: object + description: > + Returned when an Item is done streaming. Also emitted when a Response + is + + interrupted, incomplete, or cancelled. properties: - name: + event_id: type: string - description: The friendly name of the project, this name appears in reports. - required: - - name - ProjectListResponse: - type: object - properties: - object: + description: The unique ID of the server event. + type: type: string enum: - - list - data: - type: array - items: - $ref: "#/components/schemas/Project" - first_id: - type: string - last_id: + - response.output_item.done + description: The event type, must be `response.output_item.done`. + x-stainless-const: true + response_id: type: string - has_more: - type: boolean + description: The ID of the Response to which the item belongs. + output_index: + type: integer + description: The index of the output item in the Response. + item: + $ref: "#/components/schemas/RealtimeConversationItem" required: - - object - - data - - first_id - - last_id - - has_more - ProjectRateLimit: + - event_id + - type + - response_id + - output_index + - item + x-oaiMeta: + name: response.output_item.done + group: realtime + example: | + { + "event_id": "event_3536", + "type": "response.output_item.done", + "response_id": "resp_001", + "output_index": 0, + "item": { + "id": "msg_007", + "object": "realtime.item", + "type": "message", + "status": "completed", + "role": "assistant", + "content": [ + { + "type": "text", + "text": "Sure, I can help with that." + } + ] + } + } + RealtimeServerEventResponseTextDelta: type: object - description: Represents a project rate limit config. + description: Returned when the text value of a "text" content part is updated. properties: - object: + event_id: + type: string + description: The unique ID of the server event. + type: type: string enum: - - project.rate_limit - description: The object type, which is always `project.rate_limit` - id: + - response.text.delta + description: The event type, must be `response.text.delta`. + x-stainless-const: true + response_id: type: string - description: The identifier, which can be referenced in API endpoints. - model: + description: The ID of the response. + item_id: type: string - description: The model this rate limit applies to. - max_requests_per_1_minute: - type: integer - description: The maximum requests per minute. - max_tokens_per_1_minute: - type: integer - description: The maximum tokens per minute. - max_images_per_1_minute: - type: integer - description: The maximum images per minute. Only present for relevant models. - max_audio_megabytes_per_1_minute: - type: integer - description: The maximum audio megabytes per minute. Only present for relevant - models. - max_requests_per_1_day: + description: The ID of the item. + output_index: type: integer - description: The maximum requests per day. Only present for relevant models. - batch_1_day_max_input_tokens: + description: The index of the output item in the response. + content_index: type: integer - description: The maximum batch input tokens per day. Only present for relevant - models. + description: The index of the content part in the item's content array. + delta: + type: string + description: The text delta. required: - - object - - id - - model - - max_requests_per_1_minute - - max_tokens_per_1_minute + - event_id + - type + - response_id + - item_id + - output_index + - content_index + - delta x-oaiMeta: - name: The project rate limit object + name: response.text.delta + group: realtime example: | { - "object": "project.rate_limit", - "id": "rl_ada", - "model": "ada", - "max_requests_per_1_minute": 600, - "max_tokens_per_1_minute": 150000, - "max_images_per_1_minute": 10 + "event_id": "event_4142", + "type": "response.text.delta", + "response_id": "resp_001", + "item_id": "msg_007", + "output_index": 0, + "content_index": 0, + "delta": "Sure, I can h" } - ProjectRateLimitListResponse: + RealtimeServerEventResponseTextDone: type: object + description: > + Returned when the text value of a "text" content part is done streaming. + Also + + emitted when a Response is interrupted, incomplete, or cancelled. properties: - object: + event_id: + type: string + description: The unique ID of the server event. + type: type: string enum: - - list - data: - type: array - items: - $ref: "#/components/schemas/ProjectRateLimit" - first_id: + - response.text.done + description: The event type, must be `response.text.done`. + x-stainless-const: true + response_id: type: string - last_id: + description: The ID of the response. + item_id: type: string - has_more: - type: boolean - required: - - object - - data - - first_id - - last_id - - has_more - ProjectRateLimitUpdateRequest: - type: object - properties: - max_requests_per_1_minute: - type: integer - description: The maximum requests per minute. - max_tokens_per_1_minute: - type: integer - description: The maximum tokens per minute. - max_images_per_1_minute: - type: integer - description: The maximum images per minute. Only relevant for certain models. - max_audio_megabytes_per_1_minute: - type: integer - description: The maximum audio megabytes per minute. Only relevant for certain - models. - max_requests_per_1_day: + description: The ID of the item. + output_index: type: integer - description: The maximum requests per day. Only relevant for certain models. - batch_1_day_max_input_tokens: + description: The index of the output item in the response. + content_index: type: integer - description: The maximum batch input tokens per day. Only relevant for certain - models. - ProjectServiceAccount: + description: The index of the content part in the item's content array. + text: + type: string + description: The final text content. + required: + - event_id + - type + - response_id + - item_id + - output_index + - content_index + - text + x-oaiMeta: + name: response.text.done + group: realtime + example: | + { + "event_id": "event_4344", + "type": "response.text.done", + "response_id": "resp_001", + "item_id": "msg_007", + "output_index": 0, + "content_index": 0, + "text": "Sure, I can help with that." + } + RealtimeServerEventSessionCreated: type: object - description: Represents an individual service account in a project. + description: > + Returned when a Session is created. Emitted automatically when a new + + connection is established as the first server event. This event will + contain + + the default Session configuration. properties: - object: - type: string - enum: - - organization.project.service_account - description: The object type, which is always - `organization.project.service_account` - id: - type: string - description: The identifier, which can be referenced in API endpoints - name: + event_id: type: string - description: The name of the service account - role: + description: The unique ID of the server event. + type: type: string enum: - - owner - - member - description: "`owner` or `member`" - created_at: - type: integer - description: The Unix timestamp (in seconds) of when the service account was - created + - session.created + description: The event type, must be `session.created`. + x-stainless-const: true + session: + $ref: "#/components/schemas/RealtimeSession" required: - - object - - id - - name - - role - - created_at + - event_id + - type + - session x-oaiMeta: - name: The project service account object + name: session.created + group: realtime example: | { - "object": "organization.project.service_account", - "id": "svc_acct_abc", - "name": "Service Account", - "role": "owner", - "created_at": 1711471533 + "event_id": "event_1234", + "type": "session.created", + "session": { + "id": "sess_001", + "object": "realtime.session", + "model": "gpt-4o-realtime-preview", + "modalities": ["text", "audio"], + "instructions": "...model instructions here...", + "voice": "sage", + "input_audio_format": "pcm16", + "output_audio_format": "pcm16", + "input_audio_transcription": null, + "turn_detection": { + "type": "server_vad", + "threshold": 0.5, + "prefix_padding_ms": 300, + "silence_duration_ms": 200 + }, + "tools": [], + "tool_choice": "auto", + "temperature": 0.8, + "max_response_output_tokens": "inf" + } } - ProjectServiceAccountApiKey: + RealtimeServerEventSessionUpdated: type: object + description: > + Returned when a session is updated with a `session.update` event, + unless + + there is an error. properties: - object: - type: string - enum: - - organization.project.service_account.api_key - description: The object type, which is always - `organization.project.service_account.api_key` - value: - type: string - name: + event_id: type: string - created_at: - type: integer - id: + description: The unique ID of the server event. + type: type: string + enum: + - session.updated + description: The event type, must be `session.updated`. + x-stainless-const: true + session: + $ref: "#/components/schemas/RealtimeSession" required: - - object - - value - - name - - created_at - - id - ProjectServiceAccountCreateRequest: + - event_id + - type + - session + x-oaiMeta: + name: session.updated + group: realtime + example: | + { + "event_id": "event_5678", + "type": "session.updated", + "session": { + "id": "sess_001", + "object": "realtime.session", + "model": "gpt-4o-realtime-preview", + "modalities": ["text"], + "instructions": "New instructions", + "voice": "sage", + "input_audio_format": "pcm16", + "output_audio_format": "pcm16", + "input_audio_transcription": { + "model": "whisper-1" + }, + "turn_detection": null, + "tools": [], + "tool_choice": "none", + "temperature": 0.7, + "max_response_output_tokens": 200 + } + } + RealtimeServerEventTranscriptionSessionUpdated: type: object + description: > + Returned when a transcription session is updated with a + `transcription_session.update` event, unless + + there is an error. properties: - name: + event_id: type: string - description: The name of the service account being created. + description: The unique ID of the server event. + type: + type: string + enum: + - transcription_session.updated + description: The event type, must be `transcription_session.updated`. + x-stainless-const: true + session: + $ref: "#/components/schemas/RealtimeTranscriptionSessionCreateResponse" required: - - name - ProjectServiceAccountCreateResponse: + - event_id + - type + - session + x-oaiMeta: + name: transcription_session.updated + group: realtime + example: | + { + "event_id": "event_5678", + "type": "transcription_session.updated", + "session": { + "id": "sess_001", + "object": "realtime.transcription_session", + "input_audio_format": "pcm16", + "input_audio_transcription": { + "model": "gpt-4o-transcribe", + "prompt": "", + "language": "" + }, + "turn_detection": { + "type": "server_vad", + "threshold": 0.5, + "prefix_padding_ms": 300, + "silence_duration_ms": 500, + "create_response": true, + // "interrupt_response": false -- this will NOT be returned + }, + "input_audio_noise_reduction": { + "type": "near_field" + }, + "include": [ + "item.input_audio_transcription.avg_logprob", + ], + } + } + RealtimeSession: type: object + description: Realtime session object configuration. properties: - object: + id: + type: string + description: > + Unique identifier for the session that looks like + `sess_1234567890abcdef`. + modalities: + description: | + The set of modalities the model can respond with. To disable audio, + set this to ["text"]. + items: + type: string + default: + - text + - audio + enum: + - text + - audio + model: type: string + description: | + The Realtime model used for this session. enum: - - organization.project.service_account - id: + - gpt-4o-realtime-preview + - gpt-4o-realtime-preview-2024-10-01 + - gpt-4o-realtime-preview-2024-12-17 + - gpt-4o-mini-realtime-preview + - gpt-4o-mini-realtime-preview-2024-12-17 + instructions: type: string - name: + description: > + The default system instructions (i.e. system message) prepended to + model calls. This field allows the client to guide the model on + desired responses. The model can be instructed on response content + and format, (e.g. "be extremely succinct", "act friendly", "here + are examples of good responses") and on audio behavior (e.g. "talk + quickly", "inject emotion into your voice", "laugh frequently"). + The instructions are not guaranteed to be followed by the model, + but they provide guidance to the model on the desired behavior. + + + Note that the server sets default instructions which will be used if + this field is not set and are visible in the `session.created` + event at the start of the session. + voice: + $ref: "#/components/schemas/VoiceIdsShared" + description: > + The voice the model uses to respond. Voice cannot be changed during + the + + session once the model has responded with audio at least once. + Current + + voice options are `alloy`, `ash`, `ballad`, `coral`, `echo` `sage`, + + `shimmer` and `verse`. + input_audio_format: type: string - role: + default: pcm16 + enum: + - pcm16 + - g711_ulaw + - g711_alaw + description: > + The format of input audio. Options are `pcm16`, `g711_ulaw`, or + `g711_alaw`. + + For `pcm16`, input audio must be 16-bit PCM at a 24kHz sample rate, + + single channel (mono), and little-endian byte order. + output_audio_format: type: string + default: pcm16 enum: - - member - description: Service accounts can only have one role of type `member` - created_at: - type: integer - api_key: - $ref: "#/components/schemas/ProjectServiceAccountApiKey" - required: - - object - - id - - name - - role - - created_at - - api_key - ProjectServiceAccountDeleteResponse: + - pcm16 + - g711_ulaw + - g711_alaw + description: > + The format of output audio. Options are `pcm16`, `g711_ulaw`, or + `g711_alaw`. + + For `pcm16`, output audio is sampled at a rate of 24kHz. + input_audio_transcription: + type: object + description: | + Configuration for input audio transcription, defaults to off and can be set to `null` to turn off once on. Input audio transcription is not native to the model, since the model consumes audio directly. Transcription runs asynchronously through [the /audio/transcriptions endpoint](https://platform.openai.com/docs/api-reference/audio/createTranscription) and should be treated as guidance of input audio content rather than precisely what the model heard. The client can optionally set the language and prompt for transcription, these offer additional guidance to the transcription service. + properties: + model: + type: string + description: > + The model to use for transcription, current options are + `gpt-4o-transcribe`, `gpt-4o-mini-transcribe`, and `whisper-1`. + language: + type: string + description: | + The language of the input audio. Supplying the input language in + [ISO-639-1](https://en.wikipedia.org/wiki/List_of_ISO_639-1_codes) (e.g. `en`) format + will improve accuracy and latency. + prompt: + type: string + description: > + An optional text to guide the model's style or continue a + previous audio + + segment. + + For `whisper-1`, the [prompt is a list of + keywords](/docs/guides/speech-to-text#prompting). + + For `gpt-4o-transcribe` models, the prompt is a free text + string, for example "expect words related to technology". + turn_detection: + type: object + description: > + Configuration for turn detection, ether Server VAD or Semantic VAD. + This can be set to `null` to turn off, in which case the client must + manually trigger model response. + + Server VAD means that the model will detect the start and end of + speech based on audio volume and respond at the end of user speech. + + Semantic VAD is more advanced and uses a turn detection model (in + conjuction with VAD) to semantically estimate whether the user has + finished speaking, then dynamically sets a timeout based on this + probability. For example, if user audio trails off with "uhhm", the + model will score a low probability of turn end and wait longer for + the user to continue speaking. This can be useful for more natural + conversations, but may have a higher latency. + properties: + type: + type: string + default: server_vad + enum: + - server_vad + - semantic_vad + description: | + Type of turn detection. + eagerness: + type: string + default: auto + enum: + - low + - medium + - high + - auto + description: > + Used only for `semantic_vad` mode. The eagerness of the model to + respond. `low` will wait longer for the user to continue + speaking, `high` will respond more quickly. `auto` is the + default and is equivalent to `medium`. + threshold: + type: number + description: > + Used only for `server_vad` mode. Activation threshold for VAD + (0.0 to 1.0), this defaults to 0.5. A + + higher threshold will require louder audio to activate the + model, and + + thus might perform better in noisy environments. + prefix_padding_ms: + type: integer + description: > + Used only for `server_vad` mode. Amount of audio to include + before the VAD detected speech (in + + milliseconds). Defaults to 300ms. + silence_duration_ms: + type: integer + description: > + Used only for `server_vad` mode. Duration of silence to detect + speech stop (in milliseconds). Defaults + + to 500ms. With shorter values the model will respond more + quickly, + + but may jump in on short pauses from the user. + create_response: + type: boolean + default: true + description: > + Whether or not to automatically generate a response when a VAD + stop event occurs. + interrupt_response: + type: boolean + default: true + description: > + Whether or not to automatically interrupt any ongoing response + with output to the default + + conversation (i.e. `conversation` of `auto`) when a VAD start + event occurs. + input_audio_noise_reduction: + type: object + default: null + description: > + Configuration for input audio noise reduction. This can be set to + `null` to turn off. + + Noise reduction filters audio added to the input audio buffer before + it is sent to VAD and the model. + + Filtering the audio can improve VAD and turn detection accuracy + (reducing false positives) and model performance by improving + perception of the input audio. + properties: + type: + type: string + enum: + - near_field + - far_field + description: > + Type of noise reduction. `near_field` is for close-talking + microphones such as headphones, `far_field` is for far-field + microphones such as laptop or conference room microphones. + tools: + type: array + description: Tools (functions) available to the model. + items: + type: object + properties: + type: + type: string + enum: + - function + description: The type of the tool, i.e. `function`. + x-stainless-const: true + name: + type: string + description: The name of the function. + description: + type: string + description: > + The description of the function, including guidance on when + and how + + to call it, and guidance about what to tell the user when + calling + + (if anything). + parameters: + type: object + description: Parameters of the function in JSON Schema. + tool_choice: + type: string + default: auto + description: > + How the model chooses tools. Options are `auto`, `none`, `required`, + or + + specify a function. + temperature: + type: number + default: 0.8 + description: > + Sampling temperature for the model, limited to [0.6, 1.2]. For audio + models a temperature of 0.8 is highly recommended for best + performance. + max_response_output_tokens: + oneOf: + - type: integer + - type: string + enum: + - inf + x-stainless-const: true + description: | + Maximum number of output tokens for a single assistant response, + inclusive of tool calls. Provide an integer between 1 and 4096 to + limit output tokens, or `inf` for the maximum available tokens for a + given model. Defaults to `inf`. + RealtimeSessionCreateRequest: type: object + description: Realtime session object configuration. properties: - object: + modalities: + description: | + The set of modalities the model can respond with. To disable audio, + set this to ["text"]. + items: + type: string + default: + - text + - audio + enum: + - text + - audio + model: type: string + description: | + The Realtime model used for this session. enum: - - organization.project.service_account.deleted - id: + - gpt-4o-realtime-preview + - gpt-4o-realtime-preview-2024-10-01 + - gpt-4o-realtime-preview-2024-12-17 + - gpt-4o-mini-realtime-preview + - gpt-4o-mini-realtime-preview-2024-12-17 + instructions: type: string - deleted: - type: boolean - required: - - object - - id - - deleted - ProjectServiceAccountListResponse: - type: object - properties: - object: + description: > + The default system instructions (i.e. system message) prepended to + model calls. This field allows the client to guide the model on + desired responses. The model can be instructed on response content + and format, (e.g. "be extremely succinct", "act friendly", "here + are examples of good responses") and on audio behavior (e.g. "talk + quickly", "inject emotion into your voice", "laugh frequently"). + The instructions are not guaranteed to be followed by the model, + but they provide guidance to the model on the desired behavior. + + + Note that the server sets default instructions which will be used if + this field is not set and are visible in the `session.created` + event at the start of the session. + voice: + $ref: "#/components/schemas/VoiceIdsShared" + description: > + The voice the model uses to respond. Voice cannot be changed during + the + + session once the model has responded with audio at least once. + Current + + voice options are `alloy`, `ash`, `ballad`, `coral`, `echo`, + `fable`, + + `onyx`, `nova`, `sage`, `shimmer`, and `verse`. + input_audio_format: type: string + default: pcm16 enum: - - list - data: + - pcm16 + - g711_ulaw + - g711_alaw + description: > + The format of input audio. Options are `pcm16`, `g711_ulaw`, or + `g711_alaw`. + + For `pcm16`, input audio must be 16-bit PCM at a 24kHz sample rate, + + single channel (mono), and little-endian byte order. + output_audio_format: + type: string + default: pcm16 + enum: + - pcm16 + - g711_ulaw + - g711_alaw + description: > + The format of output audio. Options are `pcm16`, `g711_ulaw`, or + `g711_alaw`. + + For `pcm16`, output audio is sampled at a rate of 24kHz. + input_audio_transcription: + type: object + description: | + Configuration for input audio transcription, defaults to off and can be set to `null` to turn off once on. Input audio transcription is not native to the model, since the model consumes audio directly. Transcription runs asynchronously through [the /audio/transcriptions endpoint](https://platform.openai.com/docs/api-reference/audio/createTranscription) and should be treated as guidance of input audio content rather than precisely what the model heard. The client can optionally set the language and prompt for transcription, these offer additional guidance to the transcription service. + properties: + model: + type: string + description: > + The model to use for transcription, current options are + `gpt-4o-transcribe`, `gpt-4o-mini-transcribe`, and `whisper-1`. + language: + type: string + description: | + The language of the input audio. Supplying the input language in + [ISO-639-1](https://en.wikipedia.org/wiki/List_of_ISO_639-1_codes) (e.g. `en`) format + will improve accuracy and latency. + prompt: + type: string + description: > + An optional text to guide the model's style or continue a + previous audio + + segment. + + For `whisper-1`, the [prompt is a list of + keywords](/docs/guides/speech-to-text#prompting). + + For `gpt-4o-transcribe` models, the prompt is a free text + string, for example "expect words related to technology". + turn_detection: + type: object + description: > + Configuration for turn detection, ether Server VAD or Semantic VAD. + This can be set to `null` to turn off, in which case the client must + manually trigger model response. + + Server VAD means that the model will detect the start and end of + speech based on audio volume and respond at the end of user speech. + + Semantic VAD is more advanced and uses a turn detection model (in + conjuction with VAD) to semantically estimate whether the user has + finished speaking, then dynamically sets a timeout based on this + probability. For example, if user audio trails off with "uhhm", the + model will score a low probability of turn end and wait longer for + the user to continue speaking. This can be useful for more natural + conversations, but may have a higher latency. + properties: + type: + type: string + default: server_vad + enum: + - server_vad + - semantic_vad + description: | + Type of turn detection. + eagerness: + type: string + default: auto + enum: + - low + - medium + - high + - auto + description: > + Used only for `semantic_vad` mode. The eagerness of the model to + respond. `low` will wait longer for the user to continue + speaking, `high` will respond more quickly. `auto` is the + default and is equivalent to `medium`. + threshold: + type: number + description: > + Used only for `server_vad` mode. Activation threshold for VAD + (0.0 to 1.0), this defaults to 0.5. A + + higher threshold will require louder audio to activate the + model, and + + thus might perform better in noisy environments. + prefix_padding_ms: + type: integer + description: > + Used only for `server_vad` mode. Amount of audio to include + before the VAD detected speech (in + + milliseconds). Defaults to 300ms. + silence_duration_ms: + type: integer + description: > + Used only for `server_vad` mode. Duration of silence to detect + speech stop (in milliseconds). Defaults + + to 500ms. With shorter values the model will respond more + quickly, + + but may jump in on short pauses from the user. + create_response: + type: boolean + default: true + description: > + Whether or not to automatically generate a response when a VAD + stop event occurs. + interrupt_response: + type: boolean + default: true + description: > + Whether or not to automatically interrupt any ongoing response + with output to the default + + conversation (i.e. `conversation` of `auto`) when a VAD start + event occurs. + input_audio_noise_reduction: + type: object + default: null + description: > + Configuration for input audio noise reduction. This can be set to + `null` to turn off. + + Noise reduction filters audio added to the input audio buffer before + it is sent to VAD and the model. + + Filtering the audio can improve VAD and turn detection accuracy + (reducing false positives) and model performance by improving + perception of the input audio. + properties: + type: + type: string + enum: + - near_field + - far_field + description: > + Type of noise reduction. `near_field` is for close-talking + microphones such as headphones, `far_field` is for far-field + microphones such as laptop or conference room microphones. + tools: type: array + description: Tools (functions) available to the model. items: - $ref: "#/components/schemas/ProjectServiceAccount" - first_id: - type: string - last_id: - type: string - has_more: - type: boolean - required: - - object - - data - - first_id - - last_id - - has_more - ProjectUpdateRequest: - type: object - properties: - name: + type: object + properties: + type: + type: string + enum: + - function + description: The type of the tool, i.e. `function`. + x-stainless-const: true + name: + type: string + description: The name of the function. + description: + type: string + description: > + The description of the function, including guidance on when + and how + + to call it, and guidance about what to tell the user when + calling + + (if anything). + parameters: + type: object + description: Parameters of the function in JSON Schema. + tool_choice: type: string - description: The updated name of the project, this name appears in reports. - required: - - name - ProjectUser: + default: auto + description: > + How the model chooses tools. Options are `auto`, `none`, `required`, + or + + specify a function. + temperature: + type: number + default: 0.8 + description: > + Sampling temperature for the model, limited to [0.6, 1.2]. For audio + models a temperature of 0.8 is highly recommended for best + performance. + max_response_output_tokens: + oneOf: + - type: integer + - type: string + enum: + - inf + x-stainless-const: true + description: | + Maximum number of output tokens for a single assistant response, + inclusive of tool calls. Provide an integer between 1 and 4096 to + limit output tokens, or `inf` for the maximum available tokens for a + given model. Defaults to `inf`. + RealtimeSessionCreateResponse: type: object - description: Represents an individual user in a project. + description: > + A new Realtime session configuration, with an ephermeral key. Default + TTL + + for keys is one minute. properties: - object: - type: string - enum: - - organization.project.user - description: The object type, which is always `organization.project.user` - id: + client_secret: + type: object + description: Ephemeral key returned by the API. + properties: + value: + type: string + description: > + Ephemeral key usable in client environments to authenticate + connections + + to the Realtime API. Use this in client-side environments rather + than + + a standard API token, which should only be used server-side. + expires_at: + type: integer + description: > + Timestamp for when the token expires. Currently, all tokens + expire + + after one minute. + required: + - value + - expires_at + modalities: + description: | + The set of modalities the model can respond with. To disable audio, + set this to ["text"]. + items: + type: string + enum: + - text + - audio + instructions: type: string - description: The identifier, which can be referenced in API endpoints - name: + description: > + The default system instructions (i.e. system message) prepended to + model + + calls. This field allows the client to guide the model on desired + + responses. The model can be instructed on response content and + format, + + (e.g. "be extremely succinct", "act friendly", "here are examples of + good + + responses") and on audio behavior (e.g. "talk quickly", "inject + emotion + + into your voice", "laugh frequently"). The instructions are not + guaranteed + + to be followed by the model, but they provide guidance to the model + on the + + desired behavior. + + + Note that the server sets default instructions which will be used if + this + + field is not set and are visible in the `session.created` event at + the + + start of the session. + voice: + $ref: "#/components/schemas/VoiceIdsShared" + description: > + The voice the model uses to respond. Voice cannot be changed during + the + + session once the model has responded with audio at least once. + Current + + voice options are `alloy`, `ash`, `ballad`, `coral`, `echo` `sage`, + + `shimmer` and `verse`. + input_audio_format: type: string - description: The name of the user - email: + description: > + The format of input audio. Options are `pcm16`, `g711_ulaw`, or + `g711_alaw`. + output_audio_format: type: string - description: The email address of the user - role: + description: > + The format of output audio. Options are `pcm16`, `g711_ulaw`, or + `g711_alaw`. + input_audio_transcription: + type: object + description: > + Configuration for input audio transcription, defaults to off and can + be + + set to `null` to turn off once on. Input audio transcription is not + native + + to the model, since the model consumes audio directly. Transcription + runs + + asynchronously through Whisper and should be treated as rough + guidance + + rather than the representation understood by the model. + properties: + model: + type: string + description: > + The model to use for transcription, `whisper-1` is the only + currently + + supported model. + turn_detection: + type: object + description: > + Configuration for turn detection. Can be set to `null` to turn off. + Server + + VAD means that the model will detect the start and end of speech + based on + + audio volume and respond at the end of user speech. + properties: + type: + type: string + description: > + Type of turn detection, only `server_vad` is currently supported. + threshold: + type: number + description: > + Activation threshold for VAD (0.0 to 1.0), this defaults to 0.5. + A + + higher threshold will require louder audio to activate the + model, and + + thus might perform better in noisy environments. + prefix_padding_ms: + type: integer + description: | + Amount of audio to include before the VAD detected speech (in + milliseconds). Defaults to 300ms. + silence_duration_ms: + type: integer + description: > + Duration of silence to detect speech stop (in milliseconds). + Defaults + + to 500ms. With shorter values the model will respond more + quickly, + + but may jump in on short pauses from the user. + tools: + type: array + description: Tools (functions) available to the model. + items: + type: object + properties: + type: + type: string + enum: + - function + description: The type of the tool, i.e. `function`. + x-stainless-const: true + name: + type: string + description: The name of the function. + description: + type: string + description: > + The description of the function, including guidance on when + and how + + to call it, and guidance about what to tell the user when + calling + + (if anything). + parameters: + type: object + description: Parameters of the function in JSON Schema. + tool_choice: type: string - enum: - - owner - - member - description: "`owner` or `member`" - added_at: - type: integer - description: The Unix timestamp (in seconds) of when the project was added. + description: > + How the model chooses tools. Options are `auto`, `none`, `required`, + or + + specify a function. + temperature: + type: number + description: > + Sampling temperature for the model, limited to [0.6, 1.2]. Defaults + to 0.8. + max_response_output_tokens: + oneOf: + - type: integer + - type: string + enum: + - inf + x-stainless-const: true + description: | + Maximum number of output tokens for a single assistant response, + inclusive of tool calls. Provide an integer between 1 and 4096 to + limit output tokens, or `inf` for the maximum available tokens for a + given model. Defaults to `inf`. required: - - object - - id - - name - - email - - role - - added_at + - client_secret x-oaiMeta: - name: The project user object + name: The session object + group: realtime example: | { - "object": "organization.project.user", - "id": "user_abc", - "name": "First Last", - "email": "user@example.com", - "role": "owner", - "added_at": 1711471533 + "id": "sess_001", + "object": "realtime.session", + "model": "gpt-4o-realtime-preview", + "modalities": ["audio", "text"], + "instructions": "You are a friendly assistant.", + "voice": "alloy", + "input_audio_format": "pcm16", + "output_audio_format": "pcm16", + "input_audio_transcription": { + "model": "whisper-1" + }, + "turn_detection": null, + "tools": [], + "tool_choice": "none", + "temperature": 0.7, + "max_response_output_tokens": 200, + "client_secret": { + "value": "ek_abc123", + "expires_at": 1234567890 + } } - ProjectUserCreateRequest: - type: object - properties: - user_id: - type: string - description: The ID of the user. - role: - type: string - enum: - - owner - - member - description: "`owner` or `member`" - required: - - user_id - - role - ProjectUserDeleteResponse: - type: object - properties: - object: - type: string - enum: - - organization.project.user.deleted - id: - type: string - deleted: - type: boolean - required: - - object - - id - - deleted - ProjectUserListResponse: + RealtimeTranscriptionSessionCreateRequest: type: object + description: Realtime transcription session object configuration. properties: - object: - type: string - data: - type: array + modalities: + description: | + The set of modalities the model can respond with. To disable audio, + set this to ["text"]. items: - $ref: "#/components/schemas/ProjectUser" - first_id: - type: string - last_id: - type: string - has_more: - type: boolean - required: - - object - - data - - first_id - - last_id - - has_more - ProjectUserUpdateRequest: - type: object - properties: - role: + type: string + default: + - text + - audio + enum: + - text + - audio + input_audio_format: type: string + default: pcm16 enum: - - owner - - member - description: "`owner` or `member`" - required: - - role - RealtimeClientEventConversationItemCreate: - type: object - description: >- - Add a new Item to the Conversation's context, including messages, - function calls, and function call responses. This event can be used both - to populate a "history" of the conversation and to add new items - mid-stream, but has the current limitation that it cannot populate - assistant audio messages. + - pcm16 + - g711_ulaw + - g711_alaw + description: > + The format of input audio. Options are `pcm16`, `g711_ulaw`, or + `g711_alaw`. - If successful, the server will respond with a - `conversation.item.created` event, otherwise an `error` event will be - sent. - properties: - event_id: - type: string - description: Optional client-generated ID used to identify this event. - type: - type: string - description: The event type, must be `conversation.item.create`. - previous_item_id: - type: string - description: The ID of the preceding item after which the new item will be - inserted. If not set, the new item will be appended to the end of - the conversation. If set, it allows an item to be inserted - mid-conversation. If the ID cannot be found, an error will be - returned and the item will not be added. - item: - $ref: "#/components/schemas/RealtimeConversationItem" - required: - - type - - item - x-oaiMeta: - name: conversation.item.create - group: realtime - example: | - { - "event_id": "event_345", - "type": "conversation.item.create", - "previous_item_id": null, - "item": { - "id": "msg_001", - "type": "message", - "role": "user", - "content": [ - { - "type": "input_text", - "text": "Hello, how are you?" - } - ] - } - } - RealtimeClientEventConversationItemDelete: + For `pcm16`, input audio must be 16-bit PCM at a 24kHz sample rate, + + single channel (mono), and little-endian byte order. + input_audio_transcription: + type: object + description: > + Configuration for input audio transcription. The client can + optionally set the language and prompt for transcription, these + offer additional guidance to the transcription service. + properties: + model: + type: string + description: > + The model to use for transcription, current options are + `gpt-4o-transcribe`, `gpt-4o-mini-transcribe`, and `whisper-1`. + enum: + - gpt-4o-transcribe + - gpt-4o-mini-transcribe + - whisper-1 + language: + type: string + description: | + The language of the input audio. Supplying the input language in + [ISO-639-1](https://en.wikipedia.org/wiki/List_of_ISO_639-1_codes) (e.g. `en`) format + will improve accuracy and latency. + prompt: + type: string + description: > + An optional text to guide the model's style or continue a + previous audio + + segment. + + For `whisper-1`, the [prompt is a list of + keywords](/docs/guides/speech-to-text#prompting). + + For `gpt-4o-transcribe` models, the prompt is a free text + string, for example "expect words related to technology". + turn_detection: + type: object + description: > + Configuration for turn detection, ether Server VAD or Semantic VAD. + This can be set to `null` to turn off, in which case the client must + manually trigger model response. + + Server VAD means that the model will detect the start and end of + speech based on audio volume and respond at the end of user speech. + + Semantic VAD is more advanced and uses a turn detection model (in + conjuction with VAD) to semantically estimate whether the user has + finished speaking, then dynamically sets a timeout based on this + probability. For example, if user audio trails off with "uhhm", the + model will score a low probability of turn end and wait longer for + the user to continue speaking. This can be useful for more natural + conversations, but may have a higher latency. + properties: + type: + type: string + default: server_vad + enum: + - server_vad + - semantic_vad + description: | + Type of turn detection. + eagerness: + type: string + default: auto + enum: + - low + - medium + - high + - auto + description: > + Used only for `semantic_vad` mode. The eagerness of the model to + respond. `low` will wait longer for the user to continue + speaking, `high` will respond more quickly. `auto` is the + default and is equivalent to `medium`. + threshold: + type: number + description: > + Used only for `server_vad` mode. Activation threshold for VAD + (0.0 to 1.0), this defaults to 0.5. A + + higher threshold will require louder audio to activate the + model, and + + thus might perform better in noisy environments. + prefix_padding_ms: + type: integer + description: > + Used only for `server_vad` mode. Amount of audio to include + before the VAD detected speech (in + + milliseconds). Defaults to 300ms. + silence_duration_ms: + type: integer + description: > + Used only for `server_vad` mode. Duration of silence to detect + speech stop (in milliseconds). Defaults + + to 500ms. With shorter values the model will respond more + quickly, + + but may jump in on short pauses from the user. + create_response: + type: boolean + default: true + description: > + Whether or not to automatically generate a response when a VAD + stop event occurs. Not available for transcription sessions. + interrupt_response: + type: boolean + default: true + description: > + Whether or not to automatically interrupt any ongoing response + with output to the default + + conversation (i.e. `conversation` of `auto`) when a VAD start + event occurs. Not available for transcription sessions. + input_audio_noise_reduction: + type: object + default: null + description: > + Configuration for input audio noise reduction. This can be set to + `null` to turn off. + + Noise reduction filters audio added to the input audio buffer before + it is sent to VAD and the model. + + Filtering the audio can improve VAD and turn detection accuracy + (reducing false positives) and model performance by improving + perception of the input audio. + properties: + type: + type: string + enum: + - near_field + - far_field + description: > + Type of noise reduction. `near_field` is for close-talking + microphones such as headphones, `far_field` is for far-field + microphones such as laptop or conference room microphones. + include: + type: array + items: + type: string + description: > + The set of items to include in the transcription. Current available + items are: + + - `item.input_audio_transcription.logprobs` + RealtimeTranscriptionSessionCreateResponse: type: object - description: Send this event when you want to remove any item from the - conversation history. The server will respond with a - `conversation.item.deleted` event, unless the item does not exist in the - conversation history, in which case the server will respond with an - error. + description: > + A new Realtime transcription session configuration. + + + When a session is created on the server via REST API, the session object + + also contains an ephemeral key. Default TTL for keys is 10 minutes. + This + + property is not present when a session is updated via the WebSocket API. properties: - event_id: - type: string - description: Optional client-generated ID used to identify this event. - type: - type: string - description: The event type, must be "conversation.item.delete". - item_id: + client_secret: + type: object + description: | + Ephemeral key returned by the API. Only present when the session is + created on the server via REST API. + properties: + value: + type: string + description: > + Ephemeral key usable in client environments to authenticate + connections + + to the Realtime API. Use this in client-side environments rather + than + + a standard API token, which should only be used server-side. + expires_at: + type: integer + description: > + Timestamp for when the token expires. Currently, all tokens + expire + + after one minute. + required: + - value + - expires_at + modalities: + description: | + The set of modalities the model can respond with. To disable audio, + set this to ["text"]. + items: + type: string + enum: + - text + - audio + input_audio_format: type: string - description: The ID of the item to delete. + description: > + The format of input audio. Options are `pcm16`, `g711_ulaw`, or + `g711_alaw`. + input_audio_transcription: + type: object + description: | + Configuration of the transcription model. + properties: + model: + type: string + description: > + The model to use for transcription. Can be `gpt-4o-transcribe`, + `gpt-4o-mini-transcribe`, or `whisper-1`. + enum: + - gpt-4o-transcribe + - gpt-4o-mini-transcribe + - whisper-1 + language: + type: string + description: | + The language of the input audio. Supplying the input language in + [ISO-639-1](https://en.wikipedia.org/wiki/List_of_ISO_639-1_codes) (e.g. `en`) format + will improve accuracy and latency. + prompt: + type: string + description: > + An optional text to guide the model's style or continue a + previous audio + + segment. The [prompt](/docs/guides/speech-to-text#prompting) + should match + + the audio language. + turn_detection: + type: object + description: > + Configuration for turn detection. Can be set to `null` to turn off. + Server + + VAD means that the model will detect the start and end of speech + based on + + audio volume and respond at the end of user speech. + properties: + type: + type: string + description: > + Type of turn detection, only `server_vad` is currently supported. + threshold: + type: number + description: > + Activation threshold for VAD (0.0 to 1.0), this defaults to 0.5. + A + + higher threshold will require louder audio to activate the + model, and + + thus might perform better in noisy environments. + prefix_padding_ms: + type: integer + description: | + Amount of audio to include before the VAD detected speech (in + milliseconds). Defaults to 300ms. + silence_duration_ms: + type: integer + description: > + Duration of silence to detect speech stop (in milliseconds). + Defaults + + to 500ms. With shorter values the model will respond more + quickly, + + but may jump in on short pauses from the user. required: - - type - - item_id + - client_secret x-oaiMeta: - name: conversation.item.delete + name: The transcription session object group: realtime example: | { - "event_id": "event_901", - "type": "conversation.item.delete", - "item_id": "msg_003" + "id": "sess_BBwZc7cFV3XizEyKGDCGL", + "object": "realtime.transcription_session", + "expires_at": 1742188264, + "modalities": ["audio", "text"], + "turn_detection": { + "type": "server_vad", + "threshold": 0.5, + "prefix_padding_ms": 300, + "silence_duration_ms": 200 + }, + "input_audio_format": "pcm16", + "input_audio_transcription": { + "model": "gpt-4o-transcribe", + "language": null, + "prompt": "" + }, + "client_secret": null } - RealtimeClientEventConversationItemTruncate: + Reasoning: type: object - description: >- - Send this event to truncate a previous assistant message’s audio. The - server will produce audio faster than realtime, so this event is useful - when the user interrupts to truncate audio that has already been sent to - the client but not yet played. This will synchronize the server's - understanding of the audio with the client's playback. - - Truncating audio will delete the server-side text transcript to ensure - there is not text in the context that hasn't been heard by the user. + description: | + **o-series models only** - If successful, the server will respond with a - `conversation.item.truncated` event. + Configuration options for + [reasoning models](https://platform.openai.com/docs/guides/reasoning). + title: Reasoning properties: - event_id: - type: string - description: Optional client-generated ID used to identify this event. - type: + effort: + $ref: "#/components/schemas/ReasoningEffort" + summary: type: string - description: The event type, must be "conversation.item.truncate". - item_id: + description: > + A summary of the reasoning performed by the model. This can be + + useful for debugging and understanding the model's reasoning + process. + + One of `auto`, `concise`, or `detailed`. + enum: + - auto + - concise + - detailed + nullable: true + generate_summary: type: string - description: The ID of the assistant message item to truncate. Only assistant - message items can be truncated. - content_index: - type: integer - description: The index of the content part to truncate. Set this to 0. - audio_end_ms: - type: integer - description: Inclusive duration up to which audio is truncated, in milliseconds. - If the audio_end_ms is greater than the actual audio duration, the - server will respond with an error. - required: - - type - - item_id - - content_index - - audio_end_ms - x-oaiMeta: - name: conversation.item.truncate - group: realtime - example: | - { - "event_id": "event_678", - "type": "conversation.item.truncate", - "item_id": "msg_002", - "content_index": 0, - "audio_end_ms": 1500 - } - RealtimeClientEventInputAudioBufferAppend: + deprecated: true + description: > + **Deprecated:** use `summary` instead. + + + A summary of the reasoning performed by the model. This can be + + useful for debugging and understanding the model's reasoning + process. + + One of `auto`, `concise`, or `detailed`. + enum: + - auto + - concise + - detailed + nullable: true + ReasoningEffort: + type: string + enum: + - low + - medium + - high + default: medium + nullable: true + description: | + **o-series models only** + + Constrains effort on reasoning for + [reasoning models](https://platform.openai.com/docs/guides/reasoning). + Currently supported values are `low`, `medium`, and `high`. Reducing + reasoning effort can result in faster responses and fewer tokens used + on reasoning in a response. + ReasoningItem: type: object - description: >- - Send this event to append audio bytes to the input audio buffer. The - audio buffer is temporary storage you can write to and later commit. In - Server VAD mode, the audio buffer is used to detect speech and the - server will decide when to commit. When Server VAD is disabled, you must - commit the audio buffer manually. + description: > + A description of the chain of thought used by a reasoning model while + generating - The client may choose how much audio to place in each event up to a - maximum of 15 MiB, for example streaming smaller chunks from the client - may allow the VAD to be more responsive. Unlike made other client - events, the server will not send a confirmation response to this event. + a response. Be sure to include these items in your `input` to the + Responses API + + for subsequent turns of a conversation if you are manually + + [managing context](/docs/guides/conversation-state). + title: Reasoning properties: - event_id: - type: string - description: Optional client-generated ID used to identify this event. type: type: string - description: The event type, must be "input_audio_buffer.append". - audio: + description: | + The type of the object. Always `reasoning`. + enum: + - reasoning + x-stainless-const: true + id: + type: string + description: | + The unique identifier of the reasoning content. + encrypted_content: + type: string + description: > + The encrypted content of the reasoning item - populated when a + response is + + generated with `reasoning.encrypted_content` in the `include` + parameter. + nullable: true + summary: + type: array + description: | + Reasoning text contents. + items: + type: object + properties: + type: + type: string + description: | + The type of the object. Always `summary_text`. + enum: + - summary_text + x-stainless-const: true + text: + type: string + description: > + A short summary of the reasoning used by the model when + generating + + the response. + required: + - type + - text + status: type: string - description: Base64-encoded audio bytes. This must be in the format specified by - the `input_audio_format` field in the session configuration. + description: | + The status of the item. One of `in_progress`, `completed`, or + `incomplete`. Populated when items are returned via API. + enum: + - in_progress + - completed + - incomplete required: + - id + - summary - type - - audio - x-oaiMeta: - name: input_audio_buffer.append - group: realtime - example: | - { - "event_id": "event_456", - "type": "input_audio_buffer.append", - "audio": "Base64EncodedAudioData" - } - RealtimeClientEventInputAudioBufferClear: + Response: + title: The response object + allOf: + - $ref: "#/components/schemas/ModelResponseProperties" + - $ref: "#/components/schemas/ResponseProperties" + - type: object + properties: + id: + type: string + description: | + Unique identifier for this Response. + object: + type: string + description: | + The object type of this resource - always set to `response`. + enum: + - response + x-stainless-const: true + status: + type: string + description: > + The status of the response generation. One of `completed`, + `failed`, + + `in_progress`, or `incomplete`. + enum: + - completed + - failed + - in_progress + - incomplete + created_at: + type: number + description: | + Unix timestamp (in seconds) of when this Response was created. + error: + $ref: "#/components/schemas/ResponseError" + incomplete_details: + type: object + nullable: true + description: | + Details about why the response is incomplete. + properties: + reason: + type: string + description: The reason why the response is incomplete. + enum: + - max_output_tokens + - content_filter + output: + type: array + description: > + An array of content items generated by the model. + + + - The length and order of items in the `output` array is + dependent + on the model's response. + - Rather than accessing the first item in the `output` array + and + assuming it's an `assistant` message with the content generated by + the model, you might consider using the `output_text` property where + supported in SDKs. + items: + $ref: "#/components/schemas/OutputItem" + output_text: + type: string + nullable: true + description: > + SDK-only convenience property that contains the aggregated text + output + + from all `output_text` items in the `output` array, if any are + present. + + Supported in the Python and JavaScript SDKs. + x-oaiSupportedSDKs: + - python + - javascript + usage: + $ref: "#/components/schemas/ResponseUsage" + parallel_tool_calls: + type: boolean + description: | + Whether to allow the model to run tool calls in parallel. + default: true + required: + - id + - object + - created_at + - error + - incomplete_details + - instructions + - model + - tools + - output + - parallel_tool_calls + - metadata + - tool_choice + - temperature + - top_p + example: + id: resp_67ccd3a9da748190baa7f1570fe91ac604becb25c45c1d41 + object: response + created_at: 1741476777 + status: completed + error: null + incomplete_details: null + instructions: null + max_output_tokens: null + model: gpt-4o-2024-08-06 + output: + - type: message + id: msg_67ccd3acc8d48190a77525dc6de64b4104becb25c45c1d41 + status: completed + role: assistant + content: + - type: output_text + text: The image depicts a scenic landscape with a wooden boardwalk or pathway + leading through lush, green grass under a blue sky with some + clouds. The setting suggests a peaceful natural area, possibly + a park or nature reserve. There are trees and shrubs in the + background. + annotations: [] + parallel_tool_calls: true + previous_response_id: null + reasoning: + effort: null + summary: null + store: true + temperature: 1 + text: + format: + type: text + tool_choice: auto + tools: [] + top_p: 1 + truncation: disabled + usage: + input_tokens: 328 + input_tokens_details: + cached_tokens: 0 + output_tokens: 52 + output_tokens_details: + reasoning_tokens: 0 + total_tokens: 380 + user: null + metadata: {} + ResponseAudioDeltaEvent: type: object - description: Send this event to clear the audio bytes in the buffer. The server - will respond with an `input_audio_buffer.cleared` event. + description: Emitted when there is a partial audio response. properties: - event_id: - type: string - description: Optional client-generated ID used to identify this event. type: type: string - description: The event type, must be "input_audio_buffer.clear". + description: | + The type of the event. Always `response.audio.delta`. + enum: + - response.audio.delta + x-stainless-const: true + delta: + type: string + description: | + A chunk of Base64 encoded response audio bytes. required: - type + - delta x-oaiMeta: - name: input_audio_buffer.clear - group: realtime + name: response.audio.delta + group: responses example: | { - "event_id": "event_012", - "type": "input_audio_buffer.clear" + "type": "response.audio.delta", + "response_id": "resp_123", + "delta": "base64encoded..." } - RealtimeClientEventInputAudioBufferCommit: + ResponseAudioDoneEvent: type: object - description: >- - Send this event to commit the user input audio buffer, which will create - a new user message item in the conversation. This event will produce an - error if the input audio buffer is empty. When in Server VAD mode, the - client does not need to send this event, the server will commit the - audio buffer automatically. - - Committing the input audio buffer will trigger input audio transcription - (if enabled in session configuration), but it will not create a response - from the model. The server will respond with an - `input_audio_buffer.committed` event. + description: Emitted when the audio response is complete. properties: - event_id: - type: string - description: Optional client-generated ID used to identify this event. type: type: string - description: The event type, must be "input_audio_buffer.commit". + description: | + The type of the event. Always `response.audio.done`. + enum: + - response.audio.done + x-stainless-const: true required: - type + - response_id x-oaiMeta: - name: input_audio_buffer.commit - group: realtime + name: response.audio.done + group: responses example: | { - "event_id": "event_789", - "type": "input_audio_buffer.commit" + "type": "response.audio.done", + "response_id": "resp-123" } - RealtimeClientEventResponseCancel: + ResponseAudioTranscriptDeltaEvent: type: object - description: Send this event to cancel an in-progress response. The server will - respond with a `response.cancelled` event or an error if there is no - response to cancel. + description: Emitted when there is a partial transcript of audio. properties: - event_id: - type: string - description: Optional client-generated ID used to identify this event. type: type: string - description: The event type, must be `response.cancel`. + description: | + The type of the event. Always `response.audio.transcript.delta`. + enum: + - response.audio.transcript.delta + x-stainless-const: true + delta: + type: string + description: | + The partial transcript of the audio response. required: - type + - response_id + - delta x-oaiMeta: - name: response.cancel - group: realtime + name: response.audio.transcript.delta + group: responses example: | { - "event_id": "event_567", - "type": "response.cancel" + "type": "response.audio.transcript.delta", + "response_id": "resp_123", + "delta": " ... partial transcript ... " } - RealtimeClientEventResponseCreate: + ResponseAudioTranscriptDoneEvent: type: object - description: >- - This event instructs the server to create a Response, which means - triggering model inference. When in Server VAD mode, the server will - create Responses automatically. - - A Response will include at least one Item, and may have two, in which - case the second will be a function call. These Items will be appended to - the conversation history. - - The server will respond with a `response.created` event, events for - Items and content created, and finally a `response.done` event to - indicate the Response is complete. - - The `response.create` event includes inference configuration like - `instructions`, and `temperature`. These fields will override the - Session's configuration for this Response only. + description: Emitted when the full audio transcript is completed. properties: - event_id: - type: string - description: Optional client-generated ID used to identify this event. type: type: string - description: The event type, must be `response.create`. - response: - $ref: "#/components/schemas/RealtimeResponse" + description: | + The type of the event. Always `response.audio.transcript.done`. + enum: + - response.audio.transcript.done + x-stainless-const: true required: - type - - response + - response_id x-oaiMeta: - name: response.create - group: realtime + name: response.audio.transcript.done + group: responses example: | { - "event_id": "event_234", - "type": "response.create", - "response": { - "modalities": ["text", "audio"], - "instructions": "Please assist the user.", - "voice": "alloy", - "output_audio_format": "pcm16", - "tools": [ - { - "type": "function", - "name": "calculate_sum", - "description": "Calculates the sum of two numbers.", - "parameters": { - "type": "object", - "properties": { - "a": { "type": "number" }, - "b": { "type": "number" } - }, - "required": ["a", "b"] - } - } - ], - "tool_choice": "auto", - "temperature": 0.7, - "max_output_tokens": 150 - } + "type": "response.audio.transcript.done", + "response_id": "resp_123" } - RealtimeClientEventSessionUpdate: + ResponseCodeInterpreterCallCodeDeltaEvent: type: object - description: Send this event to update the session’s default configuration. The - client may send this event at any time to update the session - configuration, and any field may be updated at any time, except for - "voice". The server will respond with a `session.updated` event that - shows the full effective configuration. Only fields that are present are - updated, thus the correct way to clear a field like "instructions" is to - pass an empty string. + description: Emitted when a partial code snippet is added by the code interpreter. properties: - event_id: - type: string - description: Optional client-generated ID used to identify this event. type: type: string - description: The event type, must be "session.update". - session: - $ref: "#/components/schemas/RealtimeSession" + description: > + The type of the event. Always + `response.code_interpreter_call.code.delta`. + enum: + - response.code_interpreter_call.code.delta + x-stainless-const: true + output_index: + type: integer + description: > + The index of the output item that the code interpreter call is in + progress. + delta: + type: string + description: | + The partial code snippet added by the code interpreter. required: - type - - session + - response_id + - output_index + - delta x-oaiMeta: - name: session.update - group: realtime - example: > - { - "event_id": "event_123", - "type": "session.update", - "session": { - "modalities": ["text", "audio"], - "instructions": "Your knowledge cutoff is 2023-10. You are a helpful assistant.", - "voice": "alloy", - "input_audio_format": "pcm16", - "output_audio_format": "pcm16", - "input_audio_transcription": { - "model": "whisper-1" - }, - "turn_detection": { - "type": "server_vad", - "threshold": 0.5, - "prefix_padding_ms": 300, - "silence_duration_ms": 500 - }, - "tools": [ - { - "type": "function", - "name": "get_weather", - "description": "Get the current weather for a location, tell the user you are fetching the weather.", - "parameters": { - "type": "object", - "properties": { - "location": { "type": "string" } - }, - "required": ["location"] - } - } - ], - "tool_choice": "auto", - "temperature": 0.8, - "max_response_output_tokens": "inf" - } - } - RealtimeConversationItem: - type: object - description: The item to add to the conversation. - properties: - id: - type: string - description: The unique ID of the item, this can be generated by the client to - help manage server-side context, but is not required because the - server will generate one if not provided. - type: - type: string - description: The type of the item (`message`, `function_call`, - `function_call_output`). - status: - type: string - description: The status of the item (`completed`, `incomplete`). These have no - effect on the conversation, but are accepted for consistency with - the `conversation.item.created` event. - role: - type: string - description: The role of the message sender (`user`, `assistant`, `system`), - only applicable for `message` items. - content: - type: array - description: The content of the message, applicable for `message` items. Message - items with a role of `system` support only `input_text` content, - message items of role `user` support `input_text` and `input_audio` - content, and message items of role `assistant` support `text` - content. - items: - type: object - properties: - type: - type: string - description: The content type (`input_text`, `input_audio`, `text`). - text: - type: string - description: The text content, used for `input_text` and `text` content types. - audio: - type: string - description: Base64-encoded audio bytes, used for `input_audio` content type. - transcript: - type: string - description: The transcript of the audio, used for `input_audio` content type. - call_id: - type: string - description: The ID of the function call (for `function_call` and - `function_call_output` items). If passed on a `function_call_output` - item, the server will check that a `function_call` item with the - same ID exists in the conversation history. - name: - type: string - description: The name of the function being called (for `function_call` items). - arguments: - type: string - description: The arguments of the function call (for `function_call` items). - output: - type: string - description: The output of the function call (for `function_call_output` items). - RealtimeResponse: - type: object - description: The response resource. - properties: - id: - type: string - description: The unique ID of the response. - object: - type: string - description: The object type, must be `realtime.response`. - status: - type: string - description: The final status of the response (`completed`, `cancelled`, - `failed`, `incomplete`). - status_details: - type: object - description: Additional details about the status. - properties: - type: - type: string - description: The type of error that caused the response to fail, corresponding - with the `status` field (`cancelled`, `incomplete`, `failed`). - reason: - type: string - description: The reason the Response did not complete. For a `cancelled` - Response, one of `turn_detected` (the server VAD detected a new - start of speech) or `client_cancelled` (the client sent a cancel - event). For an `incomplete` Response, one of `max_output_tokens` - or `content_filter` (the server-side safety filter activated and - cut off the response). - error: - type: object - description: A description of the error that caused the response to fail, - populated when the `status` is `failed`. - properties: - type: - type: string - description: The type of error. - code: - type: string - description: Error code, if any. - output: - type: array - description: The list of output items generated by the response. - items: - type: object - description: An item in the response output. - usage: - type: object - description: Usage statistics for the Response, this will correspond to billing. - A Realtime API session will maintain a conversation context and - append new Items to the Conversation, thus output from previous - turns (text and audio tokens) will become the input for later turns. - properties: - total_tokens: - type: integer - description: The total number of tokens in the Response including input and - output text and audio tokens. - input_tokens: - type: integer - description: The number of input tokens used in the Response, including text and - audio tokens. - output_tokens: - type: integer - description: The number of output tokens sent in the Response, including text - and audio tokens. - input_token_details: - type: object - description: Details about the input tokens used in the Response. - properties: - cached_tokens: - type: integer - description: The number of cached tokens used in the Response. - text_tokens: - type: integer - description: The number of text tokens used in the Response. - audio_tokens: - type: integer - description: The number of audio tokens used in the Response. - output_token_details: - type: object - description: Details about the output tokens used in the Response. - properties: - text_tokens: - type: integer - description: The number of text tokens used in the Response. - audio_tokens: - type: integer - description: The number of audio tokens used in the Response. - RealtimeServerEventConversationCreated: + name: response.code_interpreter_call.code.delta + group: responses + example: | + { + "type": "response.code_interpreter_call.code.delta", + "response_id": "resp-123", + "output_index": 0, + "delta": "partial code" + } + ResponseCodeInterpreterCallCodeDoneEvent: type: object - description: Returned when a conversation is created. Emitted right after - session creation. + description: Emitted when code snippet output is finalized by the code interpreter. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be "conversation.created". - conversation: - type: object - description: The conversation resource. - properties: - id: - type: string - description: The unique ID of the conversation. - object: - type: string - description: The object type, must be "realtime.conversation". + description: > + The type of the event. Always + `response.code_interpreter_call.code.done`. + enum: + - response.code_interpreter_call.code.done + x-stainless-const: true + output_index: + type: integer + description: > + The index of the output item that the code interpreter call is in + progress. + code: + type: string + description: | + The final code snippet output by the code interpreter. required: - - event_id - type - - conversation + - response_id + - output_index + - code x-oaiMeta: - name: conversation.created - group: realtime + name: response.code_interpreter_call.code.done + group: responses example: | { - "event_id": "event_9101", - "type": "conversation.created", - "conversation": { - "id": "conv_001", - "object": "realtime.conversation" - } + "type": "response.code_interpreter_call.code.done", + "response_id": "resp-123", + "output_index": 3, + "code": "console.log('done');" } - RealtimeServerEventConversationItemCreated: + ResponseCodeInterpreterCallCompletedEvent: type: object - description: >- - Returned when a conversation item is created. There are several - scenarios that produce this event: - - The server is generating a Response, which if successful will produce either one or two Items, which will be of type `message` (role `assistant`) or type `function_call`. - - The input audio buffer has been committed, either by the client or the server (in `server_vad` mode). The server will take the content of the input audio buffer and add it to a new user message Item. - - The client has sent a `conversation.item.create` event to add a new Item to the Conversation. + description: Emitted when the code interpreter call is completed. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be `conversation.item.created`. - previous_item_id: - type: string - description: The ID of the preceding item in the Conversation context, allows - the client to understand the order of the conversation. - item: - $ref: "#/components/schemas/RealtimeConversationItem" + description: > + The type of the event. Always + `response.code_interpreter_call.completed`. + enum: + - response.code_interpreter_call.completed + x-stainless-const: true + output_index: + type: integer + description: > + The index of the output item that the code interpreter call is in + progress. + code_interpreter_call: + $ref: "#/components/schemas/CodeInterpreterToolCall" required: - - event_id - type - - previous_item_id - - item + - response_id + - output_index + - code_interpreter_call x-oaiMeta: - name: conversation.item.created - group: realtime + name: response.code_interpreter_call.completed + group: responses example: | { - "event_id": "event_1920", - "type": "conversation.item.created", - "previous_item_id": "msg_002", - "item": { - "id": "msg_003", - "object": "realtime.item", - "type": "message", - "status": "completed", - "role": "user", - "content": [ - { - "type": "input_audio", - "transcript": "hello how are you", - "audio": "base64encodedaudio==" - } - ] - } + "type": "response.code_interpreter_call.completed", + "response_id": "resp-123", + "output_index": 5, + "code_interpreter_call": {} } - RealtimeServerEventConversationItemDeleted: + ResponseCodeInterpreterCallInProgressEvent: type: object - description: Returned when an item in the conversation is deleted by the client - with a `conversation.item.delete` event. This event is used to - synchronize the server's understanding of the conversation history with - the client's view. + description: Emitted when a code interpreter call is in progress. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be `conversation.item.deleted`. - item_id: - type: string - description: The ID of the item that was deleted. + description: > + The type of the event. Always + `response.code_interpreter_call.in_progress`. + enum: + - response.code_interpreter_call.in_progress + x-stainless-const: true + output_index: + type: integer + description: > + The index of the output item that the code interpreter call is in + progress. + code_interpreter_call: + $ref: "#/components/schemas/CodeInterpreterToolCall" required: - - event_id - type - - item_id + - response_id + - output_index + - code_interpreter_call x-oaiMeta: - name: conversation.item.deleted - group: realtime + name: response.code_interpreter_call.in_progress + group: responses example: | { - "event_id": "event_2728", - "type": "conversation.item.deleted", - "item_id": "msg_005" + "type": "response.code_interpreter_call.in.progress", + "response_id": "resp-123", + "output_index": 0, + "code_interpreter_call": {} } - RealtimeServerEventConversationItemInputAudioTranscriptionCompleted: + ResponseCodeInterpreterCallInterpretingEvent: type: object - description: >- - This event is the output of audio transcription for user audio written - to the user audio buffer. Transcription begins when the input audio - buffer is committed by the client or server (in `server_vad` mode). - Transcription runs asynchronously with Response creation, so this event - may come before or after the Response events. - - Realtime API models accept audio natively, and thus input transcription - is a separate process run on a separate ASR (Automatic Speech - Recognition) model, currently always `whisper-1`. Thus the transcript - may diverge somewhat from the model's interpretation, and should be - treated as a rough guide. + description: Emitted when the code interpreter is actively interpreting the code + snippet. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be - `conversation.item.input_audio_transcription.completed`. - item_id: - type: string - description: The ID of the user message item containing the audio. - content_index: + description: > + The type of the event. Always + `response.code_interpreter_call.interpreting`. + enum: + - response.code_interpreter_call.interpreting + x-stainless-const: true + output_index: type: integer - description: The index of the content part containing the audio. - transcript: - type: string - description: The transcribed text. + description: > + The index of the output item that the code interpreter call is in + progress. + code_interpreter_call: + $ref: "#/components/schemas/CodeInterpreterToolCall" required: - - event_id - type - - item_id - - content_index - - transcript + - response_id + - output_index + - code_interpreter_call x-oaiMeta: - name: conversation.item.input_audio_transcription.completed - group: realtime + name: response.code_interpreter_call.interpreting + group: responses example: | { - "event_id": "event_2122", - "type": "conversation.item.input_audio_transcription.completed", - "item_id": "msg_003", - "content_index": 0, - "transcript": "Hello, how are you?" + "type": "response.code_interpreter_call.interpreting", + "response_id": "resp-123", + "output_index": 4, + "code_interpreter_call": {} } - RealtimeServerEventConversationItemInputAudioTranscriptionFailed: + ResponseCompletedEvent: type: object - description: Returned when input audio transcription is configured, and a - transcription request for a user message failed. These events are - separate from other `error` events so that the client can identify the - related Item. + description: Emitted when the model response is complete. properties: - event_id: + type: type: string - description: The unique ID of the server event. + description: | + The type of the event. Always `response.completed`. + enum: + - response.completed + x-stainless-const: true + response: + $ref: "#/components/schemas/Response" + description: | + Properties of the completed response. + required: + - type + - response + x-oaiMeta: + name: response.completed + group: responses + example: > + { + "type": "response.completed", + "response": { + "id": "resp_123", + "object": "response", + "created_at": 1740855869, + "status": "completed", + "error": null, + "incomplete_details": null, + "input": [], + "instructions": null, + "max_output_tokens": null, + "model": "gpt-4o-mini-2024-07-18", + "output": [ + { + "id": "msg_123", + "type": "message", + "role": "assistant", + "content": [ + { + "type": "output_text", + "text": "In a shimmering forest under a sky full of stars, a lonely unicorn named Lila discovered a hidden pond that glowed with moonlight. Every night, she would leave sparkling, magical flowers by the water's edge, hoping to share her beauty with others. One enchanting evening, she woke to find a group of friendly animals gathered around, eager to be friends and share in her magic.", + "annotations": [] + } + ] + } + ], + "previous_response_id": null, + "reasoning_effort": null, + "store": false, + "temperature": 1, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [], + "top_p": 1, + "truncation": "disabled", + "usage": { + "input_tokens": 0, + "output_tokens": 0, + "output_tokens_details": { + "reasoning_tokens": 0 + }, + "total_tokens": 0 + }, + "user": null, + "metadata": {} + } + } + ResponseContentPartAddedEvent: + type: object + description: Emitted when a new content part is added. + properties: type: type: string - description: The event type, must be - `conversation.item.input_audio_transcription.failed`. + description: | + The type of the event. Always `response.content_part.added`. + enum: + - response.content_part.added + x-stainless-const: true item_id: type: string - description: The ID of the user message item. + description: | + The ID of the output item that the content part was added to. + output_index: + type: integer + description: | + The index of the output item that the content part was added to. content_index: type: integer - description: The index of the content part containing the audio. - error: - type: object - description: Details of the transcription error. - properties: - type: - type: string - description: The type of error. - code: - type: string - description: Error code, if any. - message: - type: string - description: A human-readable error message. - param: - type: string - description: Parameter related to the error, if any. + description: | + The index of the content part that was added. + part: + $ref: "#/components/schemas/OutputContent" + description: | + The content part that was added. required: - - event_id - type - item_id + - output_index - content_index - - error + - part x-oaiMeta: - name: conversation.item.input_audio_transcription.failed - group: realtime + name: response.content_part.added + group: responses example: | { - "event_id": "event_2324", - "type": "conversation.item.input_audio_transcription.failed", - "item_id": "msg_003", - "content_index": 0, - "error": { - "type": "transcription_error", - "code": "audio_unintelligible", - "message": "The audio could not be transcribed.", - "param": null - } + "type": "response.content_part.added", + "item_id": "msg_123", + "output_index": 0, + "content_index": 0, + "part": { + "type": "output_text", + "text": "", + "annotations": [] + } } - RealtimeServerEventConversationItemTruncated: + ResponseContentPartDoneEvent: type: object - description: >- - Returned when an earlier assistant audio message item is truncated by - the client with a `conversation.item.truncate` event. This event is used - to synchronize the server's understanding of the audio with the client's - playback. - - This action will truncate the audio and remove the server-side text - transcript to ensure there is no text in the context that hasn't been - heard by the user. + description: Emitted when a content part is done. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be `conversation.item.truncated`. + description: | + The type of the event. Always `response.content_part.done`. + enum: + - response.content_part.done + x-stainless-const: true item_id: type: string - description: The ID of the assistant message item that was truncated. - content_index: + description: | + The ID of the output item that the content part was added to. + output_index: type: integer - description: The index of the content part that was truncated. - audio_end_ms: + description: | + The index of the output item that the content part was added to. + content_index: type: integer - description: The duration up to which the audio was truncated, in milliseconds. + description: | + The index of the content part that is done. + part: + $ref: "#/components/schemas/OutputContent" + description: | + The content part that is done. + required: + - type + - item_id + - output_index + - content_index + - part + x-oaiMeta: + name: response.content_part.done + group: responses + example: > + { + "type": "response.content_part.done", + "item_id": "msg_123", + "output_index": 0, + "content_index": 0, + "part": { + "type": "output_text", + "text": "In a shimmering forest under a sky full of stars, a lonely unicorn named Lila discovered a hidden pond that glowed with moonlight. Every night, she would leave sparkling, magical flowers by the water's edge, hoping to share her beauty with others. One enchanting evening, she woke to find a group of friendly animals gathered around, eager to be friends and share in her magic.", + "annotations": [] + } + } + ResponseCreatedEvent: + type: object + description: | + An event that is emitted when a response is created. + properties: + type: + type: string + description: | + The type of the event. Always `response.created`. + enum: + - response.created + x-stainless-const: true + response: + $ref: "#/components/schemas/Response" + description: | + The response that was created. required: - - event_id - type - - item_id - - content_index - - audio_end_ms + - response x-oaiMeta: - name: conversation.item.truncated - group: realtime + name: response.created + group: responses example: | { - "event_id": "event_2526", - "type": "conversation.item.truncated", - "item_id": "msg_004", - "content_index": 0, - "audio_end_ms": 1500 + "type": "response.created", + "response": { + "id": "resp_67ccfcdd16748190a91872c75d38539e09e4d4aac714747c", + "object": "response", + "created_at": 1741487325, + "status": "in_progress", + "error": null, + "incomplete_details": null, + "instructions": null, + "max_output_tokens": null, + "model": "gpt-4o-2024-08-06", + "output": [], + "parallel_tool_calls": true, + "previous_response_id": null, + "reasoning": { + "effort": null, + "summary": null + }, + "store": true, + "temperature": 1, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [], + "top_p": 1, + "truncation": "disabled", + "usage": null, + "user": null, + "metadata": {} + } } - RealtimeServerEventError: + ResponseError: type: object - description: Returned when an error occurs, which could be a client problem or a - server problem. Most errors are recoverable and the session will stay - open, we recommend to implementors to monitor and log error messages by - default. + description: | + An error object returned when the model fails to generate a Response. + nullable: true properties: - event_id: + code: + $ref: "#/components/schemas/ResponseErrorCode" + message: type: string - description: The unique ID of the server event. + description: | + A human-readable description of the error. + required: + - code + - message + ResponseErrorCode: + type: string + description: | + The error code for the response. + enum: + - server_error + - rate_limit_exceeded + - invalid_prompt + - vector_store_timeout + - invalid_image + - invalid_image_format + - invalid_base64_image + - invalid_image_url + - image_too_large + - image_too_small + - image_parse_error + - image_content_policy_violation + - invalid_image_mode + - image_file_too_large + - unsupported_image_media_type + - empty_image_file + - failed_to_download_image + - image_file_not_found + ResponseErrorEvent: + type: object + description: Emitted when an error occurs. + properties: type: type: string - description: The event type, must be "error". - error: - type: object - description: Details of the error. - properties: - type: - type: string - description: The type of error (e.g., "invalid_request_error", "server_error"). - code: - type: string - description: Error code, if any. - message: - type: string - description: A human-readable error message. - param: - type: string - description: Parameter related to the error, if any. - event_id: - type: string - description: The event_id of the client event that caused the error, if - applicable. + description: | + The type of the event. Always `error`. + enum: + - error + x-stainless-const: true + code: + type: string + description: | + The error code. + nullable: true + message: + type: string + description: | + The error message. + param: + type: string + description: | + The error parameter. + nullable: true required: - - event_id - type - - error + - code + - message + - param x-oaiMeta: name: error - group: realtime + group: responses example: | { - "event_id": "event_890", - "type": "error", - "error": { - "type": "invalid_request_error", - "code": "invalid_event", - "message": "The 'type' field is missing.", - "param": null, - "event_id": "event_567" - } + "type": "error", + "code": "ERR_SOMETHING", + "message": "Something went wrong", + "param": null } - RealtimeServerEventInputAudioBufferCleared: + ResponseFailedEvent: type: object - description: Returned when the input audio buffer is cleared by the client with - a `input_audio_buffer.clear` event. + description: | + An event that is emitted when a response fails. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be `input_audio_buffer.cleared`. + description: | + The type of the event. Always `response.failed`. + enum: + - response.failed + x-stainless-const: true + response: + $ref: "#/components/schemas/Response" + description: | + The response that failed. required: - - event_id - type + - response x-oaiMeta: - name: input_audio_buffer.cleared - group: realtime + name: response.failed + group: responses example: | { - "event_id": "event_1314", - "type": "input_audio_buffer.cleared" + "type": "response.failed", + "response": { + "id": "resp_123", + "object": "response", + "created_at": 1740855869, + "status": "failed", + "error": { + "code": "server_error", + "message": "The model failed to generate a response." + }, + "incomplete_details": null, + "instructions": null, + "max_output_tokens": null, + "model": "gpt-4o-mini-2024-07-18", + "output": [], + "previous_response_id": null, + "reasoning_effort": null, + "store": false, + "temperature": 1, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [], + "top_p": 1, + "truncation": "disabled", + "usage": null, + "user": null, + "metadata": {} + } } - RealtimeServerEventInputAudioBufferCommitted: + ResponseFileSearchCallCompletedEvent: type: object - description: Returned when an input audio buffer is committed, either by the - client or automatically in server VAD mode. The `item_id` property is - the ID of the user message item that will be created, thus a - `conversation.item.created` event will also be sent to the client. + description: Emitted when a file search call is completed (results found). properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be `input_audio_buffer.committed`. - previous_item_id: - type: string - description: The ID of the preceding item after which the new item will be - inserted. + description: | + The type of the event. Always `response.file_search_call.completed`. + enum: + - response.file_search_call.completed + x-stainless-const: true + output_index: + type: integer + description: | + The index of the output item that the file search call is initiated. item_id: type: string - description: The ID of the user message item that will be created. + description: | + The ID of the output item that the file search call is initiated. required: - - event_id - type - - previous_item_id + - output_index - item_id x-oaiMeta: - name: input_audio_buffer.committed - group: realtime + name: response.file_search_call.completed + group: responses example: | { - "event_id": "event_1121", - "type": "input_audio_buffer.committed", - "previous_item_id": "msg_001", - "item_id": "msg_002" + "type": "response.file_search_call.completed", + "output_index": 0, + "item_id": "fs_123", } - RealtimeServerEventInputAudioBufferSpeechStarted: + ResponseFileSearchCallInProgressEvent: type: object - description: Sent by the server when in `server_vad` mode to indicate that - speech has been detected in the audio buffer. This can happen any time - audio is added to the buffer (unless speech is already detected). The - client may want to use this event to interrupt audio playback or provide - visual feedback to the user. The client should expect to receive a - `input_audio_buffer.speech_stopped` event when speech stops. The - `item_id` property is the ID of the user message item that will be - created when speech stops and will also be included in the - `input_audio_buffer.speech_stopped` event (unless the client manually - commits the audio buffer during VAD activation). + description: Emitted when a file search call is initiated. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be `input_audio_buffer.speech_started`. - audio_start_ms: + description: > + The type of the event. Always + `response.file_search_call.in_progress`. + enum: + - response.file_search_call.in_progress + x-stainless-const: true + output_index: type: integer - description: Milliseconds from the start of all audio written to the buffer - during the session when speech was first detected. This will - correspond to the beginning of audio sent to the model, and thus - includes the `prefix_padding_ms` configured in the Session. + description: | + The index of the output item that the file search call is initiated. item_id: type: string - description: The ID of the user message item that will be created when speech - stops. + description: | + The ID of the output item that the file search call is initiated. required: - - event_id - type - - audio_start_ms + - output_index - item_id x-oaiMeta: - name: input_audio_buffer.speech_started - group: realtime + name: response.file_search_call.in_progress + group: responses example: | { - "event_id": "event_1516", - "type": "input_audio_buffer.speech_started", - "audio_start_ms": 1000, - "item_id": "msg_003" + "type": "response.file_search_call.in_progress", + "output_index": 0, + "item_id": "fs_123", } - RealtimeServerEventInputAudioBufferSpeechStopped: + ResponseFileSearchCallSearchingEvent: type: object - description: Returned in `server_vad` mode when the server detects the end of - speech in the audio buffer. The server will also send an - `conversation.item.created` event with the user message item that is - created from the audio buffer. + description: Emitted when a file search is currently searching. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be `input_audio_buffer.speech_stopped`. - audio_end_ms: + description: | + The type of the event. Always `response.file_search_call.searching`. + enum: + - response.file_search_call.searching + x-stainless-const: true + output_index: type: integer - description: Milliseconds since the session started when speech stopped. This - will correspond to the end of audio sent to the model, and thus - includes the `min_silence_duration_ms` configured in the Session. + description: | + The index of the output item that the file search call is searching. item_id: type: string - description: The ID of the user message item that will be created. + description: | + The ID of the output item that the file search call is initiated. required: - - event_id - type - - audio_end_ms + - output_index - item_id x-oaiMeta: - name: input_audio_buffer.speech_stopped - group: realtime + name: response.file_search_call.searching + group: responses example: | { - "event_id": "event_1718", - "type": "input_audio_buffer.speech_stopped", - "audio_end_ms": 2000, - "item_id": "msg_003" + "type": "response.file_search_call.searching", + "output_index": 0, + "item_id": "fs_123", } - RealtimeServerEventRateLimitsUpdated: + ResponseFormatJsonObject: type: object - description: Emitted at the beginning of a Response to indicate the updated rate - limits. When a Response is created some tokens will be "reserved" for - the output tokens, the rate limits shown here reflect that reservation, - which is then adjusted accordingly once the Response is completed. + title: JSON object + description: > + JSON object response format. An older method of generating JSON + responses. + + Using `json_schema` is recommended for models that support it. Note that + the + + model will not generate JSON without a system or user message + instructing it + + to do so. properties: - event_id: + type: type: string - description: The unique ID of the server event. + description: The type of response format being defined. Always `json_object`. + enum: + - json_object + x-stainless-const: true + required: + - type + ResponseFormatJsonSchema: + type: object + title: JSON schema + description: | + JSON Schema response format. Used to generate structured JSON responses. + Learn more about [Structured Outputs](/docs/guides/structured-outputs). + properties: type: type: string - description: The event type, must be `rate_limits.updated`. - rate_limits: - type: array - description: List of rate limit information. - items: - type: object - properties: - name: - type: string - description: The name of the rate limit (`requests`, `tokens`). - limit: - type: integer - description: The maximum allowed value for the rate limit. - remaining: - type: integer - description: The remaining value before the limit is reached. - reset_seconds: - type: number - description: Seconds until the rate limit resets. + description: The type of response format being defined. Always `json_schema`. + enum: + - json_schema + x-stainless-const: true + json_schema: + type: object + title: JSON schema + description: | + Structured Outputs configuration options, including a JSON Schema. + properties: + description: + type: string + description: > + A description of what the response format is for, used by the + model to + + determine how to respond in the format. + name: + type: string + description: > + The name of the response format. Must be a-z, A-Z, 0-9, or + contain + + underscores and dashes, with a maximum length of 64. + schema: + $ref: "#/components/schemas/ResponseFormatJsonSchemaSchema" + strict: + type: boolean + nullable: true + default: false + description: > + Whether to enable strict schema adherence when generating the + output. + + If set to true, the model will always follow the exact schema + defined + + in the `schema` field. Only a subset of JSON Schema is supported + when + + `strict` is `true`. To learn more, read the [Structured Outputs + + guide](/docs/guides/structured-outputs). + required: + - name + required: + - type + - json_schema + ResponseFormatJsonSchemaSchema: + type: object + title: JSON schema + description: | + The schema for the response format, described as a JSON Schema object. + Learn how to build JSON schemas [here](https://json-schema.org/). + additionalProperties: true + ResponseFormatText: + type: object + title: Text + description: | + Default response format. Used to generate text responses. + properties: + type: + type: string + description: The type of response format being defined. Always `text`. + enum: + - text + x-stainless-const: true required: - - event_id - type - - rate_limits - x-oaiMeta: - name: rate_limits.updated - group: realtime - example: | - { - "event_id": "event_5758", - "type": "rate_limits.updated", - "rate_limits": [ - { - "name": "requests", - "limit": 1000, - "remaining": 999, - "reset_seconds": 60 - }, - { - "name": "tokens", - "limit": 50000, - "remaining": 49950, - "reset_seconds": 60 - } - ] - } - RealtimeServerEventResponseAudioDelta: + ResponseFunctionCallArgumentsDeltaEvent: type: object - description: Returned when the model-generated audio is updated. + description: Emitted when there is a partial function-call arguments delta. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be "response.audio.delta". - response_id: - type: string - description: The ID of the response. + description: > + The type of the event. Always + `response.function_call_arguments.delta`. + enum: + - response.function_call_arguments.delta + x-stainless-const: true item_id: type: string - description: The ID of the item. + description: > + The ID of the output item that the function-call arguments delta is + added to. output_index: type: integer - description: The index of the output item in the response. - content_index: - type: integer - description: The index of the content part in the item's content array. + description: > + The index of the output item that the function-call arguments delta + is added to. delta: type: string - description: Base64-encoded audio data delta. + description: | + The function-call arguments delta that is added. required: - - event_id - type - - response_id - item_id - output_index - - content_index - delta x-oaiMeta: - name: response.audio.delta - group: realtime + name: response.function_call_arguments.delta + group: responses example: | { - "event_id": "event_4950", - "type": "response.audio.delta", - "response_id": "resp_001", - "item_id": "msg_008", - "output_index": 0, - "content_index": 0, - "delta": "Base64EncodedAudioDelta" + "type": "response.function_call_arguments.delta", + "item_id": "item-abc", + "output_index": 0, + "delta": "{ \"arg\":" } - RealtimeServerEventResponseAudioDone: + ResponseFunctionCallArgumentsDoneEvent: type: object - description: Returned when the model-generated audio is done. Also emitted when - a Response is interrupted, incomplete, or cancelled. + description: Emitted when function-call arguments are finalized. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be "response.audio.done". - response_id: - type: string - description: The ID of the response. + enum: + - response.function_call_arguments.done + x-stainless-const: true item_id: type: string description: The ID of the item. output_index: type: integer - description: The index of the output item in the response. - content_index: - type: integer - description: The index of the content part in the item's content array. + description: The index of the output item. + arguments: + type: string + description: The function-call arguments. required: - - event_id - type - - response_id - item_id - output_index - - content_index + - arguments x-oaiMeta: - name: response.audio.done - group: realtime + name: response.function_call_arguments.done + group: responses example: | { - "event_id": "event_5152", - "type": "response.audio.done", - "response_id": "resp_001", - "item_id": "msg_008", - "output_index": 0, - "content_index": 0 + "type": "response.function_call_arguments.done", + "item_id": "item-abc", + "output_index": 1, + "arguments": "{ \"arg\": 123 }" } - RealtimeServerEventResponseAudioTranscriptDelta: + ResponseInProgressEvent: type: object - description: Returned when the model-generated transcription of audio output is - updated. + description: Emitted when the response is in progress. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be "response.audio_transcript.delta". - response_id: - type: string - description: The ID of the response. - item_id: - type: string - description: The ID of the item. - output_index: - type: integer - description: The index of the output item in the response. - content_index: - type: integer - description: The index of the content part in the item's content array. - delta: - type: string - description: The transcript delta. + description: | + The type of the event. Always `response.in_progress`. + enum: + - response.in_progress + x-stainless-const: true + response: + $ref: "#/components/schemas/Response" + description: | + The response that is in progress. required: - - event_id - type - - response_id - - item_id - - output_index - - content_index - - delta + - response x-oaiMeta: - name: response.audio_transcript.delta - group: realtime + name: response.in_progress + group: responses example: | { - "event_id": "event_4546", - "type": "response.audio_transcript.delta", - "response_id": "resp_001", - "item_id": "msg_008", - "output_index": 0, - "content_index": 0, - "delta": "Hello, how can I a" + "type": "response.in_progress", + "response": { + "id": "resp_67ccfcdd16748190a91872c75d38539e09e4d4aac714747c", + "object": "response", + "created_at": 1741487325, + "status": "in_progress", + "error": null, + "incomplete_details": null, + "instructions": null, + "max_output_tokens": null, + "model": "gpt-4o-2024-08-06", + "output": [], + "parallel_tool_calls": true, + "previous_response_id": null, + "reasoning": { + "effort": null, + "summary": null + }, + "store": true, + "temperature": 1, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [], + "top_p": 1, + "truncation": "disabled", + "usage": null, + "user": null, + "metadata": {} + } } - RealtimeServerEventResponseAudioTranscriptDone: + ResponseIncompleteEvent: type: object - description: Returned when the model-generated transcription of audio output is - done streaming. Also emitted when a Response is interrupted, incomplete, - or cancelled. + description: | + An event that is emitted when a response finishes as incomplete. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be "response.audio_transcript.done". - response_id: - type: string - description: The ID of the response. - item_id: - type: string - description: The ID of the item. - output_index: - type: integer - description: The index of the output item in the response. - content_index: - type: integer - description: The index of the content part in the item's content array. - transcript: - type: string - description: The final transcript of the audio. + description: | + The type of the event. Always `response.incomplete`. + enum: + - response.incomplete + x-stainless-const: true + response: + $ref: "#/components/schemas/Response" + description: | + The response that was incomplete. required: - - event_id - type - - response_id - - item_id - - output_index - - content_index - - transcript + - response x-oaiMeta: - name: response.audio_transcript.done - group: realtime + name: response.incomplete + group: responses example: | { - "event_id": "event_4748", - "type": "response.audio_transcript.done", - "response_id": "resp_001", - "item_id": "msg_008", - "output_index": 0, - "content_index": 0, - "transcript": "Hello, how can I assist you today?" + "type": "response.incomplete", + "response": { + "id": "resp_123", + "object": "response", + "created_at": 1740855869, + "status": "incomplete", + "error": null, + "incomplete_details": { + "reason": "max_tokens" + }, + "instructions": null, + "max_output_tokens": null, + "model": "gpt-4o-mini-2024-07-18", + "output": [], + "previous_response_id": null, + "reasoning_effort": null, + "store": false, + "temperature": 1, + "text": { + "format": { + "type": "text" + } + }, + "tool_choice": "auto", + "tools": [], + "top_p": 1, + "truncation": "disabled", + "usage": null, + "user": null, + "metadata": {} + } } - RealtimeServerEventResponseContentPartAdded: + ResponseItemList: type: object - description: Returned when a new content part is added to an assistant message - item during response generation. + description: A list of Response items. properties: - event_id: - type: string - description: The unique ID of the server event. - type: + object: type: string - description: The event type, must be "response.content_part.added". - response_id: + description: The type of object returned, must be `list`. + enum: + - list + x-stainless-const: true + data: + type: array + description: A list of items used to generate this response. + items: + $ref: "#/components/schemas/ItemResource" + has_more: + type: boolean + description: Whether there are more items available. + first_id: type: string - description: The ID of the response. - item_id: + description: The ID of the first item in the list. + last_id: type: string - description: The ID of the item to which the content part was added. - output_index: - type: integer - description: The index of the output item in the response. - content_index: - type: integer - description: The index of the content part in the item's content array. - part: - type: object - description: The content part that was added. - properties: - type: - type: string - description: The content type ("text", "audio"). - text: - type: string - description: The text content (if type is "text"). - audio: - type: string - description: Base64-encoded audio data (if type is "audio"). - transcript: - type: string - description: The transcript of the audio (if type is "audio"). + description: The ID of the last item in the list. required: - - event_id - - type - - response_id - - item_id - - output_index - - content_index - - part - x-oaiMeta: - name: response.content_part.added - group: realtime - example: | - { - "event_id": "event_3738", - "type": "response.content_part.added", - "response_id": "resp_001", - "item_id": "msg_007", - "output_index": 0, - "content_index": 0, - "part": { - "type": "text", - "text": "" + - object + - data + - has_more + - first_id + - last_id + x-oaiMeta: + name: The input item list + group: responses + example: > + { + "object": "list", + "data": [ + { + "id": "msg_abc123", + "type": "message", + "role": "user", + "content": [ + { + "type": "input_text", + "text": "Tell me a three sentence bedtime story about a unicorn." + } + ] } + ], + "first_id": "msg_abc123", + "last_id": "msg_abc123", + "has_more": false } - RealtimeServerEventResponseContentPartDone: + ResponseModalities: + type: array + nullable: true + description: > + Output types that you would like the model to generate. + + Most models are capable of generating text, which is the default: + + + `["text"]` + + + The `gpt-4o-audio-preview` model can also be used to + + [generate audio](/docs/guides/audio). To request that this model + generate + + both text and audio responses, you can use: + + + `["text", "audio"]` + items: + type: string + enum: + - text + - audio + ResponseOutputItemAddedEvent: type: object - description: Returned when a content part is done streaming in an assistant - message item. Also emitted when a Response is interrupted, incomplete, - or cancelled. + description: Emitted when a new output item is added. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be "response.content_part.done". - response_id: - type: string - description: The ID of the response. - item_id: - type: string - description: The ID of the item. + description: | + The type of the event. Always `response.output_item.added`. + enum: + - response.output_item.added + x-stainless-const: true output_index: type: integer - description: The index of the output item in the response. - content_index: - type: integer - description: The index of the content part in the item's content array. - part: - type: object - description: The content part that is done. - properties: - type: - type: string - description: The content type ("text", "audio"). - text: - type: string - description: The text content (if type is "text"). - audio: - type: string - description: Base64-encoded audio data (if type is "audio"). - transcript: - type: string - description: The transcript of the audio (if type is "audio"). + description: | + The index of the output item that was added. + item: + $ref: "#/components/schemas/OutputItem" + description: | + The output item that was added. required: - - event_id - type - - response_id - - item_id - output_index - - content_index - - part + - item x-oaiMeta: - name: response.content_part.done - group: realtime + name: response.output_item.added + group: responses example: | { - "event_id": "event_3940", - "type": "response.content_part.done", - "response_id": "resp_001", - "item_id": "msg_007", - "output_index": 0, - "content_index": 0, - "part": { - "type": "text", - "text": "Sure, I can help with that." - } + "type": "response.output_item.added", + "output_index": 0, + "item": { + "id": "msg_123", + "status": "in_progress", + "type": "message", + "role": "assistant", + "content": [] + } } - RealtimeServerEventResponseCreated: + ResponseOutputItemDoneEvent: type: object - description: Returned when a new Response is created. The first event of - response creation, where the response is in an initial state of - `in_progress`. + description: Emitted when an output item is marked done. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be `response.created`. - response: - $ref: "#/components/schemas/RealtimeResponse" + description: | + The type of the event. Always `response.output_item.done`. + enum: + - response.output_item.done + x-stainless-const: true + output_index: + type: integer + description: | + The index of the output item that was marked done. + item: + $ref: "#/components/schemas/OutputItem" + description: | + The output item that was marked done. required: - - event_id - type - - response + - output_index + - item x-oaiMeta: - name: response.created - group: realtime - example: | + name: response.output_item.done + group: responses + example: > { - "event_id": "event_2930", - "type": "response.created", - "response": { - "id": "resp_001", - "object": "realtime.response", - "status": "in_progress", - "status_details": null, - "output": [], - "usage": null - } + "type": "response.output_item.done", + "output_index": 0, + "item": { + "id": "msg_123", + "status": "completed", + "type": "message", + "role": "assistant", + "content": [ + { + "type": "output_text", + "text": "In a shimmering forest under a sky full of stars, a lonely unicorn named Lila discovered a hidden pond that glowed with moonlight. Every night, she would leave sparkling, magical flowers by the water's edge, hoping to share her beauty with others. One enchanting evening, she woke to find a group of friendly animals gathered around, eager to be friends and share in her magic.", + "annotations": [] + } + ] + } } - RealtimeServerEventResponseDone: + ResponseProperties: type: object - description: Returned when a Response is done streaming. Always emitted, no - matter the final state. The Response object included in the - `response.done` event will include all output Items in the Response but - will omit the raw audio data. properties: - event_id: + previous_response_id: type: string - description: The unique ID of the server event. - type: + description: | + The unique ID of the previous response to the model. Use this to + create multi-turn conversations. Learn more about + [conversation state](/docs/guides/conversation-state). + nullable: true + model: + description: > + Model ID used to generate the response, like `gpt-4o` or `o3`. + OpenAI + + offers a wide range of models with different capabilities, + performance + + characteristics, and price points. Refer to the [model + guide](/docs/models) + + to browse and compare available models. + $ref: "#/components/schemas/ModelIdsResponses" + reasoning: + $ref: "#/components/schemas/Reasoning" + nullable: true + max_output_tokens: + description: > + An upper bound for the number of tokens that can be generated for a + response, including visible output tokens and [reasoning + tokens](/docs/guides/reasoning). + type: integer + nullable: true + instructions: type: string - description: The event type, must be "response.done". - response: - $ref: "#/components/schemas/RealtimeResponse" - required: - - event_id - - type - - response - x-oaiMeta: - name: response.done - group: realtime - example: | - { - "event_id": "event_3132", - "type": "response.done", - "response": { - "id": "resp_001", - "object": "realtime.response", - "status": "completed", - "status_details": null, - "output": [ - { - "id": "msg_006", - "object": "realtime.item", - "type": "message", - "status": "completed", - "role": "assistant", - "content": [ - { - "type": "text", - "text": "Sure, how can I assist you today?" - } - ] - } - ], - "usage": { - "total_tokens":275, - "input_tokens":127, - "output_tokens":148, - "input_token_details": { - "cached_tokens":384, - "text_tokens":119, - "audio_tokens":8, - "cached_tokens_details": { - "text_tokens": 128, - "audio_tokens": 256 - } - }, - "output_token_details": { - "text_tokens":36, - "audio_tokens":112 - } - } - } - } - RealtimeServerEventResponseFunctionCallArgumentsDelta: + description: > + Inserts a system (or developer) message as the first item in the + model's context. + + + When using along with `previous_response_id`, the instructions from + a previous + + response will not be carried over to the next response. This makes + it simple + + to swap out system (or developer) messages in new responses. + nullable: true + text: + type: object + description: > + Configuration options for a text response from the model. Can be + plain + + text or structured JSON data. Learn more: + + - [Text inputs and outputs](/docs/guides/text) + + - [Structured Outputs](/docs/guides/structured-outputs) + properties: + format: + $ref: "#/components/schemas/TextResponseFormatConfiguration" + tools: + type: array + description: > + An array of tools the model may call while generating a response. + You + + can specify which tool to use by setting the `tool_choice` + parameter. + + + The two categories of tools you can provide the model are: + + + - **Built-in tools**: Tools that are provided by OpenAI that extend + the + model's capabilities, like [web search](/docs/guides/tools-web-search) + or [file search](/docs/guides/tools-file-search). Learn more about + [built-in tools](/docs/guides/tools). + - **Function calls (custom tools)**: Functions that are defined by + you, + enabling the model to call your own code. Learn more about + [function calling](/docs/guides/function-calling). + items: + $ref: "#/components/schemas/Tool" + tool_choice: + description: > + How the model should select which tool (or tools) to use when + generating + + a response. See the `tools` parameter to see how to specify which + tools + + the model can call. + oneOf: + - $ref: "#/components/schemas/ToolChoiceOptions" + - $ref: "#/components/schemas/ToolChoiceTypes" + - $ref: "#/components/schemas/ToolChoiceFunction" + truncation: + type: string + description: > + The truncation strategy to use for the model response. + + - `auto`: If the context of this response and previous ones exceeds + the model's context window size, the model will truncate the + response to fit the context window by dropping input items in the + middle of the conversation. + - `disabled` (default): If a model response will exceed the context + window + size for a model, the request will fail with a 400 error. + enum: + - auto + - disabled + nullable: true + default: disabled + ResponseReasoningSummaryPartAddedEvent: type: object - description: Returned when the model-generated function call arguments are updated. + description: Emitted when a new reasoning summary part is added. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be "response.function_call_arguments.delta". - response_id: - type: string - description: The ID of the response. + description: > + The type of the event. Always + `response.reasoning_summary_part.added`. + enum: + - response.reasoning_summary_part.added + x-stainless-const: true item_id: type: string - description: The ID of the function call item. + description: | + The ID of the item this summary part is associated with. output_index: type: integer - description: The index of the output item in the response. - call_id: - type: string - description: The ID of the function call. - delta: - type: string - description: The arguments delta as a JSON string. + description: | + The index of the output item this summary part is associated with. + summary_index: + type: integer + description: | + The index of the summary part within the reasoning summary. + part: + type: object + description: | + The summary part that was added. + properties: + type: + type: string + description: The type of the summary part. Always `summary_text`. + enum: + - summary_text + x-stainless-const: true + text: + type: string + description: The text of the summary part. + required: + - type + - text required: - - event_id - type - - response_id - item_id - output_index - - call_id - - delta + - summary_index + - part x-oaiMeta: - name: response.function_call_arguments.delta - group: realtime + name: response.reasoning_summary_part.added + group: responses example: | { - "event_id": "event_5354", - "type": "response.function_call_arguments.delta", - "response_id": "resp_002", - "item_id": "fc_001", - "output_index": 0, - "call_id": "call_001", - "delta": "{\"location\": \"San\"" + "type": "response.reasoning_summary_part.added", + "item_id": "rs_6806bfca0b2481918a5748308061a2600d3ce51bdffd5476", + "output_index": 0, + "summary_index": 0, + "part": { + "type": "summary_text", + "text": "" + } } - RealtimeServerEventResponseFunctionCallArgumentsDone: + ResponseReasoningSummaryPartDoneEvent: type: object - description: Returned when the model-generated function call arguments are done - streaming. Also emitted when a Response is interrupted, incomplete, or - cancelled. + description: Emitted when a reasoning summary part is completed. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be "response.function_call_arguments.done". - response_id: - type: string - description: The ID of the response. + description: > + The type of the event. Always `response.reasoning_summary_part.done`. + enum: + - response.reasoning_summary_part.done + x-stainless-const: true item_id: type: string - description: The ID of the function call item. + description: | + The ID of the item this summary part is associated with. output_index: type: integer - description: The index of the output item in the response. - call_id: - type: string - description: The ID of the function call. - arguments: - type: string - description: The final arguments as a JSON string. + description: | + The index of the output item this summary part is associated with. + summary_index: + type: integer + description: | + The index of the summary part within the reasoning summary. + part: + type: object + description: | + The completed summary part. + properties: + type: + type: string + description: The type of the summary part. Always `summary_text`. + enum: + - summary_text + x-stainless-const: true + text: + type: string + description: The text of the summary part. + required: + - type + - text required: - - event_id - type - - response_id - item_id - output_index - - call_id - - arguments + - summary_index + - part x-oaiMeta: - name: response.function_call_arguments.done - group: realtime - example: | + name: response.reasoning_summary_part.done + group: responses + example: > { - "event_id": "event_5556", - "type": "response.function_call_arguments.done", - "response_id": "resp_002", - "item_id": "fc_001", - "output_index": 0, - "call_id": "call_001", - "arguments": "{\"location\": \"San Francisco\"}" + "type": "response.reasoning_summary_part.done", + "item_id": "rs_6806bfca0b2481918a5748308061a2600d3ce51bdffd5476", + "output_index": 0, + "summary_index": 0, + "part": { + "type": "summary_text", + "text": "**Responding to a greeting**\n\nThe user just said, \"Hello!\" So, it seems I need to engage. I'll greet them back and offer help since they're looking to chat. I could say something like, \"Hello! How can I assist you today?\" That feels friendly and open. They didn't ask a specific question, so this approach will work well for starting a conversation. Let's see where it goes from there!" + } } - RealtimeServerEventResponseOutputItemAdded: + ResponseReasoningSummaryTextDeltaEvent: type: object - description: Returned when a new Item is created during Response generation. + description: Emitted when a delta is added to a reasoning summary text. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be `response.output_item.added`. - response_id: + description: > + The type of the event. Always + `response.reasoning_summary_text.delta`. + enum: + - response.reasoning_summary_text.delta + x-stainless-const: true + item_id: type: string - description: The ID of the Response to which the item belongs. + description: | + The ID of the item this summary text delta is associated with. output_index: type: integer - description: The index of the output item in the Response. - item: - $ref: "#/components/schemas/RealtimeConversationItem" + description: > + The index of the output item this summary text delta is associated + with. + summary_index: + type: integer + description: | + The index of the summary part within the reasoning summary. + delta: + type: string + description: | + The text delta that was added to the summary. required: - - event_id - type - - response_id + - item_id - output_index - - item + - summary_index + - delta x-oaiMeta: - name: response.output_item.added - group: realtime + name: response.reasoning_summary_text.delta + group: responses example: | { - "event_id": "event_3334", - "type": "response.output_item.added", - "response_id": "resp_001", - "output_index": 0, - "item": { - "id": "msg_007", - "object": "realtime.item", - "type": "message", - "status": "in_progress", - "role": "assistant", - "content": [] - } + "type": "response.reasoning_summary_text.delta", + "item_id": "rs_6806bfca0b2481918a5748308061a2600d3ce51bdffd5476", + "output_index": 0, + "summary_index": 0, + "delta": "**Respond" } - RealtimeServerEventResponseOutputItemDone: + ResponseReasoningSummaryTextDoneEvent: type: object - description: Returned when an Item is done streaming. Also emitted when a - Response is interrupted, incomplete, or cancelled. + description: Emitted when a reasoning summary text is completed. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be `response.output_item.done`. - response_id: + description: > + The type of the event. Always `response.reasoning_summary_text.done`. + enum: + - response.reasoning_summary_text.done + x-stainless-const: true + item_id: type: string - description: The ID of the Response to which the item belongs. + description: | + The ID of the item this summary text is associated with. output_index: type: integer - description: The index of the output item in the Response. - item: - $ref: "#/components/schemas/RealtimeConversationItem" + description: | + The index of the output item this summary text is associated with. + summary_index: + type: integer + description: | + The index of the summary part within the reasoning summary. + text: + type: string + description: | + The full text of the completed reasoning summary. required: - - event_id - type - - response_id + - item_id - output_index - - item + - summary_index + - text x-oaiMeta: - name: response.output_item.done - group: realtime - example: | + name: response.reasoning_summary_text.done + group: responses + example: > { - "event_id": "event_3536", - "type": "response.output_item.done", - "response_id": "resp_001", - "output_index": 0, - "item": { - "id": "msg_007", - "object": "realtime.item", - "type": "message", - "status": "completed", - "role": "assistant", - "content": [ - { - "type": "text", - "text": "Sure, I can help with that." - } - ] - } + "type": "response.reasoning_summary_text.done", + "item_id": "rs_6806bfca0b2481918a5748308061a2600d3ce51bdffd5476", + "output_index": 0, + "summary_index": 0, + "text": "**Responding to a greeting**\n\nThe user just said, \"Hello!\" So, it seems I need to engage. I'll greet them back and offer help since they're looking to chat. I could say something like, \"Hello! How can I assist you today?\" That feels friendly and open. They didn't ask a specific question, so this approach will work well for starting a conversation. Let's see where it goes from there!" } - RealtimeServerEventResponseTextDelta: + ResponseRefusalDeltaEvent: type: object - description: Returned when the text value of a "text" content part is updated. + description: Emitted when there is a partial refusal text. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be "response.text.delta". - response_id: - type: string - description: The ID of the response. + description: | + The type of the event. Always `response.refusal.delta`. + enum: + - response.refusal.delta + x-stainless-const: true item_id: type: string - description: The ID of the item. + description: | + The ID of the output item that the refusal text is added to. output_index: type: integer - description: The index of the output item in the response. + description: | + The index of the output item that the refusal text is added to. content_index: type: integer - description: The index of the content part in the item's content array. + description: | + The index of the content part that the refusal text is added to. delta: type: string - description: The text delta. + description: | + The refusal text that is added. required: - - event_id - type - - response_id - item_id - output_index - content_index - delta x-oaiMeta: - name: response.text.delta - group: realtime + name: response.refusal.delta + group: responses example: | { - "event_id": "event_4142", - "type": "response.text.delta", - "response_id": "resp_001", - "item_id": "msg_007", - "output_index": 0, - "content_index": 0, - "delta": "Sure, I can h" + "type": "response.refusal.delta", + "item_id": "msg_123", + "output_index": 0, + "content_index": 0, + "delta": "refusal text so far" } - RealtimeServerEventResponseTextDone: + ResponseRefusalDoneEvent: type: object - description: Returned when the text value of a "text" content part is done - streaming. Also emitted when a Response is interrupted, incomplete, or - cancelled. + description: Emitted when refusal text is finalized. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be "response.text.done". - response_id: - type: string - description: The ID of the response. + description: | + The type of the event. Always `response.refusal.done`. + enum: + - response.refusal.done + x-stainless-const: true item_id: type: string - description: The ID of the item. + description: | + The ID of the output item that the refusal text is finalized. output_index: type: integer - description: The index of the output item in the response. + description: | + The index of the output item that the refusal text is finalized. content_index: type: integer - description: The index of the content part in the item's content array. - text: + description: | + The index of the content part that the refusal text is finalized. + refusal: type: string - description: The final text content. + description: | + The refusal text that is finalized. required: - - event_id - type - - response_id - item_id - output_index - content_index - - text + - refusal x-oaiMeta: - name: response.text.done - group: realtime + name: response.refusal.done + group: responses example: | { - "event_id": "event_4344", - "type": "response.text.done", - "response_id": "resp_001", - "item_id": "msg_007", - "output_index": 0, - "content_index": 0, - "text": "Sure, I can help with that." + "type": "response.refusal.done", + "item_id": "item-abc", + "output_index": 1, + "content_index": 2, + "refusal": "final refusal text" } - RealtimeServerEventSessionCreated: + ResponseStreamEvent: + anyOf: + - $ref: "#/components/schemas/ResponseAudioDeltaEvent" + - $ref: "#/components/schemas/ResponseAudioDoneEvent" + - $ref: "#/components/schemas/ResponseAudioTranscriptDeltaEvent" + - $ref: "#/components/schemas/ResponseAudioTranscriptDoneEvent" + - $ref: "#/components/schemas/ResponseCodeInterpreterCallCodeDeltaEvent" + - $ref: "#/components/schemas/ResponseCodeInterpreterCallCodeDoneEvent" + - $ref: "#/components/schemas/ResponseCodeInterpreterCallCompletedEvent" + - $ref: "#/components/schemas/ResponseCodeInterpreterCallInProgressEvent" + - $ref: "#/components/schemas/ResponseCodeInterpreterCallInterpretingEvent" + - $ref: "#/components/schemas/ResponseCompletedEvent" + - $ref: "#/components/schemas/ResponseContentPartAddedEvent" + - $ref: "#/components/schemas/ResponseContentPartDoneEvent" + - $ref: "#/components/schemas/ResponseCreatedEvent" + - $ref: "#/components/schemas/ResponseErrorEvent" + - $ref: "#/components/schemas/ResponseFileSearchCallCompletedEvent" + - $ref: "#/components/schemas/ResponseFileSearchCallInProgressEvent" + - $ref: "#/components/schemas/ResponseFileSearchCallSearchingEvent" + - $ref: "#/components/schemas/ResponseFunctionCallArgumentsDeltaEvent" + - $ref: "#/components/schemas/ResponseFunctionCallArgumentsDoneEvent" + - $ref: "#/components/schemas/ResponseInProgressEvent" + - $ref: "#/components/schemas/ResponseFailedEvent" + - $ref: "#/components/schemas/ResponseIncompleteEvent" + - $ref: "#/components/schemas/ResponseOutputItemAddedEvent" + - $ref: "#/components/schemas/ResponseOutputItemDoneEvent" + - $ref: "#/components/schemas/ResponseReasoningSummaryPartAddedEvent" + - $ref: "#/components/schemas/ResponseReasoningSummaryPartDoneEvent" + - $ref: "#/components/schemas/ResponseReasoningSummaryTextDeltaEvent" + - $ref: "#/components/schemas/ResponseReasoningSummaryTextDoneEvent" + - $ref: "#/components/schemas/ResponseRefusalDeltaEvent" + - $ref: "#/components/schemas/ResponseRefusalDoneEvent" + - $ref: "#/components/schemas/ResponseTextAnnotationDeltaEvent" + - $ref: "#/components/schemas/ResponseTextDeltaEvent" + - $ref: "#/components/schemas/ResponseTextDoneEvent" + - $ref: "#/components/schemas/ResponseWebSearchCallCompletedEvent" + - $ref: "#/components/schemas/ResponseWebSearchCallInProgressEvent" + - $ref: "#/components/schemas/ResponseWebSearchCallSearchingEvent" + discriminator: + propertyName: type + ResponseTextAnnotationDeltaEvent: type: object - description: Returned when a Session is created. Emitted automatically when a - new connection is established as the first server event. This event will - contain the default Session configuration. + description: Emitted when a text annotation is added. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be `session.created`. - session: - $ref: "#/components/schemas/RealtimeSession" + description: > + The type of the event. Always + `response.output_text.annotation.added`. + enum: + - response.output_text.annotation.added + x-stainless-const: true + item_id: + type: string + description: | + The ID of the output item that the text annotation was added to. + output_index: + type: integer + description: | + The index of the output item that the text annotation was added to. + content_index: + type: integer + description: | + The index of the content part that the text annotation was added to. + annotation_index: + type: integer + description: | + The index of the annotation that was added. + annotation: + $ref: "#/components/schemas/Annotation" required: - - event_id - type - - session + - item_id + - output_index + - content_index + - annotation_index + - annotation x-oaiMeta: - name: session.created - group: realtime + name: response.output_text.annotation.added + group: responses example: | { - "event_id": "event_1234", - "type": "session.created", - "session": { - "id": "sess_001", - "object": "realtime.session", - "model": "gpt-4o-realtime-preview-2024-10-01", - "modalities": ["text", "audio"], - "instructions": "", - "voice": "alloy", - "input_audio_format": "pcm16", - "output_audio_format": "pcm16", - "input_audio_transcription": null, - "turn_detection": { - "type": "server_vad", - "threshold": 0.5, - "prefix_padding_ms": 300, - "silence_duration_ms": 200 - }, - "tools": [], - "tool_choice": "auto", - "temperature": 0.8, - "max_response_output_tokens": null - } + "type": "response.output_text.annotation.added", + "item_id": "msg_abc123", + "output_index": 1, + "content_index": 0, + "annotation_index": 0, + "annotation": { + "type": "file_citation", + "index": 390, + "file_id": "file-4wDz5b167pAf72nx1h9eiN", + "filename": "dragons.pdf" + } } - RealtimeServerEventSessionUpdated: + ResponseTextDeltaEvent: type: object - description: Returned when a session is updated with a `session.update` event, - unless there is an error. + description: Emitted when there is an additional text delta. properties: - event_id: - type: string - description: The unique ID of the server event. type: type: string - description: The event type, must be "session.updated". - session: - $ref: "#/components/schemas/RealtimeSession" + description: | + The type of the event. Always `response.output_text.delta`. + enum: + - response.output_text.delta + x-stainless-const: true + item_id: + type: string + description: | + The ID of the output item that the text delta was added to. + output_index: + type: integer + description: | + The index of the output item that the text delta was added to. + content_index: + type: integer + description: | + The index of the content part that the text delta was added to. + delta: + type: string + description: | + The text delta that was added. required: - - event_id - type - - session + - item_id + - output_index + - content_index + - delta x-oaiMeta: - name: session.updated - group: realtime + name: response.output_text.delta + group: responses example: | { - "event_id": "event_5678", - "type": "session.updated", - "session": { - "id": "sess_001", - "object": "realtime.session", - "model": "gpt-4o-realtime-preview-2024-10-01", - "modalities": ["text"], - "instructions": "New instructions", - "voice": "alloy", - "input_audio_format": "pcm16", - "output_audio_format": "pcm16", - "input_audio_transcription": { - "model": "whisper-1" - }, - "turn_detection": null, - "tools": [], - "tool_choice": "none", - "temperature": 0.7, - "max_response_output_tokens": 200 - } + "type": "response.output_text.delta", + "item_id": "msg_123", + "output_index": 0, + "content_index": 0, + "delta": "In" } - RealtimeSession: + ResponseTextDoneEvent: type: object - description: Realtime session object configuration. + description: Emitted when text content is finalized. properties: - modalities: - type: array - items: - type: string - description: | - The set of modalities the model can respond with. To disable audio, - set this to ["text"]. - instructions: - type: string - description: > - The default system instructions (i.e. system message) prepended to - model - - calls. This field allows the client to guide the model on desired - - responses. The model can be instructed on response content and - format, - - (e.g. "be extremely succinct", "act friendly", "here are examples of - good - - responses") and on audio behavior (e.g. "talk quickly", "inject - emotion - - into your voice", "laugh frequently"). The instructions are not - guaranteed - - to be followed by the model, but they provide guidance to the model - on the - - desired behavior. - - - Note that the server sets default instructions which will be used if - this - - field is not set and are visible in the `session.created` event at - the - - start of the session. - voice: + type: type: string + description: | + The type of the event. Always `response.output_text.done`. enum: - - alloy - - ash - - ballad - - coral - - echo - - sage - - shimmer - - verse - description: > - The voice the model uses to respond. Supported voices are `alloy`, - `ash`, - - `ballad`, `coral`, `echo`, `sage`, `shimmer`, and `verse`. Cannot - be - - changed once the model has responded with audio at least once. - input_audio_format: - type: string - description: > - The format of input audio. Options are `pcm16`, `g711_ulaw`, or - `g711_alaw`. - output_audio_format: + - response.output_text.done + x-stainless-const: true + item_id: type: string - description: > - The format of output audio. Options are `pcm16`, `g711_ulaw`, or - `g711_alaw`. - input_audio_transcription: - type: object - description: > - Configuration for input audio transcription, defaults to off and can - be - - set to `null` to turn off once on. Input audio transcription is not - native - - to the model, since the model consumes audio directly. Transcription - runs - - asynchronously through Whisper and should be treated as rough - guidance - - rather than the representation understood by the model. - properties: - model: - type: string - description: > - The model to use for transcription, `whisper-1` is the only - currently - - supported model. - turn_detection: - type: object - description: > - Configuration for turn detection. Can be set to `null` to turn off. - Server - - VAD means that the model will detect the start and end of speech - based on - - audio volume and respond at the end of user speech. - properties: - type: - type: string - description: > - Type of turn detection, only `server_vad` is currently supported. - threshold: - type: number - description: > - Activation threshold for VAD (0.0 to 1.0), this defaults to 0.5. - A - - higher threshold will require louder audio to activate the - model, and - - thus might perform better in noisy environments. - prefix_padding_ms: - type: integer - description: | - Amount of audio to include before the VAD detected speech (in - milliseconds). Defaults to 300ms. - silence_duration_ms: - type: integer - description: > - Duration of silence to detect speech stop (in milliseconds). - Defaults - - to 500ms. With shorter values the model will respond more - quickly, - - but may jump in on short pauses from the user. - tools: - type: array - description: Tools (functions) available to the model. - items: - type: object - properties: - type: - type: string - description: The type of the tool, i.e. `function`. - name: - type: string - description: The name of the function. - description: - type: string - description: > - The description of the function, including guidance on when - and how - - to call it, and guidance about what to tell the user when - calling - - (if anything). - parameters: - type: object - description: Parameters of the function in JSON Schema. - tool_choice: + description: | + The ID of the output item that the text content is finalized. + output_index: + type: integer + description: | + The index of the output item that the text content is finalized. + content_index: + type: integer + description: | + The index of the content part that the text content is finalized. + text: type: string - description: > - How the model chooses tools. Options are `auto`, `none`, `required`, - or - - specify a function. - temperature: - type: number - description: > - Sampling temperature for the model, limited to [0.6, 1.2]. Defaults - to 0.8. - max_response_output_tokens: - oneOf: - - type: integer - - type: string - enum: - - inf description: | - Maximum number of output tokens for a single assistant response, - inclusive of tool calls. Provide an integer between 1 and 4096 to - limit output tokens, or `inf` for the maximum available tokens for a - given model. Defaults to `inf`. - ResponseFormatJsonObject: + The text content that is finalized. + required: + - type + - item_id + - output_index + - content_index + - text + x-oaiMeta: + name: response.output_text.done + group: responses + example: > + { + "type": "response.output_text.done", + "item_id": "msg_123", + "output_index": 0, + "content_index": 0, + "text": "In a shimmering forest under a sky full of stars, a lonely unicorn named Lila discovered a hidden pond that glowed with moonlight. Every night, she would leave sparkling, magical flowers by the water's edge, hoping to share her beauty with others. One enchanting evening, she woke to find a group of friendly animals gathered around, eager to be friends and share in her magic." + } + ResponseUsage: + type: object + description: | + Represents token usage details including input tokens, output tokens, + a breakdown of output tokens, and the total tokens used. + properties: + input_tokens: + type: integer + description: The number of input tokens. + input_tokens_details: + type: object + description: A detailed breakdown of the input tokens. + properties: + cached_tokens: + type: integer + description: | + The number of tokens that were retrieved from the cache. + [More on prompt caching](/docs/guides/prompt-caching). + required: + - cached_tokens + output_tokens: + type: integer + description: The number of output tokens. + output_tokens_details: + type: object + description: A detailed breakdown of the output tokens. + properties: + reasoning_tokens: + type: integer + description: The number of reasoning tokens. + required: + - reasoning_tokens + total_tokens: + type: integer + description: The total number of tokens used. + required: + - input_tokens + - input_tokens_details + - output_tokens + - output_tokens_details + - total_tokens + ResponseWebSearchCallCompletedEvent: type: object + description: Emitted when a web search call is completed. properties: type: type: string - description: "The type of response format being defined: `json_object`" + description: | + The type of the event. Always `response.web_search_call.completed`. enum: - - json_object + - response.web_search_call.completed + x-stainless-const: true + output_index: + type: integer + description: > + The index of the output item that the web search call is associated + with. + item_id: + type: string + description: | + Unique ID for the output item associated with the web search call. required: - type - ResponseFormatJsonSchema: + - output_index + - item_id + x-oaiMeta: + name: response.web_search_call.completed + group: responses + example: | + { + "type": "response.web_search_call.completed", + "output_index": 0, + "item_id": "ws_123", + } + ResponseWebSearchCallInProgressEvent: type: object + description: Emitted when a web search call is initiated. properties: type: type: string - description: "The type of response format being defined: `json_schema`" + description: > + The type of the event. Always `response.web_search_call.in_progress`. enum: - - json_schema - json_schema: - type: object - properties: - description: - type: string - description: A description of what the response format is for, used by the model - to determine how to respond in the format. - name: - type: string - description: The name of the response format. Must be a-z, A-Z, 0-9, or contain - underscores and dashes, with a maximum length of 64. - schema: - $ref: "#/components/schemas/ResponseFormatJsonSchemaSchema" - strict: - type: boolean - nullable: true - default: false - description: Whether to enable strict schema adherence when generating the - output. If set to true, the model will always follow the exact - schema defined in the `schema` field. Only a subset of JSON - Schema is supported when `strict` is `true`. To learn more, read - the [Structured Outputs guide](/docs/guides/structured-outputs). - required: - - type - - name + - response.web_search_call.in_progress + x-stainless-const: true + output_index: + type: integer + description: > + The index of the output item that the web search call is associated + with. + item_id: + type: string + description: | + Unique ID for the output item associated with the web search call. required: - type - - json_schema - ResponseFormatJsonSchemaSchema: - type: object - description: The schema for the response format, described as a JSON Schema object. - additionalProperties: true - ResponseFormatText: + - output_index + - item_id + x-oaiMeta: + name: response.web_search_call.in_progress + group: responses + example: | + { + "type": "response.web_search_call.in_progress", + "output_index": 0, + "item_id": "ws_123", + } + ResponseWebSearchCallSearchingEvent: type: object + description: Emitted when a web search call is executing. properties: type: type: string - description: "The type of response format being defined: `text`" + description: | + The type of the event. Always `response.web_search_call.searching`. enum: - - text + - response.web_search_call.searching + x-stainless-const: true + output_index: + type: integer + description: > + The index of the output item that the web search call is associated + with. + item_id: + type: string + description: | + Unique ID for the output item associated with the web search call. required: - type + - output_index + - item_id + x-oaiMeta: + name: response.web_search_call.searching + group: responses + example: | + { + "type": "response.web_search_call.searching", + "output_index": 0, + "item_id": "ws_123", + } RunCompletionUsage: type: object description: Usage statistics related to the run. This value will be `null` if @@ -19931,6 +35805,134 @@ components: - completion_tokens - total_tokens nullable: true + RunGraderRequest: + type: object + title: RunGraderRequest + properties: + grader: + type: object + description: The grader used for the fine-tuning job. + oneOf: + - $ref: "#/components/schemas/GraderStringCheck" + - $ref: "#/components/schemas/GraderTextSimilarity" + - $ref: "#/components/schemas/GraderPython" + - $ref: "#/components/schemas/GraderScoreModel" + - $ref: "#/components/schemas/GraderMulti" + reference_answer: + oneOf: + - type: string + - type: object + - type: array + - type: number + description: The reference answer for the evaluation. + model_sample: + type: string + description: The model sample to be evaluated. + required: + - grader + - reference_answer + - model_sample + RunGraderResponse: + type: object + properties: + reward: + type: number + metadata: + type: object + properties: + name: + type: string + type: + type: string + errors: + type: object + properties: + formula_parse_error: + type: boolean + sample_parse_error: + type: boolean + truncated_observation_error: + type: boolean + unresponsive_reward_error: + type: boolean + invalid_variable_error: + type: boolean + other_error: + type: boolean + python_grader_server_error: + type: boolean + python_grader_server_error_type: + type: + - string + - "null" + nullable: true + python_grader_runtime_error: + type: boolean + python_grader_runtime_error_details: + type: + - string + - "null" + nullable: true + model_grader_server_error: + type: boolean + model_grader_refusal_error: + type: boolean + model_grader_parse_error: + type: boolean + model_grader_server_error_details: + type: + - string + - "null" + nullable: true + required: + - formula_parse_error + - sample_parse_error + - truncated_observation_error + - unresponsive_reward_error + - invalid_variable_error + - other_error + - python_grader_server_error + - python_grader_server_error_type + - python_grader_runtime_error + - python_grader_runtime_error_details + - model_grader_server_error + - model_grader_refusal_error + - model_grader_parse_error + - model_grader_server_error_details + execution_time: + type: number + scores: + type: object + additionalProperties: {} + token_usage: + type: + - integer + - "null" + nullable: true + sampled_model_name: + type: + - string + - "null" + nullable: true + required: + - name + - type + - errors + - execution_time + - scores + - token_usage + - sampled_model_name + sub_rewards: + type: object + additionalProperties: {} + model_grader_token_usage_per_model: + type: object + additionalProperties: {} + required: + - reward + - metadata + - sub_rewards + - model_grader_token_usage_per_model RunObject: type: object title: A run on a thread @@ -19944,6 +35946,7 @@ components: type: string enum: - thread.run + x-stainless-const: true created_at: description: The Unix timestamp (in seconds) for when the run was created. type: integer @@ -19981,6 +35984,7 @@ components: type: string enum: - submit_tool_outputs + x-stainless-const: true submit_tool_outputs: type: object description: Details on the tool outputs needed for this run to continue. @@ -20066,16 +36070,8 @@ components: - $ref: "#/components/schemas/AssistantToolsCode" - $ref: "#/components/schemas/AssistantToolsFileSearch" - $ref: "#/components/schemas/AssistantToolsFunction" - x-oaiExpandable: true metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true + $ref: "#/components/schemas/Metadata" usage: $ref: "#/components/schemas/RunCompletionUsage" temperature: @@ -20103,11 +36099,13 @@ components: over the course of the run. minimum: 256 truncation_strategy: - $ref: "#/components/schemas/TruncationObject" - nullable: true + allOf: + - $ref: "#/components/schemas/TruncationObject" + - nullable: true tool_choice: - $ref: "#/components/schemas/AssistantsApiToolChoiceOption" - nullable: true + allOf: + - $ref: "#/components/schemas/AssistantsApiToolChoiceOption" + - nullable: true parallel_tool_calls: $ref: "#/components/schemas/ParallelToolCalls" response_format: @@ -20213,6 +36211,7 @@ components: type: string enum: - thread.run.step.delta + x-stainless-const: true delta: description: The delta containing the fields that have changed on the run step. type: object @@ -20223,7 +36222,6 @@ components: oneOf: - $ref: "#/components/schemas/RunStepDeltaStepDetailsMessageCreationObject" - $ref: "#/components/schemas/RunStepDeltaStepDetailsToolCallsObject" - x-oaiExpandable: true required: - id - object @@ -20259,6 +36257,7 @@ components: type: string enum: - message_creation + x-stainless-const: true message_creation: type: object properties: @@ -20284,6 +36283,7 @@ components: `code_interpreter` for this type of tool call. enum: - code_interpreter + x-stainless-const: true code_interpreter: type: object description: The Code Interpreter tool call definition. @@ -20304,7 +36304,6 @@ components: t" - $ref: "#/components/schemas/RunStepDeltaStepDetailsToolCallsCodeOutputImageObje\ ct" - x-oaiExpandable: true required: - index - type @@ -20320,6 +36319,7 @@ components: type: string enum: - image + x-stainless-const: true image: type: object properties: @@ -20342,6 +36342,7 @@ components: type: string enum: - logs + x-stainless-const: true logs: type: string description: The text output from the Code Interpreter tool call. @@ -20364,6 +36365,7 @@ components: this type of tool call. enum: - file_search + x-stainless-const: true file_search: type: object description: For now, this is always going to be an empty object. @@ -20388,6 +36390,7 @@ components: this type of tool call. enum: - function + x-stainless-const: true function: type: object description: The definition of the function that was called. @@ -20417,6 +36420,7 @@ components: type: string enum: - tool_calls + x-stainless-const: true tool_calls: type: array description: > @@ -20428,7 +36432,6 @@ components: - $ref: "#/components/schemas/RunStepDeltaStepDetailsToolCallsCodeObject" - $ref: "#/components/schemas/RunStepDeltaStepDetailsToolCallsFileSearchObject" - $ref: "#/components/schemas/RunStepDeltaStepDetailsToolCallsFunctionObject" - x-oaiExpandable: true required: - type RunStepDetailsMessageCreationObject: @@ -20441,6 +36444,7 @@ components: type: string enum: - message_creation + x-stainless-const: true message_creation: type: object properties: @@ -20466,6 +36470,7 @@ components: `code_interpreter` for this type of tool call. enum: - code_interpreter + x-stainless-const: true code_interpreter: type: object description: The Code Interpreter tool call definition. @@ -20487,7 +36492,6 @@ components: oneOf: - $ref: "#/components/schemas/RunStepDetailsToolCallsCodeOutputLogsObject" - $ref: "#/components/schemas/RunStepDetailsToolCallsCodeOutputImageObject" - x-oaiExpandable: true required: - id - type @@ -20501,6 +36505,7 @@ components: type: string enum: - image + x-stainless-const: true image: type: object properties: @@ -20522,6 +36527,7 @@ components: type: string enum: - logs + x-stainless-const: true logs: type: string description: The text output from the Code Interpreter tool call. @@ -20541,6 +36547,7 @@ components: this type of tool call. enum: - file_search + x-stainless-const: true file_search: type: object description: For now, this is always going to be an empty object. @@ -20564,10 +36571,7 @@ components: description: The ranking options for the file search. properties: ranker: - type: string - description: The ranker used for the file search. - enum: - - default_2024_08_21 + $ref: "#/components/schemas/FileSearchRanker" score_threshold: type: number description: The score threshold for the file search. All values must be a @@ -20607,6 +36611,7 @@ components: description: The type of the content. enum: - text + x-stainless-const: true text: type: string description: The text content of the file. @@ -20627,6 +36632,7 @@ components: this type of tool call. enum: - function + x-stainless-const: true function: type: object description: The definition of the function that was called. @@ -20661,6 +36667,7 @@ components: type: string enum: - tool_calls + x-stainless-const: true tool_calls: type: array description: > @@ -20672,7 +36679,6 @@ components: - $ref: "#/components/schemas/RunStepDetailsToolCallsCodeObject" - $ref: "#/components/schemas/RunStepDetailsToolCallsFileSearchObject" - $ref: "#/components/schemas/RunStepDetailsToolCallsFunctionObject" - x-oaiExpandable: true required: - type - tool_calls @@ -20691,6 +36697,7 @@ components: type: string enum: - thread.run.step + x-stainless-const: true created_at: description: The Unix timestamp (in seconds) for when the run step was created. type: integer @@ -20728,7 +36735,6 @@ components: oneOf: - $ref: "#/components/schemas/RunStepDetailsMessageCreationObject" - $ref: "#/components/schemas/RunStepDetailsToolCallsObject" - x-oaiExpandable: true last_error: type: object description: The last error associated with this run step. Will be `null` if @@ -20765,14 +36771,7 @@ components: type: integer nullable: true metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true + $ref: "#/components/schemas/Metadata" usage: $ref: "#/components/schemas/RunStepCompletionUsage" required: @@ -20829,1103 +36828,3265 @@ components: event: type: string enum: - - thread.run.step.created + - thread.run.step.created + x-stainless-const: true + data: + $ref: "#/components/schemas/RunStepObject" + required: + - event + - data + description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) + is created. + x-oaiMeta: + dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" + - type: object + properties: + event: + type: string + enum: + - thread.run.step.in_progress + x-stainless-const: true + data: + $ref: "#/components/schemas/RunStepObject" + required: + - event + - data + description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) + moves to an `in_progress` state. + x-oaiMeta: + dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" + - type: object + properties: + event: + type: string + enum: + - thread.run.step.delta + x-stainless-const: true + data: + $ref: "#/components/schemas/RunStepDeltaObject" + required: + - event + - data + description: Occurs when parts of a [run + step](/docs/api-reference/run-steps/step-object) are being streamed. + x-oaiMeta: + dataDescription: "`data` is a [run step + delta](/docs/api-reference/assistants-streaming/run-step-delta-ob\ + ject)" + - type: object + properties: + event: + type: string + enum: + - thread.run.step.completed + x-stainless-const: true + data: + $ref: "#/components/schemas/RunStepObject" + required: + - event + - data + description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) + is completed. + x-oaiMeta: + dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" + - type: object + properties: + event: + type: string + enum: + - thread.run.step.failed + x-stainless-const: true + data: + $ref: "#/components/schemas/RunStepObject" + required: + - event + - data + description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) + fails. + x-oaiMeta: + dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" + - type: object + properties: + event: + type: string + enum: + - thread.run.step.cancelled + x-stainless-const: true + data: + $ref: "#/components/schemas/RunStepObject" + required: + - event + - data + description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) + is cancelled. + x-oaiMeta: + dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" + - type: object + properties: + event: + type: string + enum: + - thread.run.step.expired + x-stainless-const: true + data: + $ref: "#/components/schemas/RunStepObject" + required: + - event + - data + description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) + expires. + x-oaiMeta: + dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" + RunStreamEvent: + oneOf: + - type: object + properties: + event: + type: string + enum: + - thread.run.created + x-stainless-const: true + data: + $ref: "#/components/schemas/RunObject" + required: + - event + - data + description: Occurs when a new [run](/docs/api-reference/runs/object) is created. + x-oaiMeta: + dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" + - type: object + properties: + event: + type: string + enum: + - thread.run.queued + x-stainless-const: true data: - $ref: "#/components/schemas/RunStepObject" + $ref: "#/components/schemas/RunObject" required: - event - data - description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) - is created. + description: Occurs when a [run](/docs/api-reference/runs/object) moves to a + `queued` status. x-oaiMeta: - dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" + dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - type: object properties: event: type: string enum: - - thread.run.step.in_progress + - thread.run.in_progress + x-stainless-const: true data: - $ref: "#/components/schemas/RunStepObject" + $ref: "#/components/schemas/RunObject" required: - event - data - description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) - moves to an `in_progress` state. + description: Occurs when a [run](/docs/api-reference/runs/object) moves to an + `in_progress` status. x-oaiMeta: - dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" + dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - type: object properties: event: type: string enum: - - thread.run.step.delta + - thread.run.requires_action + x-stainless-const: true data: - $ref: "#/components/schemas/RunStepDeltaObject" + $ref: "#/components/schemas/RunObject" required: - event - data - description: Occurs when parts of a [run - step](/docs/api-reference/run-steps/step-object) are being streamed. + description: Occurs when a [run](/docs/api-reference/runs/object) moves to a + `requires_action` status. x-oaiMeta: - dataDescription: "`data` is a [run step - delta](/docs/api-reference/assistants-streaming/run-step-delta-ob\ - ject)" + dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - type: object properties: event: type: string enum: - - thread.run.step.completed + - thread.run.completed + x-stainless-const: true data: - $ref: "#/components/schemas/RunStepObject" + $ref: "#/components/schemas/RunObject" required: - event - data - description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) - is completed. + description: Occurs when a [run](/docs/api-reference/runs/object) is completed. x-oaiMeta: - dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" + dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - type: object properties: event: type: string enum: - - thread.run.step.failed + - thread.run.incomplete + x-stainless-const: true data: - $ref: "#/components/schemas/RunStepObject" + $ref: "#/components/schemas/RunObject" required: - event - data - description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) - fails. + description: Occurs when a [run](/docs/api-reference/runs/object) ends with + status `incomplete`. x-oaiMeta: - dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" + dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - type: object properties: event: type: string enum: - - thread.run.step.cancelled + - thread.run.failed + x-stainless-const: true data: - $ref: "#/components/schemas/RunStepObject" + $ref: "#/components/schemas/RunObject" required: - event - data - description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) - is cancelled. + description: Occurs when a [run](/docs/api-reference/runs/object) fails. x-oaiMeta: - dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" + dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - type: object properties: event: type: string enum: - - thread.run.step.expired + - thread.run.cancelling + x-stainless-const: true data: - $ref: "#/components/schemas/RunStepObject" + $ref: "#/components/schemas/RunObject" required: - event - data - description: Occurs when a [run step](/docs/api-reference/run-steps/step-object) - expires. + description: Occurs when a [run](/docs/api-reference/runs/object) moves to a + `cancelling` status. x-oaiMeta: - dataDescription: "`data` is a [run step](/docs/api-reference/run-steps/step-object)" - RunStreamEvent: + dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" + - type: object + properties: + event: + type: string + enum: + - thread.run.cancelled + x-stainless-const: true + data: + $ref: "#/components/schemas/RunObject" + required: + - event + - data + description: Occurs when a [run](/docs/api-reference/runs/object) is cancelled. + x-oaiMeta: + dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" + - type: object + properties: + event: + type: string + enum: + - thread.run.expired + x-stainless-const: true + data: + $ref: "#/components/schemas/RunObject" + required: + - event + - data + description: Occurs when a [run](/docs/api-reference/runs/object) expires. + x-oaiMeta: + dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" + RunToolCallObject: + type: object + description: Tool call objects + properties: + id: + type: string + description: The ID of the tool call. This ID must be referenced when you submit + the tool outputs in using the [Submit tool outputs to + run](/docs/api-reference/runs/submitToolOutputs) endpoint. + type: + type: string + description: The type of tool call the output is required for. For now, this is + always `function`. + enum: + - function + x-stainless-const: true + function: + type: object + description: The function definition. + properties: + name: + type: string + description: The name of the function. + arguments: + type: string + description: The arguments that the model expects you to pass to the function. + required: + - name + - arguments + required: + - id + - type + - function + Screenshot: + type: object + title: Screenshot + description: | + A screenshot action. + properties: + type: + type: string + enum: + - screenshot + default: screenshot + description: | + Specifies the event type. For a screenshot action, this property is + always set to `screenshot`. + x-stainless-const: true + required: + - type + Scroll: + type: object + title: Scroll + description: | + A scroll action. + properties: + type: + type: string + enum: + - scroll + default: scroll + description: | + Specifies the event type. For a scroll action, this property is + always set to `scroll`. + x-stainless-const: true + x: + type: integer + description: | + The x-coordinate where the scroll occurred. + y: + type: integer + description: | + The y-coordinate where the scroll occurred. + scroll_x: + type: integer + description: | + The horizontal scroll distance. + scroll_y: + type: integer + description: | + The vertical scroll distance. + required: + - type + - x + - y + - scroll_x + - scroll_y + ServiceTier: + type: string + description: > + Specifies the latency tier to use for processing the request. This + parameter is relevant for customers subscribed to the scale tier + service: + - If set to 'auto', and the Project is Scale tier enabled, the system + will utilize scale tier credits until they are exhausted. + - If set to 'auto', and the Project is not Scale tier enabled, the request will be processed using the default service tier with a lower uptime SLA and no latency guarentee. + - If set to 'default', the request will be processed using the default service tier with a lower uptime SLA and no latency guarentee. + - If set to 'flex', the request will be processed with the Flex Processing service tier. [Learn more](/docs/guides/flex-processing). + - When not set, the default behavior is 'auto'. + + When this parameter is set, the response body will include the `service_tier` utilized. + enum: + - auto + - default + - flex + nullable: true + default: auto + StaticChunkingStrategy: + type: object + additionalProperties: false + properties: + max_chunk_size_tokens: + type: integer + minimum: 100 + maximum: 4096 + description: The maximum number of tokens in each chunk. The default value is + `800`. The minimum value is `100` and the maximum value is `4096`. + chunk_overlap_tokens: + type: integer + description: > + The number of tokens that overlap between chunks. The default value + is `400`. + + + Note that the overlap must not exceed half of + `max_chunk_size_tokens`. + required: + - max_chunk_size_tokens + - chunk_overlap_tokens + StaticChunkingStrategyRequestParam: + type: object + title: Static Chunking Strategy + description: Customize your own chunking strategy by setting chunk size and + chunk overlap. + additionalProperties: false + properties: + type: + type: string + description: Always `static`. + enum: + - static + x-stainless-const: true + static: + $ref: "#/components/schemas/StaticChunkingStrategy" + required: + - type + - static + StaticChunkingStrategyResponseParam: + type: object + title: Static Chunking Strategy + additionalProperties: false + properties: + type: + type: string + description: Always `static`. + enum: + - static + x-stainless-const: true + static: + $ref: "#/components/schemas/StaticChunkingStrategy" + required: + - type + - static + StopConfiguration: + description: | + Not supported with latest reasoning models `o3` and `o4-mini`. + + Up to 4 sequences where the API will stop generating further tokens. The + returned text will not contain the stop sequence. + default: null + nullable: true + oneOf: + - type: string + default: <|endoftext|> + example: "\n" + nullable: true + - type: array + minItems: 1 + maxItems: 4 + items: + type: string + example: '["\n"]' + SubmitToolOutputsRunRequest: + type: object + additionalProperties: false + properties: + tool_outputs: + description: A list of tools for which the outputs are being submitted. + type: array + items: + type: object + properties: + tool_call_id: + type: string + description: The ID of the tool call in the `required_action` object within the + run object the output is being submitted for. + output: + type: string + description: The output of the tool call to be submitted to continue the run. + stream: + type: boolean + nullable: true + description: > + If `true`, returns a stream of events that happen during the Run as + server-sent events, terminating when the Run enters a terminal state + with a `data: [DONE]` message. + required: + - tool_outputs + TextResponseFormatConfiguration: + description: > + An object specifying the format that the model must output. + + + Configuring `{ "type": "json_schema" }` enables Structured Outputs, + + which ensures the model will match your supplied JSON schema. Learn more + in the + + [Structured Outputs guide](/docs/guides/structured-outputs). + + + The default format is `{ "type": "text" }` with no additional options. + + + **Not recommended for gpt-4o and newer models:** + + + Setting to `{ "type": "json_object" }` enables the older JSON mode, + which + + ensures the message the model generates is valid JSON. Using + `json_schema` + + is preferred for models that support it. oneOf: - - type: object - properties: - event: - type: string - enum: - - thread.run.created - data: - $ref: "#/components/schemas/RunObject" - required: - - event - - data - description: Occurs when a new [run](/docs/api-reference/runs/object) is created. - x-oaiMeta: - dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - - type: object - properties: - event: - type: string - enum: - - thread.run.queued - data: - $ref: "#/components/schemas/RunObject" - required: - - event - - data - description: Occurs when a [run](/docs/api-reference/runs/object) moves to a - `queued` status. - x-oaiMeta: - dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - - type: object - properties: - event: - type: string - enum: - - thread.run.in_progress - data: - $ref: "#/components/schemas/RunObject" - required: - - event - - data - description: Occurs when a [run](/docs/api-reference/runs/object) moves to an - `in_progress` status. - x-oaiMeta: - dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - - type: object - properties: - event: - type: string - enum: - - thread.run.requires_action - data: - $ref: "#/components/schemas/RunObject" - required: - - event - - data - description: Occurs when a [run](/docs/api-reference/runs/object) moves to a - `requires_action` status. - x-oaiMeta: - dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - - type: object - properties: - event: - type: string - enum: - - thread.run.completed - data: - $ref: "#/components/schemas/RunObject" - required: - - event - - data - description: Occurs when a [run](/docs/api-reference/runs/object) is completed. - x-oaiMeta: - dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - - type: object - properties: - event: - type: string - enum: - - thread.run.incomplete - data: - $ref: "#/components/schemas/RunObject" - required: - - event - - data - description: Occurs when a [run](/docs/api-reference/runs/object) ends with - status `incomplete`. - x-oaiMeta: - dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - - type: object - properties: - event: - type: string - enum: - - thread.run.failed - data: - $ref: "#/components/schemas/RunObject" - required: - - event - - data - description: Occurs when a [run](/docs/api-reference/runs/object) fails. - x-oaiMeta: - dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - - type: object - properties: - event: - type: string - enum: - - thread.run.cancelling - data: - $ref: "#/components/schemas/RunObject" - required: - - event - - data - description: Occurs when a [run](/docs/api-reference/runs/object) moves to a - `cancelling` status. - x-oaiMeta: - dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - - type: object + - $ref: "#/components/schemas/ResponseFormatText" + - $ref: "#/components/schemas/TextResponseFormatJsonSchema" + - $ref: "#/components/schemas/ResponseFormatJsonObject" + TextResponseFormatJsonSchema: + type: object + title: JSON schema + description: | + JSON Schema response format. Used to generate structured JSON responses. + Learn more about [Structured Outputs](/docs/guides/structured-outputs). + properties: + type: + type: string + description: The type of response format being defined. Always `json_schema`. + enum: + - json_schema + x-stainless-const: true + description: + type: string + description: > + A description of what the response format is for, used by the model + to + + determine how to respond in the format. + name: + type: string + description: | + The name of the response format. Must be a-z, A-Z, 0-9, or contain + underscores and dashes, with a maximum length of 64. + schema: + $ref: "#/components/schemas/ResponseFormatJsonSchemaSchema" + strict: + type: boolean + nullable: true + default: false + description: > + Whether to enable strict schema adherence when generating the + output. + + If set to true, the model will always follow the exact schema + defined + + in the `schema` field. Only a subset of JSON Schema is supported + when + + `strict` is `true`. To learn more, read the [Structured Outputs + + guide](/docs/guides/structured-outputs). + required: + - type + - schema + - name + ThreadObject: + type: object + title: Thread + description: Represents a thread that contains + [messages](/docs/api-reference/messages). + properties: + id: + description: The identifier, which can be referenced in API endpoints. + type: string + object: + description: The object type, which is always `thread`. + type: string + enum: + - thread + x-stainless-const: true + created_at: + description: The Unix timestamp (in seconds) for when the thread was created. + type: integer + tool_resources: + type: object + description: > + A set of resources that are made available to the assistant's tools + in this thread. The resources are specific to the type of tool. For + example, the `code_interpreter` tool requires a list of file IDs, + while the `file_search` tool requires a list of vector store IDs. properties: - event: - type: string - enum: - - thread.run.cancelled - data: - $ref: "#/components/schemas/RunObject" - required: - - event - - data - description: Occurs when a [run](/docs/api-reference/runs/object) is cancelled. - x-oaiMeta: - dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" + code_interpreter: + type: object + properties: + file_ids: + type: array + description: > + A list of [file](/docs/api-reference/files) IDs made + available to the `code_interpreter` tool. There can be a + maximum of 20 files associated with the tool. + default: [] + maxItems: 20 + items: + type: string + file_search: + type: object + properties: + vector_store_ids: + type: array + description: > + The [vector store](/docs/api-reference/vector-stores/object) + attached to this thread. There can be a maximum of 1 vector + store attached to the thread. + maxItems: 1 + items: + type: string + nullable: true + metadata: + $ref: "#/components/schemas/Metadata" + required: + - id + - object + - created_at + - tool_resources + - metadata + x-oaiMeta: + name: The thread object + beta: true + example: | + { + "id": "thread_abc123", + "object": "thread", + "created_at": 1698107661, + "metadata": {} + } + ThreadStreamEvent: + oneOf: - type: object properties: + enabled: + type: boolean + description: Whether to enable input audio transcription. event: type: string enum: - - thread.run.expired + - thread.created + x-stainless-const: true data: - $ref: "#/components/schemas/RunObject" + $ref: "#/components/schemas/ThreadObject" required: - event - data - description: Occurs when a [run](/docs/api-reference/runs/object) expires. - x-oaiMeta: - dataDescription: "`data` is a [run](/docs/api-reference/runs/object)" - RunToolCallObject: + description: Occurs when a new [thread](/docs/api-reference/threads/object) is + created. + x-oaiMeta: + dataDescription: "`data` is a [thread](/docs/api-reference/threads/object)" + ToggleCertificatesRequest: + type: object + properties: + certificate_ids: + type: array + items: + type: string + example: cert_abc + minItems: 1 + maxItems: 10 + required: + - certificate_ids + ToolChoiceFunction: + type: object + title: Function tool + description: | + Use this option to force the model to call a specific function. + properties: + type: + type: string + enum: + - function + description: For function calling, the type is always `function`. + x-stainless-const: true + name: + type: string + description: The name of the function to call. + required: + - type + - name + ToolChoiceOptions: + type: string + title: Tool choice mode + description: > + Controls which (if any) tool is called by the model. + + + `none` means the model will not call any tool and instead generates a + message. + + + `auto` means the model can pick between generating a message or calling + one or + + more tools. + + + `required` means the model must call one or more tools. + enum: + - none + - auto + - required + ToolChoiceTypes: + type: object + title: Hosted tool + description: > + Indicates that the model should use a built-in tool to generate a + response. + + [Learn more about built-in tools](/docs/guides/tools). + properties: + type: + type: string + description: | + The type of hosted tool the model should to use. Learn more about + [built-in tools](/docs/guides/tools). + + Allowed values are: + - `file_search` + - `web_search_preview` + - `computer_use_preview` + enum: + - file_search + - web_search_preview + - computer_use_preview + - web_search_preview_2025_03_11 + required: + - type + TranscriptTextDeltaEvent: + type: object + description: Emitted when there is an additional text delta. This is also the + first event emitted when the transcription starts. Only emitted when you + [create a transcription](/docs/api-reference/audio/create-transcription) + with the `Stream` parameter set to `true`. + properties: + type: + type: string + description: | + The type of the event. Always `transcript.text.delta`. + enum: + - transcript.text.delta + x-stainless-const: true + delta: + type: string + description: | + The text delta that was additionally transcribed. + logprobs: + type: array + description: > + The log probabilities of the delta. Only included if you [create a + transcription](/docs/api-reference/audio/create-transcription) with + the `include[]` parameter set to `logprobs`. + items: + type: object + properties: + token: + type: string + description: | + The token that was used to generate the log probability. + logprob: + type: number + description: | + The log probability of the token. + bytes: + type: array + description: | + The bytes that were used to generate the log probability. + required: + - type + - delta + x-oaiMeta: + name: Stream Event (transcript.text.delta) + group: transcript + example: | + { + "type": "transcript.text.delta", + "delta": " wonderful" + } + TranscriptTextDoneEvent: + type: object + description: Emitted when the transcription is complete. Contains the complete + transcription text. Only emitted when you [create a + transcription](/docs/api-reference/audio/create-transcription) with the + `Stream` parameter set to `true`. + properties: + type: + type: string + description: | + The type of the event. Always `transcript.text.done`. + enum: + - transcript.text.done + x-stainless-const: true + text: + type: string + description: | + The text that was transcribed. + logprobs: + type: array + description: > + The log probabilities of the individual tokens in the transcription. + Only included if you [create a + transcription](/docs/api-reference/audio/create-transcription) with + the `include[]` parameter set to `logprobs`. + items: + type: object + properties: + token: + type: string + description: | + The token that was used to generate the log probability. + logprob: + type: number + description: | + The log probability of the token. + bytes: + type: array + description: | + The bytes that were used to generate the log probability. + required: + - type + - text + x-oaiMeta: + name: Stream Event (transcript.text.done) + group: transcript + example: > + { + "type": "transcript.text.done", + "text": "I see skies of blue and clouds of white, the bright blessed days, the dark sacred nights, and I think to myself, what a wonderful world." + } + TranscriptionChunkingStrategy: + type: object + description: >- + Controls how the audio is cut into chunks. When set to `"auto"`, the + + server first normalizes loudness and then uses voice activity detection + (VAD) to + + choose boundaries. `server_vad` object can be provided to tweak VAD + detection + + parameters manually. If unset, the audio is transcribed as a single + block. + oneOf: + - type: string + enum: + - auto + default: + - auto + description: > + Automatically set chunking parameters based on the audio. Must be + set to `"auto"`. + x-stainless-const: true + - $ref: "#/components/schemas/VadConfig" + TranscriptionInclude: + type: string + enum: + - logprobs + default: [] + TranscriptionSegment: + type: object + properties: + id: + type: integer + description: Unique identifier of the segment. + seek: + type: integer + description: Seek offset of the segment. + start: + type: number + format: float + description: Start time of the segment in seconds. + end: + type: number + format: float + description: End time of the segment in seconds. + text: + type: string + description: Text content of the segment. + tokens: + type: array + items: + type: integer + description: Array of token IDs for the text content. + temperature: + type: number + format: float + description: Temperature parameter used for generating the segment. + avg_logprob: + type: number + format: float + description: Average logprob of the segment. If the value is lower than -1, + consider the logprobs failed. + compression_ratio: + type: number + format: float + description: Compression ratio of the segment. If the value is greater than 2.4, + consider the compression failed. + no_speech_prob: + type: number + format: float + description: Probability of no speech in the segment. If the value is higher + than 1.0 and the `avg_logprob` is below -1, consider this segment + silent. + required: + - id + - seek + - start + - end + - text + - tokens + - temperature + - avg_logprob + - compression_ratio + - no_speech_prob + TranscriptionWord: + type: object + properties: + word: + type: string + description: The text content of the word. + start: + type: number + format: float + description: Start time of the word in seconds. + end: + type: number + format: float + description: End time of the word in seconds. + required: + - word + - start + - end + TruncationObject: + type: object + title: Thread Truncation Controls + description: Controls for how a thread will be truncated prior to the run. Use + this to control the intial context window of the run. + properties: + type: + type: string + description: The truncation strategy to use for the thread. The default is + `auto`. If set to `last_messages`, the thread will be truncated to + the n most recent messages in the thread. When set to `auto`, + messages in the middle of the thread will be dropped to fit the + context length of the model, `max_prompt_tokens`. + enum: + - auto + - last_messages + last_messages: + type: integer + description: The number of most recent messages from the thread when + constructing the context for the run. + minimum: 1 + nullable: true + required: + - type + Type: + type: object + title: Type + description: | + An action to type in text. + properties: + type: + type: string + enum: + - type + default: type + description: | + Specifies the event type. For a type action, this property is + always set to `type`. + x-stainless-const: true + text: + type: string + description: | + The text to type. + required: + - type + - text + UpdateVectorStoreFileAttributesRequest: + type: object + additionalProperties: false + properties: + attributes: + $ref: "#/components/schemas/VectorStoreFileAttributes" + required: + - attributes + x-oaiMeta: + name: Update vector store file attributes request + UpdateVectorStoreRequest: + type: object + additionalProperties: false + properties: + name: + description: The name of the vector store. + type: string + nullable: true + expires_after: + allOf: + - $ref: "#/components/schemas/VectorStoreExpirationAfter" + - nullable: true + metadata: + $ref: "#/components/schemas/Metadata" + Upload: + type: object + title: Upload + description: | + The Upload object can accept byte chunks in the form of Parts. + properties: + id: + type: string + description: The Upload unique identifier, which can be referenced in API + endpoints. + created_at: + type: integer + description: The Unix timestamp (in seconds) for when the Upload was created. + filename: + type: string + description: The name of the file to be uploaded. + bytes: + type: integer + description: The intended number of bytes to be uploaded. + purpose: + type: string + description: The intended purpose of the file. [Please refer + here](/docs/api-reference/files/object#files/object-purpose) for + acceptable values. + status: + type: string + description: The status of the Upload. + enum: + - pending + - completed + - cancelled + - expired + expires_at: + type: integer + description: The Unix timestamp (in seconds) for when the Upload will expire. + object: + type: string + description: The object type, which is always "upload". + enum: + - upload + x-stainless-const: true + file: + allOf: + - $ref: "#/components/schemas/OpenAIFile" + - nullable: true + description: The ready File object after the Upload is completed. + required: + - bytes + - created_at + - expires_at + - filename + - id + - purpose + - status + x-oaiMeta: + name: The upload object + example: | + { + "id": "upload_abc123", + "object": "upload", + "bytes": 2147483648, + "created_at": 1719184911, + "filename": "training_examples.jsonl", + "purpose": "fine-tune", + "status": "completed", + "expires_at": 1719127296, + "file": { + "id": "file-xyz321", + "object": "file", + "bytes": 2147483648, + "created_at": 1719186911, + "filename": "training_examples.jsonl", + "purpose": "fine-tune", + } + } + UploadCertificateRequest: + type: object + properties: + name: + type: string + description: An optional name for the certificate + content: + type: string + description: The certificate content in PEM format + required: + - content + UploadPart: + type: object + title: UploadPart + description: > + The upload Part represents a chunk of bytes we can add to an Upload + object. + properties: + id: + type: string + description: The upload Part unique identifier, which can be referenced in API + endpoints. + created_at: + type: integer + description: The Unix timestamp (in seconds) for when the Part was created. + upload_id: + type: string + description: The ID of the Upload object that this Part was added to. + object: + type: string + description: The object type, which is always `upload.part`. + enum: + - upload.part + x-stainless-const: true + required: + - created_at + - id + - object + - upload_id + x-oaiMeta: + name: The upload part object + example: | + { + "id": "part_def456", + "object": "upload.part", + "created_at": 1719186911, + "upload_id": "upload_abc123" + } + UsageAudioSpeechesResult: + type: object + description: The aggregated audio speeches usage details of the specific time bucket. + properties: + object: + type: string + enum: + - organization.usage.audio_speeches.result + x-stainless-const: true + characters: + type: integer + description: The number of characters processed. + num_model_requests: + type: integer + description: The count of requests made to the model. + project_id: + type: string + nullable: true + description: When `group_by=project_id`, this field provides the project ID of + the grouped usage result. + user_id: + type: string + nullable: true + description: When `group_by=user_id`, this field provides the user ID of the + grouped usage result. + api_key_id: + type: string + nullable: true + description: When `group_by=api_key_id`, this field provides the API key ID of + the grouped usage result. + model: + type: string + nullable: true + description: When `group_by=model`, this field provides the model name of the + grouped usage result. + required: + - object + - characters + - num_model_requests + x-oaiMeta: + name: Audio speeches usage object + example: | + { + "object": "organization.usage.audio_speeches.result", + "characters": 45, + "num_model_requests": 1, + "project_id": "proj_abc", + "user_id": "user-abc", + "api_key_id": "key_abc", + "model": "tts-1" + } + UsageAudioTranscriptionsResult: + type: object + description: The aggregated audio transcriptions usage details of the specific + time bucket. + properties: + object: + type: string + enum: + - organization.usage.audio_transcriptions.result + x-stainless-const: true + seconds: + type: integer + description: The number of seconds processed. + num_model_requests: + type: integer + description: The count of requests made to the model. + project_id: + type: string + nullable: true + description: When `group_by=project_id`, this field provides the project ID of + the grouped usage result. + user_id: + type: string + nullable: true + description: When `group_by=user_id`, this field provides the user ID of the + grouped usage result. + api_key_id: + type: string + nullable: true + description: When `group_by=api_key_id`, this field provides the API key ID of + the grouped usage result. + model: + type: string + nullable: true + description: When `group_by=model`, this field provides the model name of the + grouped usage result. + required: + - object + - seconds + - num_model_requests + x-oaiMeta: + name: Audio transcriptions usage object + example: | + { + "object": "organization.usage.audio_transcriptions.result", + "seconds": 10, + "num_model_requests": 1, + "project_id": "proj_abc", + "user_id": "user-abc", + "api_key_id": "key_abc", + "model": "tts-1" + } + UsageCodeInterpreterSessionsResult: + type: object + description: The aggregated code interpreter sessions usage details of the + specific time bucket. + properties: + object: + type: string + enum: + - organization.usage.code_interpreter_sessions.result + x-stainless-const: true + num_sessions: + type: integer + description: The number of code interpreter sessions. + project_id: + type: string + nullable: true + description: When `group_by=project_id`, this field provides the project ID of + the grouped usage result. + required: + - object + - sessions + x-oaiMeta: + name: Code interpreter sessions usage object + example: | + { + "object": "organization.usage.code_interpreter_sessions.result", + "num_sessions": 1, + "project_id": "proj_abc" + } + UsageCompletionsResult: + type: object + description: The aggregated completions usage details of the specific time bucket. + properties: + object: + type: string + enum: + - organization.usage.completions.result + x-stainless-const: true + input_tokens: + type: integer + description: The aggregated number of text input tokens used, including cached + tokens. For customers subscribe to scale tier, this includes scale + tier tokens. + input_cached_tokens: + type: integer + description: The aggregated number of text input tokens that has been cached + from previous requests. For customers subscribe to scale tier, this + includes scale tier tokens. + output_tokens: + type: integer + description: The aggregated number of text output tokens used. For customers + subscribe to scale tier, this includes scale tier tokens. + input_audio_tokens: + type: integer + description: The aggregated number of audio input tokens used, including cached + tokens. + output_audio_tokens: + type: integer + description: The aggregated number of audio output tokens used. + num_model_requests: + type: integer + description: The count of requests made to the model. + project_id: + type: string + nullable: true + description: When `group_by=project_id`, this field provides the project ID of + the grouped usage result. + user_id: + type: string + nullable: true + description: When `group_by=user_id`, this field provides the user ID of the + grouped usage result. + api_key_id: + type: string + nullable: true + description: When `group_by=api_key_id`, this field provides the API key ID of + the grouped usage result. + model: + type: string + nullable: true + description: When `group_by=model`, this field provides the model name of the + grouped usage result. + batch: + type: boolean + nullable: true + description: When `group_by=batch`, this field tells whether the grouped usage + result is batch or not. + required: + - object + - input_tokens + - output_tokens + - num_model_requests + x-oaiMeta: + name: Completions usage object + example: | + { + "object": "organization.usage.completions.result", + "input_tokens": 5000, + "output_tokens": 1000, + "input_cached_tokens": 4000, + "input_audio_tokens": 300, + "output_audio_tokens": 200, + "num_model_requests": 5, + "project_id": "proj_abc", + "user_id": "user-abc", + "api_key_id": "key_abc", + "model": "gpt-4o-mini-2024-07-18", + "batch": false + } + UsageEmbeddingsResult: + type: object + description: The aggregated embeddings usage details of the specific time bucket. + properties: + object: + type: string + enum: + - organization.usage.embeddings.result + x-stainless-const: true + input_tokens: + type: integer + description: The aggregated number of input tokens used. + num_model_requests: + type: integer + description: The count of requests made to the model. + project_id: + type: string + nullable: true + description: When `group_by=project_id`, this field provides the project ID of + the grouped usage result. + user_id: + type: string + nullable: true + description: When `group_by=user_id`, this field provides the user ID of the + grouped usage result. + api_key_id: + type: string + nullable: true + description: When `group_by=api_key_id`, this field provides the API key ID of + the grouped usage result. + model: + type: string + nullable: true + description: When `group_by=model`, this field provides the model name of the + grouped usage result. + required: + - object + - input_tokens + - num_model_requests + x-oaiMeta: + name: Embeddings usage object + example: | + { + "object": "organization.usage.embeddings.result", + "input_tokens": 20, + "num_model_requests": 2, + "project_id": "proj_abc", + "user_id": "user-abc", + "api_key_id": "key_abc", + "model": "text-embedding-ada-002-v2" + } + UsageImagesResult: + type: object + description: The aggregated images usage details of the specific time bucket. + properties: + object: + type: string + enum: + - organization.usage.images.result + x-stainless-const: true + images: + type: integer + description: The number of images processed. + num_model_requests: + type: integer + description: The count of requests made to the model. + source: + type: string + nullable: true + description: When `group_by=source`, this field provides the source of the + grouped usage result, possible values are `image.generation`, + `image.edit`, `image.variation`. + size: + type: string + nullable: true + description: When `group_by=size`, this field provides the image size of the + grouped usage result. + project_id: + type: string + nullable: true + description: When `group_by=project_id`, this field provides the project ID of + the grouped usage result. + user_id: + type: string + nullable: true + description: When `group_by=user_id`, this field provides the user ID of the + grouped usage result. + api_key_id: + type: string + nullable: true + description: When `group_by=api_key_id`, this field provides the API key ID of + the grouped usage result. + model: + type: string + nullable: true + description: When `group_by=model`, this field provides the model name of the + grouped usage result. + required: + - object + - images + - num_model_requests + x-oaiMeta: + name: Images usage object + example: | + { + "object": "organization.usage.images.result", + "images": 2, + "num_model_requests": 2, + "size": "1024x1024", + "source": "image.generation", + "project_id": "proj_abc", + "user_id": "user-abc", + "api_key_id": "key_abc", + "model": "dall-e-3" + } + UsageModerationsResult: + type: object + description: The aggregated moderations usage details of the specific time bucket. + properties: + object: + type: string + enum: + - organization.usage.moderations.result + x-stainless-const: true + input_tokens: + type: integer + description: The aggregated number of input tokens used. + num_model_requests: + type: integer + description: The count of requests made to the model. + project_id: + type: string + nullable: true + description: When `group_by=project_id`, this field provides the project ID of + the grouped usage result. + user_id: + type: string + nullable: true + description: When `group_by=user_id`, this field provides the user ID of the + grouped usage result. + api_key_id: + type: string + nullable: true + description: When `group_by=api_key_id`, this field provides the API key ID of + the grouped usage result. + model: + type: string + nullable: true + description: When `group_by=model`, this field provides the model name of the + grouped usage result. + required: + - object + - input_tokens + - num_model_requests + x-oaiMeta: + name: Moderations usage object + example: | + { + "object": "organization.usage.moderations.result", + "input_tokens": 20, + "num_model_requests": 2, + "project_id": "proj_abc", + "user_id": "user-abc", + "api_key_id": "key_abc", + "model": "text-moderation" + } + UsageResponse: type: object - description: Tool call objects properties: + object: + type: string + enum: + - page + x-stainless-const: true + data: + type: array + items: + $ref: "#/components/schemas/UsageTimeBucket" + has_more: + type: boolean + next_page: + type: string + required: + - object + - data + - has_more + - next_page + UsageTimeBucket: + type: object + properties: + object: + type: string + enum: + - bucket + x-stainless-const: true + start_time: + type: integer + end_time: + type: integer + result: + type: array + items: + oneOf: + - $ref: "#/components/schemas/UsageCompletionsResult" + - $ref: "#/components/schemas/UsageEmbeddingsResult" + - $ref: "#/components/schemas/UsageModerationsResult" + - $ref: "#/components/schemas/UsageImagesResult" + - $ref: "#/components/schemas/UsageAudioSpeechesResult" + - $ref: "#/components/schemas/UsageAudioTranscriptionsResult" + - $ref: "#/components/schemas/UsageVectorStoresResult" + - $ref: "#/components/schemas/UsageCodeInterpreterSessionsResult" + - $ref: "#/components/schemas/CostsResult" + required: + - object + - start_time + - end_time + - result + UsageVectorStoresResult: + type: object + description: The aggregated vector stores usage details of the specific time bucket. + properties: + object: + type: string + enum: + - organization.usage.vector_stores.result + x-stainless-const: true + usage_bytes: + type: integer + description: The vector stores usage in bytes. + project_id: + type: string + nullable: true + description: When `group_by=project_id`, this field provides the project ID of + the grouped usage result. + required: + - object + - usage_bytes + x-oaiMeta: + name: Vector stores usage object + example: | + { + "object": "organization.usage.vector_stores.result", + "usage_bytes": 1024, + "project_id": "proj_abc" + } + User: + type: object + description: Represents an individual `user` within an organization. + properties: + object: + type: string + enum: + - organization.user + description: The object type, which is always `organization.user` + x-stainless-const: true id: type: string - description: The ID of the tool call. This ID must be referenced when you submit - the tool outputs in using the [Submit tool outputs to - run](/docs/api-reference/runs/submitToolOutputs) endpoint. - type: + description: The identifier, which can be referenced in API endpoints + name: + type: string + description: The name of the user + email: + type: string + description: The email address of the user + role: type: string - description: The type of tool call the output is required for. For now, this is - always `function`. enum: - - function - function: - type: object - description: The function definition. - properties: - name: - type: string - description: The name of the function. - arguments: - type: string - description: The arguments that the model expects you to pass to the function. - required: - - name - - arguments + - owner + - reader + description: "`owner` or `reader`" + added_at: + type: integer + description: The Unix timestamp (in seconds) of when the user was added. required: + - object - id - - type - - function - StaticChunkingStrategy: + - name + - email + - role + - added_at + x-oaiMeta: + name: The user object + example: | + { + "object": "organization.user", + "id": "user_abc", + "name": "First Last", + "email": "user@example.com", + "role": "owner", + "added_at": 1711471533 + } + UserDeleteResponse: + type: object + properties: + object: + type: string + enum: + - organization.user.deleted + x-stainless-const: true + id: + type: string + deleted: + type: boolean + required: + - object + - id + - deleted + UserListResponse: + type: object + properties: + object: + type: string + enum: + - list + x-stainless-const: true + data: + type: array + items: + $ref: "#/components/schemas/User" + first_id: + type: string + last_id: + type: string + has_more: + type: boolean + required: + - object + - data + - first_id + - last_id + - has_more + UserRoleUpdateRequest: + type: object + properties: + role: + type: string + enum: + - owner + - reader + description: "`owner` or `reader`" + required: + - role + VadConfig: type: object additionalProperties: false + required: + - type properties: - max_chunk_size_tokens: + type: + type: string + enum: + - server_vad + description: Must be set to `server_vad` to enable manual chunking using server + side VAD. + prefix_padding_ms: type: integer - minimum: 100 - maximum: 4096 - description: The maximum number of tokens in each chunk. The default value is - `800`. The minimum value is `100` and the maximum value is `4096`. - chunk_overlap_tokens: + default: 300 + description: | + Amount of audio to include before the VAD detected speech (in + milliseconds). + silence_duration_ms: type: integer + default: 200 + description: | + Duration of silence to detect speech stop (in milliseconds). + With shorter values the model will respond more quickly, + but may jump in on short pauses from the user. + threshold: + type: number + default: 0.5 description: > - The number of tokens that overlap between chunks. The default value - is `400`. + Sensitivity threshold (0.0 to 1.0) for voice activity detection. A + higher threshold will require louder audio to activate the model, + and - Note that the overlap must not exceed half of - `max_chunk_size_tokens`. + thus might perform better in noisy environments. + ValidateGraderRequest: + type: object + title: ValidateGraderRequest + properties: + grader: + type: object + description: The grader used for the fine-tuning job. + oneOf: + - $ref: "#/components/schemas/GraderStringCheck" + - $ref: "#/components/schemas/GraderTextSimilarity" + - $ref: "#/components/schemas/GraderPython" + - $ref: "#/components/schemas/GraderScoreModel" + - $ref: "#/components/schemas/GraderMulti" required: - - max_chunk_size_tokens - - chunk_overlap_tokens - StaticChunkingStrategyRequestParam: + - grader + ValidateGraderResponse: type: object - title: Static Chunking Strategy - additionalProperties: false + title: ValidateGraderResponse properties: - type: + grader: + type: object + description: The grader used for the fine-tuning job. + oneOf: + - $ref: "#/components/schemas/GraderStringCheck" + - $ref: "#/components/schemas/GraderTextSimilarity" + - $ref: "#/components/schemas/GraderPython" + - $ref: "#/components/schemas/GraderScoreModel" + - $ref: "#/components/schemas/GraderMulti" + VectorStoreExpirationAfter: + type: object + title: Vector store expiration policy + description: The expiration policy for a vector store. + properties: + anchor: + description: "Anchor timestamp after which the expiration policy applies. + Supported anchors: `last_active_at`." type: string - description: Always `static`. enum: - - static - static: - $ref: "#/components/schemas/StaticChunkingStrategy" + - last_active_at + x-stainless-const: true + days: + description: The number of days after the anchor time that the vector store will + expire. + type: integer + minimum: 1 + maximum: 365 + required: + - anchor + - days + VectorStoreFileAttributes: + type: object + description: > + Set of 16 key-value pairs that can be attached to an object. This can + be + + useful for storing additional information about the object in a + structured + + format, and querying for objects via API or the dashboard. Keys are + strings + + with a maximum length of 64 characters. Values are strings with a + maximum + + length of 512 characters, booleans, or numbers. + maxProperties: 16 + propertyNames: + type: string + maxLength: 64 + additionalProperties: + oneOf: + - type: string + maxLength: 512 + - type: number + - type: boolean + x-oaiTypeLabel: map + nullable: true + VectorStoreFileBatchObject: + type: object + title: Vector store file batch + description: A batch of files attached to a vector store. + properties: + id: + description: The identifier, which can be referenced in API endpoints. + type: string + object: + description: The object type, which is always `vector_store.file_batch`. + type: string + enum: + - vector_store.files_batch + x-stainless-const: true + created_at: + description: The Unix timestamp (in seconds) for when the vector store files + batch was created. + type: integer + vector_store_id: + description: The ID of the [vector + store](/docs/api-reference/vector-stores/object) that the + [File](/docs/api-reference/files) is attached to. + type: string + status: + description: The status of the vector store files batch, which can be either + `in_progress`, `completed`, `cancelled` or `failed`. + type: string + enum: + - in_progress + - completed + - cancelled + - failed + file_counts: + type: object + properties: + in_progress: + description: The number of files that are currently being processed. + type: integer + completed: + description: The number of files that have been processed. + type: integer + failed: + description: The number of files that have failed to process. + type: integer + cancelled: + description: The number of files that where cancelled. + type: integer + total: + description: The total number of files. + type: integer + required: + - in_progress + - completed + - cancelled + - failed + - total required: - - type - - static - StaticChunkingStrategyResponseParam: + - id + - object + - created_at + - vector_store_id + - status + - file_counts + x-oaiMeta: + name: The vector store files batch object + beta: true + example: | + { + "id": "vsfb_123", + "object": "vector_store.files_batch", + "created_at": 1698107661, + "vector_store_id": "vs_abc123", + "status": "completed", + "file_counts": { + "in_progress": 0, + "completed": 100, + "failed": 0, + "cancelled": 0, + "total": 100 + } + } + VectorStoreFileContentResponse: type: object - title: Static Chunking Strategy - additionalProperties: false + description: Represents the parsed content of a vector store file. properties: - type: + object: type: string - description: Always `static`. enum: - - static - static: - $ref: "#/components/schemas/StaticChunkingStrategy" - required: - - type - - static - SubmitToolOutputsRunRequest: - type: object - additionalProperties: false - properties: - tool_outputs: - description: A list of tools for which the outputs are being submitted. + - vector_store.file_content.page + description: The object type, which is always `vector_store.file_content.page` + x-stainless-const: true + data: type: array + description: Parsed content of the file. items: type: object properties: - tool_call_id: + type: type: string - description: The ID of the tool call in the `required_action` object within the - run object the output is being submitted for. - output: + description: The content type (currently only `"text"`) + text: type: string - description: The output of the tool call to be submitted to continue the run. - stream: + description: The text content + has_more: type: boolean + description: Indicates if there are more content pages to fetch. + next_page: + type: string + description: The token for the next page, if any. nullable: true - description: > - If `true`, returns a stream of events that happen during the Run as - server-sent events, terminating when the Run enters a terminal state - with a `data: [DONE]` message. required: - - tool_outputs - ThreadObject: + - object + - data + - has_more + - next_page + VectorStoreFileObject: type: object - title: Thread - description: Represents a thread that contains - [messages](/docs/api-reference/messages). + title: Vector store files + description: A list of files attached to a vector store. properties: id: description: The identifier, which can be referenced in API endpoints. type: string object: - description: The object type, which is always `thread`. + description: The object type, which is always `vector_store.file`. type: string enum: - - thread + - vector_store.file + x-stainless-const: true + usage_bytes: + description: The total vector store usage in bytes. Note that this may be + different from the original file size. + type: integer created_at: - description: The Unix timestamp (in seconds) for when the thread was created. + description: The Unix timestamp (in seconds) for when the vector store file was + created. type: integer - tool_resources: + vector_store_id: + description: The ID of the [vector + store](/docs/api-reference/vector-stores/object) that the + [File](/docs/api-reference/files) is attached to. + type: string + status: + description: The status of the vector store file, which can be either + `in_progress`, `completed`, `cancelled`, or `failed`. The status + `completed` indicates that the vector store file is ready for use. + type: string + enum: + - in_progress + - completed + - cancelled + - failed + last_error: type: object - description: > - A set of resources that are made available to the assistant's tools - in this thread. The resources are specific to the type of tool. For - example, the `code_interpreter` tool requires a list of file IDs, - while the `file_search` tool requires a list of vector store IDs. + description: The last error associated with this vector store file. Will be + `null` if there are no errors. + nullable: true properties: - code_interpreter: - type: object - properties: - file_ids: - type: array - description: > - A list of [file](/docs/api-reference/files) IDs made - available to the `code_interpreter` tool. There can be a - maximum of 20 files associated with the tool. - default: [] - maxItems: 20 - items: - type: string - file_search: - type: object - properties: - vector_store_ids: - type: array - description: > - The [vector store](/docs/api-reference/vector-stores/object) - attached to this thread. There can be a maximum of 1 vector - store attached to the thread. - maxItems: 1 - items: - type: string + code: + type: string + description: One of `server_error` or `rate_limit_exceeded`. + enum: + - server_error + - unsupported_file + - invalid_file + message: + type: string + description: A human-readable description of the error. + required: + - code + - message + chunking_strategy: + type: object + description: The strategy used to chunk the file. + oneOf: + - $ref: "#/components/schemas/StaticChunkingStrategyResponseParam" + - $ref: "#/components/schemas/OtherChunkingStrategyResponseParam" + attributes: + $ref: "#/components/schemas/VectorStoreFileAttributes" + required: + - id + - object + - usage_bytes + - created_at + - vector_store_id + - status + - last_error + x-oaiMeta: + name: The vector store file object + beta: true + example: | + { + "id": "file-abc123", + "object": "vector_store.file", + "usage_bytes": 1234, + "created_at": 1698107661, + "vector_store_id": "vs_abc123", + "status": "completed", + "last_error": null, + "chunking_strategy": { + "type": "static", + "static": { + "max_chunk_size_tokens": 800, + "chunk_overlap_tokens": 400 + } + } + } + VectorStoreObject: + type: object + title: Vector store + description: A vector store is a collection of processed files can be used by + the `file_search` tool. + properties: + id: + description: The identifier, which can be referenced in API endpoints. + type: string + object: + description: The object type, which is always `vector_store`. + type: string + enum: + - vector_store + x-stainless-const: true + created_at: + description: The Unix timestamp (in seconds) for when the vector store was + created. + type: integer + name: + description: The name of the vector store. + type: string + usage_bytes: + description: The total number of bytes used by the files in the vector store. + type: integer + file_counts: + type: object + properties: + in_progress: + description: The number of files that are currently being processed. + type: integer + completed: + description: The number of files that have been successfully processed. + type: integer + failed: + description: The number of files that have failed to process. + type: integer + cancelled: + description: The number of files that were cancelled. + type: integer + total: + description: The total number of files. + type: integer + required: + - in_progress + - completed + - failed + - cancelled + - total + status: + description: The status of the vector store, which can be either `expired`, + `in_progress`, or `completed`. A status of `completed` indicates + that the vector store is ready for use. + type: string + enum: + - expired + - in_progress + - completed + expires_after: + $ref: "#/components/schemas/VectorStoreExpirationAfter" + expires_at: + description: The Unix timestamp (in seconds) for when the vector store will + expire. + type: integer nullable: true - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map + last_active_at: + description: The Unix timestamp (in seconds) for when the vector store was last + active. + type: integer nullable: true + metadata: + $ref: "#/components/schemas/Metadata" required: - id - object + - usage_bytes - created_at - - tool_resources + - status + - last_active_at + - name + - file_counts - metadata x-oaiMeta: - name: The thread object - beta: true + name: The vector store object example: | { - "id": "thread_abc123", - "object": "thread", + "id": "vs_123", + "object": "vector_store", "created_at": 1698107661, - "metadata": {} + "usage_bytes": 123456, + "last_active_at": 1698107661, + "name": "my_vector_store", + "status": "completed", + "file_counts": { + "in_progress": 0, + "completed": 100, + "cancelled": 0, + "failed": 0, + "total": 100 + }, + "last_used_at": 1698107661 } - ThreadStreamEvent: - oneOf: - - type: object + VectorStoreSearchRequest: + type: object + additionalProperties: false + properties: + query: + description: A query string for a search + oneOf: + - type: string + - type: array + items: + type: string + description: A list of queries to search for. + minItems: 1 + rewrite_query: + description: Whether to rewrite the natural language query for vector search. + type: boolean + default: false + max_num_results: + description: The maximum number of results to return. This number should be + between 1 and 50 inclusive. + type: integer + default: 10 + minimum: 1 + maximum: 50 + filters: + description: A filter to apply based on file attributes. + oneOf: + - $ref: "#/components/schemas/ComparisonFilter" + - $ref: "#/components/schemas/CompoundFilter" + ranking_options: + description: Ranking options for search. + type: object + additionalProperties: false properties: - enabled: - type: boolean - description: Whether to enable input audio transcription. - event: + ranker: type: string enum: - - thread.created - data: - $ref: "#/components/schemas/ThreadObject" - required: - - event - - data - description: Occurs when a new [thread](/docs/api-reference/threads/object) is - created. - x-oaiMeta: - dataDescription: "`data` is a [thread](/docs/api-reference/threads/object)" - TranscriptionSegment: + - auto + - default-2024-11-15 + default: auto + score_threshold: + type: number + minimum: 0 + maximum: 1 + default: 0 + required: + - query + x-oaiMeta: + name: Vector store search request + VectorStoreSearchResultContentObject: type: object + additionalProperties: false properties: - id: - type: integer - description: Unique identifier of the segment. - seek: - type: integer - description: Seek offset of the segment. - start: - type: number - format: float - description: Start time of the segment in seconds. - end: - type: number - format: float - description: End time of the segment in seconds. + type: + description: The type of content. + type: string + enum: + - text text: + description: The text content returned from search. type: string - description: Text content of the segment. - tokens: - type: array - items: - type: integer - description: Array of token IDs for the text content. - temperature: - type: number - format: float - description: Temperature parameter used for generating the segment. - avg_logprob: - type: number - format: float - description: Average logprob of the segment. If the value is lower than -1, - consider the logprobs failed. - compression_ratio: - type: number - format: float - description: Compression ratio of the segment. If the value is greater than 2.4, - consider the compression failed. - no_speech_prob: - type: number - format: float - description: Probability of no speech in the segment. If the value is higher - than 1.0 and the `avg_logprob` is below -1, consider this segment - silent. required: - - id - - seek - - start - - end + - type - text - - tokens - - temperature - - avg_logprob - - compression_ratio - - no_speech_prob - TranscriptionWord: + x-oaiMeta: + name: Vector store search result content object + VectorStoreSearchResultItem: type: object + additionalProperties: false properties: - word: + file_id: type: string - description: The text content of the word. - start: - type: number - format: float - description: Start time of the word in seconds. - end: + description: The ID of the vector store file. + filename: + type: string + description: The name of the vector store file. + score: type: number - format: float - description: End time of the word in seconds. + description: The similarity score for the result. + minimum: 0 + maximum: 1 + attributes: + $ref: "#/components/schemas/VectorStoreFileAttributes" + content: + type: array + description: Content chunks from the file. + items: + $ref: "#/components/schemas/VectorStoreSearchResultContentObject" required: - - word - - start - - end - TruncationObject: + - file_id + - filename + - score + - attributes + - content + x-oaiMeta: + name: Vector store search result item + VectorStoreSearchResultsPage: type: object - title: Thread Truncation Controls - description: Controls for how a thread will be truncated prior to the run. Use - this to control the intial context window of the run. + additionalProperties: false properties: - type: + object: type: string - description: The truncation strategy to use for the thread. The default is - `auto`. If set to `last_messages`, the thread will be truncated to - the n most recent messages in the thread. When set to `auto`, - messages in the middle of the thread will be dropped to fit the - context length of the model, `max_prompt_tokens`. enum: - - auto - - last_messages - last_messages: - type: integer - description: The number of most recent messages from the thread when - constructing the context for the run. - minimum: 1 + - vector_store.search_results.page + description: The object type, which is always `vector_store.search_results.page` + x-stainless-const: true + search_query: + type: array + items: + type: string + description: The query used for this search. + minItems: 1 + data: + type: array + description: The list of search result items. + items: + $ref: "#/components/schemas/VectorStoreSearchResultItem" + has_more: + type: boolean + description: Indicates if there are more results to fetch. + next_page: + type: string + description: The token for the next page, if any. nullable: true + required: + - object + - search_query + - data + - has_more + - next_page + x-oaiMeta: + name: Vector store search results page + VoiceIdsShared: + example: ash + anyOf: + - type: string + - type: string + enum: + - alloy + - ash + - ballad + - coral + - echo + - fable + - onyx + - nova + - sage + - shimmer + - verse + Wait: + type: object + title: Wait + description: | + A wait action. + properties: + type: + type: string + enum: + - wait + default: wait + description: | + Specifies the event type. For a wait action, this property is + always set to `wait`. + x-stainless-const: true required: - type - UpdateVectorStoreRequest: + WebSearchContextSize: + type: string + description: > + High level guidance for the amount of context window space to use for + the + + search. One of `low`, `medium`, or `high`. `medium` is the default. + enum: + - low + - medium + - high + default: medium + WebSearchLocation: type: object - additionalProperties: false + title: Web search location + description: Approximate location parameters for the search. properties: - name: - description: The name of the vector store. + country: type: string - nullable: true - expires_after: - $ref: "#/components/schemas/VectorStoreExpirationAfter" - nullable: true - metadata: description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true - Upload: + The two-letter + + [ISO country code](https://en.wikipedia.org/wiki/ISO_3166-1) of the + user, + + e.g. `US`. + region: + type: string + description: | + Free text input for the region of the user, e.g. `California`. + city: + type: string + description: | + Free text input for the city of the user, e.g. `San Francisco`. + timezone: + type: string + description: > + The [IANA + timezone](https://timeapi.io/documentation/iana-timezones) + + of the user, e.g. `America/Los_Angeles`. + WebSearchToolCall: type: object - title: Upload + title: Web search tool call description: | - The Upload object can accept byte chunks in the form of Parts. + The results of a web search tool call. See the + [web search guide](/docs/guides/tools-web-search) for more information. properties: id: type: string - description: The Upload unique identifier, which can be referenced in API - endpoints. - created_at: - type: integer - description: The Unix timestamp (in seconds) for when the Upload was created. - filename: - type: string - description: The name of the file to be uploaded. - bytes: - type: integer - description: The intended number of bytes to be uploaded. - purpose: + description: | + The unique ID of the web search tool call. + type: type: string - description: The intended purpose of the file. [Please refer - here](/docs/api-reference/files/object#files/object-purpose) for - acceptable values. + enum: + - web_search_call + description: | + The type of the web search tool call. Always `web_search_call`. + x-stainless-const: true status: type: string - description: The status of the Upload. + description: | + The status of the web search tool call. enum: - - pending + - in_progress + - searching - completed - - cancelled - - expired - expires_at: - type: integer - description: The Unix timestamp (in seconds) for when the Upload was created. - object: - type: string - description: The object type, which is always "upload". - enum: - - upload - file: - $ref: "#/components/schemas/OpenAIFile" - nullable: true - description: The ready File object after the Upload is completed. + - failed required: - - bytes - - created_at - - expires_at - - filename - id - - purpose + - type - status - x-oaiMeta: - name: The upload object - example: | - { - "id": "upload_abc123", - "object": "upload", - "bytes": 2147483648, - "created_at": 1719184911, - "filename": "training_examples.jsonl", - "purpose": "fine-tune", - "status": "completed", - "expires_at": 1719127296, - "file": { - "id": "file-xyz321", - "object": "file", - "bytes": 2147483648, - "created_at": 1719186911, - "filename": "training_examples.jsonl", - "purpose": "fine-tune", - } - } - UploadPart: - type: object - title: UploadPart - description: > - The upload Part represents a chunk of bytes we can add to an Upload - object. + InputTextContent: properties: - id: + type: type: string - description: The upload Part unique identifier, which can be referenced in API - endpoints. - created_at: - type: integer - description: The Unix timestamp (in seconds) for when the Part was created. - upload_id: + enum: + - input_text + description: The type of the input item. Always `input_text`. + default: input_text + x-stainless-const: true + text: type: string - description: The ID of the Upload object that this Part was added to. - object: + description: The text input to the model. + type: object + required: + - type + - text + title: Input text + description: A text input to the model. + InputImageContent: + properties: + type: type: string - description: The object type, which is always `upload.part`. enum: - - upload.part - required: - - created_at - - id - - object - - upload_id - x-oaiMeta: - name: The upload part object - example: | - { - "id": "part_def456", - "object": "upload.part", - "created_at": 1719186911, - "upload_id": "upload_abc123" - } - User: + - input_image + description: The type of the input item. Always `input_image`. + default: input_image + x-stainless-const: true + image_url: + anyOf: + - type: string + description: The URL of the image to be sent to the model. A fully qualified URL + or base64 encoded image in a data URL. + - type: "null" + file_id: + anyOf: + - type: string + description: The ID of the file to be sent to the model. + - type: "null" + detail: + type: string + enum: + - low + - high + - auto + description: The detail level of the image to be sent to the model. One of + `high`, `low`, or `auto`. Defaults to `auto`. type: object - description: Represents an individual `user` within an organization. + required: + - type + - detail + title: Input image + description: An image input to the model. Learn about [image + inputs](/docs/guides/vision). + InputFileContent: properties: - object: + type: type: string enum: - - organization.user - description: The object type, which is always `organization.user` - id: + - input_file + description: The type of the input item. Always `input_file`. + default: input_file + x-stainless-const: true + file_id: + anyOf: + - type: string + description: The ID of the file to be sent to the model. + - type: "null" + filename: type: string - description: The identifier, which can be referenced in API endpoints - name: + description: The name of the file to be sent to the model. + file_data: type: string - description: The name of the user - email: + description: | + The content of the file to be sent to the model. + type: object + required: &a1 + - type + title: Input file + description: A file input to the model. + RankingOptions: + properties: + ranker: type: string - description: The email address of the user - role: + enum: + - auto + - default-2024-11-15 + description: The ranker to use for the file search. + score_threshold: + type: number + description: The score threshold for the file search, a number between 0 and 1. + Numbers closer to 1 will attempt to return only the most relevant + results, but may return fewer results. + type: object + required: [] + Filters: + anyOf: + - $ref: "#/components/schemas/ComparisonFilter" + - $ref: "#/components/schemas/CompoundFilter" + FileSearchTool: + properties: + type: type: string enum: - - owner - - reader - description: "`owner` or `reader`" - added_at: + - file_search + description: The type of the file search tool. Always `file_search`. + default: file_search + x-stainless-const: true + vector_store_ids: + items: + type: string + type: array + description: The IDs of the vector stores to search. + max_num_results: type: integer - description: The Unix timestamp (in seconds) of when the user was added. - required: - - object - - id - - name - - email - - role - - added_at - x-oaiMeta: - name: The user object - example: | - { - "object": "organization.user", - "id": "user_abc", - "name": "First Last", - "email": "user@example.com", - "role": "owner", - "added_at": 1711471533 - } - UserDeleteResponse: + description: The maximum number of results to return. This number should be + between 1 and 50 inclusive. + ranking_options: + $ref: "#/components/schemas/RankingOptions" + description: Ranking options for search. + filters: + anyOf: + - $ref: "#/components/schemas/Filters" + description: A filter to apply. + - type: "null" type: object + required: + - type + - vector_store_ids + title: File search + description: A tool that searches for relevant content from uploaded files. + Learn more about the [file search + tool](https://platform.openai.com/docs/guides/tools-file-search). + FunctionTool: properties: - object: + type: type: string enum: - - organization.user.deleted - id: + - function + description: The type of the function tool. Always `function`. + default: function + x-stainless-const: true + name: type: string - deleted: - type: boolean - required: - - object - - id - - deleted - UserListResponse: + description: The name of the function to call. + description: + anyOf: + - type: string + description: A description of the function. Used by the model to determine + whether or not to call the function. + - type: "null" + parameters: + anyOf: + - additionalProperties: {} + type: object + description: A JSON schema object describing the parameters of the function. + - type: "null" + strict: + anyOf: + - type: boolean + description: Whether to enforce strict parameter validation. Default `true`. + - type: "null" type: object + required: + - type + - name + - strict + - parameters + title: Function + description: Defines a function in your own code the model can choose to call. + Learn more about [function + calling](https://platform.openai.com/docs/guides/function-calling). + ApproximateLocation: properties: - object: + type: type: string enum: - - list - data: - type: array - items: - $ref: "#/components/schemas/User" - first_id: - type: string - last_id: - type: string - has_more: - type: boolean - required: - - object - - data - - first_id - - last_id - - has_more - UserRoleUpdateRequest: + - approximate + description: The type of location approximation. Always `approximate`. + default: approximate + x-stainless-const: true + country: + anyOf: + - type: string + description: The two-letter [ISO country + code](https://en.wikipedia.org/wiki/ISO_3166-1) of the user, + e.g. `US`. + - type: "null" + region: + anyOf: + - type: string + description: Free text input for the region of the user, e.g. `California`. + - type: "null" + city: + anyOf: + - type: string + description: Free text input for the city of the user, e.g. `San Francisco`. + - type: "null" + timezone: + anyOf: + - type: string + description: The [IANA + timezone](https://timeapi.io/documentation/iana-timezones) of + the user, e.g. `America/Los_Angeles`. + - type: "null" type: object + required: *a1 + WebSearchPreviewTool: properties: - role: + type: type: string enum: - - owner - - reader - description: "`owner` or `reader`" - required: - - role - VectorStoreExpirationAfter: + - web_search_preview + - web_search_preview_2025_03_11 + description: The type of the web search tool. One of `web_search_preview` or + `web_search_preview_2025_03_11`. + default: web_search_preview + x-stainless-const: true + user_location: + anyOf: + - $ref: "#/components/schemas/ApproximateLocation" + description: The user's location. + - type: "null" + search_context_size: + type: string + enum: + - low + - medium + - high + description: High level guidance for the amount of context window space to use + for the search. One of `low`, `medium`, or `high`. `medium` is the + default. type: object - title: Vector store expiration policy - description: The expiration policy for a vector store. + required: *a1 + title: Web search preview + description: This tool searches the web for relevant results to use in a + response. Learn more about the [web search + tool](https://platform.openai.com/docs/guides/tools-web-search). + ComputerUsePreviewTool: properties: - anchor: - description: "Anchor timestamp after which the expiration policy applies. - Supported anchors: `last_active_at`." + type: type: string enum: - - last_active_at - days: - description: The number of days after the anchor time that the vector store will - expire. + - computer_use_preview + description: The type of the computer use tool. Always `computer_use_preview`. + default: computer_use_preview + x-stainless-const: true + environment: + type: string + enum: + - windows + - mac + - linux + - ubuntu + - browser + description: The type of computer environment to control. + display_width: type: integer - minimum: 1 - maximum: 365 - required: - - anchor - - days - VectorStoreFileBatchObject: + description: The width of the computer display. + display_height: + type: integer + description: The height of the computer display. type: object - title: Vector store file batch - description: A batch of files attached to a vector store. + required: + - type + - environment + - display_width + - display_height + title: Computer use preview + description: A tool that controls a virtual computer. Learn more about the + [computer + tool](https://platform.openai.com/docs/guides/tools-computer-use). + Tool: + oneOf: + - $ref: "#/components/schemas/FileSearchTool" + - $ref: "#/components/schemas/FunctionTool" + - $ref: "#/components/schemas/WebSearchPreviewTool" + - $ref: "#/components/schemas/ComputerUsePreviewTool" + description: A tool that can be used to generate a response. + discriminator: + propertyName: type + FileCitationBody: properties: - id: - description: The identifier, which can be referenced in API endpoints. + type: + type: string + enum: + - file_citation + description: The type of the file citation. Always `file_citation`. + default: file_citation + x-stainless-const: true + file_id: type: string - object: - description: The object type, which is always `vector_store.file_batch`. + description: The ID of the file. + index: + type: integer + description: The index of the file in the list of files. + type: object + required: + - type + - file_id + - index + title: File citation + description: A citation to a file. + UrlCitationBody: + properties: + type: type: string enum: - - vector_store.files_batch - created_at: - description: The Unix timestamp (in seconds) for when the vector store files - batch was created. + - url_citation + description: The type of the URL citation. Always `url_citation`. + default: url_citation + x-stainless-const: true + url: + type: string + description: The URL of the web resource. + start_index: type: integer - vector_store_id: - description: The ID of the [vector - store](/docs/api-reference/vector-stores/object) that the - [File](/docs/api-reference/files) is attached to. + description: The index of the first character of the URL citation in the message. + end_index: + type: integer + description: The index of the last character of the URL citation in the message. + title: type: string - status: - description: The status of the vector store files batch, which can be either - `in_progress`, `completed`, `cancelled` or `failed`. + description: The title of the web resource. + type: object + required: + - type + - url + - start_index + - end_index + - title + title: URL citation + description: A citation for a web resource used to generate a model response. + Annotation: + oneOf: + - $ref: "#/components/schemas/FileCitationBody" + - $ref: "#/components/schemas/UrlCitationBody" + - $ref: "#/components/schemas/FilePath" + discriminator: + propertyName: type + OutputTextContent: + properties: + type: type: string enum: - - in_progress - - completed - - cancelled - - failed - file_counts: - type: object - properties: - in_progress: - description: The number of files that are currently being processed. - type: integer - completed: - description: The number of files that have been processed. - type: integer - failed: - description: The number of files that have failed to process. - type: integer - cancelled: - description: The number of files that where cancelled. - type: integer - total: - description: The total number of files. - type: integer - required: - - in_progress - - completed - - cancelled - - failed - - total - required: - - id - - object - - created_at - - vector_store_id - - status - - file_counts - x-oaiMeta: - name: The vector store files batch object - beta: true - example: | - { - "id": "vsfb_123", - "object": "vector_store.files_batch", - "created_at": 1698107661, - "vector_store_id": "vs_abc123", - "status": "completed", - "file_counts": { - "in_progress": 0, - "completed": 100, - "failed": 0, - "cancelled": 0, - "total": 100 - } - } - VectorStoreFileObject: + - output_text + description: The type of the output text. Always `output_text`. + default: output_text + x-stainless-const: true + text: + type: string + description: The text output from the model. + annotations: + items: + $ref: "#/components/schemas/Annotation" + type: array + description: The annotations of the text output. type: object - title: Vector store files - description: A list of files attached to a vector store. + required: + - type + - text + - annotations + title: Output text + description: A text output from the model. + RefusalContent: properties: - id: - description: The identifier, which can be referenced in API endpoints. - type: string - object: - description: The object type, which is always `vector_store.file`. + type: type: string enum: - - vector_store.file - usage_bytes: - description: The total vector store usage in bytes. Note that this may be - different from the original file size. - type: integer - created_at: - description: The Unix timestamp (in seconds) for when the vector store file was - created. - type: integer - vector_store_id: - description: The ID of the [vector - store](/docs/api-reference/vector-stores/object) that the - [File](/docs/api-reference/files) is attached to. + - refusal + description: The type of the refusal. Always `refusal`. + default: refusal + x-stainless-const: true + refusal: type: string - status: - description: The status of the vector store file, which can be either - `in_progress`, `completed`, `cancelled`, or `failed`. The status - `completed` indicates that the vector store file is ready for use. + description: The refusal explanationfrom the model. + type: object + required: + - type + - refusal + title: Refusal + description: A refusal from the model. + ComputerCallSafetyCheckParam: + properties: + id: type: string - enum: - - in_progress - - completed - - cancelled - - failed - last_error: - type: object - description: The last error associated with this vector store file. Will be - `null` if there are no errors. - nullable: true - properties: - code: - type: string - description: One of `server_error` or `rate_limit_exceeded`. - enum: - - server_error - - unsupported_file - - invalid_file - message: - type: string - description: A human-readable description of the error. - required: - - code - - message - chunking_strategy: - type: object - description: The strategy used to chunk the file. - oneOf: - - $ref: "#/components/schemas/StaticChunkingStrategyResponseParam" - - $ref: "#/components/schemas/OtherChunkingStrategyResponseParam" - x-oaiExpandable: true + description: The ID of the pending safety check. + code: + anyOf: + - type: string + description: The type of the pending safety check. + - type: "null" + message: + anyOf: + - type: string + description: Details about the pending safety check. + - type: "null" + type: object required: - id - - object - - usage_bytes - - created_at - - vector_store_id - - status - - last_error - x-oaiMeta: - name: The vector store file object - beta: true - example: | - { - "id": "file-abc123", - "object": "vector_store.file", - "usage_bytes": 1234, - "created_at": 1698107661, - "vector_store_id": "vs_abc123", - "status": "completed", - "last_error": null, - "chunking_strategy": { - "type": "static", - "static": { - "max_chunk_size_tokens": 800, - "chunk_overlap_tokens": 400 - } - } - } - VectorStoreObject: - type: object - title: Vector store - description: A vector store is a collection of processed files can be used by - the `file_search` tool. + description: A pending safety check for the computer call. + ComputerCallOutputItemParam: properties: id: - description: The identifier, which can be referenced in API endpoints. + anyOf: + - type: string + description: The ID of the computer tool call output. + - type: "null" + call_id: type: string - object: - description: The object type, which is always `vector_store`. + maxLength: 64 + minLength: 1 + description: The ID of the computer tool call that produced the output. + type: type: string enum: - - vector_store - created_at: - description: The Unix timestamp (in seconds) for when the vector store was - created. - type: integer - name: - description: The name of the vector store. - type: string - usage_bytes: - description: The total number of bytes used by the files in the vector store. - type: integer - file_counts: - type: object - properties: - in_progress: - description: The number of files that are currently being processed. - type: integer - completed: - description: The number of files that have been successfully processed. - type: integer - failed: - description: The number of files that have failed to process. - type: integer - cancelled: - description: The number of files that were cancelled. - type: integer - total: - description: The total number of files. - type: integer - required: - - in_progress - - completed - - failed - - cancelled - - total + - computer_call_output + description: The type of the computer tool call output. Always + `computer_call_output`. + default: computer_call_output + x-stainless-const: true + output: + $ref: "#/components/schemas/ComputerScreenshotImage" + acknowledged_safety_checks: + anyOf: + - items: + $ref: "#/components/schemas/ComputerCallSafetyCheckParam" + type: array + description: The safety checks reported by the API that have been acknowledged + by the developer. + - type: "null" status: - description: The status of the vector store, which can be either `expired`, - `in_progress`, or `completed`. A status of `completed` indicates - that the vector store is ready for use. + anyOf: + - type: string + enum: + - in_progress + - completed + - incomplete + description: The status of the message input. One of `in_progress`, `completed`, + or `incomplete`. Populated when input items are returned via + API. + - type: "null" + type: object + required: + - call_id + - type + - output + title: Computer tool call output + description: The output of a computer tool call. + FunctionCallOutputItemParam: + properties: + id: + anyOf: + - type: string + description: The unique ID of the function tool call output. Populated when this + item is returned via API. + - type: "null" + call_id: + type: string + maxLength: 64 + minLength: 1 + description: The unique ID of the function tool call generated by the model. + type: type: string enum: - - expired - - in_progress - - completed - expires_after: - $ref: "#/components/schemas/VectorStoreExpirationAfter" - expires_at: - description: The Unix timestamp (in seconds) for when the vector store will - expire. - type: integer - nullable: true - last_active_at: - description: The Unix timestamp (in seconds) for when the vector store was last - active. - type: integer - nullable: true - metadata: - description: > - Set of 16 key-value pairs that can be attached to an object. This - can be useful for storing additional information about the object in - a structured format. Keys can be a maximum of 64 characters long and - values can be a maximum of 512 characters long. - type: object - x-oaiTypeLabel: map - nullable: true + - function_call_output + description: The type of the function tool call output. Always + `function_call_output`. + default: function_call_output + x-stainless-const: true + output: + type: string + maxLength: 10485760 + description: A JSON string of the output of the function tool call. + status: + anyOf: + - type: string + enum: + - in_progress + - completed + - incomplete + description: The status of the item. One of `in_progress`, `completed`, or + `incomplete`. Populated when items are returned via API. + - type: "null" + type: object + required: + - call_id + - type + - output + title: Function tool call output + description: The output of a function tool call. + ItemReferenceParam: + properties: + type: + anyOf: + - type: string + enum: + - item_reference + description: The type of item to reference. Always `item_reference`. + default: item_reference + x-stainless-const: true + - type: "null" + id: + type: string + description: The ID of the item to reference. + type: object required: - id - - object - - usage_bytes - - created_at - - status - - last_active_at - - name - - file_counts - - metadata - x-oaiMeta: - name: The vector store object - beta: true - example: | - { - "id": "vs_123", - "object": "vector_store", - "created_at": 1698107661, - "usage_bytes": 123456, - "last_active_at": 1698107661, - "name": "my_vector_store", - "status": "completed", - "file_counts": { - "in_progress": 0, - "completed": 100, - "cancelled": 0, - "failed": 0, - "total": 100 - }, - "metadata": {}, - "last_used_at": 1698107661 - } + title: Item reference + description: An internal identifier for an item to reference. securitySchemes: ApiKeyAuth: type: http scheme: bearer -security: - - ApiKeyAuth: [] x-oaiMeta: navigationGroups: + - id: responses + title: Responses + - id: chat + title: Chat Completions + - id: realtime + title: Realtime + beta: true - id: endpoints - title: Endpoints + title: Platform APIs + - id: vector_stores + title: Vector stores - id: assistants title: Assistants beta: true - id: administration title: Administration - - id: realtime - title: Realtime - beta: true - id: legacy title: Legacy groups: + - id: responses + title: Responses + description: > + OpenAI's most advanced interface for generating model responses. + Supports + + text and image inputs, and text outputs. Create stateful interactions + + with the model, using the output of previous responses as input. Extend + + the model's capabilities with built-in tools for file search, web + search, + + computer use, and more. Allow the model access to external systems and + data + + using function calling. + + + Related guides: + + - [Quickstart](/docs/quickstart?api-mode=responses) + + - [Text inputs and outputs](/docs/guides/text?api-mode=responses) + + - [Image inputs](/docs/guides/images?api-mode=responses) + + - [Structured + Outputs](/docs/guides/structured-outputs?api-mode=responses) + + - [Function calling](/docs/guides/function-calling?api-mode=responses) + + - [Conversation + state](/docs/guides/conversation-state?api-mode=responses) + + - [Extend the models with tools](/docs/guides/tools?api-mode=responses) + navigationGroup: responses + sections: + - type: endpoint + key: createResponse + path: create + - type: endpoint + key: getResponse + path: get + - type: endpoint + key: deleteResponse + path: delete + - type: endpoint + key: listInputItems + path: input-items + - type: object + key: Response + path: object + - type: object + key: ResponseItemList + path: list + - id: responses-streaming + title: Streaming + description: > + When you [create a Response](/docs/api-reference/responses/create) with + + `stream` set to `true`, the server will emit server-sent events to the + + client as the Response is generated. This section contains the events + that + + are emitted by the server. + + + [Learn more about streaming + responses](/docs/guides/streaming-responses?api-mode=responses). + navigationGroup: responses + sections: + - type: object + key: ResponseCreatedEvent + path: + - type: object + key: ResponseInProgressEvent + path: + - type: object + key: ResponseCompletedEvent + path: + - type: object + key: ResponseFailedEvent + path: + - type: object + key: ResponseIncompleteEvent + path: + - type: object + key: ResponseOutputItemAddedEvent + path: + - type: object + key: ResponseOutputItemDoneEvent + path: + - type: object + key: ResponseContentPartAddedEvent + path: + - type: object + key: ResponseContentPartDoneEvent + path: + - type: object + key: ResponseTextDeltaEvent + path: + - type: object + key: ResponseTextAnnotationDeltaEvent + path: + - type: object + key: ResponseTextDoneEvent + path: + - type: object + key: ResponseRefusalDeltaEvent + path: + - type: object + key: ResponseRefusalDoneEvent + path: + - type: object + key: ResponseFunctionCallArgumentsDeltaEvent + path: + - type: object + key: ResponseFunctionCallArgumentsDoneEvent + path: + - type: object + key: ResponseFileSearchCallInProgressEvent + path: + - type: object + key: ResponseFileSearchCallSearchingEvent + path: + - type: object + key: ResponseFileSearchCallCompletedEvent + path: + - type: object + key: ResponseWebSearchCallInProgressEvent + path: + - type: object + key: ResponseWebSearchCallSearchingEvent + path: + - type: object + key: ResponseWebSearchCallCompletedEvent + path: + - type: object + key: ResponseReasoningSummaryPartAddedEvent + path: + - type: object + key: ResponseReasoningSummaryPartDoneEvent + path: + - type: object + key: ResponseReasoningSummaryTextDeltaEvent + path: + - type: object + key: ResponseReasoningSummaryTextDoneEvent + path: + - type: object + key: ResponseErrorEvent + path: + - id: chat + title: Chat Completions + description: | + The Chat Completions API endpoint will generate a model response from a + list of messages comprising a conversation. + + Related guides: + - [Quickstart](/docs/quickstart?api-mode=chat) + - [Text inputs and outputs](/docs/guides/text?api-mode=chat) + - [Image inputs](/docs/guides/images?api-mode=chat) + - [Audio inputs and outputs](/docs/guides/audio?api-mode=chat) + - [Structured Outputs](/docs/guides/structured-outputs?api-mode=chat) + - [Function calling](/docs/guides/function-calling?api-mode=chat) + - [Conversation state](/docs/guides/conversation-state?api-mode=chat) + + **Starting a new project?** We recommend trying [Responses](/docs/api-reference/responses) + to take advantage of the latest OpenAI platform features. Compare + [Chat Completions with Responses](/docs/guides/responses-vs-chat-completions?api-mode=responses). + navigationGroup: chat + sections: + - type: endpoint + key: createChatCompletion + path: create + - type: endpoint + key: getChatCompletion + path: get + - type: endpoint + key: getChatCompletionMessages + path: getMessages + - type: endpoint + key: listChatCompletions + path: list + - type: endpoint + key: updateChatCompletion + path: update + - type: endpoint + key: deleteChatCompletion + path: delete + - type: object + key: CreateChatCompletionResponse + path: object + - type: object + key: ChatCompletionList + path: list-object + - type: object + key: ChatCompletionMessageList + path: message-list + - id: chat-streaming + title: Streaming + description: | + Stream Chat Completions in real time. Receive chunks of completions + returned from the model using server-sent events. + [Learn more](/docs/guides/streaming-responses?api-mode=chat). + navigationGroup: chat + sections: + - type: object + key: CreateChatCompletionStreamResponse + path: streaming + - id: realtime + title: Realtime + beta: true + description: | + Communicate with a GPT-4o class model in real time using WebRTC or + WebSockets. Supports text and audio inputs and ouputs, along with audio + transcriptions. + [Learn more about the Realtime API](/docs/guides/realtime). + navigationGroup: realtime + - id: realtime-sessions + title: Session tokens + description: > + REST API endpoint to generate ephemeral session tokens for use in + client-side + + applications. + navigationGroup: realtime + sections: + - type: endpoint + key: create-realtime-session + path: create + - type: endpoint + key: create-realtime-transcription-session + path: create-transcription + - type: object + key: RealtimeSessionCreateResponse + path: session_object + - type: object + key: RealtimeTranscriptionSessionCreateResponse + path: transcription_session_object + - id: realtime-client-events + title: Client events + description: > + These are events that the OpenAI Realtime WebSocket server will accept + from the client. + navigationGroup: realtime + sections: + - type: object + key: RealtimeClientEventSessionUpdate + path: + - type: object + key: RealtimeClientEventInputAudioBufferAppend + path: + - type: object + key: RealtimeClientEventInputAudioBufferCommit + path: + - type: object + key: RealtimeClientEventInputAudioBufferClear + path: + - type: object + key: RealtimeClientEventConversationItemCreate + path: + - type: object + key: RealtimeClientEventConversationItemRetrieve + path: + - type: object + key: RealtimeClientEventConversationItemTruncate + path: + - type: object + key: RealtimeClientEventConversationItemDelete + path: + - type: object + key: RealtimeClientEventResponseCreate + path: + - type: object + key: RealtimeClientEventResponseCancel + path: + - type: object + key: RealtimeClientEventTranscriptionSessionUpdate + path: + - type: object + key: RealtimeClientEventOutputAudioBufferClear + path: + - id: realtime-server-events + title: Server events + description: > + These are events emitted from the OpenAI Realtime WebSocket server to + the client. + navigationGroup: realtime + sections: + - type: object + key: RealtimeServerEventError + path: + - type: object + key: RealtimeServerEventSessionCreated + path: + - type: object + key: RealtimeServerEventSessionUpdated + path: + - type: object + key: RealtimeServerEventConversationCreated + path: + - type: object + key: RealtimeServerEventConversationItemCreated + path: + - type: object + key: RealtimeServerEventConversationItemRetrieved + path: + - type: object + key: RealtimeServerEventConversationItemInputAudioTranscriptionCompleted + path: + - type: object + key: RealtimeServerEventConversationItemInputAudioTranscriptionDelta + path: + - type: object + key: RealtimeServerEventConversationItemInputAudioTranscriptionFailed + path: + - type: object + key: RealtimeServerEventConversationItemTruncated + path: + - type: object + key: RealtimeServerEventConversationItemDeleted + path: + - type: object + key: RealtimeServerEventInputAudioBufferCommitted + path: + - type: object + key: RealtimeServerEventInputAudioBufferCleared + path: + - type: object + key: RealtimeServerEventInputAudioBufferSpeechStarted + path: + - type: object + key: RealtimeServerEventInputAudioBufferSpeechStopped + path: + - type: object + key: RealtimeServerEventResponseCreated + path: + - type: object + key: RealtimeServerEventResponseDone + path: + - type: object + key: RealtimeServerEventResponseOutputItemAdded + path: + - type: object + key: RealtimeServerEventResponseOutputItemDone + path: + - type: object + key: RealtimeServerEventResponseContentPartAdded + path: + - type: object + key: RealtimeServerEventResponseContentPartDone + path: + - type: object + key: RealtimeServerEventResponseTextDelta + path: + - type: object + key: RealtimeServerEventResponseTextDone + path: + - type: object + key: RealtimeServerEventResponseAudioTranscriptDelta + path: + - type: object + key: RealtimeServerEventResponseAudioTranscriptDone + path: + - type: object + key: RealtimeServerEventResponseAudioDelta + path: + - type: object + key: RealtimeServerEventResponseAudioDone + path: + - type: object + key: RealtimeServerEventResponseFunctionCallArgumentsDelta + path: + - type: object + key: RealtimeServerEventResponseFunctionCallArgumentsDone + path: + - type: object + key: RealtimeServerEventTranscriptionSessionUpdated + path: + - type: object + key: RealtimeServerEventRateLimitsUpdated + path: + - type: object + key: RealtimeServerEventOutputAudioBufferStarted + path: + - type: object + key: RealtimeServerEventOutputAudioBufferStopped + path: + - type: object + key: RealtimeServerEventOutputAudioBufferCleared + path: - id: audio title: Audio description: | @@ -21949,24 +40110,33 @@ x-oaiMeta: - type: object key: CreateTranscriptionResponseVerboseJson path: verbose-json-object - - id: chat - title: Chat + - type: object + key: TranscriptTextDeltaEvent + path: transcript-text-delta-event + - type: object + key: TranscriptTextDoneEvent + path: transcript-text-done-event + - id: images + title: Images description: > - Given a list of messages comprising a conversation, the model will - return a response. + Given a prompt and/or an input image, the model will generate a new + image. - Related guide: [Chat Completions](/docs/guides/text-generation) + Related guide: [Image generation](/docs/guides/images) navigationGroup: endpoints sections: - type: endpoint - key: createChatCompletion + key: createImage path: create + - type: endpoint + key: createImageEdit + path: createEdit + - type: endpoint + key: createImageVariation + path: createVariation - type: object - key: CreateChatCompletionResponse + key: ImagesResponse path: object - - type: object - key: CreateChatCompletionStreamResponse - path: streaming - id: embeddings title: Embeddings description: > @@ -21982,6 +40152,58 @@ x-oaiMeta: - type: object key: Embedding path: object + - id: evals + title: Evals + description: | + Create, manage, and run evals in the OpenAI platform. + Related guide: [Evals](/docs/guides/evals) + navigationGroup: endpoints + sections: + - type: endpoint + key: createEval + path: create + - type: endpoint + key: getEval + path: get + - type: endpoint + key: updateEval + path: update + - type: endpoint + key: deleteEval + path: delete + - type: endpoint + key: listEvals + path: list + - type: endpoint + key: getEvalRuns + path: getRuns + - type: endpoint + key: getEvalRun + path: getRun + - type: endpoint + key: createEvalRun + path: createRun + - type: endpoint + key: cancelEvalRun + path: cancelRun + - type: endpoint + key: deleteEvalRun + path: deleteRun + - type: endpoint + key: getEvalRunOutputItem + path: getRunOutputItem + - type: endpoint + key: getEvalRunOutputItems + path: getRunOutputItems + - type: object + key: Eval + path: object + - type: object + key: EvalRun + path: run-object + - type: object + key: EvalRunOutputItem + path: run-output-item-object - id: fine-tuning title: Fine-tuning description: > @@ -22003,18 +40225,36 @@ x-oaiMeta: - type: endpoint key: listFineTuningJobCheckpoints path: list-checkpoints + - type: endpoint + key: listFineTuningCheckpointPermissions + path: list-permissions + - type: endpoint + key: createFineTuningCheckpointPermission + path: create-permission + - type: endpoint + key: deleteFineTuningCheckpointPermission + path: delete-permission - type: endpoint key: retrieveFineTuningJob path: retrieve - type: endpoint key: cancelFineTuningJob path: cancel + - type: endpoint + key: resumeFineTuningJob + path: resume + - type: endpoint + key: pauseFineTuningJob + path: pause - type: object - key: FinetuneChatRequestInput + key: FineTuneChatRequestInput path: chat-input - type: object - key: FinetuneCompletionRequestInput - path: completions-input + key: FineTunePreferenceRequestInput + path: preference-input + - type: object + key: FineTuneReinforcementRequestInput + path: reinforcement-input - type: object key: FineTuningJob path: object @@ -22024,6 +40264,41 @@ x-oaiMeta: - type: object key: FineTuningJobCheckpoint path: checkpoint-object + - type: object + key: FineTuningCheckpointPermission + path: permission-object + - id: graders + title: Graders + description: | + Manage and run graders in the OpenAI platform. + Related guide: [Graders](/docs/guides/graders) + navigationGroup: endpoints + sections: + - type: object + key: GraderStringCheck + path: string-check + - type: object + key: GraderTextSimilarity + path: text-similarity + - type: object + key: GraderScoreModel + path: score-model + - type: object + key: GraderLabelModel + path: label-model + - type: object + key: GraderPython + path: python + - type: object + key: GraderMulti + path: multi + - type: endpoint + key: runGrader + path: run + - type: endpoint + key: validateGrader + path: validate + beta: true - id: batch title: Batch description: > @@ -22105,27 +40380,6 @@ x-oaiMeta: - type: object key: UploadPart path: part-object - - id: images - title: Images - description: > - Given a prompt and/or an input image, the model will generate a new - image. - - Related guide: [Image generation](/docs/guides/images) - navigationGroup: endpoints - sections: - - type: endpoint - key: createImage - path: create - - type: endpoint - key: createImageEdit - path: createEdit - - type: endpoint - key: createImageVariation - path: createVariation - - type: object - key: Image - path: object - id: models title: Models description: > @@ -22159,8 +40413,92 @@ x-oaiMeta: key: createModeration path: create - type: object - key: CreateModerationResponse - path: object + key: CreateModerationResponse + path: object + - id: vector-stores + title: Vector stores + description: > + Vector stores power semantic search for the Retrieval API and the + `file_search` tool in the Responses and Assistants APIs. + + + Related guide: [File Search](/docs/assistants/tools/file-search) + navigationGroup: vector_stores + sections: + - type: endpoint + key: createVectorStore + path: create + - type: endpoint + key: listVectorStores + path: list + - type: endpoint + key: getVectorStore + path: retrieve + - type: endpoint + key: modifyVectorStore + path: modify + - type: endpoint + key: deleteVectorStore + path: delete + - type: endpoint + key: searchVectorStore + path: search + - type: object + key: VectorStoreObject + path: object + - id: vector-stores-files + title: Vector store files + description: | + Vector store files represent files inside a vector store. + + Related guide: [File Search](/docs/assistants/tools/file-search) + navigationGroup: vector_stores + sections: + - type: endpoint + key: createVectorStoreFile + path: createFile + - type: endpoint + key: listVectorStoreFiles + path: listFiles + - type: endpoint + key: getVectorStoreFile + path: getFile + - type: endpoint + key: retrieveVectorStoreFileContent + path: getContent + - type: endpoint + key: updateVectorStoreFileAttributes + path: updateAttributes + - type: endpoint + key: deleteVectorStoreFile + path: deleteFile + - type: object + key: VectorStoreFileObject + path: file-object + - id: vector-stores-file-batches + title: Vector store file batches + description: > + Vector store file batches represent operations to add multiple files to + a vector store. + + Related guide: [File Search](/docs/assistants/tools/file-search) + navigationGroup: vector_stores + sections: + - type: endpoint + key: createVectorStoreFileBatch + path: createBatch + - type: endpoint + key: getVectorStoreFileBatch + path: getBatch + - type: endpoint + key: cancelVectorStoreFileBatch + path: cancelBatch + - type: endpoint + key: listFilesInVectorStoreBatch + path: listBatchFiles + - type: object + key: VectorStoreFileBatchObject + path: batch-object - id: assistants title: Assistants beta: true @@ -22290,103 +40628,15 @@ x-oaiMeta: - type: object key: RunStepObject path: step-object - - id: vector-stores - title: Vector stores - beta: true - description: | - Vector stores are used to store files for use by the `file_search` tool. - - Related guide: [File Search](/docs/assistants/tools/file-search) - navigationGroup: assistants - sections: - - type: endpoint - key: createVectorStore - path: create - - type: endpoint - key: listVectorStores - path: list - - type: endpoint - key: getVectorStore - path: retrieve - - type: endpoint - key: modifyVectorStore - path: modify - - type: endpoint - key: deleteVectorStore - path: delete - - type: object - key: VectorStoreObject - path: object - - id: vector-stores-files - title: Vector store files - beta: true - description: | - Vector store files represent files inside a vector store. - - Related guide: [File Search](/docs/assistants/tools/file-search) - navigationGroup: assistants - sections: - - type: endpoint - key: createVectorStoreFile - path: createFile - - type: endpoint - key: listVectorStoreFiles - path: listFiles - - type: endpoint - key: getVectorStoreFile - path: getFile - - type: endpoint - key: deleteVectorStoreFile - path: deleteFile - - type: object - key: VectorStoreFileObject - path: file-object - - id: vector-stores-file-batches - title: Vector store file batches - beta: true - description: > - Vector store file batches represent operations to add multiple files to - a vector store. - - Related guide: [File Search](/docs/assistants/tools/file-search) - navigationGroup: assistants - sections: - - type: endpoint - key: createVectorStoreFileBatch - path: createBatch - - type: endpoint - key: getVectorStoreFileBatch - path: getBatch - - type: endpoint - key: cancelVectorStoreFileBatch - path: cancelBatch - - type: endpoint - key: listFilesInVectorStoreBatch - path: listBatchFiles - - type: object - key: VectorStoreFileBatchObject - path: batch-object - id: assistants-streaming title: Streaming beta: true - description: > - Stream the result of executing a Run or resuming a Run after submitting - tool outputs. - - You can stream events from the [Create Thread and - Run](/docs/api-reference/runs/createThreadAndRun), - - [Create Run](/docs/api-reference/runs/createRun), and [Submit Tool - Outputs](/docs/api-reference/runs/submitToolOutputs) - - endpoints by passing `"stream": true`. The response will be a - [Server-Sent - events](https://html.spec.whatwg.org/multipage/server-sent-events.html#server-sent-events) - stream. - - Our Node and Python SDKs provide helpful utilities to make streaming - easy. Reference the - + description: | + Stream the result of executing a Run or resuming a Run after submitting tool outputs. + You can stream events from the [Create Thread and Run](/docs/api-reference/runs/createThreadAndRun), + [Create Run](/docs/api-reference/runs/createRun), and [Submit Tool Outputs](/docs/api-reference/runs/submitToolOutputs) + endpoints by passing `"stream": true`. The response will be a [Server-Sent events](https://html.spec.whatwg.org/multipage/server-sent-events.html#server-sent-events) stream. + Our Node and Python SDKs provide helpful utilities to make streaming easy. Reference the [Assistants API quickstart](/docs/assistants/overview) to learn more. navigationGroup: assistants sections: @@ -22401,23 +40651,52 @@ x-oaiMeta: path: events - id: administration title: Administration - description: > - Programmatically manage your organization. + description: | + Programmatically manage your organization. + The Audit Logs endpoint provides a log of all actions taken in the organization for security and monitoring purposes. + To access these endpoints please generate an Admin API Key through the [API Platform Organization overview](/organization/admin-keys). Admin API keys cannot be used for non-administration endpoints. + For best practices on setting up your organization, please refer to this [guide](/docs/guides/production-best-practices#setting-up-your-organization) + navigationGroup: administration + - id: admin-api-keys + title: Admin API Keys + description: | + Admin API keys enable Organization Owners to programmatically manage various aspects of their organization, including users, projects, and API keys. These keys provide administrative capabilities, such as creating, updating, and deleting users; managing projects; and overseeing API key lifecycles. + + Key Features of Admin API Keys: + + - User Management: Invite new users, update roles, and remove users from the organization. + + - Project Management: Create, update, archive projects, and manage user assignments within projects. - The Audit Logs endpoint provides a log of all actions taken in - the organization for security and monitoring purposes. + - API Key Oversight: List, retrieve, and delete API keys associated with projects. - To access these endpoints please generate an Admin API Key through the - [API Platform Organization overview](/organization/admin-keys). Admin - API keys cannot be used for non-administration endpoints. + Only Organization Owners have the authority to create and utilize Admin API keys. To manage these keys, Organization Owners can navigate to the Admin Keys section of their API Platform dashboard. - For best practices on setting up your organization, please refer to this - [guide](/docs/guides/production-best-practices#setting-up-your-organization) + For direct access to the Admin Keys management page, Organization Owners can use the following link: + + [https://platform.openai.com/settings/organization/admin-keys](https://platform.openai.com/settings/organization/admin-keys) + + It's crucial to handle Admin API keys with care due to their elevated permissions. Adhering to best practices, such as regular key rotation and assigning appropriate permissions, enhances security and ensures proper governance within the organization. navigationGroup: administration + sections: + - type: endpoint + key: admin-api-keys-list + path: list + - type: endpoint + key: admin-api-keys-create + path: create + - type: endpoint + key: admin-api-keys-get + path: listget + - type: endpoint + key: admin-api-keys-delete + path: delete + - type: object + key: AdminApiKey + path: object - id: invite title: Invites - description: Invite and manage invitations for an organization. Invited users - are automatically added to the Default project. + description: Invite and manage invitations for an organization. navigationGroup: administration sections: - type: endpoint @@ -22437,9 +40716,8 @@ x-oaiMeta: path: object - id: users title: Users - description: > - Manage users and their role in an organization. Users will be - automatically added to the Default project. + description: | + Manage users and their role in an organization. navigationGroup: administration sections: - type: endpoint @@ -22461,9 +40739,9 @@ x-oaiMeta: title: Projects description: > Manage the projects within an orgnanization includes creation, updating, - and archiving or projects. + and archiving or projects. - The Default project cannot be modified or archived. + The Default project cannot be archived. navigationGroup: administration sections: - type: endpoint @@ -22488,10 +40766,7 @@ x-oaiMeta: title: Project users description: > Manage users within a project, including adding, updating roles, and - removing users. - - Users cannot be removed from the Default project, unless they are being - removed from the organization. + removing users. navigationGroup: administration sections: - type: endpoint @@ -22516,10 +40791,10 @@ x-oaiMeta: title: Project service accounts description: > Manage service accounts within a project. A service account is a bot - user that is not associated with a user. + user that is not associated with a user. If a user leaves an organization, their keys and membership in projects - will no longer work. Service accounts + will no longer work. Service accounts do not have this limitation. However, service accounts can also be deleted from a project. @@ -22544,7 +40819,7 @@ x-oaiMeta: title: Project API keys description: > Manage API keys for a given project. Supports listing and deleting keys - for users. + for users. This API does not allow issuing keys for users, as users need to authorize themselves to generate keys. @@ -22581,11 +40856,10 @@ x-oaiMeta: - id: audit-logs title: Audit logs description: > - Logs of user actions and configuration changes within this - organization. + Logs of user actions and configuration changes within this organization. To log events, you must activate logging in the [Organization - Settings](/settings/organization/general). + Settings](/settings/organization/general). Once activated, for security reasons, logging cannot be deactivated. navigationGroup: administration @@ -22596,142 +40870,120 @@ x-oaiMeta: - type: object key: AuditLog path: object - - id: realtime - title: Realtime - beta: true - description: > - Communicate with a GPT-4o class model live, in real time, over - WebSocket. - - Produces both audio and text transcriptions. - - [Learn more about the Realtime API](/docs/guides/realtime). - navigationGroup: realtime - - id: realtime-client-events - title: Client events + - id: usage + title: Usage description: > - These are events that the OpenAI Realtime WebSocket server will accept - from the client. - navigationGroup: realtime + The **Usage API** provides detailed insights into your activity across + the OpenAI API. It also includes a separate [Costs + endpoint](/docs/api-reference/usage/costs), which offers visibility into + your spend, breaking down consumption by invoice line items and project + IDs. + + + While the Usage API delivers granular usage data, it may not always + reconcile perfectly with the Costs due to minor differences in how usage + and spend are recorded. For financial purposes, we recommend using the + [Costs endpoint](/docs/api-reference/usage/costs) or the [Costs + tab](/settings/organization/usage) in the Usage Dashboard, which will + reconcile back to your billing invoice. + navigationGroup: administration sections: + - type: endpoint + key: usage-completions + path: completions - type: object - key: RealtimeClientEventSessionUpdate - path: + key: UsageCompletionsResult + path: completions_object + - type: endpoint + key: usage-embeddings + path: embeddings - type: object - key: RealtimeClientEventInputAudioBufferAppend - path: + key: UsageEmbeddingsResult + path: embeddings_object + - type: endpoint + key: usage-moderations + path: moderations - type: object - key: RealtimeClientEventInputAudioBufferCommit - path: + key: UsageModerationsResult + path: moderations_object + - type: endpoint + key: usage-images + path: images - type: object - key: RealtimeClientEventInputAudioBufferClear - path: + key: UsageImagesResult + path: images_object + - type: endpoint + key: usage-audio-speeches + path: audio_speeches - type: object - key: RealtimeClientEventConversationItemCreate - path: + key: UsageAudioSpeechesResult + path: audio_speeches_object + - type: endpoint + key: usage-audio-transcriptions + path: audio_transcriptions - type: object - key: RealtimeClientEventConversationItemTruncate - path: + key: UsageAudioTranscriptionsResult + path: audio_transcriptions_object + - type: endpoint + key: usage-vector-stores + path: vector_stores - type: object - key: RealtimeClientEventConversationItemDelete - path: + key: UsageVectorStoresResult + path: vector_stores_object + - type: endpoint + key: usage-code-interpreter-sessions + path: code_interpreter_sessions - type: object - key: RealtimeClientEventResponseCreate - path: + key: UsageCodeInterpreterSessionsResult + path: code_interpreter_sessions_object + - type: endpoint + key: usage-costs + path: costs - type: object - key: RealtimeClientEventResponseCancel - path: - - id: realtime-server-events - title: Server events - description: > - These are events emitted from the OpenAI Realtime WebSocket server to - the client. - navigationGroup: realtime + key: CostsResult + path: costs_object + - id: certificates + beta: true + title: Certificates + description: | + Manage Mutual TLS certificates across your organization and projects. + + [Learn more about Mutual TLS.](https://help.openai.com/en/articles/10876024-openai-mutual-tls-beta-program) + navigationGroup: administration sections: + - type: endpoint + key: uploadCertificate + path: uploadCertificate + - type: endpoint + key: getCertificate + path: getCertificate + - type: endpoint + key: modifyCertificate + path: modifyCertificate + - type: endpoint + key: deleteCertificate + path: deleteCertificate + - type: endpoint + key: listOrganizationCertificates + path: listOrganizationCertificates + - type: endpoint + key: listProjectCertificates + path: listProjectCertificates + - type: endpoint + key: activateOrganizationCertificates + path: activateOrganizationCertificates + - type: endpoint + key: deactivateOrganizationCertificates + path: deactivateOrganizationCertificates + - type: endpoint + key: activateProjectCertificates + path: activateProjectCertificates + - type: endpoint + key: deactivateProjectCertificates + path: deactivateProjectCertificates - type: object - key: RealtimeServerEventError - path: - - type: object - key: RealtimeServerEventSessionCreated - path: - - type: object - key: RealtimeServerEventSessionUpdated - path: - - type: object - key: RealtimeServerEventConversationCreated - path: - - type: object - key: RealtimeServerEventConversationItemCreated - path: - - type: object - key: RealtimeServerEventConversationItemInputAudioTranscriptionCompleted - path: - - type: object - key: RealtimeServerEventConversationItemInputAudioTranscriptionFailed - path: - - type: object - key: RealtimeServerEventConversationItemTruncated - path: - - type: object - key: RealtimeServerEventConversationItemDeleted - path: - - type: object - key: RealtimeServerEventInputAudioBufferCommitted - path: - - type: object - key: RealtimeServerEventInputAudioBufferCleared - path: - - type: object - key: RealtimeServerEventInputAudioBufferSpeechStarted - path: - - type: object - key: RealtimeServerEventInputAudioBufferSpeechStopped - path: - - type: object - key: RealtimeServerEventResponseCreated - path: - - type: object - key: RealtimeServerEventResponseDone - path: - - type: object - key: RealtimeServerEventResponseOutputItemAdded - path: - - type: object - key: RealtimeServerEventResponseOutputItemDone - path: - - type: object - key: RealtimeServerEventResponseContentPartAdded - path: - - type: object - key: RealtimeServerEventResponseContentPartDone - path: - - type: object - key: RealtimeServerEventResponseTextDelta - path: - - type: object - key: RealtimeServerEventResponseTextDone - path: - - type: object - key: RealtimeServerEventResponseAudioTranscriptDelta - path: - - type: object - key: RealtimeServerEventResponseAudioTranscriptDone - path: - - type: object - key: RealtimeServerEventResponseAudioDelta - path: - - type: object - key: RealtimeServerEventResponseAudioDone - path: - - type: object - key: RealtimeServerEventResponseFunctionCallArgumentsDelta - path: - - type: object - key: RealtimeServerEventResponseFunctionCallArgumentsDone - path: - - type: object - key: RealtimeServerEventRateLimitsUpdated - path: + key: Certificate + path: object - id: completions title: Completions legacy: true